\").html(e).find(t.opts.filter))),t.$slide.one(\"onReset\",function(){n(this).find(\"video,audio\").trigger(\"pause\"),t.$placeholder&&(t.$placeholder.after(e.removeClass(\"fancybox-content\").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is(\"video,audio\")&&(n(e).addClass(\"fancybox-video\"),n(e).wrap(\"
\"),t.contentType=\"video\",t.opts.width=t.opts.width||n(e).attr(\"width\"),t.opts.height=t.opts.height||n(e).attr(\"height\")),t.$content=t.$slide.children().filter(\"div,form,main,video,audio,article,.fancybox-content\").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner(\"
\").children().first()),t.$content.addClass(\"fancybox-content\"),t.$slide.addClass(\"fancybox-slide--\"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger(\"onReset\").removeClass(\"fancybox-slide--\"+t.contentType).addClass(\"fancybox-slide--error\"),t.contentType=\"html\",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn(\"fast\"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger(\"afterLoad\",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on(\"contextmenu.fb\",function(t){return 2==t.button&&t.preventDefault(),!0}),\"image\"===t.type&&n('
').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass(\"fancybox-caption--separate\",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css(\"padding-bottom\",r||\"\"))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css(\"margin-bottom\",\"\"),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style[\"padding-bottom\"],i=s.$slide.css(\"padding-bottom\"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css(\"padding-bottom\",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css(\"padding-bottom\",o))),s.$content.css(\"margin-bottom\",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?\"animationEffect\":\"transitionEffect\"],i=t.opts[s.firstRun?\"animationDuration\":\"transitionDuration\"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),\"zoom\"===e&&(t.pos===s.currPos&&i&&\"image\"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e=\"fade\"),\"zoom\"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,\"auto\"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass(\"fancybox-is-hidden\"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o=\"fancybox-slide--\"+(t.pos>=s.prevPos?\"next\":\"previous\")+\" fancybox-animated fancybox-fx-\"+e,r.addClass(o).removeClass(\"fancybox-slide--current\"),t.$content.removeClass(\"fancybox-is-hidden\"),p(r),\"image\"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,\"fancybox-slide--current\",i,function(){r.removeClass(o).css({transform:\"\",opacity:\"\"}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass(\"fancybox-is-hidden\"),u||!d||\"image\"!==t.type||t.hasError||t.$content.hide().fadeIn(\"fast\"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css(\"border-top-width\")||0),i=parseFloat(c.css(\"border-right-width\")||0),a=parseFloat(c.css(\"border-bottom-width\")||0),s=parseFloat(c.css(\"border-left-width\")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger(\"onReset\"),e.preload(\"inline\"),p(o.$slide),o.$slide.addClass(\"fancybox-slide--complete\"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger(\"afterShow\"),o.opts.video.autoStart&&o.$slide.find(\"video,audio\").filter(\":visible:first\").trigger(\"play\").one(\"ended\",function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&\"html\"===o.contentType&&(t=o.$content.find(\"input[autofocus]:enabled:visible:first\"),t.length?t.trigger(\"focus\"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=[\"a[href]\",\"area[href]\",'input:not([disabled]):not([type=\"hidden\"]):not([aria-hidden])',\"select:not([disabled]):not([aria-hidden])\",\"textarea:not([disabled]):not([aria-hidden])\",\"button:not([disabled]):not([aria-hidden])\",\"iframe\",\"object\",\"embed\",\"video\",\"audio\",\"[contenteditable]\",'[tabindex]:not([tabindex^=\"-\"])'].join(\",\");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find(\"*:visible\"+(o?\":not(.fancybox-close-small)\":\"\")):s.$refs.container.find(\"*:visible\"),i=i.filter(r).filter(function(){return\"hidden\"!==n(this).css(\"visibility\")&&!n(this).hasClass(\"disabled\")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger(\"focus\")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger(\"focus\"))):s.$refs.container.trigger(\"focus\"))},activate:function(){var t=this;n(\".fancybox-container\").each(function(){var e=n(this).data(\"FancyBox\");e&&e.id!==t.id&&!e.isClosing&&(e.trigger(\"onDeactivate\"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger(\"onActivate\"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger(\"beforeClose\",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass(\"fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated\"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger(\"onReset\").remove(),i&&u.$refs.container.removeClass(\"fancybox-is-open\").addClass(\"fancybox-is-closing\").css(\"transition-duration\",i+\"ms\"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),\"zoom\"!==o||a&&i&&\"image\"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o=\"fade\"),\"zoom\"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,\r\n\"auto\"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass(\"fancybox-slide--previous\").removeClass(\"fancybox-slide--current\"),\"fancybox-animated fancybox-fx-\"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger(\"onReset\"),s.$refs.container.empty().remove(),s.trigger(\"afterClose\",e),s.current.opts.backFocus&&(r&&r.length&&r.is(\":visible\")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger(\"focus\"),n(\"html, body\").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n(\"body\").removeClass(\"fancybox-active compensate-for-scrollbar\"),n(\"#fancybox-style-noscroll\").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;\"afterClose\"!==t&&a.$refs?a.$refs.container.trigger(t+\".fb\",i):r.trigger(t+\".fb\",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger(\"refresh\"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find(\"[data-fancybox-count]\").html(t.group.length),a.find(\"[data-fancybox-index]\").html(i+1),a.find(\"[data-fancybox-prev]\").prop(\"disabled\",!o.opts.loop&&i<=0),a.find(\"[data-fancybox-next]\").prop(\"disabled\",!o.opts.loop&&i>=t.group.length-1),\"image\"===o.type?a.find(\"[data-fancybox-zoom]\").show().end().find(\"[data-fancybox-download]\").attr(\"href\",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find(\"[data-fancybox-download],[data-fancybox-zoom]\").hide(),n(e.activeElement).is(\":hidden,[disabled]\")&&t.$refs.container.trigger(\"focus\")},hideControls:function(t){var e=this,n=[\"infobar\",\"toolbar\",\"nav\"];!t&&e.current.opts.preventCaptionOverlap||n.push(\"caption\"),this.$refs.container.removeClass(n.map(function(t){return\"fancybox-show-\"+t}).join(\" \")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass(\"fancybox-show-toolbar\",!(!e.toolbar||!e.buttons)).toggleClass(\"fancybox-show-infobar\",!!(e.infobar&&t.group.length>1)).toggleClass(\"fancybox-show-caption\",!!t.$caption).toggleClass(\"fancybox-show-nav\",!!(e.arrows&&t.group.length>1)).toggleClass(\"fancybox-is-modal\",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:\"3.5.7\",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(\".fancybox-is-closing\"):last').data(\"FancyBox\"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&(\"string\"===n.type(t)?e[t].apply(e,o):\"function\"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add(\"body\").off(\"click.fb-start\",\"**\")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement(\"div\");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue(\"transform\")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css(\"opacity\"))})},setTranslate:function(t,e){var n=\"\",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+\"px, \"+(void 0===e.top?t.position().top:e.top)+\"px\",n=this.use3d?\"translate3d(\"+n+\", 0px)\":\"translate(\"+n+\")\"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=\" scale(\"+e.scaleX+\", \"+e.scaleY+\")\":void 0!==e.scaleX&&(n+=\" scaleX(\"+e.scaleX+\")\"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&\"z-index\"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css(\"transition-duration\",\"\"),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css(\"transition-duration\",o+\"ms\"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass(\"fancybox-slide--image\")&&t.parent().addClass(\"fancybox-is-scaling\")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data(\"timer\",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data(\"timer\")),e&&t.trigger(f),t.off(f).css(\"transition-duration\",\"\"),t.parent().removeClass(\"fancybox-is-scaling\"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n(\"body\").off(\"click.fb-start\",e).on(\"click.fb-start\",e,{options:t},i):this.off(\"click.fb-start\").on(\"click.fb-start\",{items:this,options:t},i),this},r.on(\"click.fb-start\",\"[data-fancybox]\",i),r.on(\"click.fb-start\",\"[data-fancybox-trigger]\",function(t){n('[data-fancybox=\"'+n(this).attr(\"data-fancybox-trigger\")+'\"]').eq(n(this).attr(\"data-fancybox-index\")||0).trigger(\"click.fb-start\",{$trigger:n(this)})}),function(){var t=null;r.on(\"mousedown mouseup focus blur\",\".fancybox-button\",function(e){switch(e.type){case\"mousedown\":t=n(this);break;case\"mouseup\":t=null;break;case\"focusin\":n(\".fancybox-button\").removeClass(\"fancybox-focus\"),n(this).is(t)||n(this).is(\"[disabled]\")||n(this).addClass(\"fancybox-focus\");break;case\"focusout\":n(\".fancybox-button\").removeClass(\"fancybox-focus\")}})}()}}(window,document,jQuery),function(t){\"use strict\";var e={youtube:{matcher:/(youtube\\.com|youtu\\.be|youtube\\-nocookie\\.com)\\/(watch\\?(.*&)?v=|v\\/|u\\/|embed\\/?)?(videoseries\\?list=(.*)|[\\w-]{11}|\\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:\"transparent\",enablejsapi:1,html5:1},paramPlace:8,type:\"iframe\",url:\"https://www.youtube-nocookie.com/embed/$4\",thumb:\"https://img.youtube.com/vi/$4/hqdefault.jpg\"},vimeo:{matcher:/^.+vimeo.com\\/(.*\\/)?([\\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:\"iframe\",url:\"//player.vimeo.com/video/$2\"},instagram:{matcher:/(instagr\\.am|instagram\\.com)\\/p\\/([a-zA-Z0-9_\\-]+)\\/?/i,type:\"image\",url:\"//$1/p/$2/media/?size=l\"},gmap_place:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(((maps\\/(place\\/(.*)\\/)?\\@(.*),(\\d+.?\\d+?)z))|(\\?ll=))(.*)?/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/?ll=\"+(t[9]?t[9]+\"&z=\"+Math.floor(t[10])+(t[12]?t[12].replace(/^\\//,\"&\"):\"\"):t[12]+\"\").replace(/\\?/,\"&\")+\"&output=\"+(t[12]&&t[12].indexOf(\"layer=c\")>0?\"svembed\":\"embed\")}},gmap_search:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(maps\\/search\\/)(.*)/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/maps?q=\"+t[5].replace(\"query=\",\"q=\").replace(\"api=1\",\"\")+\"&output=embed\"}}},n=function(e,n,o){if(e)return o=o||\"\",\"object\"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace(\"$\"+t,n||\"\")}),o.length&&(e+=(e.indexOf(\"?\")>0?\"&\":\"?\")+o),e};t(document).on(\"objectNeedsType.fb\",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||\"\",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],\"?\"==d[0]&&(d=d.substring(1)),d=d.split(\"&\");for(var i=0;i
1&&(\"youtube\"===n.contentSource||\"vimeo\"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){\"use strict\";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?\"x\"===n?t.x-e.x:\"y\"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role=\"button\"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data(\"selectable\"))return!0;for(var e=0,o=t[0].attributes,i=o.length;ee.clientHeight,a=(\"scroll\"===o||\"auto\"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass(\"fancybox-stage\")||t.is(\"body\"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on(\"touchstart.fb.touch mousedown.fb.touch\",n.proxy(e,\"ontouchstart\"))};d.prototype.destroy=function(){var t=this;t.$container.off(\".fb.touch\"),n(e).off(\".fb.touch\"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h=\"touchstart\"==o.type;if(h&&i.$container.off(\"mousedown.fb.touch\"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is(\"img\")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass(\"fancybox-animated\"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(\".fb.touch\").on(h?\"touchend.fb.touch touchcancel.fb.touch\":\"mouseup.fb.touch mouseleave.fb.touch\",n.proxy(i,\"ontouchend\")).on(h?\"touchmove.fb.touch\":\"mousemove.fb.touch\",n.proxy(i,\"ontouchmove\")),n.fancybox.isMobile&&e.addEventListener(\"scroll\",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(\".fancybox-image\")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(\".fancybox-caption\").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass(\"fancybox-is-grabbing\")),2===i.startPoints.length&&\"image\"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener(\"scroll\",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],\"x\"),e.distanceY=s(e.newPoints[0],e.startPoints[0],\"y\"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)\"x\"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:\"x\"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass(\"fancybox-is-sliding\"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping=\"y\":r.isDragging||!1===s.opts.vertical||\"auto\"===s.opts.vertical&&n(t).width()>800?s.isSwiping=\"x\":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?\"y\":\"x\"),\"y\"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:\"\",opacity:\"\",\"transition-duration\":\"\"}).removeClass(\"fancybox-animated\").removeClass(function(t,e){return(e.match(/(^|\\s)fancybox-fx-\\S+/g)||[]).join(\" \")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&aa?(t=t>0?0:t,t=ts?(e=e>0?0:e,e=e1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,\"y\"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||\"x\"!=t&&\"y\"!=t||o.instance.centerSlide(200),o.$container.removeClass(\"fancybox-is-sliding\")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),rs.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case\"close\":r.close(i.startEvent);break;case\"toggleControls\":r.toggleControls();break;case\"next\":r.next();break;case\"nextOrClose\":r.group.length>1?r.next():r.close(i.startEvent);break;case\"zoom\":\"image\"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is(\"img\")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(\".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container\"))o=\"Outside\";else if(s.is(\".fancybox-slide\"))o=\"Slide\";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o=\"Content\"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f(\"dblclick\"+o)}else i.tapX=d,i.tapY=u,c.opts[\"dblclick\"+o]&&c.opts[\"dblclick\"+o]!==c.opts[\"click\"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f(\"click\"+o)},500):f(\"click\"+o);return this}},n(e).on(\"onActivate.fb\",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on(\"beforeClose.fb\",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){\"use strict\";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:''},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find(\"[data-fancybox-play]\").on(\"click\",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&\"image\"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger(\"onFullscreenChange\",t),n.$refs.container.toggleClass(\"fancybox-is-fullscreen\",t),n.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").toggleClass(\"fancybox-button--fsenter\",!t).toggleClass(\"fancybox-button--fsexit\",t))})}e(t).on({\"onInit.fb\":function(t,e){var i;if(!n)return void e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on(\"click.fb-fullscreen\",\"[data-fancybox-fullscreen]\",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").hide()},\"afterKeydown.fb\":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},\"beforeClose.fb\":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass(\"fancybox-is-fullscreen\")&&o.exit()}})}(document,jQuery),function(t,e){\"use strict\";var n=\"fancybox-thumbs\";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:''},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:\".fancybox-container\",axis:\"y\"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find(\"[data-fancybox-thumbs]\");for(var i=0,a=n.length;i1));i++);o>1&&e.opts?(e.$button.removeAttr(\"style\").on(\"click\",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on(\"click\",\"a\",function(){i.jumpTo(e(this).attr(\"data-index\"))})),o.$list||(o.$list=e('').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||\"image\"!==n.type||(t=n.src),s.push('
\")}),o.$list[0].innerHTML=s.join(\"\"),\"x\"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css(\"padding-right\"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass(\"fancybox-thumbs-active\").filter('[data-index=\"'+o.instance.current.index+'\"]').addClass(\"fancybox-thumbs-active\"),n=e.position(),\"y\"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):\"x\"===o.opts.axis&&(n.left
a.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass(\"fancybox-show-thumbs\",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger(\"onThumbsShow\"),t.focus(0)):t.$grid&&t.instance.trigger(\"onThumbsHide\"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({\"onInit.fb\":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},\"beforeShow.fb\":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},\"afterKeydown.fb\":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},\"beforeClose.fb\":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){\"use strict\";function n(t){var e={\"&\":\"&\",\"<\":\"<\",\">\":\">\",'\"':\""\",\"'\":\"'\",\"/\":\"/\",\"`\":\"`\",\"=\":\"=\"};return String(t).replace(/[&<>\"'`=\\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:''},share:{url:function(t,e){return!t.currentHash&&\"inline\"!==e.type&&\"html\"!==e.type&&(e.origSrc||e.src)||window.location},\r\ntpl:''}}),e(t).on(\"click\",\"[data-fancybox-share]\",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&(\"function\"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\\{\\{media\\}\\}/g,\"image\"===a.type?encodeURIComponent(a.src):\"\").replace(/\\{\\{url\\}\\}/g,encodeURIComponent(t)).replace(/\\{\\{url_raw\\}\\}/g,n(t)).replace(/\\{\\{descr\\}\\}/g,i.$caption?encodeURIComponent(i.$caption.text()):\"\"),e.fancybox.open({src:i.translate(i,o),type:\"html\",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one(\"beforeClose.fb\",function(){t.close(null,0)}),e.$content.find(\".fancybox-share__button\").click(function(){return window.open(this.href,\"Share\",\"width=550, height=450\"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){\"use strict\";function o(){var e=t.location.hash.substr(1),n=e.split(\"-\"),o=n.length>1&&/^\\+?\\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join(\"-\");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){\"\"!==t.gallery&&n(\"[data-fancybox='\"+n.escapeSelector(t.gallery)+\"']\").eq(t.index-1).focus().trigger(\"click.fb-start\")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,\"\"!==(n=e.hash||(e.$orig?e.$orig.data(\"fancybox\")||e.$orig.data(\"fancybox-trigger\"):\"\"))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+\"\").replace(/([\\0-\\x1f\\x7f]|^-?\\d)|^-$|[^\\x80-\\uFFFF\\w-]/g,function(t,e){return e?\"\\0\"===t?\"�\":t.slice(0,-1)+\"\\\\\"+t.charCodeAt(t.length-1).toString(16)+\" \":\"\\\\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({\"onInit.fb\":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},\"beforeShow.fb\":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?\"-\"+(i.index+1):\"\"),t.location.hash!==\"#\"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){\"replaceState\"in t.history?(t.history[s?\"pushState\":\"replaceState\"]({},e.title,t.location.pathname+t.location.search+\"#\"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},\"beforeClose.fb\":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&(\"replaceState\"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||\"\")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on(\"hashchange.fb\",function(){var t=o(),e=null;n.each(n(\".fancybox-container\").get().reverse(),function(t,o){var i=n(o).data(\"FancyBox\");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+\"-\"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):\"\"!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){\"use strict\";var n=(new Date).getTime();e(t).on({\"onInit.fb\":function(t,e,o){e.$refs.stage.on(\"mousewheel DOMMouseScroll wheel MozMousePixelScroll\",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||\"auto\"===o.opts.wheel&&\"image\"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass(\"fancybox-animated\")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?\"next\":\"previous\"]())))})}})}(document,jQuery);","function createCountdownElm(counter, label) {\r\n return \"\" + counter + \"\" + label + \"
\";\r\n};\r\n\r\n$(document).ready(function () {\r\n $('.module-countdown-banner-countdown').each(function () {\r\n\r\n var countdownContainer = $(this);\r\n var endDateRaw = $('.module-countdown-hidden-enddate', countdownContainer).val();\r\n var labelDays = $('.module-countdown-hidden-days', countdownContainer).val();\r\n var labelHours = $('.module-countdown-hidden-hours', countdownContainer).val();\r\n var labelMins = $('.module-countdown-hidden-mins', countdownContainer).val();\r\n var labelSecs = $('.module-countdown-hidden-secs', countdownContainer).val();\r\n\r\n // Set the date we're counting down to\r\n var countDownDate = new Date(endDateRaw).getTime();\r\n\r\n // Update the count down every 1 second\r\n var x = setInterval(function () {\r\n\r\n // Get todays date and time\r\n var now = new Date().getTime();\r\n\r\n // Find the distance between now an the count down date\r\n var distance = countDownDate - now;\r\n\r\n // Time calculations for days, hours, minutes and seconds\r\n var days = Math.floor(distance / (1000 * 60 * 60 * 24));\r\n var hours = Math.floor((distance % (1000 * 60 * 60 * 24)) / (1000 * 60 * 60));\r\n var minutes = Math.floor((distance % (1000 * 60 * 60)) / (1000 * 60));\r\n var seconds = Math.floor((distance % (1000 * 60)) / 1000);\r\n\r\n // If the count down is finished, clear and set to 0\r\n if (distance <= 0) {\r\n clearInterval(x);\r\n days = hours = minutes = seconds = 0;\r\n }\r\n\r\n // Update countdown HTML\r\n var newHtml = createCountdownElm(days, labelDays) +\r\n createCountdownElm(hours, labelHours) +\r\n createCountdownElm(minutes, labelMins) +\r\n createCountdownElm(seconds, labelSecs);\r\n\r\n countdownContainer.html(newHtml);\r\n }, 1000);\r\n\r\n });\r\n});","import \"../Script/_shared/index\"\r\nimport \"../Script/p4g/index\"\r\nimport \"../Style/p4g/index.scss\"","import \"../default/index\" //INHERIT FROM DEFAULT","$(document).ready(function () {\r\n\r\n var expandableFocusText = $(\".module-focustext-content-expandable-container\");\r\n\r\n if (expandableFocusText.length > 0) {\r\n\r\n expandableFocusText.each(function () {\r\n\r\n var expandableFocusTextItem = this;\r\n var expandableText = $(\".module-focustext-content-expandable\", expandableFocusTextItem);\r\n\r\n if (expandableText.innerHeight() > 220) {\r\n\r\n expandableText.css(\"max-height\", \"180px\").wrap(\"\").after(\"\");\r\n\r\n var expandableTextButton = $(\".module-focustext-content-expand-button\", expandableFocusTextItem);\r\n\r\n expandableTextButton.on('click', function (event) {\r\n event.preventDefault();\r\n expandableText.css(\"max-height\", \"100%\");\r\n $(expandableFocusTextItem).addClass(\"module-focustext-content-expandable-expanded\");\r\n expandableTextButton.hide();\r\n $(\".module-focustext-content-expandable-overlay\", expandableFocusTextItem).hide();\r\n });\r\n\r\n expandableTextButton.show();\r\n }\r\n })\r\n }\r\n});","$(document).ready(function() {\r\n var collapsibleContentComponent = $(\r\n \"body:not(.website-state-edit) .module-text-accordion-content\"\r\n );\r\n\r\n if (collapsibleContentComponent.length > 0) {\r\n collapsibleContentComponent.hide();\r\n\r\n //WRAP CONTENT BETWEEN H2 HEADINGS IN DIVS\r\n $(\".module-text-accordion-content h2\").each(function() {\r\n $(this)\r\n .attr(\"tabindex\", \"0\")\r\n .addClass(\"closed\")\r\n .nextUntil(\"h2\")\r\n .wrapAll(\r\n ''\r\n );\r\n });\r\n\r\n //ADD CLICK EVENT TO SHOW/HIDE CONTENT BELOW HEADERS\r\n $(\".module-text-accordion-content h2\").on(\"click\", function(event) {\r\n event.preventDefault();\r\n $(this)\r\n .toggleClass(\"closed\")\r\n .next()\r\n .slideToggle(\"fast\")\r\n .trigger(\"accordionToggled\");\r\n });\r\n\r\n //HANDLE KEYPRESS ON COLLAPSIBLE HEADERS AND TOGGLE-ALL\r\n $(\".module-text-accordion-content h2\").keypress(function(event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //SHOW AFTER TRANSFORMATION\r\n collapsibleContentComponent.show();\r\n }\r\n});\r\n","$(document).ready(function () {\r\n\r\n var collapsibleContentComponent = $(\"body:not(.website-state-edit) .module-agenda-accordion-content\");\r\n\r\n if (collapsibleContentComponent.length > 0) {\r\n\r\n collapsibleContentComponent.hide();\r\n\r\n //WRAP CONTENT BETWEEN H2 HEADINGS IN DIVS\r\n $(\".module-agenda-sheet-item-clickable-container\").each(function () {\r\n $(this).attr('tabindex', '0').addClass('closed').next().hide();\r\n });\r\n\r\n //ADD CLICK EVENT TO SHOW/HIDE CONTENT BELOW HEADERS\r\n $(\".module-agenda-sheet-item-clickable-container\").on('click', function (event) {\r\n event.preventDefault();\r\n $(this).toggleClass('closed').next().slideToggle('fast');\r\n });\r\n\r\n $(\".module-agenda-accordion-content\").each(function () {\r\n\r\n var currentAgenda = this;\r\n //$(\".js-module-agenda-sheet-button\",this).prependTo(this);\r\n $(\".js-module-agenda-sheet-button\", $(this)).each(function () {\r\n\r\n $(this).appendTo($(\".js-module-agenda-button-container\", currentAgenda));\r\n\r\n var sheetId = this.id.replace(\"-button\", \"\");\r\n\r\n $(this).on('click', function (event) {\r\n event.preventDefault();\r\n\r\n //ONLY CLICK WHEN CHANGING SHEET\r\n var sheetElm = $('#' + sheetId);\r\n if (sheetElm.is(':visible')) return;\r\n\r\n $('.module-agenda-sheet', currentAgenda).hide();\r\n sheetElm.slideDown('fast');\r\n $(\".btn-default\", currentAgenda).removeClass('btn-default').addClass('btn-outline');\r\n $(this).removeClass('btn-outline').addClass('btn-default');\r\n });\r\n });\r\n\r\n $(\".module-agenda-sheet:not(:first)\", currentAgenda).hide();\r\n $(\".js-module-agenda-sheet-button:first\", currentAgenda).addClass('btn-default').removeClass('btn-outline');\r\n\r\n });\r\n\r\n //HANDLE KEYPRESS ON COLLAPSIBLE HEADERS\r\n $('.module-agenda-sheet-item-clickable-container').keypress(function (event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //HANDLE KEYPRESS ON BUTTONS\r\n $('.js-module-agenda-sheet-button').keypress(function (event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //SHOW AFTER TRANSFORMATION\r\n collapsibleContentComponent.show();\r\n\r\n }\r\n});","(function (_superfunction) {\r\n Date.prototype.toString = function (format, language) {\r\n if (!format) return _superfunction.call(this);\r\n\r\n var langs = {\r\n 'en-US': {\r\n days: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],\r\n months: ['Janurary', 'Februrary', 'Marts', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']\r\n },\r\n 'da-DK': {\r\n days: ['søndag', 'mandag', 'tirsdag', 'onsdag', 'torsdag', 'fredag', 'lørdag'],\r\n months: ['januar', 'februar', 'marts', 'april', 'maj', 'juni', 'july', 'august', 'september', 'october', 'november', 'december']\r\n }\r\n }\r\n var lang = langs[language] || (typeof (navigator) !== 'undefined' ? langs[navigator.language] : false) || langs['en-US'];\r\n // Standard types\r\n return format\r\n .replace(/{yyyy}|{year}/g, this.getYear() + 1900)\r\n .replace(/{yy}/g, ('0' + (this.getYear() - 100)).slice(-2))\r\n .replace(/{MMMM}/g, lang.months[this.getMonth()])\r\n .replace(/{MMM}/g, lang.months[this.getMonth()].substr(0, 3))\r\n .replace(/{MM}|{month}/g, ('0' + (this.getMonth() + 1)).slice(-2))\r\n .replace(/{dddd}/g, lang.days[this.getDay()])\r\n .replace(/{ddd}/g, lang.days[this.getDay()].substr(0, 3))\r\n .replace(/{dd}|{date}/g, ('0' + this.getDate()).slice(-2))\r\n .replace(/{d}/g, this.getDate())\r\n .replace(/{hh}|{hour}/g, ('0' + this.getHours()).slice(-2))\r\n .replace(/{mm}|{minute}/g, ('0' + this.getMinutes()).slice(-2))\r\n .replace(/{ss}|{second}/g, ('0' + this.getSeconds()).slice(-2))\r\n .replace(/{ms}|{millisecond}/g, ('00' + this.getMilliseconds()).slice(-3))\r\n .replace(/{wd}|{weekday}|{dayofweek}/g, this.getDay())\r\n .replace(/{time}/g, this.getTime())\r\n .replace(/{.+}/g, undefined);\r\n };\r\n})(Date.prototype.toString);","$(document).ready(function () {\r\n if ($(\"form[data-wffm]\").length) {\r\n $(\"input:radio\").each(function () {\r\n $(this).parent().append(\"\");\r\n });\r\n $(\"input:checkbox\").each(function () {\r\n $(this).parent().append(\"\");\r\n });\r\n }\r\n});\r\n","window.onload = () => {\r\n (function(window, document, undefined) {\r\n \"use strict\";\r\n\r\n /**********************************\\\r\n - KEEPING TRACK OF INPUT METHODS\r\n \\**********************************/\r\n var tabActive = false;\r\n\r\n //KEY EVENTS\r\n function keyDownHandler(e) {\r\n tabActive = e.keyCode === 9 || e.which === 9;\r\n }\r\n\r\n function keyUpHandler(e) {\r\n tabActive = false;\r\n }\r\n\r\n document.documentElement.addEventListener('keydown', keyDownHandler, true);\r\n document.documentElement.addEventListener('keyup', keyUpHandler, true);\r\n\r\n\r\n /***************************************\\\r\n - UPDATING ATTRIBUTES ON FOCUS & BLUR\r\n \\***************************************/\r\n var focusableElems = Array.prototype.slice.call(\r\n document.querySelectorAll(\"a, input, textarea, select, button, [tabindex]\")\r\n );\r\n\r\n focusableElems.forEach(function(elem) {\r\n elem.addEventListener(\"focus\",\r\n function(e) {\r\n document.documentElement.dataset.focusSource = this.dataset.focusSource = tabActive ? \"tab\" : \"\";\r\n });\r\n\r\n elem.addEventListener(\"blur\",\r\n function(e) {\r\n document.documentElement.dataset.focusSource = this.dataset.focusSource = \"\";\r\n });\r\n });\r\n\r\n })(this, document)\r\n};","import \"../_lib/stacktable/stacktable.custom.js\"\r\nimport \"../_lib/datatables/datatables.js\"\r\n\r\nfunction showHideStackedTables(tables) {\r\n tables.each(function () {\r\n $(this).show();\r\n\r\n if ($(this).width() > $(this).parent().width()) {\r\n $(this).hide();\r\n\r\n if ($(this).prev().hasClass('card-table-container'))\r\n $(this).prev().show();\r\n }\r\n\r\n else {\r\n $(this).show();\r\n\r\n if ($(this).prev().hasClass('card-table-container'))\r\n $(this).prev().hide();\r\n }\r\n });\r\n}\r\n\r\n$(document).ready(function () {\r\n\r\n //DISABLE IN WEB EDIT\r\n if ($(\"body\").hasClass(\"website-state-edit\")) return;\r\n\r\n $('table.table-sortable').each(function() {\r\n var thisTable = $(this);\r\n var thisDataTable = thisTable.DataTable({\r\n \"autoWidth\": false\r\n });\r\n\r\n thisDataTable.on('draw.dt', function() {\r\n if (thisTable.hasClass('table-responsive')) {\r\n thisTable.removeClass('large-only').removeClass('stacktable').prev().remove();\r\n thisTable.cardtable({ myClass: 'card-table-container' });\r\n showHideStackedTables(thisTable);\r\n }\r\n \r\n });\r\n\r\n });\r\n\r\n // ADD SORTING AND FILTERING TO TABLES WITH table-sortable CLASS\r\n //var sortableSourceTables = $('table.table-sortable');\r\n //sortableSourceTables.DataTable();\r\n\r\n //$('#myTable').on( 'draw.dt', function () {\r\n // alert( 'Table redrawn' );\r\n //} );\r\n\r\n // ADD STACKTABLE TO TABLES WITH table-responsive CLASS\r\n var responsiveSourceTables = $('table.table-responsive');\r\n responsiveSourceTables.cardtable({ myClass: 'card-table-container' });\r\n\r\n responsiveSourceTables = $('table.table-responsive.large-only');\r\n showHideStackedTables(responsiveSourceTables);\r\n\r\n $(window).resize(function () {\r\n showHideStackedTables(responsiveSourceTables);\r\n });\r\n});","/**\r\n * stacktable.js\r\n * Author & copyright (c) 2012: John Polacek\r\n * CardTable by: Justin McNally (2015)\r\n * MIT license\r\n *\r\n * Page: http://johnpolacek.github.com/stacktable.js\r\n * Repo: https://github.com/johnpolacek/stacktable.js/\r\n *\r\n * jQuery plugin for stacking tables on small screens\r\n * Requires jQuery version 1.7 or above\r\n *\r\n */\r\n; (function ($) {\r\n $.fn.cardtable = function (options) {\r\n var $tables = this,\r\n defaults = { headIndex: 0 },\r\n settings = $.extend({}, defaults, options),\r\n headIndex;\r\n\r\n // checking the \"headIndex\" option presence... or defaults it to 0\r\n if (options && options.headIndex)\r\n headIndex = options.headIndex;\r\n else\r\n headIndex = 0;\r\n\r\n return $tables.each(function () {\r\n var $table = $(this);\r\n if ($table.hasClass('stacktable')) {\r\n return;\r\n }\r\n var table_css = $(this).prop('class');\r\n var $stacktable = $('');\r\n if (typeof settings.myClass !== 'undefined') $stacktable.addClass(settings.myClass);\r\n var markup = '';\r\n var $caption, $topRow, headMarkup, bodyMarkup, tr_class;\r\n\r\n $table.addClass('stacktable large-only');\r\n\r\n $caption = $table.find(\">caption\").clone();\r\n $topRow = $table.find('>thead>tr,>tbody>tr,>tfoot>tr,>tr').eq(0);\r\n\r\n // avoid duplication when paginating\r\n $table.siblings().filter('.small-only').remove();\r\n\r\n // using rowIndex and cellIndex in order to reduce ambiguity\r\n $table.find('>tbody>tr').each(function () {\r\n\r\n // declaring headMarkup and bodyMarkup, to be used for separately head and body of single records\r\n headMarkup = '';\r\n bodyMarkup = '';\r\n tr_class = $(this).prop('class');\r\n // for the first row, \"headIndex\" cell is the head of the table\r\n // for the other rows, put the \"headIndex\" cell as the head for that row\r\n // then iterate through the key/values\r\n $(this).find('>td,>th').each(function (cellIndex) {\r\n if ($(this).html() !== '') {\r\n bodyMarkup += '';\r\n if ($topRow.find('>td,>th').eq(cellIndex).html()) {\r\n bodyMarkup += '| ' + $topRow.find('>td,>th').eq(cellIndex).html() + ' | ';\r\n } else {\r\n bodyMarkup += ' | ';\r\n }\r\n bodyMarkup += '' + $(this).html() + ' | ';\r\n bodyMarkup += '
';\r\n }\r\n });\r\n\r\n markup += '' + headMarkup + bodyMarkup + '
';\r\n });\r\n\r\n $table.find('>tfoot>tr').each(function () {\r\n\r\n // declaring headMarkup and bodyMarkup, to be used for separately head and body of single records\r\n headMarkup = '';\r\n bodyMarkup = '';\r\n tr_class = $(this).prop('class');\r\n // for the first row, \"headIndex\" cell is the head of the table\r\n // for the other rows, put the \"headIndex\" cell as the head for that row\r\n // then iterate through the key/values\r\n $(this).find('>td,>th').each(function (cellIndex) {\r\n if ($(this).html() !== '') {\r\n bodyMarkup += '';\r\n if ($topRow.find('>td,>th').eq(cellIndex).html()) {\r\n bodyMarkup += '| ' + $topRow.find('>td,>th').eq(cellIndex).html() + ' | ';\r\n } else {\r\n bodyMarkup += ' | ';\r\n }\r\n bodyMarkup += '' + $(this).html() + ' | ';\r\n bodyMarkup += '
';\r\n }\r\n });\r\n\r\n markup += '' + headMarkup + bodyMarkup + '
';\r\n });\r\n\r\n $stacktable.prepend($caption);\r\n $stacktable.append($(markup));\r\n $table.before($stacktable);\r\n });\r\n };\r\n\r\n}(jQuery));\r\n","// https://tc39.github.io/ecma262/#sec-array.prototype.find\r\nif (!Array.prototype.find) {\r\n Object.defineProperty(Array.prototype, 'find', {\r\n value: function (predicate) {\r\n // 1. Let O be ? ToObject(this value).\r\n if (this == null) {\r\n throw new TypeError('\"this\" is null or not defined');\r\n }\r\n\r\n var o = Object(this);\r\n\r\n // 2. Let len be ? ToLength(? Get(O, \"length\")).\r\n var len = o.length >>> 0;\r\n\r\n // 3. If IsCallable(predicate) is false, throw a TypeError exception.\r\n if (typeof predicate !== 'function') {\r\n throw new TypeError('predicate must be a function');\r\n }\r\n\r\n // 4. If thisArg was supplied, let T be thisArg; else let T be undefined.\r\n var thisArg = arguments[1];\r\n\r\n // 5. Let k be 0.\r\n var k = 0;\r\n\r\n // 6. Repeat, while k < len\r\n while (k < len) {\r\n // a. Let Pk be ! ToString(k).\r\n // b. Let kValue be ? Get(O, Pk).\r\n // c. Let testResult be ToBoolean(? Call(predicate, T, « kValue, k, O »)).\r\n // d. If testResult is true, return kValue.\r\n var kValue = o[k];\r\n if (predicate.call(thisArg, kValue, k, o)) {\r\n return kValue;\r\n }\r\n // e. Increase k by 1.\r\n k++;\r\n }\r\n\r\n // 7. Return undefined.\r\n return undefined;\r\n }\r\n });\r\n}","/*\r\n * This combined file was created by the DataTables downloader builder:\r\n * https://datatables.net/download\r\n *\r\n * To rebuild or modify this file with the latest versions of the included\r\n * software please visit:\r\n * https://datatables.net/download/#dt/dt-1.10.16\r\n *\r\n * Included libraries:\r\n * DataTables 1.10.16\r\n */\r\n\r\n/*! DataTables 1.10.16\r\n * ©2008-2017 SpryMedia Ltd - datatables.net/license\r\n */\r\n\r\n/**\r\n * @summary DataTables\r\n * @description Paginate, search and order HTML tables\r\n * @version 1.10.16\r\n * @file jquery.dataTables.js\r\n * @author SpryMedia Ltd\r\n * @contact www.datatables.net\r\n * @copyright Copyright 2008-2017 SpryMedia Ltd.\r\n *\r\n * This source file is free software, available under the following license:\r\n * MIT license - http://datatables.net/license\r\n *\r\n * This source file is distributed in the hope that it will be useful, but\r\n * WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY\r\n * or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.\r\n *\r\n * For details please refer to: http://www.datatables.net\r\n */\r\n\r\n/*jslint evil: true, undef: true, browser: true */\r\n/*globals $,require,jQuery,define,_selector_run,_selector_opts,_selector_first,_selector_row_indexes,_ext,_Api,_api_register,_api_registerPlural,_re_new_lines,_re_html,_re_formatted_numeric,_re_escape_regex,_empty,_intVal,_numToDecimal,_isNumber,_isHtml,_htmlNumeric,_pluck,_pluck_order,_range,_stripHtml,_unique,_fnBuildAjax,_fnAjaxUpdate,_fnAjaxParameters,_fnAjaxUpdateDraw,_fnAjaxDataSrc,_fnAddColumn,_fnColumnOptions,_fnAdjustColumnSizing,_fnVisibleToColumnIndex,_fnColumnIndexToVisible,_fnVisbleColumns,_fnGetColumns,_fnColumnTypes,_fnApplyColumnDefs,_fnHungarianMap,_fnCamelToHungarian,_fnLanguageCompat,_fnBrowserDetect,_fnAddData,_fnAddTr,_fnNodeToDataIndex,_fnNodeToColumnIndex,_fnGetCellData,_fnSetCellData,_fnSplitObjNotation,_fnGetObjectDataFn,_fnSetObjectDataFn,_fnGetDataMaster,_fnClearTable,_fnDeleteIndex,_fnInvalidate,_fnGetRowElements,_fnCreateTr,_fnBuildHead,_fnDrawHead,_fnDraw,_fnReDraw,_fnAddOptionsHtml,_fnDetectHeader,_fnGetUniqueThs,_fnFeatureHtmlFilter,_fnFilterComplete,_fnFilterCustom,_fnFilterColumn,_fnFilter,_fnFilterCreateSearch,_fnEscapeRegex,_fnFilterData,_fnFeatureHtmlInfo,_fnUpdateInfo,_fnInfoMacros,_fnInitialise,_fnInitComplete,_fnLengthChange,_fnFeatureHtmlLength,_fnFeatureHtmlPaginate,_fnPageChange,_fnFeatureHtmlProcessing,_fnProcessingDisplay,_fnFeatureHtmlTable,_fnScrollDraw,_fnApplyToChildren,_fnCalculateColumnWidths,_fnThrottle,_fnConvertToWidth,_fnGetWidestNode,_fnGetMaxLenString,_fnStringToCss,_fnSortFlatten,_fnSort,_fnSortAria,_fnSortListener,_fnSortAttachListener,_fnSortingClasses,_fnSortData,_fnSaveState,_fnLoadState,_fnSettingsFromNode,_fnLog,_fnMap,_fnBindAction,_fnCallbackReg,_fnCallbackFire,_fnLengthOverflow,_fnRenderer,_fnDataSource,_fnRowAttributes*/\r\n\r\n(function( factory ) {\r\n\t\"use strict\";\r\n\r\n\tif ( typeof define === 'function' && define.amd ) {\r\n\t\t// AMD\r\n\t\tdefine( ['jquery'], function ( $ ) {\r\n\t\t\treturn factory( $, window, document );\r\n\t\t} );\r\n\t}\r\n\telse if ( typeof exports === 'object' ) {\r\n\t\t// CommonJS\r\n\t\tmodule.exports = function (root, $) {\r\n\t\t\tif ( ! root ) {\r\n\t\t\t\t// CommonJS environments without a window global must pass a\r\n\t\t\t\t// root. This will give an error otherwise\r\n\t\t\t\troot = window;\r\n\t\t\t}\r\n\r\n\t\t\tif ( ! $ ) {\r\n\t\t\t\t$ = typeof window !== 'undefined' ? // jQuery's factory checks for a global window\r\n\t\t\t\t\trequire('jquery') :\r\n\t\t\t\t\trequire('jquery')( root );\r\n\t\t\t}\r\n\r\n\t\t\treturn factory( $, root, root.document );\r\n\t\t};\r\n\t}\r\n\telse {\r\n\t\t// Browser\r\n\t\tfactory( jQuery, window, document );\r\n\t}\r\n}\r\n(function( $, window, document, undefined ) {\r\n\t\"use strict\";\r\n\r\n\t/**\r\n\t * DataTables is a plug-in for the jQuery Javascript library. It is a highly\r\n\t * flexible tool, based upon the foundations of progressive enhancement,\r\n\t * which will add advanced interaction controls to any HTML table. For a\r\n\t * full list of features please refer to\r\n\t * [DataTables.net](href=\"http://datatables.net).\r\n\t *\r\n\t * Note that the `DataTable` object is not a global variable but is aliased\r\n\t * to `jQuery.fn.DataTable` and `jQuery.fn.dataTable` through which it may\r\n\t * be accessed.\r\n\t *\r\n\t * @class\r\n\t * @param {object} [init={}] Configuration object for DataTables. Options\r\n\t * are defined by {@link DataTable.defaults}\r\n\t * @requires jQuery 1.7+\r\n\t *\r\n\t * @example\r\n\t * // Basic initialisation\r\n\t * $(document).ready( function {\r\n\t * $('#example').dataTable();\r\n\t * } );\r\n\t *\r\n\t * @example\r\n\t * // Initialisation with configuration options - in this case, disable\r\n\t * // pagination and sorting.\r\n\t * $(document).ready( function {\r\n\t * $('#example').dataTable( {\r\n\t * \"paginate\": false,\r\n\t * \"sort\": false\r\n\t * } );\r\n\t * } );\r\n\t */\r\n\tvar DataTable = function ( options )\r\n\t{\r\n\t\t/**\r\n\t\t * Perform a jQuery selector action on the table's TR elements (from the tbody) and\r\n\t\t * return the resulting jQuery object.\r\n\t\t * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on\r\n\t\t * @param {object} [oOpts] Optional parameters for modifying the rows to be included\r\n\t\t * @param {string} [oOpts.filter=none] Select TR elements that meet the current filter\r\n\t\t * criterion (\"applied\") or all TR elements (i.e. no filter).\r\n\t\t * @param {string} [oOpts.order=current] Order of the TR elements in the processed array.\r\n\t\t * Can be either 'current', whereby the current sorting of the table is used, or\r\n\t\t * 'original' whereby the original order the data was read into the table is used.\r\n\t\t * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page\r\n\t\t * (\"current\") or not (\"all\"). If 'current' is given, then order is assumed to be\r\n\t\t * 'current' and filter is 'applied', regardless of what they might be given as.\r\n\t\t * @returns {object} jQuery object, filtered by the given selector.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Highlight every second row\r\n\t\t * oTable.$('tr:odd').css('backgroundColor', 'blue');\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Filter to rows with 'Webkit' in them, add a background colour and then\r\n\t\t * // remove the filter, thus highlighting the 'Webkit' rows only.\r\n\t\t * oTable.fnFilter('Webkit');\r\n\t\t * oTable.$('tr', {\"search\": \"applied\"}).css('backgroundColor', 'blue');\r\n\t\t * oTable.fnFilter('');\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.$ = function ( sSelector, oOpts )\r\n\t\t{\r\n\t\t\treturn this.api(true).$( sSelector, oOpts );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Almost identical to $ in operation, but in this case returns the data for the matched\r\n\t\t * rows - as such, the jQuery selector used should match TR row nodes or TD/TH cell nodes\r\n\t\t * rather than any descendants, so the data can be obtained for the row/cell. If matching\r\n\t\t * rows are found, the data returned is the original data array/object that was used to\r\n\t\t * create the row (or a generated array if from a DOM source).\r\n\t\t *\r\n\t\t * This method is often useful in-combination with $ where both functions are given the\r\n\t\t * same parameters and the array indexes will match identically.\r\n\t\t * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on\r\n\t\t * @param {object} [oOpts] Optional parameters for modifying the rows to be included\r\n\t\t * @param {string} [oOpts.filter=none] Select elements that meet the current filter\r\n\t\t * criterion (\"applied\") or all elements (i.e. no filter).\r\n\t\t * @param {string} [oOpts.order=current] Order of the data in the processed array.\r\n\t\t * Can be either 'current', whereby the current sorting of the table is used, or\r\n\t\t * 'original' whereby the original order the data was read into the table is used.\r\n\t\t * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page\r\n\t\t * (\"current\") or not (\"all\"). If 'current' is given, then order is assumed to be\r\n\t\t * 'current' and filter is 'applied', regardless of what they might be given as.\r\n\t\t * @returns {array} Data for the matched elements. If any elements, as a result of the\r\n\t\t * selector, were not TR, TD or TH elements in the DataTable, they will have a null\r\n\t\t * entry in the array.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Get the data from the first row in the table\r\n\t\t * var data = oTable._('tr:first');\r\n\t\t *\r\n\t\t * // Do something useful with the data\r\n\t\t * alert( \"First cell is: \"+data[0] );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Filter to 'Webkit' and get all data for\r\n\t\t * oTable.fnFilter('Webkit');\r\n\t\t * var data = oTable._('tr', {\"search\": \"applied\"});\r\n\t\t *\r\n\t\t * // Do something with the data\r\n\t\t * alert( data.length+\" rows matched the search\" );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis._ = function ( sSelector, oOpts )\r\n\t\t{\r\n\t\t\treturn this.api(true).rows( sSelector, oOpts ).data();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Create a DataTables Api instance, with the currently selected tables for\r\n\t\t * the Api's context.\r\n\t\t * @param {boolean} [traditional=false] Set the API instance's context to be\r\n\t\t * only the table referred to by the `DataTable.ext.iApiIndex` option, as was\r\n\t\t * used in the API presented by DataTables 1.9- (i.e. the traditional mode),\r\n\t\t * or if all tables captured in the jQuery object should be used.\r\n\t\t * @return {DataTables.Api}\r\n\t\t */\r\n\t\tthis.api = function ( traditional )\r\n\t\t{\r\n\t\t\treturn traditional ?\r\n\t\t\t\tnew _Api(\r\n\t\t\t\t\t_fnSettingsFromNode( this[ _ext.iApiIndex ] )\r\n\t\t\t\t) :\r\n\t\t\t\tnew _Api( this );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Add a single new row or multiple rows of data to the table. Please note\r\n\t\t * that this is suitable for client-side processing only - if you are using\r\n\t\t * server-side processing (i.e. \"bServerSide\": true), then to add data, you\r\n\t\t * must add it to the data source, i.e. the server-side, through an Ajax call.\r\n\t\t * @param {array|object} data The data to be added to the table. This can be:\r\n\t\t * \r\n\t\t * - 1D array of data - add a single row with the data provided
\r\n\t\t * - 2D array of arrays - add multiple rows in a single call
\r\n\t\t * - object - data object when using mData
\r\n\t\t * - array of objects - multiple data objects when using mData
\r\n\t\t *
\r\n\t\t * @param {bool} [redraw=true] redraw the table or not\r\n\t\t * @returns {array} An array of integers, representing the list of indexes in\r\n\t\t * aoData ({@link DataTable.models.oSettings}) that have been added to\r\n\t\t * the table.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Global var for counter\r\n\t\t * var giCount = 2;\r\n\t\t *\r\n\t\t * $(document).ready(function() {\r\n\t\t * $('#example').dataTable();\r\n\t\t * } );\r\n\t\t *\r\n\t\t * function fnClickAddRow() {\r\n\t\t * $('#example').dataTable().fnAddData( [\r\n\t\t * giCount+\".1\",\r\n\t\t * giCount+\".2\",\r\n\t\t * giCount+\".3\",\r\n\t\t * giCount+\".4\" ]\r\n\t\t * );\r\n\t\t *\r\n\t\t * giCount++;\r\n\t\t * }\r\n\t\t */\r\n\t\tthis.fnAddData = function( data, redraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\t/* Check if we want to add multiple rows or not */\r\n\t\t\tvar rows = $.isArray(data) && ( $.isArray(data[0]) || $.isPlainObject(data[0]) ) ?\r\n\t\t\t\tapi.rows.add( data ) :\r\n\t\t\t\tapi.row.add( data );\r\n\t\t\r\n\t\t\tif ( redraw === undefined || redraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn rows.flatten().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * This function will make DataTables recalculate the column sizes, based on the data\r\n\t\t * contained in the table and the sizes applied to the columns (in the DOM, CSS or\r\n\t\t * through the sWidth parameter). This can be useful when the width of the table's\r\n\t\t * parent element changes (for example a window resize).\r\n\t\t * @param {boolean} [bRedraw=true] Redraw the table or not, you will typically want to\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable( {\r\n\t\t * \"sScrollY\": \"200px\",\r\n\t\t * \"bPaginate\": false\r\n\t\t * } );\r\n\t\t *\r\n\t\t * $(window).on('resize', function () {\r\n\t\t * oTable.fnAdjustColumnSizing();\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnAdjustColumnSizing = function ( bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).columns.adjust();\r\n\t\t\tvar settings = api.settings()[0];\r\n\t\t\tvar scroll = settings.oScroll;\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw( false );\r\n\t\t\t}\r\n\t\t\telse if ( scroll.sX !== \"\" || scroll.sY !== \"\" ) {\r\n\t\t\t\t/* If not redrawing, but scrolling, we want to apply the new column sizes anyway */\r\n\t\t\t\t_fnScrollDraw( settings );\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Quickly and simply clear a table\r\n\t\t * @param {bool} [bRedraw=true] redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Immediately 'nuke' the current rows (perhaps waiting for an Ajax callback...)\r\n\t\t * oTable.fnClearTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnClearTable = function( bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).clear();\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * The exact opposite of 'opening' a row, this function will close any rows which\r\n\t\t * are currently 'open'.\r\n\t\t * @param {node} nTr the table row to 'close'\r\n\t\t * @returns {int} 0 on success, or 1 if failed (can't find the row)\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnClose = function( nTr )\r\n\t\t{\r\n\t\t\tthis.api( true ).row( nTr ).child.hide();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Remove a row for the table\r\n\t\t * @param {mixed} target The index of the row from aoData to be deleted, or\r\n\t\t * the TR element you want to delete\r\n\t\t * @param {function|null} [callBack] Callback function\r\n\t\t * @param {bool} [redraw=true] Redraw the table or not\r\n\t\t * @returns {array} The row that was deleted\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Immediately remove the first row\r\n\t\t * oTable.fnDeleteRow( 0 );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDeleteRow = function( target, callback, redraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\tvar rows = api.rows( target );\r\n\t\t\tvar settings = rows.settings()[0];\r\n\t\t\tvar data = settings.aoData[ rows[0][0] ];\r\n\t\t\r\n\t\t\trows.remove();\r\n\t\t\r\n\t\t\tif ( callback ) {\r\n\t\t\t\tcallback.call( this, settings, data );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( redraw === undefined || redraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn data;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Restore the table to it's original state in the DOM by removing all of DataTables\r\n\t\t * enhancements, alterations to the DOM structure of the table and event listeners.\r\n\t\t * @param {boolean} [remove=false] Completely remove the table from the DOM\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * // This example is fairly pointless in reality, but shows how fnDestroy can be used\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnDestroy();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDestroy = function ( remove )\r\n\t\t{\r\n\t\t\tthis.api( true ).destroy( remove );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Redraw the table\r\n\t\t * @param {bool} [complete=true] Re-filter and resort (if enabled) the table before the draw.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Re-draw the table - you wouldn't want to do it here, but it's an example :-)\r\n\t\t * oTable.fnDraw();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDraw = function( complete )\r\n\t\t{\r\n\t\t\t// Note that this isn't an exact match to the old call to _fnDraw - it takes\r\n\t\t\t// into account the new data, but can hold position.\r\n\t\t\tthis.api( true ).draw( complete );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Filter the input based on data\r\n\t\t * @param {string} sInput String to filter the table on\r\n\t\t * @param {int|null} [iColumn] Column to limit filtering to\r\n\t\t * @param {bool} [bRegex=false] Treat as regular expression or not\r\n\t\t * @param {bool} [bSmart=true] Perform smart filtering or not\r\n\t\t * @param {bool} [bShowGlobal=true] Show the input global filter in it's input box(es)\r\n\t\t * @param {bool} [bCaseInsensitive=true] Do case-insensitive matching (true) or not (false)\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sometime later - filter...\r\n\t\t * oTable.fnFilter( 'test string' );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnFilter = function( sInput, iColumn, bRegex, bSmart, bShowGlobal, bCaseInsensitive )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( iColumn === null || iColumn === undefined ) {\r\n\t\t\t\tapi.search( sInput, bRegex, bSmart, bCaseInsensitive );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tapi.column( iColumn ).search( sInput, bRegex, bSmart, bCaseInsensitive );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tapi.draw();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the data for the whole table, an individual row or an individual cell based on the\r\n\t\t * provided parameters.\r\n\t\t * @param {int|node} [src] A TR row node, TD/TH cell node or an integer. If given as\r\n\t\t * a TR node then the data source for the whole row will be returned. If given as a\r\n\t\t * TD/TH cell node then iCol will be automatically calculated and the data for the\r\n\t\t * cell returned. If given as an integer, then this is treated as the aoData internal\r\n\t\t * data index for the row (see fnGetPosition) and the data for that row used.\r\n\t\t * @param {int} [col] Optional column index that you want the data of.\r\n\t\t * @returns {array|object|string} If mRow is undefined, then the data for all rows is\r\n\t\t * returned. If mRow is defined, just data for that row, and is iCol is\r\n\t\t * defined, only data for the designated cell is returned.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Row data\r\n\t\t * $(document).ready(function() {\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * oTable.$('tr').click( function () {\r\n\t\t * var data = oTable.fnGetData( this );\r\n\t\t * // ... do something with the array / object of data for the row\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Individual cell data\r\n\t\t * $(document).ready(function() {\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * oTable.$('td').click( function () {\r\n\t\t * var sData = oTable.fnGetData( this );\r\n\t\t * alert( 'The cell clicked on had the value of '+sData );\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetData = function( src, col )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( src !== undefined ) {\r\n\t\t\t\tvar type = src.nodeName ? src.nodeName.toLowerCase() : '';\r\n\t\t\r\n\t\t\t\treturn col !== undefined || type == 'td' || type == 'th' ?\r\n\t\t\t\t\tapi.cell( src, col ).data() :\r\n\t\t\t\t\tapi.row( src ).data() || null;\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn api.data().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get an array of the TR nodes that are used in the table's body. Note that you will\r\n\t\t * typically want to use the '$' API method in preference to this as it is more\r\n\t\t * flexible.\r\n\t\t * @param {int} [iRow] Optional row index for the TR element you want\r\n\t\t * @returns {array|node} If iRow is undefined, returns an array of all TR elements\r\n\t\t * in the table's body, or iRow is defined, just the TR element requested.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Get the nodes from the table\r\n\t\t * var nNodes = oTable.fnGetNodes( );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetNodes = function( iRow )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\treturn iRow !== undefined ?\r\n\t\t\t\tapi.row( iRow ).node() :\r\n\t\t\t\tapi.rows().nodes().flatten().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the array indexes of a particular cell from it's DOM element\r\n\t\t * and column index including hidden columns\r\n\t\t * @param {node} node this can either be a TR, TD or TH in the table's body\r\n\t\t * @returns {int} If nNode is given as a TR, then a single index is returned, or\r\n\t\t * if given as a cell, an array of [row index, column index (visible),\r\n\t\t * column index (all)] is given.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * $('#example tbody td').click( function () {\r\n\t\t * // Get the position of the current data from the node\r\n\t\t * var aPos = oTable.fnGetPosition( this );\r\n\t\t *\r\n\t\t * // Get the data array for this row\r\n\t\t * var aData = oTable.fnGetData( aPos[0] );\r\n\t\t *\r\n\t\t * // Update the data array and return the value\r\n\t\t * aData[ aPos[1] ] = 'clicked';\r\n\t\t * this.innerHTML = 'clicked';\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // Init DataTables\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetPosition = function( node )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\tvar nodeName = node.nodeName.toUpperCase();\r\n\t\t\r\n\t\t\tif ( nodeName == 'TR' ) {\r\n\t\t\t\treturn api.row( node ).index();\r\n\t\t\t}\r\n\t\t\telse if ( nodeName == 'TD' || nodeName == 'TH' ) {\r\n\t\t\t\tvar cell = api.cell( node ).index();\r\n\t\t\r\n\t\t\t\treturn [\r\n\t\t\t\t\tcell.row,\r\n\t\t\t\t\tcell.columnVisible,\r\n\t\t\t\t\tcell.column\r\n\t\t\t\t];\r\n\t\t\t}\r\n\t\t\treturn null;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Check to see if a row is 'open' or not.\r\n\t\t * @param {node} nTr the table row to check\r\n\t\t * @returns {boolean} true if the row is currently open, false otherwise\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnIsOpen = function( nTr )\r\n\t\t{\r\n\t\t\treturn this.api( true ).row( nTr ).child.isShown();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * This function will place a new row directly after a row which is currently\r\n\t\t * on display on the page, with the HTML contents that is passed into the\r\n\t\t * function. This can be used, for example, to ask for confirmation that a\r\n\t\t * particular record should be deleted.\r\n\t\t * @param {node} nTr The table row to 'open'\r\n\t\t * @param {string|node|jQuery} mHtml The HTML to put into the row\r\n\t\t * @param {string} sClass Class to give the new TD cell\r\n\t\t * @returns {node} The row opened. Note that if the table row passed in as the\r\n\t\t * first parameter, is not found in the table, this method will silently\r\n\t\t * return.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnOpen = function( nTr, mHtml, sClass )\r\n\t\t{\r\n\t\t\treturn this.api( true )\r\n\t\t\t\t.row( nTr )\r\n\t\t\t\t.child( mHtml, sClass )\r\n\t\t\t\t.show()\r\n\t\t\t\t.child()[0];\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Change the pagination - provides the internal logic for pagination in a simple API\r\n\t\t * function. With this function you can have a DataTables table go to the next,\r\n\t\t * previous, first or last pages.\r\n\t\t * @param {string|int} mAction Paging action to take: \"first\", \"previous\", \"next\" or \"last\"\r\n\t\t * or page number to jump to (integer), note that page 0 is the first page.\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnPageChange( 'next' );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnPageChange = function ( mAction, bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).page( mAction );\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw(false);\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Show a particular column\r\n\t\t * @param {int} iCol The column whose display should be changed\r\n\t\t * @param {bool} bShow Show (true) or hide (false) the column\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Hide the second column after initialisation\r\n\t\t * oTable.fnSetColumnVis( 1, false );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSetColumnVis = function ( iCol, bShow, bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).column( iCol ).visible( bShow );\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.columns.adjust().draw();\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the settings for a particular table for external manipulation\r\n\t\t * @returns {object} DataTables settings object. See\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * var oSettings = oTable.fnSettings();\r\n\t\t *\r\n\t\t * // Show an example parameter from the settings\r\n\t\t * alert( oSettings._iDisplayStart );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSettings = function()\r\n\t\t{\r\n\t\t\treturn _fnSettingsFromNode( this[_ext.iApiIndex] );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Sort the table by a particular column\r\n\t\t * @param {int} iCol the data index to sort on. Note that this will not match the\r\n\t\t * 'display index' if you have hidden data entries\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sort immediately with columns 0 and 1\r\n\t\t * oTable.fnSort( [ [0,'asc'], [1,'asc'] ] );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSort = function( aaSort )\r\n\t\t{\r\n\t\t\tthis.api( true ).order( aaSort ).draw();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Attach a sort listener to an element for a given column\r\n\t\t * @param {node} nNode the element to attach the sort listener to\r\n\t\t * @param {int} iColumn the column that a click on this node will sort on\r\n\t\t * @param {function} [fnCallback] callback function when sort is run\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sort on column 1, when 'sorter' is clicked on\r\n\t\t * oTable.fnSortListener( document.getElementById('sorter'), 1 );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSortListener = function( nNode, iColumn, fnCallback )\r\n\t\t{\r\n\t\t\tthis.api( true ).order.listener( nNode, iColumn, fnCallback );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Update a table cell or row - this method will accept either a single value to\r\n\t\t * update the cell with, an array of values with one element for each column or\r\n\t\t * an object in the same format as the original data source. The function is\r\n\t\t * self-referencing in order to make the multi column updates easier.\r\n\t\t * @param {object|array|string} mData Data to update the cell/row with\r\n\t\t * @param {node|int} mRow TR element you want to update or the aoData index\r\n\t\t * @param {int} [iColumn] The column to update, give as null or undefined to\r\n\t\t * update a whole row.\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @param {bool} [bAction=true] Perform pre-draw actions or not\r\n\t\t * @returns {int} 0 on success, 1 on error\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnUpdate( 'Example update', 0, 0 ); // Single cell\r\n\t\t * oTable.fnUpdate( ['a', 'b', 'c', 'd', 'e'], $('tbody tr')[0] ); // Row\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnUpdate = function( mData, mRow, iColumn, bRedraw, bAction )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( iColumn === undefined || iColumn === null ) {\r\n\t\t\t\tapi.row( mRow ).data( mData );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tapi.cell( mRow, iColumn ).data( mData );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( bAction === undefined || bAction ) {\r\n\t\t\t\tapi.columns.adjust();\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\treturn 0;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Provide a common method for plug-ins to check the version of DataTables being used, in order\r\n\t\t * to ensure compatibility.\r\n\t\t * @param {string} sVersion Version string to check for, in the format \"X.Y.Z\". Note that the\r\n\t\t * formats \"X\" and \"X.Y\" are also acceptable.\r\n\t\t * @returns {boolean} true if this version of DataTables is greater or equal to the required\r\n\t\t * version, or false if this version of DataTales is not suitable\r\n\t\t * @method\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * alert( oTable.fnVersionCheck( '1.9.0' ) );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnVersionCheck = _ext.fnVersionCheck;\r\n\t\t\r\n\r\n\t\tvar _that = this;\r\n\t\tvar emptyInit = options === undefined;\r\n\t\tvar len = this.length;\r\n\r\n\t\tif ( emptyInit ) {\r\n\t\t\toptions = {};\r\n\t\t}\r\n\r\n\t\tthis.oApi = this.internal = _ext.internal;\r\n\r\n\t\t// Extend with old style plug-in API methods\r\n\t\tfor ( var fn in DataTable.ext.internal ) {\r\n\t\t\tif ( fn ) {\r\n\t\t\t\tthis[fn] = _fnExternApiFunc(fn);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis.each(function() {\r\n\t\t\t// For each initialisation we want to give it a clean initialisation\r\n\t\t\t// object that can be bashed around\r\n\t\t\tvar o = {};\r\n\t\t\tvar oInit = len > 1 ? // optimisation for single table case\r\n\t\t\t\t_fnExtend( o, options, true ) :\r\n\t\t\t\toptions;\r\n\r\n\t\t\t/*global oInit,_that,emptyInit*/\r\n\t\t\tvar i=0, iLen, j, jLen, k, kLen;\r\n\t\t\tvar sId = this.getAttribute( 'id' );\r\n\t\t\tvar bInitHandedOff = false;\r\n\t\t\tvar defaults = DataTable.defaults;\r\n\t\t\tvar $this = $(this);\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t/* Sanity check */\r\n\t\t\tif ( this.nodeName.toLowerCase() != 'table' )\r\n\t\t\t{\r\n\t\t\t\t_fnLog( null, 0, 'Non-table node initialisation ('+this.nodeName+')', 2 );\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\t\t\r\n\t\t\t/* Backwards compatibility for the defaults */\r\n\t\t\t_fnCompatOpts( defaults );\r\n\t\t\t_fnCompatCols( defaults.column );\r\n\t\t\t\r\n\t\t\t/* Convert the camel-case defaults to Hungarian */\r\n\t\t\t_fnCamelToHungarian( defaults, defaults, true );\r\n\t\t\t_fnCamelToHungarian( defaults.column, defaults.column, true );\r\n\t\t\t\r\n\t\t\t/* Setting up the initialisation object */\r\n\t\t\t_fnCamelToHungarian( defaults, $.extend( oInit, $this.data() ) );\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t/* Check to see if we are re-initialising a table */\r\n\t\t\tvar allSettings = DataTable.settings;\r\n\t\t\tfor ( i=0, iLen=allSettings.length ; i').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\toSettings.nTHead = thead[0];\r\n\t\t\t\r\n\t\t\t\tvar tbody = $this.children('tbody');\r\n\t\t\t\tif ( tbody.length === 0 ) {\r\n\t\t\t\t\ttbody = $('').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\toSettings.nTBody = tbody[0];\r\n\t\t\t\r\n\t\t\t\tvar tfoot = $this.children('tfoot');\r\n\t\t\t\tif ( tfoot.length === 0 && captions.length > 0 && (oSettings.oScroll.sX !== \"\" || oSettings.oScroll.sY !== \"\") ) {\r\n\t\t\t\t\t// If we are a scrolling table, and no footer has been given, then we need to create\r\n\t\t\t\t\t// a tfoot element for the caption element to be appended to\r\n\t\t\t\t\ttfoot = $('').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\r\n\t\t\t\tif ( tfoot.length === 0 || tfoot.children().length === 0 ) {\r\n\t\t\t\t\t$this.addClass( oClasses.sNoFooter );\r\n\t\t\t\t}\r\n\t\t\t\telse if ( tfoot.length > 0 ) {\r\n\t\t\t\t\toSettings.nTFoot = tfoot[0];\r\n\t\t\t\t\t_fnDetectHeader( oSettings.aoFooter, oSettings.nTFoot );\r\n\t\t\t\t}\r\n\t\t\t\r\n\t\t\t\t/* Check if there is data passing into the constructor */\r\n\t\t\t\tif ( oInit.aaData ) {\r\n\t\t\t\t\tfor ( i=0 ; i/g;\r\n\t\r\n\t// This is not strict ISO8601 - Date.parse() is quite lax, although\r\n\t// implementations differ between browsers.\r\n\tvar _re_date = /^\\d{2,4}[\\.\\/\\-]\\d{1,2}[\\.\\/\\-]\\d{1,2}([T ]{1}\\d{1,2}[:\\.]\\d{2}([\\.:]\\d{2})?)?$/;\r\n\t\r\n\t// Escape regular expression special characters\r\n\tvar _re_escape_regex = new RegExp( '(\\\\' + [ '/', '.', '*', '+', '?', '|', '(', ')', '[', ']', '{', '}', '\\\\', '$', '^', '-' ].join('|\\\\') + ')', 'g' );\r\n\t\r\n\t// http://en.wikipedia.org/wiki/Foreign_exchange_market\r\n\t// - \\u20BD - Russian ruble.\r\n\t// - \\u20a9 - South Korean Won\r\n\t// - \\u20BA - Turkish Lira\r\n\t// - \\u20B9 - Indian Rupee\r\n\t// - R - Brazil (R$) and South Africa\r\n\t// - fr - Swiss Franc\r\n\t// - kr - Swedish krona, Norwegian krone and Danish krone\r\n\t// - \\u2009 is thin space and \\u202F is narrow no-break space, both used in many\r\n\t// standards as thousands separators.\r\n\tvar _re_formatted_numeric = /[',$£€¥%\\u2009\\u202F\\u20BD\\u20a9\\u20BArfk]/gi;\r\n\t\r\n\t\r\n\tvar _empty = function ( d ) {\r\n\t\treturn !d || d === true || d === '-' ? true : false;\r\n\t};\r\n\t\r\n\t\r\n\tvar _intVal = function ( s ) {\r\n\t\tvar integer = parseInt( s, 10 );\r\n\t\treturn !isNaN(integer) && isFinite(s) ? integer : null;\r\n\t};\r\n\t\r\n\t// Convert from a formatted number with characters other than `.` as the\r\n\t// decimal place, to a Javascript number\r\n\tvar _numToDecimal = function ( num, decimalPoint ) {\r\n\t\t// Cache created regular expressions for speed as this function is called often\r\n\t\tif ( ! _re_dic[ decimalPoint ] ) {\r\n\t\t\t_re_dic[ decimalPoint ] = new RegExp( _fnEscapeRegex( decimalPoint ), 'g' );\r\n\t\t}\r\n\t\treturn typeof num === 'string' && decimalPoint !== '.' ?\r\n\t\t\tnum.replace( /\\./g, '' ).replace( _re_dic[ decimalPoint ], '.' ) :\r\n\t\t\tnum;\r\n\t};\r\n\t\r\n\t\r\n\tvar _isNumber = function ( d, decimalPoint, formatted ) {\r\n\t\tvar strType = typeof d === 'string';\r\n\t\r\n\t\t// If empty return immediately so there must be a number if it is a\r\n\t\t// formatted string (this stops the string \"k\", or \"kr\", etc being detected\r\n\t\t// as a formatted number for currency\r\n\t\tif ( _empty( d ) ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\tif ( decimalPoint && strType ) {\r\n\t\t\td = _numToDecimal( d, decimalPoint );\r\n\t\t}\r\n\t\r\n\t\tif ( formatted && strType ) {\r\n\t\t\td = d.replace( _re_formatted_numeric, '' );\r\n\t\t}\r\n\t\r\n\t\treturn !isNaN( parseFloat(d) ) && isFinite( d );\r\n\t};\r\n\t\r\n\t\r\n\t// A string without HTML in it can be considered to be HTML still\r\n\tvar _isHtml = function ( d ) {\r\n\t\treturn _empty( d ) || typeof d === 'string';\r\n\t};\r\n\t\r\n\t\r\n\tvar _htmlNumeric = function ( d, decimalPoint, formatted ) {\r\n\t\tif ( _empty( d ) ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\tvar html = _isHtml( d );\r\n\t\treturn ! html ?\r\n\t\t\tnull :\r\n\t\t\t_isNumber( _stripHtml( d ), decimalPoint, formatted ) ?\r\n\t\t\t\ttrue :\r\n\t\t\t\tnull;\r\n\t};\r\n\t\r\n\t\r\n\tvar _pluck = function ( a, prop, prop2 ) {\r\n\t\tvar out = [];\r\n\t\tvar i=0, ien=a.length;\r\n\t\r\n\t\t// Could have the test in the loop for slightly smaller code, but speed\r\n\t\t// is essential here\r\n\t\tif ( prop2 !== undefined ) {\r\n\t\t\tfor ( ; i')\r\n\t\t\t\t.css( {\r\n\t\t\t\t\tposition: 'fixed',\r\n\t\t\t\t\ttop: 0,\r\n\t\t\t\t\tleft: $(window).scrollLeft()*-1, // allow for scrolling\r\n\t\t\t\t\theight: 1,\r\n\t\t\t\t\twidth: 1,\r\n\t\t\t\t\toverflow: 'hidden'\r\n\t\t\t\t} )\r\n\t\t\t\t.append(\r\n\t\t\t\t\t$('')\r\n\t\t\t\t\t\t.css( {\r\n\t\t\t\t\t\t\tposition: 'absolute',\r\n\t\t\t\t\t\t\ttop: 1,\r\n\t\t\t\t\t\t\tleft: 1,\r\n\t\t\t\t\t\t\twidth: 100,\r\n\t\t\t\t\t\t\toverflow: 'scroll'\r\n\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t.append(\r\n\t\t\t\t\t\t\t$('')\r\n\t\t\t\t\t\t\t\t.css( {\r\n\t\t\t\t\t\t\t\t\twidth: '100%',\r\n\t\t\t\t\t\t\t\t\theight: 10\r\n\t\t\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t)\r\n\t\t\t\t)\r\n\t\t\t\t.appendTo( 'body' );\r\n\t\r\n\t\t\tvar outer = n.children();\r\n\t\t\tvar inner = outer.children();\r\n\t\r\n\t\t\t// Numbers below, in order, are:\r\n\t\t\t// inner.offsetWidth, inner.clientWidth, outer.offsetWidth, outer.clientWidth\r\n\t\t\t//\r\n\t\t\t// IE6 XP: 100 100 100 83\r\n\t\t\t// IE7 Vista: 100 100 100 83\r\n\t\t\t// IE 8+ Windows: 83 83 100 83\r\n\t\t\t// Evergreen Windows: 83 83 100 83\r\n\t\t\t// Evergreen Mac with scrollbars: 85 85 100 85\r\n\t\t\t// Evergreen Mac without scrollbars: 100 100 100 100\r\n\t\r\n\t\t\t// Get scrollbar width\r\n\t\t\tbrowser.barWidth = outer[0].offsetWidth - outer[0].clientWidth;\r\n\t\r\n\t\t\t// IE6/7 will oversize a width 100% element inside a scrolling element, to\r\n\t\t\t// include the width of the scrollbar, while other browsers ensure the inner\r\n\t\t\t// element is contained without forcing scrolling\r\n\t\t\tbrowser.bScrollOversize = inner[0].offsetWidth === 100 && outer[0].clientWidth !== 100;\r\n\t\r\n\t\t\t// In rtl text layout, some browsers (most, but not all) will place the\r\n\t\t\t// scrollbar on the left, rather than the right.\r\n\t\t\tbrowser.bScrollbarLeft = Math.round( inner.offset().left ) !== 1;\r\n\t\r\n\t\t\t// IE8- don't provide height and width for getBoundingClientRect\r\n\t\t\tbrowser.bBounding = n[0].getBoundingClientRect().width ? true : false;\r\n\t\r\n\t\t\tn.remove();\r\n\t\t}\r\n\t\r\n\t\t$.extend( settings.oBrowser, DataTable.__browser );\r\n\t\tsettings.oScroll.iBarWidth = DataTable.__browser.barWidth;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Array.prototype reduce[Right] method, used for browsers which don't support\r\n\t * JS 1.6. Done this way to reduce code size, since we iterate either way\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnReduce ( that, fn, init, start, end, inc )\r\n\t{\r\n\t\tvar\r\n\t\t\ti = start,\r\n\t\t\tvalue,\r\n\t\t\tisSet = false;\r\n\t\r\n\t\tif ( init !== undefined ) {\r\n\t\t\tvalue = init;\r\n\t\t\tisSet = true;\r\n\t\t}\r\n\t\r\n\t\twhile ( i !== end ) {\r\n\t\t\tif ( ! that.hasOwnProperty(i) ) {\r\n\t\t\t\tcontinue;\r\n\t\t\t}\r\n\t\r\n\t\t\tvalue = isSet ?\r\n\t\t\t\tfn( value, that[i], i, that ) :\r\n\t\t\t\tthat[i];\r\n\t\r\n\t\t\tisSet = true;\r\n\t\t\ti += inc;\r\n\t\t}\r\n\t\r\n\t\treturn value;\r\n\t}\r\n\t\r\n\t/**\r\n\t * Add a column to the list used for the table with default values\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {node} nTh The th element for this column\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddColumn( oSettings, nTh )\r\n\t{\r\n\t\t// Add column to aoColumns array\r\n\t\tvar oDefaults = DataTable.defaults.column;\r\n\t\tvar iCol = oSettings.aoColumns.length;\r\n\t\tvar oCol = $.extend( {}, DataTable.models.oColumn, oDefaults, {\r\n\t\t\t\"nTh\": nTh ? nTh : document.createElement('th'),\r\n\t\t\t\"sTitle\": oDefaults.sTitle ? oDefaults.sTitle : nTh ? nTh.innerHTML : '',\r\n\t\t\t\"aDataSort\": oDefaults.aDataSort ? oDefaults.aDataSort : [iCol],\r\n\t\t\t\"mData\": oDefaults.mData ? oDefaults.mData : iCol,\r\n\t\t\tidx: iCol\r\n\t\t} );\r\n\t\toSettings.aoColumns.push( oCol );\r\n\t\r\n\t\t// Add search object for column specific search. Note that the `searchCols[ iCol ]`\r\n\t\t// passed into extend can be undefined. This allows the user to give a default\r\n\t\t// with only some of the parameters defined, and also not give a default\r\n\t\tvar searchCols = oSettings.aoPreSearchCols;\r\n\t\tsearchCols[ iCol ] = $.extend( {}, DataTable.models.oSearch, searchCols[ iCol ] );\r\n\t\r\n\t\t// Use the default column options function to initialise classes etc\r\n\t\t_fnColumnOptions( oSettings, iCol, $(nTh).data() );\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Apply options for a column\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {int} iCol column index to consider\r\n\t * @param {object} oOptions object with sType, bVisible and bSearchable etc\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnColumnOptions( oSettings, iCol, oOptions )\r\n\t{\r\n\t\tvar oCol = oSettings.aoColumns[ iCol ];\r\n\t\tvar oClasses = oSettings.oClasses;\r\n\t\tvar th = $(oCol.nTh);\r\n\t\r\n\t\t// Try to get width information from the DOM. We can't get it from CSS\r\n\t\t// as we'd need to parse the CSS stylesheet. `width` option can override\r\n\t\tif ( ! oCol.sWidthOrig ) {\r\n\t\t\t// Width attribute\r\n\t\t\toCol.sWidthOrig = th.attr('width') || null;\r\n\t\r\n\t\t\t// Style attribute\r\n\t\t\tvar t = (th.attr('style') || '').match(/width:\\s*(\\d+[pxem%]+)/);\r\n\t\t\tif ( t ) {\r\n\t\t\t\toCol.sWidthOrig = t[1];\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* User specified column options */\r\n\t\tif ( oOptions !== undefined && oOptions !== null )\r\n\t\t{\r\n\t\t\t// Backwards compatibility\r\n\t\t\t_fnCompatCols( oOptions );\r\n\t\r\n\t\t\t// Map camel case parameters to their Hungarian counterparts\r\n\t\t\t_fnCamelToHungarian( DataTable.defaults.column, oOptions );\r\n\t\r\n\t\t\t/* Backwards compatibility for mDataProp */\r\n\t\t\tif ( oOptions.mDataProp !== undefined && !oOptions.mData )\r\n\t\t\t{\r\n\t\t\t\toOptions.mData = oOptions.mDataProp;\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( oOptions.sType )\r\n\t\t\t{\r\n\t\t\t\toCol._sManualType = oOptions.sType;\r\n\t\t\t}\r\n\t\r\n\t\t\t// `class` is a reserved word in Javascript, so we need to provide\r\n\t\t\t// the ability to use a valid name for the camel case input\r\n\t\t\tif ( oOptions.className && ! oOptions.sClass )\r\n\t\t\t{\r\n\t\t\t\toOptions.sClass = oOptions.className;\r\n\t\t\t}\r\n\t\t\tif ( oOptions.sClass ) {\r\n\t\t\t\tth.addClass( oOptions.sClass );\r\n\t\t\t}\r\n\t\r\n\t\t\t$.extend( oCol, oOptions );\r\n\t\t\t_fnMap( oCol, oOptions, \"sWidth\", \"sWidthOrig\" );\r\n\t\r\n\t\t\t/* iDataSort to be applied (backwards compatibility), but aDataSort will take\r\n\t\t\t * priority if defined\r\n\t\t\t */\r\n\t\t\tif ( oOptions.iDataSort !== undefined )\r\n\t\t\t{\r\n\t\t\t\toCol.aDataSort = [ oOptions.iDataSort ];\r\n\t\t\t}\r\n\t\t\t_fnMap( oCol, oOptions, \"aDataSort\" );\r\n\t\t}\r\n\t\r\n\t\t/* Cache the data get and set functions for speed */\r\n\t\tvar mDataSrc = oCol.mData;\r\n\t\tvar mData = _fnGetObjectDataFn( mDataSrc );\r\n\t\tvar mRender = oCol.mRender ? _fnGetObjectDataFn( oCol.mRender ) : null;\r\n\t\r\n\t\tvar attrTest = function( src ) {\r\n\t\t\treturn typeof src === 'string' && src.indexOf('@') !== -1;\r\n\t\t};\r\n\t\toCol._bAttrSrc = $.isPlainObject( mDataSrc ) && (\r\n\t\t\tattrTest(mDataSrc.sort) || attrTest(mDataSrc.type) || attrTest(mDataSrc.filter)\r\n\t\t);\r\n\t\toCol._setter = null;\r\n\t\r\n\t\toCol.fnGetData = function (rowData, type, meta) {\r\n\t\t\tvar innerData = mData( rowData, type, undefined, meta );\r\n\t\r\n\t\t\treturn mRender && type ?\r\n\t\t\t\tmRender( innerData, type, rowData, meta ) :\r\n\t\t\t\tinnerData;\r\n\t\t};\r\n\t\toCol.fnSetData = function ( rowData, val, meta ) {\r\n\t\t\treturn _fnSetObjectDataFn( mDataSrc )( rowData, val, meta );\r\n\t\t};\r\n\t\r\n\t\t// Indicate if DataTables should read DOM data as an object or array\r\n\t\t// Used in _fnGetRowElements\r\n\t\tif ( typeof mDataSrc !== 'number' ) {\r\n\t\t\toSettings._rowReadObject = true;\r\n\t\t}\r\n\t\r\n\t\t/* Feature sorting overrides column specific when off */\r\n\t\tif ( !oSettings.oFeatures.bSort )\r\n\t\t{\r\n\t\t\toCol.bSortable = false;\r\n\t\t\tth.addClass( oClasses.sSortableNone ); // Have to add class here as order event isn't called\r\n\t\t}\r\n\t\r\n\t\t/* Check that the class assignment is correct for sorting */\r\n\t\tvar bAsc = $.inArray('asc', oCol.asSorting) !== -1;\r\n\t\tvar bDesc = $.inArray('desc', oCol.asSorting) !== -1;\r\n\t\tif ( !oCol.bSortable || (!bAsc && !bDesc) )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableNone;\r\n\t\t\toCol.sSortingClassJUI = \"\";\r\n\t\t}\r\n\t\telse if ( bAsc && !bDesc )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableAsc;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUIAscAllowed;\r\n\t\t}\r\n\t\telse if ( !bAsc && bDesc )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableDesc;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUIDescAllowed;\r\n\t\t}\r\n\t\telse\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortable;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUI;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Adjust the table column widths for new data. Note: you would probably want to\r\n\t * do a redraw after calling this function!\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAdjustColumnSizing ( settings )\r\n\t{\r\n\t\t/* Not interested in doing column width calculation if auto-width is disabled */\r\n\t\tif ( settings.oFeatures.bAutoWidth !== false )\r\n\t\t{\r\n\t\t\tvar columns = settings.aoColumns;\r\n\t\r\n\t\t\t_fnCalculateColumnWidths( settings );\r\n\t\t\tfor ( var i=0 , iLen=columns.length ; i=0 ; i-- )\r\n\t\t\t{\r\n\t\t\t\tdef = aoColDefs[i];\r\n\t\r\n\t\t\t\t/* Each definition can target multiple columns, as it is an array */\r\n\t\t\t\tvar aTargets = def.targets !== undefined ?\r\n\t\t\t\t\tdef.targets :\r\n\t\t\t\t\tdef.aTargets;\r\n\t\r\n\t\t\t\tif ( ! $.isArray( aTargets ) )\r\n\t\t\t\t{\r\n\t\t\t\t\taTargets = [ aTargets ];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tfor ( j=0, jLen=aTargets.length ; j= 0 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Add columns that we don't yet know about */\r\n\t\t\t\t\t\twhile( columns.length <= aTargets[j] )\r\n\t\t\t\t\t\t{\r\n\t\t\t\t\t\t\t_fnAddColumn( oSettings );\r\n\t\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t\t/* Integer, basic index */\r\n\t\t\t\t\t\tfn( aTargets[j], def );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( typeof aTargets[j] === 'number' && aTargets[j] < 0 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Negative integer, right to left column counting */\r\n\t\t\t\t\t\tfn( columns.length+aTargets[j], def );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( typeof aTargets[j] === 'string' )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Class name matching on TH element */\r\n\t\t\t\t\t\tfor ( k=0, kLen=columns.length ; k=0 if successful (index of new aoData entry), -1 if failed\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddData ( oSettings, aDataIn, nTr, anTds )\r\n\t{\r\n\t\t/* Create the object for storing information about this new row */\r\n\t\tvar iRow = oSettings.aoData.length;\r\n\t\tvar oData = $.extend( true, {}, DataTable.models.oRow, {\r\n\t\t\tsrc: nTr ? 'dom' : 'data',\r\n\t\t\tidx: iRow\r\n\t\t} );\r\n\t\r\n\t\toData._aData = aDataIn;\r\n\t\toSettings.aoData.push( oData );\r\n\t\r\n\t\t/* Create the cells */\r\n\t\tvar nTd, sThisType;\r\n\t\tvar columns = oSettings.aoColumns;\r\n\t\r\n\t\t// Invalidate the column types as the new data needs to be revalidated\r\n\t\tfor ( var i=0, iLen=columns.length ; i iTarget )\r\n\t\t\t{\r\n\t\t\t\ta[i]--;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\tif ( iTargetIndex != -1 && splice === undefined )\r\n\t\t{\r\n\t\t\ta.splice( iTargetIndex, 1 );\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Mark cached data as invalid such that a re-read of the data will occur when\r\n\t * the cached data is next requested. Also update from the data source object.\r\n\t *\r\n\t * @param {object} settings DataTables settings object\r\n\t * @param {int} rowIdx Row index to invalidate\r\n\t * @param {string} [src] Source to invalidate from: undefined, 'auto', 'dom'\r\n\t * or 'data'\r\n\t * @param {int} [colIdx] Column index to invalidate. If undefined the whole\r\n\t * row will be invalidated\r\n\t * @memberof DataTable#oApi\r\n\t *\r\n\t * @todo For the modularisation of v1.11 this will need to become a callback, so\r\n\t * the sort and filter methods can subscribe to it. That will required\r\n\t * initialisation options for sorting, which is why it is not already baked in\r\n\t */\r\n\tfunction _fnInvalidate( settings, rowIdx, src, colIdx )\r\n\t{\r\n\t\tvar row = settings.aoData[ rowIdx ];\r\n\t\tvar i, ien;\r\n\t\tvar cellWrite = function ( cell, col ) {\r\n\t\t\t// This is very frustrating, but in IE if you just write directly\r\n\t\t\t// to innerHTML, and elements that are overwritten are GC'ed,\r\n\t\t\t// even if there is a reference to them elsewhere\r\n\t\t\twhile ( cell.childNodes.length ) {\r\n\t\t\t\tcell.removeChild( cell.firstChild );\r\n\t\t\t}\r\n\t\r\n\t\t\tcell.innerHTML = _fnGetCellData( settings, rowIdx, col, 'display' );\r\n\t\t};\r\n\t\r\n\t\t// Are we reading last data from DOM or the data object?\r\n\t\tif ( src === 'dom' || ((! src || src === 'auto') && row.src === 'dom') ) {\r\n\t\t\t// Read the data from the DOM\r\n\t\t\trow._aData = _fnGetRowElements(\r\n\t\t\t\t\tsettings, row, colIdx, colIdx === undefined ? undefined : row._aData\r\n\t\t\t\t)\r\n\t\t\t\t.data;\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// Reading from data object, update the DOM\r\n\t\t\tvar cells = row.anCells;\r\n\t\r\n\t\t\tif ( cells ) {\r\n\t\t\t\tif ( colIdx !== undefined ) {\r\n\t\t\t\t\tcellWrite( cells[colIdx], colIdx );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tfor ( i=0, ien=cells.length ; i').appendTo( thead );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, ien=columns.length ; itr').attr('role', 'row');\r\n\t\r\n\t\t/* Deal with the footer - add classes if required */\r\n\t\t$(thead).find('>tr>th, >tr>td').addClass( classes.sHeaderTH );\r\n\t\t$(tfoot).find('>tr>th, >tr>td').addClass( classes.sFooterTH );\r\n\t\r\n\t\t// Cache the footer cells. Note that we only take the cells from the first\r\n\t\t// row in the footer. If there is more than one row the user wants to\r\n\t\t// interact with, they need to use the table().foot() method. Note also this\r\n\t\t// allows cells to be used for multiple columns using colspan\r\n\t\tif ( tfoot !== null ) {\r\n\t\t\tvar cells = oSettings.aoFooter[0];\r\n\t\r\n\t\t\tfor ( i=0, ien=cells.length ; i=0 ; j-- )\r\n\t\t\t{\r\n\t\t\t\tif ( !oSettings.aoColumns[j].bVisible && !bIncludeHidden )\r\n\t\t\t\t{\r\n\t\t\t\t\taoLocal[i].splice( j, 1 );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t/* Prep the applied array - it needs an element for each row */\r\n\t\t\taApplied.push( [] );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, iLen=aoLocal.length ; i= oSettings.fnRecordsDisplay() ?\r\n\t\t\t\t\t0 :\r\n\t\t\t\t\tiInitDisplayStart;\r\n\t\r\n\t\t\toSettings.iInitDisplayStart = -1;\r\n\t\t}\r\n\t\r\n\t\tvar iDisplayStart = oSettings._iDisplayStart;\r\n\t\tvar iDisplayEnd = oSettings.fnDisplayEnd();\r\n\t\r\n\t\t/* Server-side processing draw intercept */\r\n\t\tif ( oSettings.bDeferLoading )\r\n\t\t{\r\n\t\t\toSettings.bDeferLoading = false;\r\n\t\t\toSettings.iDraw++;\r\n\t\t\t_fnProcessingDisplay( oSettings, false );\r\n\t\t}\r\n\t\telse if ( !bServerSide )\r\n\t\t{\r\n\t\t\toSettings.iDraw++;\r\n\t\t}\r\n\t\telse if ( !oSettings.bDestroying && !_fnAjaxUpdate( oSettings ) )\r\n\t\t{\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tif ( aiDisplay.length !== 0 )\r\n\t\t{\r\n\t\t\tvar iStart = bServerSide ? 0 : iDisplayStart;\r\n\t\t\tvar iEnd = bServerSide ? oSettings.aoData.length : iDisplayEnd;\r\n\t\r\n\t\t\tfor ( var j=iStart ; j', { 'class': iStripes ? asStripeClasses[0] : '' } )\r\n\t\t\t\t.append( $(' | ', {\r\n\t\t\t\t\t'valign': 'top',\r\n\t\t\t\t\t'colSpan': _fnVisbleColumns( oSettings ),\r\n\t\t\t\t\t'class': oSettings.oClasses.sRowEmpty\r\n\t\t\t\t} ).html( sZero ) )[0];\r\n\t\t}\r\n\t\r\n\t\t/* Header and footer callbacks */\r\n\t\t_fnCallbackFire( oSettings, 'aoHeaderCallback', 'header', [ $(oSettings.nTHead).children('tr')[0],\r\n\t\t\t_fnGetDataMaster( oSettings ), iDisplayStart, iDisplayEnd, aiDisplay ] );\r\n\t\r\n\t\t_fnCallbackFire( oSettings, 'aoFooterCallback', 'footer', [ $(oSettings.nTFoot).children('tr')[0],\r\n\t\t\t_fnGetDataMaster( oSettings ), iDisplayStart, iDisplayEnd, aiDisplay ] );\r\n\t\r\n\t\tvar body = $(oSettings.nTBody);\r\n\t\r\n\t\tbody.children().detach();\r\n\t\tbody.append( $(anRows) );\r\n\t\r\n\t\t/* Call all required callback functions for the end of a draw */\r\n\t\t_fnCallbackFire( oSettings, 'aoDrawCallback', 'draw', [oSettings] );\r\n\t\r\n\t\t/* Draw is complete, sorting and filtering must be as well */\r\n\t\toSettings.bSorted = false;\r\n\t\toSettings.bFiltered = false;\r\n\t\toSettings.bDrawing = false;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Redraw the table - taking account of the various features which are enabled\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {boolean} [holdPosition] Keep the current paging position. By default\r\n\t * the paging is reset to the first page\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnReDraw( settings, holdPosition )\r\n\t{\r\n\t\tvar\r\n\t\t\tfeatures = settings.oFeatures,\r\n\t\t\tsort = features.bSort,\r\n\t\t\tfilter = features.bFilter;\r\n\t\r\n\t\tif ( sort ) {\r\n\t\t\t_fnSort( settings );\r\n\t\t}\r\n\t\r\n\t\tif ( filter ) {\r\n\t\t\t_fnFilterComplete( settings, settings.oPreviousSearch );\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// No filtering, so we want to just use the display master\r\n\t\t\tsettings.aiDisplay = settings.aiDisplayMaster.slice();\r\n\t\t}\r\n\t\r\n\t\tif ( holdPosition !== true ) {\r\n\t\t\tsettings._iDisplayStart = 0;\r\n\t\t}\r\n\t\r\n\t\t// Let any modules know about the draw hold position state (used by\r\n\t\t// scrolling internally)\r\n\t\tsettings._drawHold = holdPosition;\r\n\t\r\n\t\t_fnDraw( settings );\r\n\t\r\n\t\tsettings._drawHold = false;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Add the options to the page HTML for the table\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddOptionsHtml ( oSettings )\r\n\t{\r\n\t\tvar classes = oSettings.oClasses;\r\n\t\tvar table = $(oSettings.nTable);\r\n\t\tvar holding = $('').insertBefore( table ); // Holding element for speed\r\n\t\tvar features = oSettings.oFeatures;\r\n\t\r\n\t\t// All DataTables are wrapped in a div\r\n\t\tvar insert = $('', {\r\n\t\t\tid: oSettings.sTableId+'_wrapper',\r\n\t\t\t'class': classes.sWrapper + (oSettings.nTFoot ? '' : ' '+classes.sNoFooter)\r\n\t\t} );\r\n\t\r\n\t\toSettings.nHolding = holding[0];\r\n\t\toSettings.nTableWrapper = insert[0];\r\n\t\toSettings.nTableReinsertBefore = oSettings.nTable.nextSibling;\r\n\t\r\n\t\t/* Loop over the user set positioning and place the elements as needed */\r\n\t\tvar aDom = oSettings.sDom.split('');\r\n\t\tvar featureNode, cOption, nNewNode, cNext, sAttr, j;\r\n\t\tfor ( var i=0 ; i')[0];\r\n\t\r\n\t\t\t\t/* Check to see if we should append an id and/or a class name to the container */\r\n\t\t\t\tcNext = aDom[i+1];\r\n\t\t\t\tif ( cNext == \"'\" || cNext == '\"' )\r\n\t\t\t\t{\r\n\t\t\t\t\tsAttr = \"\";\r\n\t\t\t\t\tj = 2;\r\n\t\t\t\t\twhile ( aDom[i+j] != cNext )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr += aDom[i+j];\r\n\t\t\t\t\t\tj++;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t/* Replace jQuery UI constants @todo depreciated */\r\n\t\t\t\t\tif ( sAttr == \"H\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr = classes.sJUIHeader;\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( sAttr == \"F\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr = classes.sJUIFooter;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t/* The attribute can be in the format of \"#id.class\", \"#id\" or \"class\" This logic\r\n\t\t\t\t\t * breaks the string into parts and applies them as needed\r\n\t\t\t\t\t */\r\n\t\t\t\t\tif ( sAttr.indexOf('.') != -1 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tvar aSplit = sAttr.split('.');\r\n\t\t\t\t\t\tnNewNode.id = aSplit[0].substr(1, aSplit[0].length-1);\r\n\t\t\t\t\t\tnNewNode.className = aSplit[1];\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( sAttr.charAt(0) == \"#\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tnNewNode.id = sAttr.substr(1, sAttr.length-1);\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tnNewNode.className = sAttr;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\ti += j; /* Move along the position array */\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tinsert.append( nNewNode );\r\n\t\t\t\tinsert = $(nNewNode);\r\n\t\t\t}\r\n\t\t\telse if ( cOption == '>' )\r\n\t\t\t{\r\n\t\t\t\t/* End container div */\r\n\t\t\t\tinsert = insert.parent();\r\n\t\t\t}\r\n\t\t\t// @todo Move options into their own plugins?\r\n\t\t\telse if ( cOption == 'l' && features.bPaginate && features.bLengthChange )\r\n\t\t\t{\r\n\t\t\t\t/* Length */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlLength( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'f' && features.bFilter )\r\n\t\t\t{\r\n\t\t\t\t/* Filter */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlFilter( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'r' && features.bProcessing )\r\n\t\t\t{\r\n\t\t\t\t/* pRocessing */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlProcessing( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 't' )\r\n\t\t\t{\r\n\t\t\t\t/* Table */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlTable( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'i' && features.bInfo )\r\n\t\t\t{\r\n\t\t\t\t/* Info */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlInfo( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'p' && features.bPaginate )\r\n\t\t\t{\r\n\t\t\t\t/* Pagination */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlPaginate( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( DataTable.ext.feature.length !== 0 )\r\n\t\t\t{\r\n\t\t\t\t/* Plug-in features */\r\n\t\t\t\tvar aoFeatures = DataTable.ext.feature;\r\n\t\t\t\tfor ( var k=0, kLen=aoFeatures.length ; k';\r\n\t\r\n\t\tvar str = language.sSearch;\r\n\t\tstr = str.match(/_INPUT_/) ?\r\n\t\t\tstr.replace('_INPUT_', input) :\r\n\t\t\tstr+input;\r\n\t\r\n\t\tvar filter = $('', {\r\n\t\t\t\t'id': ! features.f ? tableId+'_filter' : null,\r\n\t\t\t\t'class': classes.sFilter\r\n\t\t\t} )\r\n\t\t\t.append( $('' ).append( str ) );\r\n\t\r\n\t\tvar searchFn = function() {\r\n\t\t\t/* Update all other filter input elements for the new display */\r\n\t\t\tvar n = features.f;\r\n\t\t\tvar val = !this.value ? \"\" : this.value; // mental IE8 fix :-(\r\n\t\r\n\t\t\t/* Now do the filter */\r\n\t\t\tif ( val != previousSearch.sSearch ) {\r\n\t\t\t\t_fnFilterComplete( settings, {\r\n\t\t\t\t\t\"sSearch\": val,\r\n\t\t\t\t\t\"bRegex\": previousSearch.bRegex,\r\n\t\t\t\t\t\"bSmart\": previousSearch.bSmart ,\r\n\t\t\t\t\t\"bCaseInsensitive\": previousSearch.bCaseInsensitive\r\n\t\t\t\t} );\r\n\t\r\n\t\t\t\t// Need to redraw, without resorting\r\n\t\t\t\tsettings._iDisplayStart = 0;\r\n\t\t\t\t_fnDraw( settings );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\tvar searchDelay = settings.searchDelay !== null ?\r\n\t\t\tsettings.searchDelay :\r\n\t\t\t_fnDataSource( settings ) === 'ssp' ?\r\n\t\t\t\t400 :\r\n\t\t\t\t0;\r\n\t\r\n\t\tvar jqFilter = $('input', filter)\r\n\t\t\t.val( previousSearch.sSearch )\r\n\t\t\t.attr( 'placeholder', language.sSearchPlaceholder )\r\n\t\t\t.on(\r\n\t\t\t\t'keyup.DT search.DT input.DT paste.DT cut.DT',\r\n\t\t\t\tsearchDelay ?\r\n\t\t\t\t\t_fnThrottle( searchFn, searchDelay ) :\r\n\t\t\t\t\tsearchFn\r\n\t\t\t)\r\n\t\t\t.on( 'keypress.DT', function(e) {\r\n\t\t\t\t/* Prevent form submission */\r\n\t\t\t\tif ( e.keyCode == 13 ) {\r\n\t\t\t\t\treturn false;\r\n\t\t\t\t}\r\n\t\t\t} )\r\n\t\t\t.attr('aria-controls', tableId);\r\n\t\r\n\t\t// Update the input elements whenever the table is filtered\r\n\t\t$(settings.nTable).on( 'search.dt.DT', function ( ev, s ) {\r\n\t\t\tif ( settings === s ) {\r\n\t\t\t\t// IE9 throws an 'unknown error' if document.activeElement is used\r\n\t\t\t\t// inside an iframe or frame...\r\n\t\t\t\ttry {\r\n\t\t\t\t\tif ( jqFilter[0] !== document.activeElement ) {\r\n\t\t\t\t\t\tjqFilter.val( previousSearch.sSearch );\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t\tcatch ( e ) {}\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn filter[0];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Filter the table using both the global filter and column based filtering\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {object} oSearch search information\r\n\t * @param {int} [iForce] force a research of the master array (1) or not (undefined or 0)\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnFilterComplete ( oSettings, oInput, iForce )\r\n\t{\r\n\t\tvar oPrevSearch = oSettings.oPreviousSearch;\r\n\t\tvar aoPrevSearch = oSettings.aoPreSearchCols;\r\n\t\tvar fnSaveFilter = function ( oFilter ) {\r\n\t\t\t/* Save the filtering values */\r\n\t\t\toPrevSearch.sSearch = oFilter.sSearch;\r\n\t\t\toPrevSearch.bRegex = oFilter.bRegex;\r\n\t\t\toPrevSearch.bSmart = oFilter.bSmart;\r\n\t\t\toPrevSearch.bCaseInsensitive = oFilter.bCaseInsensitive;\r\n\t\t};\r\n\t\tvar fnRegex = function ( o ) {\r\n\t\t\t// Backwards compatibility with the bEscapeRegex option\r\n\t\t\treturn o.bEscapeRegex !== undefined ? !o.bEscapeRegex : o.bRegex;\r\n\t\t};\r\n\t\r\n\t\t// Resolve any column types that are unknown due to addition or invalidation\r\n\t\t// @todo As per sort - can this be moved into an event handler?\r\n\t\t_fnColumnTypes( oSettings );\r\n\t\r\n\t\t/* In server-side processing all filtering is done by the server, so no point hanging around here */\r\n\t\tif ( _fnDataSource( oSettings ) != 'ssp' )\r\n\t\t{\r\n\t\t\t/* Global filter */\r\n\t\t\t_fnFilter( oSettings, oInput.sSearch, iForce, fnRegex(oInput), oInput.bSmart, oInput.bCaseInsensitive );\r\n\t\t\tfnSaveFilter( oInput );\r\n\t\r\n\t\t\t/* Now do the individual column filter */\r\n\t\t\tfor ( var i=0 ; i input.length ||\r\n\t\t\t\t input.indexOf(prevSearch) !== 0 ||\r\n\t\t\t\t settings.bSorted // On resort, the display master needs to be\r\n\t\t\t\t // re-filtered since indexes will have changed\r\n\t\t\t) {\r\n\t\t\t\tsettings.aiDisplay = displayMaster.slice();\r\n\t\t\t}\r\n\t\r\n\t\t\t// Search the display array\r\n\t\t\tdisplay = settings.aiDisplay;\r\n\t\r\n\t\t\tfor ( i=0 ; i')[0];\r\n\tvar __filter_div_textContent = __filter_div.textContent !== undefined;\r\n\t\r\n\t// Update the filtering data for each row if needed (by invalidation or first run)\r\n\tfunction _fnFilterData ( settings )\r\n\t{\r\n\t\tvar columns = settings.aoColumns;\r\n\t\tvar column;\r\n\t\tvar i, j, ien, jen, filterData, cellData, row;\r\n\t\tvar fomatters = DataTable.ext.type.search;\r\n\t\tvar wasInvalidated = false;\r\n\t\r\n\t\tfor ( i=0, ien=settings.aoData.length ; i', {\r\n\t\t\t\t'class': settings.oClasses.sInfo,\r\n\t\t\t\t'id': ! nodes ? tid+'_info' : null\r\n\t\t\t} );\r\n\t\r\n\t\tif ( ! nodes ) {\r\n\t\t\t// Update display on each draw\r\n\t\t\tsettings.aoDrawCallback.push( {\r\n\t\t\t\t\"fn\": _fnUpdateInfo,\r\n\t\t\t\t\"sName\": \"information\"\r\n\t\t\t} );\r\n\t\r\n\t\t\tn\r\n\t\t\t\t.attr( 'role', 'status' )\r\n\t\t\t\t.attr( 'aria-live', 'polite' );\r\n\t\r\n\t\t\t// Table is described by our info div\r\n\t\t\t$(settings.nTable).attr( 'aria-describedby', tid+'_info' );\r\n\t\t}\r\n\t\r\n\t\treturn n[0];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Update the information elements in the display\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnUpdateInfo ( settings )\r\n\t{\r\n\t\t/* Show information about the table */\r\n\t\tvar nodes = settings.aanFeatures.i;\r\n\t\tif ( nodes.length === 0 ) {\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tvar\r\n\t\t\tlang = settings.oLanguage,\r\n\t\t\tstart = settings._iDisplayStart+1,\r\n\t\t\tend = settings.fnDisplayEnd(),\r\n\t\t\tmax = settings.fnRecordsTotal(),\r\n\t\t\ttotal = settings.fnRecordsDisplay(),\r\n\t\t\tout = total ?\r\n\t\t\t\tlang.sInfo :\r\n\t\t\t\tlang.sInfoEmpty;\r\n\t\r\n\t\tif ( total !== max ) {\r\n\t\t\t/* Record set after filtering */\r\n\t\t\tout += ' ' + lang.sInfoFiltered;\r\n\t\t}\r\n\t\r\n\t\t// Convert the macros\r\n\t\tout += lang.sInfoPostFix;\r\n\t\tout = _fnInfoMacros( settings, out );\r\n\t\r\n\t\tvar callback = lang.fnInfoCallback;\r\n\t\tif ( callback !== null ) {\r\n\t\t\tout = callback.call( settings.oInstance,\r\n\t\t\t\tsettings, start, end, max, total, out\r\n\t\t\t);\r\n\t\t}\r\n\t\r\n\t\t$(nodes).html( out );\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnInfoMacros ( settings, str )\r\n\t{\r\n\t\t// When infinite scrolling, we are always starting at 1. _iDisplayStart is used only\r\n\t\t// internally\r\n\t\tvar\r\n\t\t\tformatter = settings.fnFormatNumber,\r\n\t\t\tstart = settings._iDisplayStart+1,\r\n\t\t\tlen = settings._iDisplayLength,\r\n\t\t\tvis = settings.fnRecordsDisplay(),\r\n\t\t\tall = len === -1;\r\n\t\r\n\t\treturn str.\r\n\t\t\treplace(/_START_/g, formatter.call( settings, start ) ).\r\n\t\t\treplace(/_END_/g, formatter.call( settings, settings.fnDisplayEnd() ) ).\r\n\t\t\treplace(/_MAX_/g, formatter.call( settings, settings.fnRecordsTotal() ) ).\r\n\t\t\treplace(/_TOTAL_/g, formatter.call( settings, vis ) ).\r\n\t\t\treplace(/_PAGE_/g, formatter.call( settings, all ? 1 : Math.ceil( start / len ) ) ).\r\n\t\t\treplace(/_PAGES_/g, formatter.call( settings, all ? 1 : Math.ceil( vis / len ) ) );\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Draw the table for the first time, adding all required features\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnInitialise ( settings )\r\n\t{\r\n\t\tvar i, iLen, iAjaxStart=settings.iInitDisplayStart;\r\n\t\tvar columns = settings.aoColumns, column;\r\n\t\tvar features = settings.oFeatures;\r\n\t\tvar deferLoading = settings.bDeferLoading; // value modified by the draw\r\n\t\r\n\t\t/* Ensure that the table data is fully initialised */\r\n\t\tif ( ! settings.bInitialised ) {\r\n\t\t\tsetTimeout( function(){ _fnInitialise( settings ); }, 200 );\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\t/* Show the display HTML options */\r\n\t\t_fnAddOptionsHtml( settings );\r\n\t\r\n\t\t/* Build and draw the header / footer for the table */\r\n\t\t_fnBuildHead( settings );\r\n\t\t_fnDrawHead( settings, settings.aoHeader );\r\n\t\t_fnDrawHead( settings, settings.aoFooter );\r\n\t\r\n\t\t/* Okay to show that something is going on now */\r\n\t\t_fnProcessingDisplay( settings, true );\r\n\t\r\n\t\t/* Calculate sizes for columns */\r\n\t\tif ( features.bAutoWidth ) {\r\n\t\t\t_fnCalculateColumnWidths( settings );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, iLen=columns.length ; i', {\r\n\t\t\t'name': tableId+'_length',\r\n\t\t\t'aria-controls': tableId,\r\n\t\t\t'class': classes.sLengthSelect\r\n\t\t} );\r\n\t\r\n\t\tfor ( var i=0, ien=lengths.length ; i'+headerContent[i]+'
';\r\n\t\t\tnSizer.style.width = headerWidths[i];\r\n\t\t}, headerSrcEls );\r\n\t\r\n\t\tif ( footer )\r\n\t\t{\r\n\t\t\t_fnApplyToChildren( function(nSizer, i) {\r\n\t\t\t\tnSizer.innerHTML = ''+footerContent[i]+'
';\r\n\t\t\t\tnSizer.style.width = footerWidths[i];\r\n\t\t\t}, footerSrcEls );\r\n\t\t}\r\n\t\r\n\t\t// Sanity check that the table is of a sensible width. If not then we are going to get\r\n\t\t// misalignment - try to prevent this by not allowing the table to shrink below its min width\r\n\t\tif ( table.outerWidth() < sanityWidth )\r\n\t\t{\r\n\t\t\t// The min width depends upon if we have a vertical scrollbar visible or not */\r\n\t\t\tcorrection = ((divBodyEl.scrollHeight > divBodyEl.offsetHeight ||\r\n\t\t\t\tdivBody.css('overflow-y') == \"scroll\")) ?\r\n\t\t\t\t\tsanityWidth+barWidth :\r\n\t\t\t\t\tsanityWidth;\r\n\t\r\n\t\t\t// IE6/7 are a law unto themselves...\r\n\t\t\tif ( ie67 && (divBodyEl.scrollHeight >\r\n\t\t\t\tdivBodyEl.offsetHeight || divBody.css('overflow-y') == \"scroll\")\r\n\t\t\t) {\r\n\t\t\t\ttableStyle.width = _fnStringToCss( correction-barWidth );\r\n\t\t\t}\r\n\t\r\n\t\t\t// And give the user a warning that we've stopped the table getting too small\r\n\t\t\tif ( scrollX === \"\" || scrollXInner !== \"\" ) {\r\n\t\t\t\t_fnLog( settings, 1, 'Possible column misalignment', 6 );\r\n\t\t\t}\r\n\t\t}\r\n\t\telse\r\n\t\t{\r\n\t\t\tcorrection = '100%';\r\n\t\t}\r\n\t\r\n\t\t// Apply to the container elements\r\n\t\tdivBodyStyle.width = _fnStringToCss( correction );\r\n\t\tdivHeaderStyle.width = _fnStringToCss( correction );\r\n\t\r\n\t\tif ( footer ) {\r\n\t\t\tsettings.nScrollFoot.style.width = _fnStringToCss( correction );\r\n\t\t}\r\n\t\r\n\t\r\n\t\t/*\r\n\t\t * 4. Clean up\r\n\t\t */\r\n\t\tif ( ! scrollY ) {\r\n\t\t\t/* IE7< puts a vertical scrollbar in place (when it shouldn't be) due to subtracting\r\n\t\t\t * the scrollbar height from the visible display, rather than adding it on. We need to\r\n\t\t\t * set the height in order to sort this. Don't want to do it in any other browsers.\r\n\t\t\t */\r\n\t\t\tif ( ie67 ) {\r\n\t\t\t\tdivBodyStyle.height = _fnStringToCss( tableEl.offsetHeight+barWidth );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* Finally set the width's of the header and footer tables */\r\n\t\tvar iOuterWidth = table.outerWidth();\r\n\t\tdivHeaderTable[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\tdivHeaderInnerStyle.width = _fnStringToCss( iOuterWidth );\r\n\t\r\n\t\t// Figure out if there are scrollbar present - if so then we need a the header and footer to\r\n\t\t// provide a bit more space to allow \"overflow\" scrolling (i.e. past the scrollbar)\r\n\t\tvar bScrolling = table.height() > divBodyEl.clientHeight || divBody.css('overflow-y') == \"scroll\";\r\n\t\tvar padding = 'padding' + (browser.bScrollbarLeft ? 'Left' : 'Right' );\r\n\t\tdivHeaderInnerStyle[ padding ] = bScrolling ? barWidth+\"px\" : \"0px\";\r\n\t\r\n\t\tif ( footer ) {\r\n\t\t\tdivFooterTable[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\t\tdivFooterInner[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\t\tdivFooterInner[0].style[padding] = bScrolling ? barWidth+\"px\" : \"0px\";\r\n\t\t}\r\n\t\r\n\t\t// Correct DOM ordering for colgroup - comes before the thead\r\n\t\ttable.children('colgroup').insertBefore( table.children('thead') );\r\n\t\r\n\t\t/* Adjust the position of the header in case we loose the y-scrollbar */\r\n\t\tdivBody.scroll();\r\n\t\r\n\t\t// If sorting or filtering has occurred, jump the scrolling back to the top\r\n\t\t// only if we aren't holding the position\r\n\t\tif ( (settings.bSorted || settings.bFiltered) && ! settings._drawHold ) {\r\n\t\t\tdivBodyEl.scrollTop = 0;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Apply a given function to the display child nodes of an element array (typically\r\n\t * TD children of TR rows\r\n\t * @param {function} fn Method to apply to the objects\r\n\t * @param array {nodes} an1 List of elements to look through for display children\r\n\t * @param array {nodes} an2 Another list (identical structure to the first) - optional\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnApplyToChildren( fn, an1, an2 )\r\n\t{\r\n\t\tvar index=0, i=0, iLen=an1.length;\r\n\t\tvar nNode1, nNode2;\r\n\t\r\n\t\twhile ( i < iLen ) {\r\n\t\t\tnNode1 = an1[i].firstChild;\r\n\t\t\tnNode2 = an2 ? an2[i].firstChild : null;\r\n\t\r\n\t\t\twhile ( nNode1 ) {\r\n\t\t\t\tif ( nNode1.nodeType === 1 ) {\r\n\t\t\t\t\tif ( an2 ) {\r\n\t\t\t\t\t\tfn( nNode1, nNode2, index );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse {\r\n\t\t\t\t\t\tfn( nNode1, index );\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tindex++;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tnNode1 = nNode1.nextSibling;\r\n\t\t\t\tnNode2 = an2 ? nNode2.nextSibling : null;\r\n\t\t\t}\r\n\t\r\n\t\t\ti++;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\tvar __re_html_remove = /<.*?>/g;\r\n\t\r\n\t\r\n\t/**\r\n\t * Calculate the width of columns for the table\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnCalculateColumnWidths ( oSettings )\r\n\t{\r\n\t\tvar\r\n\t\t\ttable = oSettings.nTable,\r\n\t\t\tcolumns = oSettings.aoColumns,\r\n\t\t\tscroll = oSettings.oScroll,\r\n\t\t\tscrollY = scroll.sY,\r\n\t\t\tscrollX = scroll.sX,\r\n\t\t\tscrollXInner = scroll.sXInner,\r\n\t\t\tcolumnCount = columns.length,\r\n\t\t\tvisibleColumns = _fnGetColumns( oSettings, 'bVisible' ),\r\n\t\t\theaderCells = $('th', oSettings.nTHead),\r\n\t\t\ttableWidthAttr = table.getAttribute('width'), // from DOM element\r\n\t\t\ttableContainer = table.parentNode,\r\n\t\t\tuserInputs = false,\r\n\t\t\ti, column, columnIdx, width, outerWidth,\r\n\t\t\tbrowser = oSettings.oBrowser,\r\n\t\t\tie67 = browser.bScrollOversize;\r\n\t\r\n\t\tvar styleWidth = table.style.width;\r\n\t\tif ( styleWidth && styleWidth.indexOf('%') !== -1 ) {\r\n\t\t\ttableWidthAttr = styleWidth;\r\n\t\t}\r\n\t\r\n\t\t/* Convert any user input sizes into pixel sizes */\r\n\t\tfor ( i=0 ; i').appendTo( tmpTable.find('tbody') );\r\n\t\r\n\t\t\t// Clone the table header and footer - we can't use the header / footer\r\n\t\t\t// from the cloned table, since if scrolling is active, the table's\r\n\t\t\t// real header and footer are contained in different table tags\r\n\t\t\ttmpTable.find('thead, tfoot').remove();\r\n\t\t\ttmpTable\r\n\t\t\t\t.append( $(oSettings.nTHead).clone() )\r\n\t\t\t\t.append( $(oSettings.nTFoot).clone() );\r\n\t\r\n\t\t\t// Remove any assigned widths from the footer (from scrolling)\r\n\t\t\ttmpTable.find('tfoot th, tfoot td').css('width', '');\r\n\t\r\n\t\t\t// Apply custom sizing to the cloned header\r\n\t\t\theaderCells = _fnGetUniqueThs( oSettings, tmpTable.find('thead')[0] );\r\n\t\r\n\t\t\tfor ( i=0 ; i').css( {\r\n\t\t\t\t\t\twidth: column.sWidthOrig,\r\n\t\t\t\t\t\tmargin: 0,\r\n\t\t\t\t\t\tpadding: 0,\r\n\t\t\t\t\t\tborder: 0,\r\n\t\t\t\t\t\theight: 1\r\n\t\t\t\t\t} ) );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// Find the widest cell for each column and put it into the table\r\n\t\t\tif ( oSettings.aoData.length ) {\r\n\t\t\t\tfor ( i=0 ; i').css( scrollX || scrollY ?\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tposition: 'absolute',\r\n\t\t\t\t\t\ttop: 0,\r\n\t\t\t\t\t\tleft: 0,\r\n\t\t\t\t\t\theight: 1,\r\n\t\t\t\t\t\tright: 0,\r\n\t\t\t\t\t\toverflow: 'hidden'\r\n\t\t\t\t\t} :\r\n\t\t\t\t\t{}\r\n\t\t\t\t)\r\n\t\t\t\t.append( tmpTable )\r\n\t\t\t\t.appendTo( tableContainer );\r\n\t\r\n\t\t\t// When scrolling (X or Y) we want to set the width of the table as \r\n\t\t\t// appropriate. However, when not scrolling leave the table width as it\r\n\t\t\t// is. This results in slightly different, but I think correct behaviour\r\n\t\t\tif ( scrollX && scrollXInner ) {\r\n\t\t\t\ttmpTable.width( scrollXInner );\r\n\t\t\t}\r\n\t\t\telse if ( scrollX ) {\r\n\t\t\t\ttmpTable.css( 'width', 'auto' );\r\n\t\t\t\ttmpTable.removeAttr('width');\r\n\t\r\n\t\t\t\t// If there is no width attribute or style, then allow the table to\r\n\t\t\t\t// collapse\r\n\t\t\t\tif ( tmpTable.width() < tableContainer.clientWidth && tableWidthAttr ) {\r\n\t\t\t\t\ttmpTable.width( tableContainer.clientWidth );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\telse if ( scrollY ) {\r\n\t\t\t\ttmpTable.width( tableContainer.clientWidth );\r\n\t\t\t}\r\n\t\t\telse if ( tableWidthAttr ) {\r\n\t\t\t\ttmpTable.width( tableWidthAttr );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Get the width of each column in the constructed table - we need to\r\n\t\t\t// know the inner width (so it can be assigned to the other table's\r\n\t\t\t// cells) and the outer width so we can calculate the full width of the\r\n\t\t\t// table. This is safe since DataTables requires a unique cell for each\r\n\t\t\t// column, but if ever a header can span multiple columns, this will\r\n\t\t\t// need to be modified.\r\n\t\t\tvar total = 0;\r\n\t\t\tfor ( i=0 ; i')\r\n\t\t\t.css( 'width', _fnStringToCss( width ) )\r\n\t\t\t.appendTo( parent || document.body );\r\n\t\r\n\t\tvar val = n[0].offsetWidth;\r\n\t\tn.remove();\r\n\t\r\n\t\treturn val;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the widest node\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {int} colIdx column of interest\r\n\t * @returns {node} widest table node\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnGetWidestNode( settings, colIdx )\r\n\t{\r\n\t\tvar idx = _fnGetMaxLenString( settings, colIdx );\r\n\t\tif ( idx < 0 ) {\r\n\t\t\treturn null;\r\n\t\t}\r\n\t\r\n\t\tvar data = settings.aoData[ idx ];\r\n\t\treturn ! data.nTr ? // Might not have been created when deferred rendering\r\n\t\t\t$(' | ').html( _fnGetCellData( settings, idx, colIdx, 'display' ) )[0] :\r\n\t\t\tdata.anCells[ colIdx ];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the maximum strlen for each data column\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {int} colIdx column of interest\r\n\t * @returns {string} max string length for each column\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnGetMaxLenString( settings, colIdx )\r\n\t{\r\n\t\tvar s, max=-1, maxIdx = -1;\r\n\t\r\n\t\tfor ( var i=0, ien=settings.aoData.length ; i max ) {\r\n\t\t\t\tmax = s.length;\r\n\t\t\t\tmaxIdx = i;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn maxIdx;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Append a CSS unit (only if required) to a string\r\n\t * @param {string} value to css-ify\r\n\t * @returns {string} value with css unit\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnStringToCss( s )\r\n\t{\r\n\t\tif ( s === null ) {\r\n\t\t\treturn '0px';\r\n\t\t}\r\n\t\r\n\t\tif ( typeof s == 'number' ) {\r\n\t\t\treturn s < 0 ?\r\n\t\t\t\t'0px' :\r\n\t\t\t\ts+'px';\r\n\t\t}\r\n\t\r\n\t\t// Check it has a unit character already\r\n\t\treturn s.match(/\\d$/) ?\r\n\t\t\ts+'px' :\r\n\t\t\ts;\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\tfunction _fnSortFlatten ( settings )\r\n\t{\r\n\t\tvar\r\n\t\t\ti, iLen, k, kLen,\r\n\t\t\taSort = [],\r\n\t\t\taiOrig = [],\r\n\t\t\taoColumns = settings.aoColumns,\r\n\t\t\taDataSort, iCol, sType, srcCol,\r\n\t\t\tfixed = settings.aaSortingFixed,\r\n\t\t\tfixedObj = $.isPlainObject( fixed ),\r\n\t\t\tnestedSort = [],\r\n\t\t\tadd = function ( a ) {\r\n\t\t\t\tif ( a.length && ! $.isArray( a[0] ) ) {\r\n\t\t\t\t\t// 1D array\r\n\t\t\t\t\tnestedSort.push( a );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\t// 2D array\r\n\t\t\t\t\t$.merge( nestedSort, a );\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\r\n\t\t// Build the sort array, with pre-fix and post-fix options if they have been\r\n\t\t// specified\r\n\t\tif ( $.isArray( fixed ) ) {\r\n\t\t\tadd( fixed );\r\n\t\t}\r\n\t\r\n\t\tif ( fixedObj && fixed.pre ) {\r\n\t\t\tadd( fixed.pre );\r\n\t\t}\r\n\t\r\n\t\tadd( settings.aaSorting );\r\n\t\r\n\t\tif (fixedObj && fixed.post ) {\r\n\t\t\tadd( fixed.post );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0 ; iy ? 1 : 0;\r\n\t\t\t\t\t\tif ( test !== 0 ) {\r\n\t\t\t\t\t\t\treturn sort.dir === 'asc' ? test : -test;\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tx = aiOrig[a];\r\n\t\t\t\t\ty = aiOrig[b];\r\n\t\t\t\t\treturn xy ? 1 : 0;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// Depreciated - remove in 1.11 (providing a plug-in option)\r\n\t\t\t\t// Not all sort types have formatting methods, so we have to call their sorting\r\n\t\t\t\t// methods.\r\n\t\t\t\tdisplayMaster.sort( function ( a, b ) {\r\n\t\t\t\t\tvar\r\n\t\t\t\t\t\tx, y, k, l, test, sort, fn,\r\n\t\t\t\t\t\tlen=aSort.length,\r\n\t\t\t\t\t\tdataA = aoData[a]._aSortData,\r\n\t\t\t\t\t\tdataB = aoData[b]._aSortData;\r\n\t\r\n\t\t\t\t\tfor ( k=0 ; ky ? 1 : 0;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* Tell the draw function that we have sorted the data */\r\n\t\toSettings.bSorted = true;\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnSortAria ( settings )\r\n\t{\r\n\t\tvar label;\r\n\t\tvar nextSort;\r\n\t\tvar columns = settings.aoColumns;\r\n\t\tvar aSort = _fnSortFlatten( settings );\r\n\t\tvar oAria = settings.oLanguage.oAria;\r\n\t\r\n\t\t// ARIA attributes - need to loop all columns, to update all (removing old\r\n\t\t// attributes as needed)\r\n\t\tfor ( var i=0, iLen=columns.length ; i/g, \"\" );\r\n\t\t\tvar th = col.nTh;\r\n\t\r\n\t\t\t// IE7 is throwing an error when setting these properties with jQuery's\r\n\t\t\t// attr() and removeAttr() methods...\r\n\t\t\tth.removeAttribute('aria-sort');\r\n\t\r\n\t\t\t/* In ARIA only the first sorting column can be marked as sorting - no multi-sort option */\r\n\t\t\tif ( col.bSortable ) {\r\n\t\t\t\tif ( aSort.length > 0 && aSort[0].col == i ) {\r\n\t\t\t\t\tth.setAttribute('aria-sort', aSort[0].dir==\"asc\" ? \"ascending\" : \"descending\" );\r\n\t\t\t\t\tnextSort = asSorting[ aSort[0].index+1 ] || asSorting[0];\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tnextSort = asSorting[0];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tlabel = sTitle + ( nextSort === \"asc\" ?\r\n\t\t\t\t\toAria.sSortAscending :\r\n\t\t\t\t\toAria.sSortDescending\r\n\t\t\t\t);\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tlabel = sTitle;\r\n\t\t\t}\r\n\t\r\n\t\t\tth.setAttribute('aria-label', label);\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Function to run on user sort request\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {node} attachTo node to attach the handler to\r\n\t * @param {int} colIdx column sorting index\r\n\t * @param {boolean} [append=false] Append the requested sort to the existing\r\n\t * sort if true (i.e. multi-column sort)\r\n\t * @param {function} [callback] callback function\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortListener ( settings, colIdx, append, callback )\r\n\t{\r\n\t\tvar col = settings.aoColumns[ colIdx ];\r\n\t\tvar sorting = settings.aaSorting;\r\n\t\tvar asSorting = col.asSorting;\r\n\t\tvar nextSortIdx;\r\n\t\tvar next = function ( a, overflow ) {\r\n\t\t\tvar idx = a._idx;\r\n\t\t\tif ( idx === undefined ) {\r\n\t\t\t\tidx = $.inArray( a[1], asSorting );\r\n\t\t\t}\r\n\t\r\n\t\t\treturn idx+1 < asSorting.length ?\r\n\t\t\t\tidx+1 :\r\n\t\t\t\toverflow ?\r\n\t\t\t\t\tnull :\r\n\t\t\t\t\t0;\r\n\t\t};\r\n\t\r\n\t\t// Convert to 2D array if needed\r\n\t\tif ( typeof sorting[0] === 'number' ) {\r\n\t\t\tsorting = settings.aaSorting = [ sorting ];\r\n\t\t}\r\n\t\r\n\t\t// If appending the sort then we are multi-column sorting\r\n\t\tif ( append && settings.oFeatures.bSortMulti ) {\r\n\t\t\t// Are we already doing some kind of sort on this column?\r\n\t\t\tvar sortIdx = $.inArray( colIdx, _pluck(sorting, '0') );\r\n\t\r\n\t\t\tif ( sortIdx !== -1 ) {\r\n\t\t\t\t// Yes, modify the sort\r\n\t\t\t\tnextSortIdx = next( sorting[sortIdx], true );\r\n\t\r\n\t\t\t\tif ( nextSortIdx === null && sorting.length === 1 ) {\r\n\t\t\t\t\tnextSortIdx = 0; // can't remove sorting completely\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tif ( nextSortIdx === null ) {\r\n\t\t\t\t\tsorting.splice( sortIdx, 1 );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tsorting[sortIdx][1] = asSorting[ nextSortIdx ];\r\n\t\t\t\t\tsorting[sortIdx]._idx = nextSortIdx;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// No sort on this column yet\r\n\t\t\t\tsorting.push( [ colIdx, asSorting[0], 0 ] );\r\n\t\t\t\tsorting[sorting.length-1]._idx = 0;\r\n\t\t\t}\r\n\t\t}\r\n\t\telse if ( sorting.length && sorting[0][0] == colIdx ) {\r\n\t\t\t// Single column - already sorting on this column, modify the sort\r\n\t\t\tnextSortIdx = next( sorting[0] );\r\n\t\r\n\t\t\tsorting.length = 1;\r\n\t\t\tsorting[0][1] = asSorting[ nextSortIdx ];\r\n\t\t\tsorting[0]._idx = nextSortIdx;\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// Single column - sort only on this column\r\n\t\t\tsorting.length = 0;\r\n\t\t\tsorting.push( [ colIdx, asSorting[0] ] );\r\n\t\t\tsorting[0]._idx = 0;\r\n\t\t}\r\n\t\r\n\t\t// Run the sort by calling a full redraw\r\n\t\t_fnReDraw( settings );\r\n\t\r\n\t\t// callback used for async user interaction\r\n\t\tif ( typeof callback == 'function' ) {\r\n\t\t\tcallback( settings );\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Attach a sort handler (click) to a node\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {node} attachTo node to attach the handler to\r\n\t * @param {int} colIdx column sorting index\r\n\t * @param {function} [callback] callback function\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortAttachListener ( settings, attachTo, colIdx, callback )\r\n\t{\r\n\t\tvar col = settings.aoColumns[ colIdx ];\r\n\t\r\n\t\t_fnBindAction( attachTo, {}, function (e) {\r\n\t\t\t/* If the column is not sortable - don't to anything */\r\n\t\t\tif ( col.bSortable === false ) {\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// If processing is enabled use a timeout to allow the processing\r\n\t\t\t// display to be shown - otherwise to it synchronously\r\n\t\t\tif ( settings.oFeatures.bProcessing ) {\r\n\t\t\t\t_fnProcessingDisplay( settings, true );\r\n\t\r\n\t\t\t\tsetTimeout( function() {\r\n\t\t\t\t\t_fnSortListener( settings, colIdx, e.shiftKey, callback );\r\n\t\r\n\t\t\t\t\t// In server-side processing, the draw callback will remove the\r\n\t\t\t\t\t// processing display\r\n\t\t\t\t\tif ( _fnDataSource( settings ) !== 'ssp' ) {\r\n\t\t\t\t\t\t_fnProcessingDisplay( settings, false );\r\n\t\t\t\t\t}\r\n\t\t\t\t}, 0 );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t_fnSortListener( settings, colIdx, e.shiftKey, callback );\r\n\t\t\t}\r\n\t\t} );\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Set the sorting classes on table's body, Note: it is safe to call this function\r\n\t * when bSort and bSortClasses are false\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortingClasses( settings )\r\n\t{\r\n\t\tvar oldSort = settings.aLastSort;\r\n\t\tvar sortClass = settings.oClasses.sSortColumn;\r\n\t\tvar sort = _fnSortFlatten( settings );\r\n\t\tvar features = settings.oFeatures;\r\n\t\tvar i, ien, colIdx;\r\n\t\r\n\t\tif ( features.bSort && features.bSortClasses ) {\r\n\t\t\t// Remove old sorting classes\r\n\t\t\tfor ( i=0, ien=oldSort.length ; i 0 && s.time < +new Date() - (duration*1000) ) {\r\n\t\t\t\tcallback();\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Number of columns have changed - all bets are off, no restore of settings\r\n\t\t\tif ( s.columns && columns.length !== s.columns.length ) {\r\n\t\t\t\tcallback();\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Store the saved state so it might be accessed at any time\r\n\t\t\tsettings.oLoadedState = $.extend( true, {}, s );\r\n\t\r\n\t\t\t// Restore key features - todo - for 1.11 this needs to be done by\r\n\t\t\t// subscribed events\r\n\t\t\tif ( s.start !== undefined ) {\r\n\t\t\t\tsettings._iDisplayStart = s.start;\r\n\t\t\t\tsettings.iInitDisplayStart = s.start;\r\n\t\t\t}\r\n\t\t\tif ( s.length !== undefined ) {\r\n\t\t\t\tsettings._iDisplayLength = s.length;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Order\r\n\t\t\tif ( s.order !== undefined ) {\r\n\t\t\t\tsettings.aaSorting = [];\r\n\t\t\t\t$.each( s.order, function ( i, col ) {\r\n\t\t\t\t\tsettings.aaSorting.push( col[0] >= columns.length ?\r\n\t\t\t\t\t\t[ 0, col[1] ] :\r\n\t\t\t\t\t\tcol\r\n\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Search\r\n\t\t\tif ( s.search !== undefined ) {\r\n\t\t\t\t$.extend( settings.oPreviousSearch, _fnSearchToHung( s.search ) );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Columns\r\n\t\t\t//\r\n\t\t\tif ( s.columns ) {\r\n\t\t\t\tfor ( i=0, ien=s.columns.length ; i= end )\r\n\t\t{\r\n\t\t\tstart = end - len;\r\n\t\t}\r\n\t\r\n\t\t// Keep the start record on the current page\r\n\t\tstart -= (start % len);\r\n\t\r\n\t\tif ( len === -1 || start < 0 )\r\n\t\t{\r\n\t\t\tstart = 0;\r\n\t\t}\r\n\t\r\n\t\tsettings._iDisplayStart = start;\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnRenderer( settings, type )\r\n\t{\r\n\t\tvar renderer = settings.renderer;\r\n\t\tvar host = DataTable.ext.renderer[type];\r\n\t\r\n\t\tif ( $.isPlainObject( renderer ) && renderer[type] ) {\r\n\t\t\t// Specific renderer for this type. If available use it, otherwise use\r\n\t\t\t// the default.\r\n\t\t\treturn host[renderer[type]] || host._;\r\n\t\t}\r\n\t\telse if ( typeof renderer === 'string' ) {\r\n\t\t\t// Common renderer - if there is one available for this type use it,\r\n\t\t\t// otherwise use the default\r\n\t\t\treturn host[renderer] || host._;\r\n\t\t}\r\n\t\r\n\t\t// Use the default\r\n\t\treturn host._;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Detect the data source being used for the table. Used to simplify the code\r\n\t * a little (ajax) and to make it compress a little smaller.\r\n\t *\r\n\t * @param {object} settings dataTables settings object\r\n\t * @returns {string} Data source\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnDataSource ( settings )\r\n\t{\r\n\t\tif ( settings.oFeatures.bServerSide ) {\r\n\t\t\treturn 'ssp';\r\n\t\t}\r\n\t\telse if ( settings.ajax || settings.sAjaxSource ) {\r\n\t\t\treturn 'ajax';\r\n\t\t}\r\n\t\treturn 'dom';\r\n\t}\r\n\t\r\n\r\n\t\r\n\t\r\n\t/**\r\n\t * Computed structure of the DataTables API, defined by the options passed to\r\n\t * `DataTable.Api.register()` when building the API.\r\n\t *\r\n\t * The structure is built in order to speed creation and extension of the Api\r\n\t * objects since the extensions are effectively pre-parsed.\r\n\t *\r\n\t * The array is an array of objects with the following structure, where this\r\n\t * base array represents the Api prototype base:\r\n\t *\r\n\t * [\r\n\t * {\r\n\t * name: 'data' -- string - Property name\r\n\t * val: function () {}, -- function - Api method (or undefined if just an object\r\n\t * methodExt: [ ... ], -- array - Array of Api object definitions to extend the method result\r\n\t * propExt: [ ... ] -- array - Array of Api object definitions to extend the property\r\n\t * },\r\n\t * {\r\n\t * name: 'row'\r\n\t * val: {},\r\n\t * methodExt: [ ... ],\r\n\t * propExt: [\r\n\t * {\r\n\t * name: 'data'\r\n\t * val: function () {},\r\n\t * methodExt: [ ... ],\r\n\t * propExt: [ ... ]\r\n\t * },\r\n\t * ...\r\n\t * ]\r\n\t * }\r\n\t * ]\r\n\t *\r\n\t * @type {Array}\r\n\t * @ignore\r\n\t */\r\n\tvar __apiStruct = [];\r\n\t\r\n\t\r\n\t/**\r\n\t * `Array.prototype` reference.\r\n\t *\r\n\t * @type object\r\n\t * @ignore\r\n\t */\r\n\tvar __arrayProto = Array.prototype;\r\n\t\r\n\t\r\n\t/**\r\n\t * Abstraction for `context` parameter of the `Api` constructor to allow it to\r\n\t * take several different forms for ease of use.\r\n\t *\r\n\t * Each of the input parameter types will be converted to a DataTables settings\r\n\t * object where possible.\r\n\t *\r\n\t * @param {string|node|jQuery|object} mixed DataTable identifier. Can be one\r\n\t * of:\r\n\t *\r\n\t * * `string` - jQuery selector. Any DataTables' matching the given selector\r\n\t * with be found and used.\r\n\t * * `node` - `TABLE` node which has already been formed into a DataTable.\r\n\t * * `jQuery` - A jQuery object of `TABLE` nodes.\r\n\t * * `object` - DataTables settings object\r\n\t * * `DataTables.Api` - API instance\r\n\t * @return {array|null} Matching DataTables settings objects. `null` or\r\n\t * `undefined` is returned if no matching DataTable is found.\r\n\t * @ignore\r\n\t */\r\n\tvar _toSettings = function ( mixed )\r\n\t{\r\n\t\tvar idx, jq;\r\n\t\tvar settings = DataTable.settings;\r\n\t\tvar tables = $.map( settings, function (el, i) {\r\n\t\t\treturn el.nTable;\r\n\t\t} );\r\n\t\r\n\t\tif ( ! mixed ) {\r\n\t\t\treturn [];\r\n\t\t}\r\n\t\telse if ( mixed.nTable && mixed.oApi ) {\r\n\t\t\t// DataTables settings object\r\n\t\t\treturn [ mixed ];\r\n\t\t}\r\n\t\telse if ( mixed.nodeName && mixed.nodeName.toLowerCase() === 'table' ) {\r\n\t\t\t// Table node\r\n\t\t\tidx = $.inArray( mixed, tables );\r\n\t\t\treturn idx !== -1 ? [ settings[idx] ] : null;\r\n\t\t}\r\n\t\telse if ( mixed && typeof mixed.settings === 'function' ) {\r\n\t\t\treturn mixed.settings().toArray();\r\n\t\t}\r\n\t\telse if ( typeof mixed === 'string' ) {\r\n\t\t\t// jQuery selector\r\n\t\t\tjq = $(mixed);\r\n\t\t}\r\n\t\telse if ( mixed instanceof $ ) {\r\n\t\t\t// jQuery object (also DataTables instance)\r\n\t\t\tjq = mixed;\r\n\t\t}\r\n\t\r\n\t\tif ( jq ) {\r\n\t\t\treturn jq.map( function(i) {\r\n\t\t\t\tidx = $.inArray( this, tables );\r\n\t\t\t\treturn idx !== -1 ? settings[idx] : null;\r\n\t\t\t} ).toArray();\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables API class - used to control and interface with one or more\r\n\t * DataTables enhanced tables.\r\n\t *\r\n\t * The API class is heavily based on jQuery, presenting a chainable interface\r\n\t * that you can use to interact with tables. Each instance of the API class has\r\n\t * a \"context\" - i.e. the tables that it will operate on. This could be a single\r\n\t * table, all tables on a page or a sub-set thereof.\r\n\t *\r\n\t * Additionally the API is designed to allow you to easily work with the data in\r\n\t * the tables, retrieving and manipulating it as required. This is done by\r\n\t * presenting the API class as an array like interface. The contents of the\r\n\t * array depend upon the actions requested by each method (for example\r\n\t * `rows().nodes()` will return an array of nodes, while `rows().data()` will\r\n\t * return an array of objects or arrays depending upon your table's\r\n\t * configuration). The API object has a number of array like methods (`push`,\r\n\t * `pop`, `reverse` etc) as well as additional helper methods (`each`, `pluck`,\r\n\t * `unique` etc) to assist your working with the data held in a table.\r\n\t *\r\n\t * Most methods (those which return an Api instance) are chainable, which means\r\n\t * the return from a method call also has all of the methods available that the\r\n\t * top level object had. For example, these two calls are equivalent:\r\n\t *\r\n\t * // Not chained\r\n\t * api.row.add( {...} );\r\n\t * api.draw();\r\n\t *\r\n\t * // Chained\r\n\t * api.row.add( {...} ).draw();\r\n\t *\r\n\t * @class DataTable.Api\r\n\t * @param {array|object|string|jQuery} context DataTable identifier. This is\r\n\t * used to define which DataTables enhanced tables this API will operate on.\r\n\t * Can be one of:\r\n\t *\r\n\t * * `string` - jQuery selector. Any DataTables' matching the given selector\r\n\t * with be found and used.\r\n\t * * `node` - `TABLE` node which has already been formed into a DataTable.\r\n\t * * `jQuery` - A jQuery object of `TABLE` nodes.\r\n\t * * `object` - DataTables settings object\r\n\t * @param {array} [data] Data to initialise the Api instance with.\r\n\t *\r\n\t * @example\r\n\t * // Direct initialisation during DataTables construction\r\n\t * var api = $('#example').DataTable();\r\n\t *\r\n\t * @example\r\n\t * // Initialisation using a DataTables jQuery object\r\n\t * var api = $('#example').dataTable().api();\r\n\t *\r\n\t * @example\r\n\t * // Initialisation as a constructor\r\n\t * var api = new $.fn.DataTable.Api( 'table.dataTable' );\r\n\t */\r\n\t_Api = function ( context, data )\r\n\t{\r\n\t\tif ( ! (this instanceof _Api) ) {\r\n\t\t\treturn new _Api( context, data );\r\n\t\t}\r\n\t\r\n\t\tvar settings = [];\r\n\t\tvar ctxSettings = function ( o ) {\r\n\t\t\tvar a = _toSettings( o );\r\n\t\t\tif ( a ) {\r\n\t\t\t\tsettings = settings.concat( a );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\tif ( $.isArray( context ) ) {\r\n\t\t\tfor ( var i=0, ien=context.length ; i idx ?\r\n\t\t\t\tnew _Api( ctx[idx], this[idx] ) :\r\n\t\t\t\tnull;\r\n\t\t},\r\n\t\r\n\t\r\n\t\tfilter: function ( fn )\r\n\t\t{\r\n\t\t\tvar a = [];\r\n\t\r\n\t\t\tif ( __arrayProto.filter ) {\r\n\t\t\t\ta = __arrayProto.filter.call( this, fn, this );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// Compatibility for browsers without EMCA-252-5 (JS 1.6)\r\n\t\t\t\tfor ( var i=0, ien=this.length ; i 0 ) {\r\n\t\t\treturn ctx[0].json;\r\n\t\t}\r\n\t\r\n\t\t// else return undefined;\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the data submitted in the last Ajax request\r\n\t */\r\n\t_api_register( 'ajax.params()', function () {\r\n\t\tvar ctx = this.context;\r\n\t\r\n\t\tif ( ctx.length > 0 ) {\r\n\t\t\treturn ctx[0].oAjaxData;\r\n\t\t}\r\n\t\r\n\t\t// else return undefined;\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Reload tables from the Ajax data source. Note that this function will\r\n\t * automatically re-draw the table when the remote data has been loaded.\r\n\t *\r\n\t * @param {boolean} [reset=true] Reset (default) or hold the current paging\r\n\t * position. A full re-sort and re-filter is performed when this method is\r\n\t * called, which is why the pagination reset is the default action.\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.reload()', function ( callback, resetPaging ) {\r\n\t\treturn this.iterator( 'table', function (settings) {\r\n\t\t\t__reload( settings, resetPaging===false, callback );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the current Ajax URL. Note that this returns the URL from the first\r\n\t * table in the current context.\r\n\t *\r\n\t * @return {string} Current Ajax source URL\r\n\t *//**\r\n\t * Set the Ajax URL. Note that this will set the URL for all tables in the\r\n\t * current context.\r\n\t *\r\n\t * @param {string} url URL to set.\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.url()', function ( url ) {\r\n\t\tvar ctx = this.context;\r\n\t\r\n\t\tif ( url === undefined ) {\r\n\t\t\t// get\r\n\t\t\tif ( ctx.length === 0 ) {\r\n\t\t\t\treturn undefined;\r\n\t\t\t}\r\n\t\t\tctx = ctx[0];\r\n\t\r\n\t\t\treturn ctx.ajax ?\r\n\t\t\t\t$.isPlainObject( ctx.ajax ) ?\r\n\t\t\t\t\tctx.ajax.url :\r\n\t\t\t\t\tctx.ajax :\r\n\t\t\t\tctx.sAjaxSource;\r\n\t\t}\r\n\t\r\n\t\t// set\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\tif ( $.isPlainObject( settings.ajax ) ) {\r\n\t\t\t\tsettings.ajax.url = url;\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tsettings.ajax = url;\r\n\t\t\t}\r\n\t\t\t// No need to consider sAjaxSource here since DataTables gives priority\r\n\t\t\t// to `ajax` over `sAjaxSource`. So setting `ajax` here, renders any\r\n\t\t\t// value of `sAjaxSource` redundant.\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Load data from the newly set Ajax URL. Note that this method is only\r\n\t * available when `ajax.url()` is used to set a URL. Additionally, this method\r\n\t * has the same effect as calling `ajax.reload()` but is provided for\r\n\t * convenience when setting a new URL. Like `ajax.reload()` it will\r\n\t * automatically redraw the table once the remote data has been loaded.\r\n\t *\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.url().load()', function ( callback, resetPaging ) {\r\n\t\t// Same as a reload, but makes sense to present it for easy access after a\r\n\t\t// url change\r\n\t\treturn this.iterator( 'table', function ( ctx ) {\r\n\t\t\t__reload( ctx, resetPaging===false, callback );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\t\r\n\tvar _selector_run = function ( type, selector, selectFn, settings, opts )\r\n\t{\r\n\t\tvar\r\n\t\t\tout = [], res,\r\n\t\t\ta, i, ien, j, jen,\r\n\t\t\tselectorType = typeof selector;\r\n\t\r\n\t\t// Can't just check for isArray here, as an API or jQuery instance might be\r\n\t\t// given with their array like look\r\n\t\tif ( ! selector || selectorType === 'string' || selectorType === 'function' || selector.length === undefined ) {\r\n\t\t\tselector = [ selector ];\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, ien=selector.length ; i 0 ) {\r\n\t\t\t\t// Assign the first element to the first item in the instance\r\n\t\t\t\t// and truncate the instance and context\r\n\t\t\t\tinst[0] = inst[i];\r\n\t\t\t\tinst[0].length = 1;\r\n\t\t\t\tinst.length = 1;\r\n\t\t\t\tinst.context = [ inst.context[i] ];\r\n\t\r\n\t\t\t\treturn inst;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t// Not found - return an empty instance\r\n\t\tinst.length = 0;\r\n\t\treturn inst;\r\n\t};\r\n\t\r\n\t\r\n\tvar _selector_row_indexes = function ( settings, opts )\r\n\t{\r\n\t\tvar\r\n\t\t\ti, ien, tmp, a=[],\r\n\t\t\tdisplayFiltered = settings.aiDisplay,\r\n\t\t\tdisplayMaster = settings.aiDisplayMaster;\r\n\t\r\n\t\tvar\r\n\t\t\tsearch = opts.search, // none, applied, removed\r\n\t\t\torder = opts.order, // applied, current, index (original - compatibility with 1.9)\r\n\t\t\tpage = opts.page; // all, current\r\n\t\r\n\t\tif ( _fnDataSource( settings ) == 'ssp' ) {\r\n\t\t\t// In server-side processing mode, most options are irrelevant since\r\n\t\t\t// rows not shown don't exist and the index order is the applied order\r\n\t\t\t// Removed is a special case - for consistency just return an empty\r\n\t\t\t// array\r\n\t\t\treturn search === 'removed' ?\r\n\t\t\t\t[] :\r\n\t\t\t\t_range( 0, displayMaster.length );\r\n\t\t}\r\n\t\telse if ( page == 'current' ) {\r\n\t\t\t// Current page implies that order=current and fitler=applied, since it is\r\n\t\t\t// fairly senseless otherwise, regardless of what order and search actually\r\n\t\t\t// are\r\n\t\t\tfor ( i=settings._iDisplayStart, ien=settings.fnDisplayEnd() ; i= 0 && search == 'applied') )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\ta.push( i );\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn a;\r\n\t};\r\n\t\r\n\t\r\n\t/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\r\n\t * Rows\r\n\t *\r\n\t * {} - no selector - use all available rows\r\n\t * {integer} - row aoData index\r\n\t * {node} - TR node\r\n\t * {string} - jQuery selector to apply to the TR elements\r\n\t * {array} - jQuery array of nodes, or simply an array of TR nodes\r\n\t *\r\n\t */\r\n\t\r\n\t\r\n\tvar __row_selector = function ( settings, selector, opts )\r\n\t{\r\n\t\tvar rows;\r\n\t\tvar run = function ( sel ) {\r\n\t\t\tvar selInt = _intVal( sel );\r\n\t\t\tvar i, ien;\r\n\t\r\n\t\t\t// Short cut - selector is a number and no options provided (default is\r\n\t\t\t// all records, so no need to check if the index is in there, since it\r\n\t\t\t// must be - dev error if the index doesn't exist).\r\n\t\t\tif ( selInt !== null && ! opts ) {\r\n\t\t\t\treturn [ selInt ];\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( ! rows ) {\r\n\t\t\t\trows = _selector_row_indexes( settings, opts );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( selInt !== null && $.inArray( selInt, rows ) !== -1 ) {\r\n\t\t\t\t// Selector - integer\r\n\t\t\t\treturn [ selInt ];\r\n\t\t\t}\r\n\t\t\telse if ( sel === null || sel === undefined || sel === '' ) {\r\n\t\t\t\t// Selector - none\r\n\t\t\t\treturn rows;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector - function\r\n\t\t\tif ( typeof sel === 'function' ) {\r\n\t\t\t\treturn $.map( rows, function (idx) {\r\n\t\t\t\t\tvar row = settings.aoData[ idx ];\r\n\t\t\t\t\treturn sel( idx, row._aData, row.nTr ) ? idx : null;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Get nodes in the order from the `rows` array with null values removed\r\n\t\t\tvar nodes = _removeEmpty(\r\n\t\t\t\t_pluck_order( settings.aoData, rows, 'nTr' )\r\n\t\t\t);\r\n\t\r\n\t\t\t// Selector - node\r\n\t\t\tif ( sel.nodeName ) {\r\n\t\t\t\tif ( sel._DT_RowIndex !== undefined ) {\r\n\t\t\t\t\treturn [ sel._DT_RowIndex ]; // Property added by DT for fast lookup\r\n\t\t\t\t}\r\n\t\t\t\telse if ( sel._DT_CellIndex ) {\r\n\t\t\t\t\treturn [ sel._DT_CellIndex.row ];\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tvar host = $(sel).closest('*[data-dt-row]');\r\n\t\t\t\t\treturn host.length ?\r\n\t\t\t\t\t\t[ host.data('dt-row') ] :\r\n\t\t\t\t\t\t[];\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// ID selector. Want to always be able to select rows by id, regardless\r\n\t\t\t// of if the tr element has been created or not, so can't rely upon\r\n\t\t\t// jQuery here - hence a custom implementation. This does not match\r\n\t\t\t// Sizzle's fast selector or HTML4 - in HTML5 the ID can be anything,\r\n\t\t\t// but to select it using a CSS selector engine (like Sizzle or\r\n\t\t\t// querySelect) it would need to need to be escaped for some characters.\r\n\t\t\t// DataTables simplifies this for row selectors since you can select\r\n\t\t\t// only a row. A # indicates an id any anything that follows is the id -\r\n\t\t\t// unescaped.\r\n\t\t\tif ( typeof sel === 'string' && sel.charAt(0) === '#' ) {\r\n\t\t\t\t// get row index from id\r\n\t\t\t\tvar rowObj = settings.aIds[ sel.replace( /^#/, '' ) ];\r\n\t\t\t\tif ( rowObj !== undefined ) {\r\n\t\t\t\t\treturn [ rowObj.idx ];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t// need to fall through to jQuery in case there is DOM id that\r\n\t\t\t\t// matches\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector - jQuery selector string, array of nodes or jQuery object/\r\n\t\t\t// As jQuery's .filter() allows jQuery objects to be passed in filter,\r\n\t\t\t// it also allows arrays, so this will cope with all three options\r\n\t\t\treturn $(nodes)\r\n\t\t\t\t.filter( sel )\r\n\t\t\t\t.map( function () {\r\n\t\t\t\t\treturn this._DT_RowIndex;\r\n\t\t\t\t} )\r\n\t\t\t\t.toArray();\r\n\t\t};\r\n\t\r\n\t\treturn _selector_run( 'row', selector, run, settings, opts );\r\n\t};\r\n\t\r\n\t\r\n\t_api_register( 'rows()', function ( selector, opts ) {\r\n\t\t// argument shifting\r\n\t\tif ( selector === undefined ) {\r\n\t\t\tselector = '';\r\n\t\t}\r\n\t\telse if ( $.isPlainObject( selector ) ) {\r\n\t\t\topts = selector;\r\n\t\t\tselector = '';\r\n\t\t}\r\n\t\r\n\t\topts = _selector_opts( opts );\r\n\t\r\n\t\tvar inst = this.iterator( 'table', function ( settings ) {\r\n\t\t\treturn __row_selector( settings, selector, opts );\r\n\t\t}, 1 );\r\n\t\r\n\t\t// Want argument shifting here and in __row_selector?\r\n\t\tinst.selector.rows = selector;\r\n\t\tinst.selector.opts = opts;\r\n\t\r\n\t\treturn inst;\r\n\t} );\r\n\t\r\n\t_api_register( 'rows().nodes()', function () {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\treturn settings.aoData[ row ].nTr || undefined;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_register( 'rows().data()', function () {\r\n\t\treturn this.iterator( true, 'rows', function ( settings, rows ) {\r\n\t\t\treturn _pluck_order( settings.aoData, rows, '_aData' );\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().cache()', 'row().cache()', function ( type ) {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\tvar r = settings.aoData[ row ];\r\n\t\t\treturn type === 'search' ? r._aFilterData : r._aSortData;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().invalidate()', 'row().invalidate()', function ( src ) {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\t_fnInvalidate( settings, row, src );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().indexes()', 'row().index()', function () {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\treturn row;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().ids()', 'row().id()', function ( hash ) {\r\n\t\tvar a = [];\r\n\t\tvar context = this.context;\r\n\t\r\n\t\t// `iterator` will drop undefined values, but in this case we want them\r\n\t\tfor ( var i=0, ien=context.length ; i 0 ) {\r\n\t\t\t\tsettings._iRecordsDisplay--;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Check for an 'overflow' they case for displaying the table\r\n\t\t\t_fnLengthOverflow( settings );\r\n\t\r\n\t\t\t// Remove the row's ID reference if there is one\r\n\t\t\tvar id = settings.rowIdFn( rowData._aData );\r\n\t\t\tif ( id !== undefined ) {\r\n\t\t\t\tdelete settings.aIds[ id ];\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\tthis.iterator( 'table', function ( settings ) {\r\n\t\t\tfor ( var i=0, ien=settings.aoData.length ; i | ').addClass( k );\r\n\t\t\t\t$('td', created)\r\n\t\t\t\t\t.addClass( k )\r\n\t\t\t\t\t.html( r )\r\n\t\t\t\t\t[0].colSpan = _fnVisbleColumns( ctx );\r\n\t\r\n\t\t\t\trows.push( created[0] );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\taddRow( data, klass );\r\n\t\r\n\t\tif ( row._details ) {\r\n\t\t\trow._details.detach();\r\n\t\t}\r\n\t\r\n\t\trow._details = $(rows);\r\n\t\r\n\t\t// If the children were already shown, that state should be retained\r\n\t\tif ( row._detailsShow ) {\r\n\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_remove = function ( api, idx )\r\n\t{\r\n\t\tvar ctx = api.context;\r\n\t\r\n\t\tif ( ctx.length ) {\r\n\t\t\tvar row = ctx[0].aoData[ idx !== undefined ? idx : api[0] ];\r\n\t\r\n\t\t\tif ( row && row._details ) {\r\n\t\t\t\trow._details.remove();\r\n\t\r\n\t\t\t\trow._detailsShow = undefined;\r\n\t\t\t\trow._details = undefined;\r\n\t\t\t}\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_display = function ( api, show ) {\r\n\t\tvar ctx = api.context;\r\n\t\r\n\t\tif ( ctx.length && api.length ) {\r\n\t\t\tvar row = ctx[0].aoData[ api[0] ];\r\n\t\r\n\t\t\tif ( row._details ) {\r\n\t\t\t\trow._detailsShow = show;\r\n\t\r\n\t\t\t\tif ( show ) {\r\n\t\t\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\trow._details.detach();\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t__details_events( ctx[0] );\r\n\t\t\t}\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_events = function ( settings )\r\n\t{\r\n\t\tvar api = new _Api( settings );\r\n\t\tvar namespace = '.dt.DT_details';\r\n\t\tvar drawEvent = 'draw'+namespace;\r\n\t\tvar colvisEvent = 'column-visibility'+namespace;\r\n\t\tvar destroyEvent = 'destroy'+namespace;\r\n\t\tvar data = settings.aoData;\r\n\t\r\n\t\tapi.off( drawEvent +' '+ colvisEvent +' '+ destroyEvent );\r\n\t\r\n\t\tif ( _pluck( data, '_details' ).length > 0 ) {\r\n\t\t\t// On each draw, insert the required elements into the document\r\n\t\t\tapi.on( drawEvent, function ( e, ctx ) {\r\n\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\treturn;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tapi.rows( {page:'current'} ).eq(0).each( function (idx) {\r\n\t\t\t\t\t// Internal data grab\r\n\t\t\t\t\tvar row = data[ idx ];\r\n\t\r\n\t\t\t\t\tif ( row._detailsShow ) {\r\n\t\t\t\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t\t\t\t}\r\n\t\t\t\t} );\r\n\t\t\t} );\r\n\t\r\n\t\t\t// Column visibility change - update the colspan\r\n\t\t\tapi.on( colvisEvent, function ( e, ctx, idx, vis ) {\r\n\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\treturn;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t// Update the colspan for the details rows (note, only if it already has\r\n\t\t\t\t// a colspan)\r\n\t\t\t\tvar row, visible = _fnVisbleColumns( ctx );\r\n\t\r\n\t\t\t\tfor ( var i=0, ien=data.length ; i=0 count from left, <0 count from right)\r\n\t * \"{integer}:visIdx\" - visible column index (i.e. translate to column index) (>=0 count from left, <0 count from right)\r\n\t * \"{integer}:visible\" - alias for {integer}:visIdx (>=0 count from left, <0 count from right)\r\n\t * \"{string}:name\" - column name\r\n\t * \"{string}\" - jQuery selector on column header nodes\r\n\t *\r\n\t */\r\n\t\r\n\t// can be an array of these items, comma separated list, or an array of comma\r\n\t// separated lists\r\n\t\r\n\tvar __re_column_selector = /^([^:]+):(name|visIdx|visible)$/;\r\n\t\r\n\t\r\n\t// r1 and r2 are redundant - but it means that the parameters match for the\r\n\t// iterator callback in columns().data()\r\n\tvar __columnData = function ( settings, column, r1, r2, rows ) {\r\n\t\tvar a = [];\r\n\t\tfor ( var row=0, ien=rows.length ; row= 0 ?\r\n\t\t\t\t\tselInt : // Count from left\r\n\t\t\t\t\tcolumns.length + selInt // Count from right (+ because its a negative value)\r\n\t\t\t\t];\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector = function\r\n\t\t\tif ( typeof s === 'function' ) {\r\n\t\t\t\tvar rows = _selector_row_indexes( settings, opts );\r\n\t\r\n\t\t\t\treturn $.map( columns, function (col, idx) {\r\n\t\t\t\t\treturn s(\r\n\t\t\t\t\t\t\tidx,\r\n\t\t\t\t\t\t\t__columnData( settings, idx, 0, 0, rows ),\r\n\t\t\t\t\t\t\tnodes[ idx ]\r\n\t\t\t\t\t\t) ? idx : null;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// jQuery or string selector\r\n\t\t\tvar match = typeof s === 'string' ?\r\n\t\t\t\ts.match( __re_column_selector ) :\r\n\t\t\t\t'';\r\n\t\r\n\t\t\tif ( match ) {\r\n\t\t\t\tswitch( match[2] ) {\r\n\t\t\t\t\tcase 'visIdx':\r\n\t\t\t\t\tcase 'visible':\r\n\t\t\t\t\t\tvar idx = parseInt( match[1], 10 );\r\n\t\t\t\t\t\t// Visible index given, convert to column index\r\n\t\t\t\t\t\tif ( idx < 0 ) {\r\n\t\t\t\t\t\t\t// Counting from the right\r\n\t\t\t\t\t\t\tvar visColumns = $.map( columns, function (col,i) {\r\n\t\t\t\t\t\t\t\treturn col.bVisible ? i : null;\r\n\t\t\t\t\t\t\t} );\r\n\t\t\t\t\t\t\treturn [ visColumns[ visColumns.length + idx ] ];\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t\t// Counting from the left\r\n\t\t\t\t\t\treturn [ _fnVisibleToColumnIndex( settings, idx ) ];\r\n\t\r\n\t\t\t\t\tcase 'name':\r\n\t\t\t\t\t\t// match by name. `names` is column index complete and in order\r\n\t\t\t\t\t\treturn $.map( names, function (name, i) {\r\n\t\t\t\t\t\t\treturn name === match[1] ? i : null;\r\n\t\t\t\t\t\t} );\r\n\t\r\n\t\t\t\t\tdefault:\r\n\t\t\t\t\t\treturn [];\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// Cell in the table body\r\n\t\t\tif ( s.nodeName && s._DT_CellIndex ) {\r\n\t\t\t\treturn [ s._DT_CellIndex.column ];\r\n\t\t\t}\r\n\t\r\n\t\t\t// jQuery selector on the TH elements for the columns\r\n\t\t\tvar jqResult = $( nodes )\r\n\t\t\t\t.filter( s )\r\n\t\t\t\t.map( function () {\r\n\t\t\t\t\treturn $.inArray( this, nodes ); // `nodes` is column index complete and in order\r\n\t\t\t\t} )\r\n\t\t\t\t.toArray();\r\n\t\r\n\t\t\tif ( jqResult.length || ! s.nodeName ) {\r\n\t\t\t\treturn jqResult;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Otherwise a node which might have a `dt-column` data attribute, or be\r\n\t\t\t// a child or such an element\r\n\t\t\tvar host = $(s).closest('*[data-dt-column]');\r\n\t\t\treturn host.length ?\r\n\t\t\t\t[ host.data('dt-column') ] :\r\n\t\t\t\t[];\r\n\t\t};\r\n\t\r\n\t\treturn _selector_run( 'column', selector, run, settings, opts );\r\n\t};\r\n\t\r\n\t\r\n\tvar __setColumnVis = function ( settings, column, vis ) {\r\n\t\tvar\r\n\t\t\tcols = settings.aoColumns,\r\n\t\t\tcol = cols[ column ],\r\n\t\t\tdata = settings.aoData,\r\n\t\t\trow, cells, i, ien, tr;\r\n\t\r\n\t\t// Get\r\n\t\tif ( vis === undefined ) {\r\n\t\t\treturn col.bVisible;\r\n\t\t}\r\n\t\r\n\t\t// Set\r\n\t\t// No change\r\n\t\tif ( col.bVisible === vis ) {\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tif ( vis ) {\r\n\t\t\t// Insert column\r\n\t\t\t// Need to decide if we should use appendChild or insertBefore\r\n\t\t\tvar insertBefore = $.inArray( true, _pluck(cols, 'bVisible'), column+1 );\r\n\t\r\n\t\t\tfor ( i=0, ien=data.length ; i iThat;\r\n\t\t}\r\n\t\r\n\t\treturn true;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Check if a `` node is a DataTable table already or not.\r\n\t *\r\n\t * @param {node|jquery|string} table Table node, jQuery object or jQuery\r\n\t * selector for the table to test. Note that if more than more than one\r\n\t * table is passed on, only the first will be checked\r\n\t * @returns {boolean} true the table given is a DataTable, or false otherwise\r\n\t * @static\r\n\t * @dtopt API-Static\r\n\t *\r\n\t * @example\r\n\t * if ( ! $.fn.DataTable.isDataTable( '#example' ) ) {\r\n\t * $('#example').dataTable();\r\n\t * }\r\n\t */\r\n\tDataTable.isDataTable = DataTable.fnIsDataTable = function ( table )\r\n\t{\r\n\t\tvar t = $(table).get(0);\r\n\t\tvar is = false;\r\n\t\r\n\t\tif ( table instanceof DataTable.Api ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\t$.each( DataTable.settings, function (i, o) {\r\n\t\t\tvar head = o.nScrollHead ? $('table', o.nScrollHead)[0] : null;\r\n\t\t\tvar foot = o.nScrollFoot ? $('table', o.nScrollFoot)[0] : null;\r\n\t\r\n\t\t\tif ( o.nTable === t || head === t || foot === t ) {\r\n\t\t\t\tis = true;\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn is;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Get all DataTable tables that have been initialised - optionally you can\r\n\t * select to get only currently visible tables.\r\n\t *\r\n\t * @param {boolean} [visible=false] Flag to indicate if you want all (default)\r\n\t * or visible tables only.\r\n\t * @returns {array} Array of `table` nodes (not DataTable instances) which are\r\n\t * DataTables\r\n\t * @static\r\n\t * @dtopt API-Static\r\n\t *\r\n\t * @example\r\n\t * $.each( $.fn.dataTable.tables(true), function () {\r\n\t * $(table).DataTable().columns.adjust();\r\n\t * } );\r\n\t */\r\n\tDataTable.tables = DataTable.fnTables = function ( visible )\r\n\t{\r\n\t\tvar api = false;\r\n\t\r\n\t\tif ( $.isPlainObject( visible ) ) {\r\n\t\t\tapi = visible.api;\r\n\t\t\tvisible = visible.visible;\r\n\t\t}\r\n\t\r\n\t\tvar a = $.map( DataTable.settings, function (o) {\r\n\t\t\tif ( !visible || (visible && $(o.nTable).is(':visible')) ) {\r\n\t\t\t\treturn o.nTable;\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn api ?\r\n\t\t\tnew _Api( a ) :\r\n\t\t\ta;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Convert from camel case parameters to Hungarian notation. This is made public\r\n\t * for the extensions to provide the same ability as DataTables core to accept\r\n\t * either the 1.9 style Hungarian notation, or the 1.10+ style camelCase\r\n\t * parameters.\r\n\t *\r\n\t * @param {object} src The model object which holds all parameters that can be\r\n\t * mapped.\r\n\t * @param {object} user The object to convert from camel case to Hungarian.\r\n\t * @param {boolean} force When set to `true`, properties which already have a\r\n\t * Hungarian value in the `user` object will be overwritten. Otherwise they\r\n\t * won't be.\r\n\t */\r\n\tDataTable.camelToHungarian = _fnCamelToHungarian;\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t *\r\n\t */\r\n\t_api_register( '$()', function ( selector, opts ) {\r\n\t\tvar\r\n\t\t\trows = this.rows( opts ).nodes(), // Get all rows\r\n\t\t\tjqRows = $(rows);\r\n\t\r\n\t\treturn $( [].concat(\r\n\t\t\tjqRows.filter( selector ).toArray(),\r\n\t\t\tjqRows.find( selector ).toArray()\r\n\t\t) );\r\n\t} );\r\n\t\r\n\t\r\n\t// jQuery functions to operate on the tables\r\n\t$.each( [ 'on', 'one', 'off' ], function (i, key) {\r\n\t\t_api_register( key+'()', function ( /* event, handler */ ) {\r\n\t\t\tvar args = Array.prototype.slice.call(arguments);\r\n\t\r\n\t\t\t// Add the `dt` namespace automatically if it isn't already present\r\n\t\t\targs[0] = $.map( args[0].split( /\\s/ ), function ( e ) {\r\n\t\t\t\treturn ! e.match(/\\.dt\\b/) ?\r\n\t\t\t\t\te+'.dt' :\r\n\t\t\t\t\te;\r\n\t\t\t\t} ).join( ' ' );\r\n\t\r\n\t\t\tvar inst = $( this.tables().nodes() );\r\n\t\t\tinst[key].apply( inst, args );\r\n\t\t\treturn this;\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'clear()', function () {\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\t_fnClearTable( settings );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'settings()', function () {\r\n\t\treturn new _Api( this.context, this.context );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'init()', function () {\r\n\t\tvar ctx = this.context;\r\n\t\treturn ctx.length ? ctx[0].oInit : null;\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'data()', function () {\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\treturn _pluck( settings.aoData, '_aData' );\r\n\t\t} ).flatten();\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'destroy()', function ( remove ) {\r\n\t\tremove = remove || false;\r\n\t\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\tvar orig = settings.nTableWrapper.parentNode;\r\n\t\t\tvar classes = settings.oClasses;\r\n\t\t\tvar table = settings.nTable;\r\n\t\t\tvar tbody = settings.nTBody;\r\n\t\t\tvar thead = settings.nTHead;\r\n\t\t\tvar tfoot = settings.nTFoot;\r\n\t\t\tvar jqTable = $(table);\r\n\t\t\tvar jqTbody = $(tbody);\r\n\t\t\tvar jqWrapper = $(settings.nTableWrapper);\r\n\t\t\tvar rows = $.map( settings.aoData, function (r) { return r.nTr; } );\r\n\t\t\tvar i, ien;\r\n\t\r\n\t\t\t// Flag to note that the table is currently being destroyed - no action\r\n\t\t\t// should be taken\r\n\t\t\tsettings.bDestroying = true;\r\n\t\r\n\t\t\t// Fire off the destroy callbacks for plug-ins etc\r\n\t\t\t_fnCallbackFire( settings, \"aoDestroyCallback\", \"destroy\", [settings] );\r\n\t\r\n\t\t\t// If not being removed from the document, make all columns visible\r\n\t\t\tif ( ! remove ) {\r\n\t\t\t\tnew _Api( settings ).columns().visible( true );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Blitz all `DT` namespaced events (these are internal events, the\r\n\t\t\t// lowercase, `dt` events are user subscribed and they are responsible\r\n\t\t\t// for removing them\r\n\t\t\tjqWrapper.off('.DT').find(':not(tbody *)').off('.DT');\r\n\t\t\t$(window).off('.DT-'+settings.sInstance);\r\n\t\r\n\t\t\t// When scrolling we had to break the table up - restore it\r\n\t\t\tif ( table != thead.parentNode ) {\r\n\t\t\t\tjqTable.children('thead').detach();\r\n\t\t\t\tjqTable.append( thead );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( tfoot && table != tfoot.parentNode ) {\r\n\t\t\t\tjqTable.children('tfoot').detach();\r\n\t\t\t\tjqTable.append( tfoot );\r\n\t\t\t}\r\n\t\r\n\t\t\tsettings.aaSorting = [];\r\n\t\t\tsettings.aaSortingFixed = [];\r\n\t\t\t_fnSortingClasses( settings );\r\n\t\r\n\t\t\t$( rows ).removeClass( settings.asStripeClasses.join(' ') );\r\n\t\r\n\t\t\t$('th, td', thead).removeClass( classes.sSortable+' '+\r\n\t\t\t\tclasses.sSortableAsc+' '+classes.sSortableDesc+' '+classes.sSortableNone\r\n\t\t\t);\r\n\t\r\n\t\t\t// Add the TR elements back into the table in their original order\r\n\t\t\tjqTbody.children().detach();\r\n\t\t\tjqTbody.append( rows );\r\n\t\r\n\t\t\t// Remove the DataTables generated nodes, events and classes\r\n\t\t\tvar removedMethod = remove ? 'remove' : 'detach';\r\n\t\t\tjqTable[ removedMethod ]();\r\n\t\t\tjqWrapper[ removedMethod ]();\r\n\t\r\n\t\t\t// If we need to reattach the table to the document\r\n\t\t\tif ( ! remove && orig ) {\r\n\t\t\t\t// insertBefore acts like appendChild if !arg[1]\r\n\t\t\t\torig.insertBefore( table, settings.nTableReinsertBefore );\r\n\t\r\n\t\t\t\t// Restore the width of the original table - was read from the style property,\r\n\t\t\t\t// so we can restore directly to that\r\n\t\t\t\tjqTable\r\n\t\t\t\t\t.css( 'width', settings.sDestroyWidth )\r\n\t\t\t\t\t.removeClass( classes.sTable );\r\n\t\r\n\t\t\t\t// If the were originally stripe classes - then we add them back here.\r\n\t\t\t\t// Note this is not fool proof (for example if not all rows had stripe\r\n\t\t\t\t// classes - but it's a good effort without getting carried away\r\n\t\t\t\tien = settings.asDestroyStripes.length;\r\n\t\r\n\t\t\t\tif ( ien ) {\r\n\t\t\t\t\tjqTbody.children().each( function (i) {\r\n\t\t\t\t\t\t$(this).addClass( settings.asDestroyStripes[i % ien] );\r\n\t\t\t\t\t} );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t/* Remove the settings object from the settings array */\r\n\t\t\tvar idx = $.inArray( settings, DataTable.settings );\r\n\t\t\tif ( idx !== -1 ) {\r\n\t\t\t\tDataTable.settings.splice( idx, 1 );\r\n\t\t\t}\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t// Add the `every()` method for rows, columns and cells in a compact form\r\n\t$.each( [ 'column', 'row', 'cell' ], function ( i, type ) {\r\n\t\t_api_register( type+'s().every()', function ( fn ) {\r\n\t\t\tvar opts = this.selector.opts;\r\n\t\t\tvar api = this;\r\n\t\r\n\t\t\treturn this.iterator( type, function ( settings, arg1, arg2, arg3, arg4 ) {\r\n\t\t\t\t// Rows and columns:\r\n\t\t\t\t// arg1 - index\r\n\t\t\t\t// arg2 - table counter\r\n\t\t\t\t// arg3 - loop counter\r\n\t\t\t\t// arg4 - undefined\r\n\t\t\t\t// Cells:\r\n\t\t\t\t// arg1 - row index\r\n\t\t\t\t// arg2 - column index\r\n\t\t\t\t// arg3 - table counter\r\n\t\t\t\t// arg4 - loop counter\r\n\t\t\t\tfn.call(\r\n\t\t\t\t\tapi[ type ](\r\n\t\t\t\t\t\targ1,\r\n\t\t\t\t\t\ttype==='cell' ? arg2 : opts,\r\n\t\t\t\t\t\ttype==='cell' ? opts : undefined\r\n\t\t\t\t\t),\r\n\t\t\t\t\targ1, arg2, arg3, arg4\r\n\t\t\t\t);\r\n\t\t\t} );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t// i18n method for extensions to be able to use the language object from the\r\n\t// DataTable\r\n\t_api_register( 'i18n()', function ( token, def, plural ) {\r\n\t\tvar ctx = this.context[0];\r\n\t\tvar resolved = _fnGetObjectDataFn( token )( ctx.oLanguage );\r\n\t\r\n\t\tif ( resolved === undefined ) {\r\n\t\t\tresolved = def;\r\n\t\t}\r\n\t\r\n\t\tif ( plural !== undefined && $.isPlainObject( resolved ) ) {\r\n\t\t\tresolved = resolved[ plural ] !== undefined ?\r\n\t\t\t\tresolved[ plural ] :\r\n\t\t\t\tresolved._;\r\n\t\t}\r\n\t\r\n\t\treturn resolved.replace( '%d', plural ); // nb: plural might be undefined,\r\n\t} );\r\n\r\n\t/**\r\n\t * Version string for plug-ins to check compatibility. Allowed format is\r\n\t * `a.b.c-d` where: a:int, b:int, c:int, d:string(dev|beta|alpha). `d` is used\r\n\t * only for non-release builds. See http://semver.org/ for more information.\r\n\t * @member\r\n\t * @type string\r\n\t * @default Version number\r\n\t */\r\n\tDataTable.version = \"1.10.16\";\r\n\r\n\t/**\r\n\t * Private data store, containing all of the settings objects that are\r\n\t * created for the tables on a given page.\r\n\t *\r\n\t * Note that the `DataTable.settings` object is aliased to\r\n\t * `jQuery.fn.dataTableExt` through which it may be accessed and\r\n\t * manipulated, or `jQuery.fn.dataTable.settings`.\r\n\t * @member\r\n\t * @type array\r\n\t * @default []\r\n\t * @private\r\n\t */\r\n\tDataTable.settings = [];\r\n\r\n\t/**\r\n\t * Object models container, for the various models that DataTables has\r\n\t * available to it. These models define the objects that are used to hold\r\n\t * the active state and configuration of the table.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models = {};\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the way in which DataTables holds information about\r\n\t * search information for the global filter and individual column filters.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oSearch = {\r\n\t\t/**\r\n\t\t * Flag to indicate if the filtering should be case insensitive or not\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bCaseInsensitive\": true,\r\n\t\r\n\t\t/**\r\n\t\t * Applied search term\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t */\r\n\t\t\"sSearch\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the search term should be interpreted as a\r\n\t\t * regular expression (true) or not (false) and therefore and special\r\n\t\t * regex characters escaped.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bRegex\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if DataTables is to use its smart filtering or not.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bSmart\": true\r\n\t};\r\n\t\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the way in which DataTables holds information about\r\n\t * each individual row. This is the object format used for the settings\r\n\t * aoData array.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oRow = {\r\n\t\t/**\r\n\t\t * TR element for the row\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTr\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Array of TD elements for each row. This is null until the row has been\r\n\t\t * created.\r\n\t\t * @type array nodes\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"anCells\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Data object from the original data source for the row. This is either\r\n\t\t * an array if using the traditional form of DataTables, or an object if\r\n\t\t * using mData options. The exact type will depend on the passed in\r\n\t\t * data from the data source, or will be an array if using DOM a data\r\n\t\t * source.\r\n\t\t * @type array|object\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"_aData\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Sorting data cache - this array is ostensibly the same length as the\r\n\t\t * number of columns (although each index is generated only as it is\r\n\t\t * needed), and holds the data that is used for sorting each column in the\r\n\t\t * row. We do this cache generation at the start of the sort in order that\r\n\t\t * the formatting of the sort data need be done only once for each cell\r\n\t\t * per sort. This array should not be read from or written to by anything\r\n\t\t * other than the master sorting methods.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_aSortData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Per cell filtering data cache. As per the sort data cache, used to\r\n\t\t * increase the performance of the filtering in DataTables\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_aFilterData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Filtering data cache. This is the same as the cell filtering cache, but\r\n\t\t * in this case a string rather than an array. This is easily computed with\r\n\t\t * a join on `_aFilterData`, but is provided as a cache so the join isn't\r\n\t\t * needed on every search (memory traded for performance)\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sFilterRow\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Cache of the class name that DataTables has applied to the row, so we\r\n\t\t * can quickly look at this variable rather than needing to do a DOM check\r\n\t\t * on className for the nTr property.\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sRowStripe\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * Denote if the original data source was from the DOM, or the data source\r\n\t\t * object. This is used for invalidating data, so DataTables can\r\n\t\t * automatically read data from the original source, unless uninstructed\r\n\t\t * otherwise.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"src\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Index in the aoData array. This saves an indexOf lookup when we have the\r\n\t\t * object, but want to know the index\r\n\t\t * @type integer\r\n\t\t * @default -1\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"idx\": -1\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the column information object in DataTables. This object\r\n\t * is held in the settings aoColumns array and contains all the information that\r\n\t * DataTables needs about each individual column.\r\n\t *\r\n\t * Note that this object is related to {@link DataTable.defaults.column}\r\n\t * but this one is the internal data store for DataTables's cache of columns.\r\n\t * It should NOT be manipulated outside of DataTables. Any configuration should\r\n\t * be done through the initialisation options.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oColumn = {\r\n\t\t/**\r\n\t\t * Column index. This could be worked out on-the-fly with $.inArray, but it\r\n\t\t * is faster to just hold it as a variable\r\n\t\t * @type integer\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"idx\": null,\r\n\t\r\n\t\t/**\r\n\t\t * A list of the columns that sorting should occur on when this column\r\n\t\t * is sorted. That this property is an array allows multi-column sorting\r\n\t\t * to be defined for a column (for example first name / last name columns\r\n\t\t * would benefit from this). The values are integers pointing to the\r\n\t\t * columns to be sorted on (typically it will be a single integer pointing\r\n\t\t * at itself, but that doesn't need to be the case).\r\n\t\t * @type array\r\n\t\t */\r\n\t\t\"aDataSort\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Define the sorting directions that are applied to the column, in sequence\r\n\t\t * as the column is repeatedly sorted upon - i.e. the first value is used\r\n\t\t * as the sorting direction when the column if first sorted (clicked on).\r\n\t\t * Sort it again (click again) and it will move on to the next index.\r\n\t\t * Repeat until loop.\r\n\t\t * @type array\r\n\t\t */\r\n\t\t\"asSorting\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is searchable, and thus should be included\r\n\t\t * in the filtering or not.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSearchable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is sortable or not.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSortable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is currently visible in the table or not\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bVisible\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Store for manual type assignment using the `column.type` option. This\r\n\t\t * is held in store so we can manipulate the column's `sType` property.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sManualType\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if HTML5 data attributes should be used as the data\r\n\t\t * source for filtering or sorting. True is either are.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_bAttrSrc\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Developer definable function that is called whenever a cell is created (Ajax source,\r\n\t\t * etc) or processed for input (DOM source). This can be used as a compliment to mRender\r\n\t\t * allowing you to modify the DOM element (add background colour for example) when the\r\n\t\t * element is available.\r\n\t\t * @type function\r\n\t\t * @param {element} nTd The TD node that has been created\r\n\t\t * @param {*} sData The Data for the cell\r\n\t\t * @param {array|object} oData The data for the whole row\r\n\t\t * @param {int} iRow The row index for the aoData data store\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnCreatedCell\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Function to get data from a cell in a column. You should never\r\n\t\t * access data directly through _aData internally in DataTables - always use\r\n\t\t * the method attached to this property. It allows mData to function as\r\n\t\t * required. This function is automatically assigned by the column\r\n\t\t * initialisation method\r\n\t\t * @type function\r\n\t\t * @param {array|object} oData The data array/object for the array\r\n\t\t * (i.e. aoData[]._aData)\r\n\t\t * @param {string} sSpecific The specific data type you want to get -\r\n\t\t * 'display', 'type' 'filter' 'sort'\r\n\t\t * @returns {*} The data for the cell from the given row's data\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnGetData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Function to set data for a cell in the column. You should never\r\n\t\t * set the data directly to _aData internally in DataTables - always use\r\n\t\t * this method. It allows mData to function as required. This function\r\n\t\t * is automatically assigned by the column initialisation method\r\n\t\t * @type function\r\n\t\t * @param {array|object} oData The data array/object for the array\r\n\t\t * (i.e. aoData[]._aData)\r\n\t\t * @param {*} sValue Value to set\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnSetData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Property to read the value for the cells in the column from the data\r\n\t\t * source array / object. If null, then the default content is used, if a\r\n\t\t * function is given then the return from the function is used.\r\n\t\t * @type function|int|string|null\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"mData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Partner property to mData which is used (only when defined) to get\r\n\t\t * the data - i.e. it is basically the same as mData, but without the\r\n\t\t * 'set' option, and also the data fed to it is the result from mData.\r\n\t\t * This is the rendering method to match the data method of mData.\r\n\t\t * @type function|int|string|null\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"mRender\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique header TH/TD element for this column - this is what the sorting\r\n\t\t * listener is attached to (if sorting is enabled.)\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTh\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique footer TH/TD element for this column (if there is one). Not used\r\n\t\t * in DataTables as such, but can be used for plug-ins to reference the\r\n\t\t * footer for each column.\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTf\": null,\r\n\t\r\n\t\t/**\r\n\t\t * The class to apply to all TD elements in the table's TBODY for the column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sClass\": null,\r\n\t\r\n\t\t/**\r\n\t\t * When DataTables calculates the column widths to assign to each column,\r\n\t\t * it finds the longest string in each column and then constructs a\r\n\t\t * temporary table and reads the widths from that. The problem with this\r\n\t\t * is that \"mmm\" is much wider then \"iiii\", but the latter is a longer\r\n\t\t * string - thus the calculation can go wrong (doing it properly and putting\r\n\t\t * it into an DOM object and measuring that is horribly(!) slow). Thus as\r\n\t\t * a \"work around\" we provide this option. It will append its value to the\r\n\t\t * text that is found to be the longest string for the column - i.e. padding.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sContentPadding\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Allows a default value to be given for a column's data, and will be used\r\n\t\t * whenever a null data source is encountered (this can be because mData\r\n\t\t * is set to null, or because the data source itself is null).\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sDefaultContent\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Name for the column, allowing reference to the column by name as well as\r\n\t\t * by index (needs a lookup to work by name).\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sName\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Custom sorting data type - defines which of the available plug-ins in\r\n\t\t * afnSortData the custom sorting will use - if any is defined.\r\n\t\t * @type string\r\n\t\t * @default std\r\n\t\t */\r\n\t\t\"sSortDataType\": 'std',\r\n\t\r\n\t\t/**\r\n\t\t * Class to be applied to the header element when sorting on this column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sSortingClass\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Class to be applied to the header element when sorting on this column -\r\n\t\t * when jQuery UI theming is used.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sSortingClassJUI\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Title of the column - what is seen in the TH element (nTh).\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sTitle\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Column sorting and filtering type\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sType\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Width of the column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sWidth\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Width of the column when it was first \"encountered\"\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sWidthOrig\": null\r\n\t};\r\n\t\r\n\t\r\n\t/*\r\n\t * Developer note: The properties of the object below are given in Hungarian\r\n\t * notation, that was used as the interface for DataTables prior to v1.10, however\r\n\t * from v1.10 onwards the primary interface is camel case. In order to avoid\r\n\t * breaking backwards compatibility utterly with this change, the Hungarian\r\n\t * version is still, internally the primary interface, but is is not documented\r\n\t * - hence the @name tags in each doc comment. This allows a Javascript function\r\n\t * to create a map from Hungarian notation to camel case (going the other direction\r\n\t * would require each property to be listed, which would at around 3K to the size\r\n\t * of DataTables, while this method is about a 0.5K hit.\r\n\t *\r\n\t * Ultimately this does pave the way for Hungarian notation to be dropped\r\n\t * completely, but that is a massive amount of work and will break current\r\n\t * installs (therefore is on-hold until v2).\r\n\t */\r\n\t\r\n\t/**\r\n\t * Initialisation options that can be given to DataTables at initialisation\r\n\t * time.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.defaults = {\r\n\t\t/**\r\n\t\t * An array of data to use for the table, passed in at initialisation which\r\n\t\t * will be used in preference to any data which is already in the DOM. This is\r\n\t\t * particularly useful for constructing tables purely in Javascript, for\r\n\t\t * example with a custom Ajax call.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.data\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using a 2D array data source\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"data\": [\r\n\t\t * ['Trident', 'Internet Explorer 4.0', 'Win 95+', 4, 'X'],\r\n\t\t * ['Trident', 'Internet Explorer 5.0', 'Win 95+', 5, 'C'],\r\n\t\t * ],\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"Engine\" },\r\n\t\t * { \"title\": \"Browser\" },\r\n\t\t * { \"title\": \"Platform\" },\r\n\t\t * { \"title\": \"Version\" },\r\n\t\t * { \"title\": \"Grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using an array of objects as a data source (`data`)\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"data\": [\r\n\t\t * {\r\n\t\t * \"engine\": \"Trident\",\r\n\t\t * \"browser\": \"Internet Explorer 4.0\",\r\n\t\t * \"platform\": \"Win 95+\",\r\n\t\t * \"version\": 4,\r\n\t\t * \"grade\": \"X\"\r\n\t\t * },\r\n\t\t * {\r\n\t\t * \"engine\": \"Trident\",\r\n\t\t * \"browser\": \"Internet Explorer 5.0\",\r\n\t\t * \"platform\": \"Win 95+\",\r\n\t\t * \"version\": 5,\r\n\t\t * \"grade\": \"C\"\r\n\t\t * }\r\n\t\t * ],\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"Engine\", \"data\": \"engine\" },\r\n\t\t * { \"title\": \"Browser\", \"data\": \"browser\" },\r\n\t\t * { \"title\": \"Platform\", \"data\": \"platform\" },\r\n\t\t * { \"title\": \"Version\", \"data\": \"version\" },\r\n\t\t * { \"title\": \"Grade\", \"data\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aaData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * If ordering is enabled, then DataTables will perform a first pass sort on\r\n\t\t * initialisation. You can define which column(s) the sort is performed\r\n\t\t * upon, and the sorting direction, with this variable. The `sorting` array\r\n\t\t * should contain an array for each column to be sorted initially containing\r\n\t\t * the column's index and a direction string ('asc' or 'desc').\r\n\t\t * @type array\r\n\t\t * @default [[0,'asc']]\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.order\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Sort by 3rd column first, and then 4th column\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"order\": [[2,'asc'], [3,'desc']]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // No initial sorting\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"order\": []\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aaSorting\": [[0,'asc']],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter is basically identical to the `sorting` parameter, but\r\n\t\t * cannot be overridden by user interaction with the table. What this means\r\n\t\t * is that you could have a column (visible or hidden) which the sorting\r\n\t\t * will always be forced on first - any sorting after that (from the user)\r\n\t\t * will then be performed as required. This can be useful for grouping rows\r\n\t\t * together.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.orderFixed\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderFixed\": [[0,'asc']]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"aaSortingFixed\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables can be instructed to load data to display in the table from a\r\n\t\t * Ajax source. This option defines how that Ajax call is made and where to.\r\n\t\t *\r\n\t\t * The `ajax` property has three different modes of operation, depending on\r\n\t\t * how it is defined. These are:\r\n\t\t *\r\n\t\t * * `string` - Set the URL from where the data should be loaded from.\r\n\t\t * * `object` - Define properties for `jQuery.ajax`.\r\n\t\t * * `function` - Custom data get function\r\n\t\t *\r\n\t\t * `string`\r\n\t\t * --------\r\n\t\t *\r\n\t\t * As a string, the `ajax` property simply defines the URL from which\r\n\t\t * DataTables will load data.\r\n\t\t *\r\n\t\t * `object`\r\n\t\t * --------\r\n\t\t *\r\n\t\t * As an object, the parameters in the object are passed to\r\n\t\t * [jQuery.ajax](http://api.jquery.com/jQuery.ajax/) allowing fine control\r\n\t\t * of the Ajax request. DataTables has a number of default parameters which\r\n\t\t * you can override using this option. Please refer to the jQuery\r\n\t\t * documentation for a full description of the options available, although\r\n\t\t * the following parameters provide additional options in DataTables or\r\n\t\t * require special consideration:\r\n\t\t *\r\n\t\t * * `data` - As with jQuery, `data` can be provided as an object, but it\r\n\t\t * can also be used as a function to manipulate the data DataTables sends\r\n\t\t * to the server. The function takes a single parameter, an object of\r\n\t\t * parameters with the values that DataTables has readied for sending. An\r\n\t\t * object may be returned which will be merged into the DataTables\r\n\t\t * defaults, or you can add the items to the object that was passed in and\r\n\t\t * not return anything from the function. This supersedes `fnServerParams`\r\n\t\t * from DataTables 1.9-.\r\n\t\t *\r\n\t\t * * `dataSrc` - By default DataTables will look for the property `data` (or\r\n\t\t * `aaData` for compatibility with DataTables 1.9-) when obtaining data\r\n\t\t * from an Ajax source or for server-side processing - this parameter\r\n\t\t * allows that property to be changed. You can use Javascript dotted\r\n\t\t * object notation to get a data source for multiple levels of nesting, or\r\n\t\t * it my be used as a function. As a function it takes a single parameter,\r\n\t\t * the JSON returned from the server, which can be manipulated as\r\n\t\t * required, with the returned value being that used by DataTables as the\r\n\t\t * data source for the table. This supersedes `sAjaxDataProp` from\r\n\t\t * DataTables 1.9-.\r\n\t\t *\r\n\t\t * * `success` - Should not be overridden it is used internally in\r\n\t\t * DataTables. To manipulate / transform the data returned by the server\r\n\t\t * use `ajax.dataSrc`, or use `ajax` as a function (see below).\r\n\t\t *\r\n\t\t * `function`\r\n\t\t * ----------\r\n\t\t *\r\n\t\t * As a function, making the Ajax call is left up to yourself allowing\r\n\t\t * complete control of the Ajax request. Indeed, if desired, a method other\r\n\t\t * than Ajax could be used to obtain the required data, such as Web storage\r\n\t\t * or an AIR database.\r\n\t\t *\r\n\t\t * The function is given four parameters and no return is required. The\r\n\t\t * parameters are:\r\n\t\t *\r\n\t\t * 1. _object_ - Data to send to the server\r\n\t\t * 2. _function_ - Callback function that must be executed when the required\r\n\t\t * data has been obtained. That data should be passed into the callback\r\n\t\t * as the only parameter\r\n\t\t * 3. _object_ - DataTables settings object for the table\r\n\t\t *\r\n\t\t * Note that this supersedes `fnServerData` from DataTables 1.9-.\r\n\t\t *\r\n\t\t * @type string|object|function\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.ajax\r\n\t\t * @since 1.10.0\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax.\r\n\t\t * // Note DataTables expects data in the form `{ data: [ ...data... ] }` by default).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": \"data.json\"\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax, using `dataSrc` to change\r\n\t\t * // `data` to `tableData` (i.e. `{ tableData: [ ...data... ] }`)\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": \"tableData\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax, using `dataSrc` to read data\r\n\t\t * // from a plain array rather than an array in an object\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": \"\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Manipulate the data returned from the server - add a link to data\r\n\t\t * // (note this can, should, be done using `render` for the column - this\r\n\t\t * // is just a simple example of how the data can be manipulated).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": function ( json ) {\r\n\t\t * for ( var i=0, ien=json.length ; iView message';\r\n\t\t * }\r\n\t\t * return json;\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Add data to the request\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"data\": function ( d ) {\r\n\t\t * return {\r\n\t\t * \"extra_search\": $('#extra').val()\r\n\t\t * };\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Send request as POST\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"type\": \"POST\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get the data from localStorage (could interface with a form for\r\n\t\t * // adding, editing and removing rows).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": function (data, callback, settings) {\r\n\t\t * callback(\r\n\t\t * JSON.parse( localStorage.getItem('dataTablesData') )\r\n\t\t * );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"ajax\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter allows you to readily specify the entries in the length drop\r\n\t\t * down menu that DataTables shows when pagination is enabled. It can be\r\n\t\t * either a 1D array of options which will be used for both the displayed\r\n\t\t * option and the value, or a 2D array which will use the array in the first\r\n\t\t * position as the value, and the array in the second position as the\r\n\t\t * displayed options (useful for language strings such as 'All').\r\n\t\t *\r\n\t\t * Note that the `pageLength` property will be automatically set to the\r\n\t\t * first value given in this array, unless `pageLength` is also provided.\r\n\t\t * @type array\r\n\t\t * @default [ 10, 25, 50, 100 ]\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.lengthMenu\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"lengthMenu\": [[10, 25, 50, -1], [10, 25, 50, \"All\"]]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aLengthMenu\": [ 10, 25, 50, 100 ],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The `columns` option in the initialisation parameter allows you to define\r\n\t\t * details about the way individual columns behave. For a full list of\r\n\t\t * column options that can be set, please see\r\n\t\t * {@link DataTable.defaults.column}. Note that if you use `columns` to\r\n\t\t * define your columns, you must have an entry in the array for every single\r\n\t\t * column that you have in your table (these can be null if you don't which\r\n\t\t * to specify any options).\r\n\t\t * @member\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column\r\n\t\t */\r\n\t\t\"aoColumns\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Very similar to `columns`, `columnDefs` allows you to target a specific\r\n\t\t * column, multiple columns, or all columns, using the `targets` property of\r\n\t\t * each object in the array. This allows great flexibility when creating\r\n\t\t * tables, as the `columnDefs` arrays can be of any length, targeting the\r\n\t\t * columns you specifically want. `columnDefs` may use any of the column\r\n\t\t * options available: {@link DataTable.defaults.column}, but it _must_\r\n\t\t * have `targets` defined in each object in the array. Values in the `targets`\r\n\t\t * array may be:\r\n\t\t * \r\n\t\t * - a string - class name will be matched on the TH for the column
\r\n\t\t * - 0 or a positive integer - column index counting from the left
\r\n\t\t * - a negative integer - column index counting from the right
\r\n\t\t * - the string \"_all\" - all columns (i.e. assign a default)
\r\n\t\t *
\r\n\t\t * @member\r\n\t\t *\r\n\t\t * @name DataTable.defaults.columnDefs\r\n\t\t */\r\n\t\t\"aoColumnDefs\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Basically the same as `search`, this parameter defines the individual column\r\n\t\t * filtering state at initialisation time. The array must be of the same size\r\n\t\t * as the number of columns, and each element be an object with the parameters\r\n\t\t * `search` and `escapeRegex` (the latter is optional). 'null' is also\r\n\t\t * accepted and the default will be used.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.searchCols\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searchCols\": [\r\n\t\t * null,\r\n\t\t * { \"search\": \"My filter\" },\r\n\t\t * null,\r\n\t\t * { \"search\": \"^[0-9]\", \"escapeRegex\": false }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"aoSearchCols\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * An array of CSS classes that should be applied to displayed rows. This\r\n\t\t * array may be of any length, and DataTables will apply each class\r\n\t\t * sequentially, looping when required.\r\n\t\t * @type array\r\n\t\t * @default null Will take the values determined by the `oClasses.stripe*`\r\n\t\t * options\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.stripeClasses\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stripeClasses\": [ 'strip1', 'strip2', 'strip3' ]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"asStripeClasses\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable automatic column width calculation. This can be disabled\r\n\t\t * as an optimisation (it takes some time to calculate the widths) if the\r\n\t\t * tables widths are passed in using `columns`.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.autoWidth\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"autoWidth\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bAutoWidth\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Deferred rendering can provide DataTables with a huge speed boost when you\r\n\t\t * are using an Ajax or JS data source for the table. This option, when set to\r\n\t\t * true, will cause DataTables to defer the creation of the table elements for\r\n\t\t * each row until they are needed for a draw - saving a significant amount of\r\n\t\t * time.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.deferRender\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": \"sources/arrays.txt\",\r\n\t\t * \"deferRender\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bDeferRender\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Replace a DataTable which matches the given selector and replace it with\r\n\t\t * one which has the properties of the new initialisation object passed. If no\r\n\t\t * table matches the selector, then the new DataTable will be constructed as\r\n\t\t * per normal.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.destroy\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"srollY\": \"200px\",\r\n\t\t * \"paginate\": false\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // Some time later....\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"filter\": false,\r\n\t\t * \"destroy\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bDestroy\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable filtering of data. Filtering in DataTables is \"smart\" in\r\n\t\t * that it allows the end user to input multiple words (space separated) and\r\n\t\t * will match a row containing those words, even if not in the order that was\r\n\t\t * specified (this allow matching across multiple columns). Note that if you\r\n\t\t * wish to use filtering in DataTables this must remain 'true' - to remove the\r\n\t\t * default filtering input box and retain filtering abilities, please use\r\n\t\t * {@link DataTable.defaults.dom}.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.searching\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searching\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bFilter\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the table information display. This shows information\r\n\t\t * about the data that is currently visible on the page, including information\r\n\t\t * about filtered data if that action is being performed.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.info\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"info\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bInfo\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows the end user to select the size of a formatted page from a select\r\n\t\t * menu (sizes are 10, 25, 50 and 100). Requires pagination (`paginate`).\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.lengthChange\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"lengthChange\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bLengthChange\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable pagination.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.paging\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"paging\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bPaginate\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the display of a 'processing' indicator when the table is\r\n\t\t * being processed (e.g. a sort). This is particularly useful for tables with\r\n\t\t * large amounts of data where it can take a noticeable amount of time to sort\r\n\t\t * the entries.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.processing\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"processing\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bProcessing\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Retrieve the DataTables object for the given selector. Note that if the\r\n\t\t * table has already been initialised, this parameter will cause DataTables\r\n\t\t * to simply return the object that has already been set up - it will not take\r\n\t\t * account of any changes you might have made to the initialisation object\r\n\t\t * passed to DataTables (setting this parameter to true is an acknowledgement\r\n\t\t * that you understand this). `destroy` can be used to reinitialise a table if\r\n\t\t * you need.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.retrieve\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * initTable();\r\n\t\t * tableActions();\r\n\t\t * } );\r\n\t\t *\r\n\t\t * function initTable ()\r\n\t\t * {\r\n\t\t * return $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200px\",\r\n\t\t * \"paginate\": false,\r\n\t\t * \"retrieve\": true\r\n\t\t * } );\r\n\t\t * }\r\n\t\t *\r\n\t\t * function tableActions ()\r\n\t\t * {\r\n\t\t * var table = initTable();\r\n\t\t * // perform API operations with oTable\r\n\t\t * }\r\n\t\t */\r\n\t\t\"bRetrieve\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When vertical (y) scrolling is enabled, DataTables will force the height of\r\n\t\t * the table's viewport to the given height at all times (useful for layout).\r\n\t\t * However, this can look odd when filtering data down to a small data set,\r\n\t\t * and the footer is left \"floating\" further down. This parameter (when\r\n\t\t * enabled) will cause DataTables to collapse the table's viewport down when\r\n\t\t * the result set will fit within the given Y height.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.scrollCollapse\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200\",\r\n\t\t * \"scrollCollapse\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bScrollCollapse\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Configure DataTables to use server-side processing. Note that the\r\n\t\t * `ajax` parameter must also be given in order to give DataTables a\r\n\t\t * source to obtain the required data for each draw.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverSide\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"xhr.php\"\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bServerSide\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable sorting of columns. Sorting of individual columns can be\r\n\t\t * disabled by the `sortable` option for each column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.ordering\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ordering\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSort\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or display DataTables' ability to sort multiple columns at the\r\n\t\t * same time (activated by shift-click by the user).\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.orderMulti\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Disable multiple column sorting ability\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderMulti\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortMulti\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows control over whether DataTables should use the top (true) unique\r\n\t\t * cell that is found for a single column, or the bottom (false - default).\r\n\t\t * This is useful when using complex headers.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.orderCellsTop\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderCellsTop\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortCellsTop\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the addition of the classes `sorting\\_1`, `sorting\\_2` and\r\n\t\t * `sorting\\_3` to the columns which are currently being sorted on. This is\r\n\t\t * presented as a feature switch as it can increase processing time (while\r\n\t\t * classes are removed and added) so for large data sets you might want to\r\n\t\t * turn this off.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.orderClasses\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderClasses\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortClasses\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable state saving. When enabled HTML5 `localStorage` will be\r\n\t\t * used to save table display information such as pagination information,\r\n\t\t * display length, filtering and sorting. As such when the end user reloads\r\n\t\t * the page the display display will match what thy had previously set up.\r\n\t\t *\r\n\t\t * Due to the use of `localStorage` the default state saving is not supported\r\n\t\t * in IE6 or 7. If state saving is required in those browsers, use\r\n\t\t * `stateSaveCallback` to provide a storage solution such as cookies.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.stateSave\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bStateSave\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called when a TR element is created (and all TD child\r\n\t\t * elements have been inserted), or registered if using a DOM source, allowing\r\n\t\t * manipulation of the TR element (adding classes etc).\r\n\t\t * @type function\r\n\t\t * @param {node} row \"TR\" element for the current row\r\n\t\t * @param {array} data Raw data array for this row\r\n\t\t * @param {int} dataIndex The index of this row in the internal aoData array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.createdRow\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"createdRow\": function( row, data, dataIndex ) {\r\n\t\t * // Bold the grade for all 'A' grade browsers\r\n\t\t * if ( data[4] == \"A\" )\r\n\t\t * {\r\n\t\t * $('td:eq(4)', row).html( 'A' );\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnCreatedRow\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called on every 'draw' event, and allows you to\r\n\t\t * dynamically modify any aspect you want about the created DOM.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.drawCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"drawCallback\": function( settings ) {\r\n\t\t * alert( 'DataTables has redrawn the table' );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnDrawCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Identical to fnHeaderCallback() but for the table footer this function\r\n\t\t * allows you to modify the table footer on every 'draw' event.\r\n\t\t * @type function\r\n\t\t * @param {node} foot \"TR\" element for the footer\r\n\t\t * @param {array} data Full table data (as derived from the original HTML)\r\n\t\t * @param {int} start Index for the current display starting point in the\r\n\t\t * display array\r\n\t\t * @param {int} end Index for the current display ending point in the\r\n\t\t * display array\r\n\t\t * @param {array int} display Index array to translate the visual position\r\n\t\t * to the full data array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.footerCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"footerCallback\": function( tfoot, data, start, end, display ) {\r\n\t\t * tfoot.getElementsByTagName('th')[0].innerHTML = \"Starting index is \"+start;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnFooterCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When rendering large numbers in the information element for the table\r\n\t\t * (i.e. \"Showing 1 to 10 of 57 entries\") DataTables will render large numbers\r\n\t\t * to have a comma separator for the 'thousands' units (e.g. 1 million is\r\n\t\t * rendered as \"1,000,000\") to help readability for the end user. This\r\n\t\t * function will override the default method DataTables uses.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {int} toFormat number to be formatted\r\n\t\t * @returns {string} formatted string for DataTables to show the number\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.formatNumber\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Format a number using a single quote for the separator (note that\r\n\t\t * // this can also be done with the language.thousands option)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"formatNumber\": function ( toFormat ) {\r\n\t\t * return toFormat.toString().replace(\r\n\t\t * /\\B(?=(\\d{3})+(?!\\d))/g, \"'\"\r\n\t\t * );\r\n\t\t * };\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnFormatNumber\": function ( toFormat ) {\r\n\t\t\treturn toFormat.toString().replace(\r\n\t\t\t\t/\\B(?=(\\d{3})+(?!\\d))/g,\r\n\t\t\t\tthis.oLanguage.sThousands\r\n\t\t\t);\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called on every 'draw' event, and allows you to\r\n\t\t * dynamically modify the header row. This can be used to calculate and\r\n\t\t * display useful information about the table.\r\n\t\t * @type function\r\n\t\t * @param {node} head \"TR\" element for the header\r\n\t\t * @param {array} data Full table data (as derived from the original HTML)\r\n\t\t * @param {int} start Index for the current display starting point in the\r\n\t\t * display array\r\n\t\t * @param {int} end Index for the current display ending point in the\r\n\t\t * display array\r\n\t\t * @param {array int} display Index array to translate the visual position\r\n\t\t * to the full data array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.headerCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"fheaderCallback\": function( head, data, start, end, display ) {\r\n\t\t * head.getElementsByTagName('th')[0].innerHTML = \"Displaying \"+(end-start)+\" records\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnHeaderCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The information element can be used to convey information about the current\r\n\t\t * state of the table. Although the internationalisation options presented by\r\n\t\t * DataTables are quite capable of dealing with most customisations, there may\r\n\t\t * be times where you wish to customise the string further. This callback\r\n\t\t * allows you to do exactly that.\r\n\t\t * @type function\r\n\t\t * @param {object} oSettings DataTables settings object\r\n\t\t * @param {int} start Starting position in data for the draw\r\n\t\t * @param {int} end End position in data for the draw\r\n\t\t * @param {int} max Total number of rows in the table (regardless of\r\n\t\t * filtering)\r\n\t\t * @param {int} total Total number of rows in the data set, after filtering\r\n\t\t * @param {string} pre The string that DataTables has formatted using it's\r\n\t\t * own rules\r\n\t\t * @returns {string} The string to be displayed in the information element.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.infoCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"infoCallback\": function( settings, start, end, max, total, pre ) {\r\n\t\t * return start +\" to \"+ end;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnInfoCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Called when the table has been initialised. Normally DataTables will\r\n\t\t * initialise sequentially and there will be no need for this function,\r\n\t\t * however, this does not hold true when using external language information\r\n\t\t * since that is obtained using an async XHR call.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} json The JSON object request from the server - only\r\n\t\t * present if client-side Ajax sourced data is used\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.initComplete\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"initComplete\": function(settings, json) {\r\n\t\t * alert( 'DataTables has finished its initialisation.' );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnInitComplete\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Called at the very start of each table draw and can be used to cancel the\r\n\t\t * draw by returning false, any other return (including undefined) results in\r\n\t\t * the full draw occurring).\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @returns {boolean} False will cancel the draw, anything else (including no\r\n\t\t * return) will allow it to complete.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.preDrawCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"preDrawCallback\": function( settings ) {\r\n\t\t * if ( $('#test').val() == 1 ) {\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnPreDrawCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function allows you to 'post process' each row after it have been\r\n\t\t * generated for each table draw, but before it is rendered on screen. This\r\n\t\t * function might be used for setting the row class name etc.\r\n\t\t * @type function\r\n\t\t * @param {node} row \"TR\" element for the current row\r\n\t\t * @param {array} data Raw data array for this row\r\n\t\t * @param {int} displayIndex The display index for the current table draw\r\n\t\t * @param {int} displayIndexFull The index of the data in the full list of\r\n\t\t * rows (after filtering)\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.rowCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"rowCallback\": function( row, data, displayIndex, displayIndexFull ) {\r\n\t\t * // Bold the grade for all 'A' grade browsers\r\n\t\t * if ( data[4] == \"A\" ) {\r\n\t\t * $('td:eq(4)', row).html( 'A' );\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnRowCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * This parameter allows you to override the default function which obtains\r\n\t\t * the data from the server so something more suitable for your application.\r\n\t\t * For example you could use POST data, or pull information from a Gears or\r\n\t\t * AIR database.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {string} source HTTP source to obtain the data from (`ajax`)\r\n\t\t * @param {array} data A key/value pair object containing the data to send\r\n\t\t * to the server\r\n\t\t * @param {function} callback to be called on completion of the data get\r\n\t\t * process that will draw the data on the page.\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverData\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"fnServerData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * It is often useful to send extra data to the server when making an Ajax\r\n\t\t * request - for example custom filtering information, and this callback\r\n\t\t * function makes it trivial to send extra information to the server. The\r\n\t\t * passed in parameter is the data set that has been constructed by\r\n\t\t * DataTables, and you can add to this or modify it as you require.\r\n\t\t * @type function\r\n\t\t * @param {array} data Data array (array of objects which are name/value\r\n\t\t * pairs) that has been constructed by DataTables and will be sent to the\r\n\t\t * server. In the case of Ajax sourced data with server-side processing\r\n\t\t * this will be an empty array, for server-side processing there will be a\r\n\t\t * significant number of parameters!\r\n\t\t * @returns {undefined} Ensure that you modify the data array passed in,\r\n\t\t * as this is passed by reference.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverParams\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"fnServerParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Load the table state. With this function you can define from where, and how, the\r\n\t\t * state of a table is loaded. By default DataTables will load from `localStorage`\r\n\t\t * but you might wish to use a server-side database or cookies.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} callback Callback that can be executed when done. It\r\n\t\t * should be passed the loaded state object.\r\n\t\t * @return {object} The DataTables state object to be loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoadCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadCallback\": function (settings, callback) {\r\n\t\t * $.ajax( {\r\n\t\t * \"url\": \"/state_load\",\r\n\t\t * \"dataType\": \"json\",\r\n\t\t * \"success\": function (json) {\r\n\t\t * callback( json );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoadCallback\": function ( settings ) {\r\n\t\t\ttry {\r\n\t\t\t\treturn JSON.parse(\r\n\t\t\t\t\t(settings.iStateDuration === -1 ? sessionStorage : localStorage).getItem(\r\n\t\t\t\t\t\t'DataTables_'+settings.sInstance+'_'+location.pathname\r\n\t\t\t\t\t)\r\n\t\t\t\t);\r\n\t\t\t} catch (e) {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback which allows modification of the saved state prior to loading that state.\r\n\t\t * This callback is called when the table is loading state from the stored data, but\r\n\t\t * prior to the settings object being modified by the saved state. Note that for\r\n\t\t * plug-in authors, you should use the `stateLoadParams` event to load parameters for\r\n\t\t * a plug-in.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object that is to be loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoadParams\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Remove a saved filter, so filtering is never loaded\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadParams\": function (settings, data) {\r\n\t\t * data.oSearch.sSearch = \"\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Disallow state loading by returning false\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadParams\": function (settings, data) {\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoadParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback that is called when the state has been loaded from the state saving method\r\n\t\t * and the DataTables settings object has been modified as a result of the loaded state.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object that was loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoaded\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Show an alert with the filtering value that was saved\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoaded\": function (settings, data) {\r\n\t\t * alert( 'Saved filter was: '+data.oSearch.sSearch );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoaded\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Save the table state. This function allows you to define where and how the state\r\n\t\t * information for the table is stored By default DataTables will use `localStorage`\r\n\t\t * but you might wish to use a server-side database or cookies.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object to be saved\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateSaveCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateSaveCallback\": function (settings, data) {\r\n\t\t * // Send an Ajax request to the server with the state object\r\n\t\t * $.ajax( {\r\n\t\t * \"url\": \"/state_save\",\r\n\t\t * \"data\": data,\r\n\t\t * \"dataType\": \"json\",\r\n\t\t * \"method\": \"POST\"\r\n\t\t * \"success\": function () {}\r\n\t\t * } );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateSaveCallback\": function ( settings, data ) {\r\n\t\t\ttry {\r\n\t\t\t\t(settings.iStateDuration === -1 ? sessionStorage : localStorage).setItem(\r\n\t\t\t\t\t'DataTables_'+settings.sInstance+'_'+location.pathname,\r\n\t\t\t\t\tJSON.stringify( data )\r\n\t\t\t\t);\r\n\t\t\t} catch (e) {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback which allows modification of the state to be saved. Called when the table\r\n\t\t * has changed state a new state save is required. This method allows modification of\r\n\t\t * the state saving object prior to actually doing the save, including addition or\r\n\t\t * other state properties or modification. Note that for plug-in authors, you should\r\n\t\t * use the `stateSaveParams` event to save parameters for a plug-in.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object to be saved\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateSaveParams\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Remove a saved filter, so filtering is never saved\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateSaveParams\": function (settings, data) {\r\n\t\t * data.oSearch.sSearch = \"\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateSaveParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Duration for which the saved state information is considered valid. After this period\r\n\t\t * has elapsed the state will be returned to the default.\r\n\t\t * Value is given in seconds.\r\n\t\t * @type int\r\n\t\t * @default 7200 (2 hours)\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.stateDuration\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateDuration\": 60*60*24; // 1 day\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iStateDuration\": 7200,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When enabled DataTables will not make a request to the server for the first\r\n\t\t * page draw - rather it will use the data already on the page (no sorting etc\r\n\t\t * will be applied to it), thus saving on an XHR at load time. `deferLoading`\r\n\t\t * is used to indicate that deferred loading is required, but it is also used\r\n\t\t * to tell DataTables how many records there are in the full table (allowing\r\n\t\t * the information element and pagination to be displayed correctly). In the case\r\n\t\t * where a filtering is applied to the table on initial load, this can be\r\n\t\t * indicated by giving the parameter as an array, where the first element is\r\n\t\t * the number of records available after filtering and the second element is the\r\n\t\t * number of records without filtering (allowing the table information element\r\n\t\t * to be shown correctly).\r\n\t\t * @type int | array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.deferLoading\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // 57 records available in the table, no filtering applied\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"scripts/server_processing.php\",\r\n\t\t * \"deferLoading\": 57\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // 57 records after filtering, 100 without filtering (an initial filter applied)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"scripts/server_processing.php\",\r\n\t\t * \"deferLoading\": [ 57, 100 ],\r\n\t\t * \"search\": {\r\n\t\t * \"search\": \"my_filter\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"iDeferLoading\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Number of rows to display on a single page when using pagination. If\r\n\t\t * feature enabled (`lengthChange`) then the end user will be able to override\r\n\t\t * this to a custom setting using a pop-up menu.\r\n\t\t * @type int\r\n\t\t * @default 10\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.pageLength\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"pageLength\": 50\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iDisplayLength\": 10,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Define the starting point for data display when using DataTables with\r\n\t\t * pagination. Note that this parameter is the number of records, rather than\r\n\t\t * the page number, so if you have 10 records per page and want to start on\r\n\t\t * the third page, it should be \"20\".\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.displayStart\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"displayStart\": 20\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iDisplayStart\": 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * By default DataTables allows keyboard navigation of the table (sorting, paging,\r\n\t\t * and filtering) by adding a `tabindex` attribute to the required elements. This\r\n\t\t * allows you to tab through the controls and press the enter key to activate them.\r\n\t\t * The tabindex is default 0, meaning that the tab follows the flow of the document.\r\n\t\t * You can overrule this using this parameter if you wish. Use a value of -1 to\r\n\t\t * disable built-in keyboard navigation.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.tabIndex\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"tabIndex\": 1\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"iTabIndex\": 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Classes that DataTables assigns to the various components and features\r\n\t\t * that it adds to the HTML table. This allows classes to be configured\r\n\t\t * during initialisation in addition to through the static\r\n\t\t * {@link DataTable.ext.oStdClasses} object).\r\n\t\t * @namespace\r\n\t\t * @name DataTable.defaults.classes\r\n\t\t */\r\n\t\t\"oClasses\": {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * All strings that DataTables uses in the user interface that it creates\r\n\t\t * are defined in this object, allowing you to modified them individually or\r\n\t\t * completely replace them all as required.\r\n\t\t * @namespace\r\n\t\t * @name DataTable.defaults.language\r\n\t\t */\r\n\t\t\"oLanguage\": {\r\n\t\t\t/**\r\n\t\t\t * Strings that are used for WAI-ARIA labels and controls only (these are not\r\n\t\t\t * actually visible on the page, but will be read by screenreaders, and thus\r\n\t\t\t * must be internationalised as well).\r\n\t\t\t * @namespace\r\n\t\t\t * @name DataTable.defaults.language.aria\r\n\t\t\t */\r\n\t\t\t\"oAria\": {\r\n\t\t\t\t/**\r\n\t\t\t\t * ARIA label that is added to the table headers when the column may be\r\n\t\t\t\t * sorted ascending by activing the column (click or return when focused).\r\n\t\t\t\t * Note that the column header is prefixed to this string.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default : activate to sort column ascending\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.aria.sortAscending\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"aria\": {\r\n\t\t\t\t * \"sortAscending\": \" - click/return to sort ascending\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sSortAscending\": \": activate to sort column ascending\",\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * ARIA label that is added to the table headers when the column may be\r\n\t\t\t\t * sorted descending by activing the column (click or return when focused).\r\n\t\t\t\t * Note that the column header is prefixed to this string.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default : activate to sort column ascending\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.aria.sortDescending\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"aria\": {\r\n\t\t\t\t * \"sortDescending\": \" - click/return to sort descending\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sSortDescending\": \": activate to sort column descending\"\r\n\t\t\t},\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Pagination string used by DataTables for the built-in pagination\r\n\t\t\t * control types.\r\n\t\t\t * @namespace\r\n\t\t\t * @name DataTable.defaults.language.paginate\r\n\t\t\t */\r\n\t\t\t\"oPaginate\": {\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use when using the 'full_numbers' type of pagination for the\r\n\t\t\t\t * button to take the user to the first page.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default First\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.first\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"first\": \"First page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sFirst\": \"First\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use when using the 'full_numbers' type of pagination for the\r\n\t\t\t\t * button to take the user to the last page.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Last\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.last\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"last\": \"Last page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sLast\": \"Last\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use for the 'next' pagination button (to take the user to the\r\n\t\t\t\t * next page).\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Next\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.next\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"next\": \"Next page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sNext\": \"Next\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use for the 'previous' pagination button (to take the user to\r\n\t\t\t\t * the previous page).\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Previous\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.previous\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"previous\": \"Previous page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sPrevious\": \"Previous\"\r\n\t\t\t},\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This string is shown in preference to `zeroRecords` when the table is\r\n\t\t\t * empty of data (regardless of filtering). Note that this is an optional\r\n\t\t\t * parameter - if it is not given, the value of `zeroRecords` will be used\r\n\t\t\t * instead (either the default or given value).\r\n\t\t\t * @type string\r\n\t\t\t * @default No data available in table\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.emptyTable\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"emptyTable\": \"No data available in table\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sEmptyTable\": \"No data available in table\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This string gives information to the end user about the information\r\n\t\t\t * that is current on display on the page. The following tokens can be\r\n\t\t\t * used in the string and will be dynamically replaced as the table\r\n\t\t\t * display updates. This tokens can be placed anywhere in the string, or\r\n\t\t\t * removed as needed by the language requires:\r\n\t\t\t *\r\n\t\t\t * * `\\_START\\_` - Display index of the first record on the current page\r\n\t\t\t * * `\\_END\\_` - Display index of the last record on the current page\r\n\t\t\t * * `\\_TOTAL\\_` - Number of records in the table after filtering\r\n\t\t\t * * `\\_MAX\\_` - Number of records in the table without filtering\r\n\t\t\t * * `\\_PAGE\\_` - Current page number\r\n\t\t\t * * `\\_PAGES\\_` - Total number of pages of data in the table\r\n\t\t\t *\r\n\t\t\t * @type string\r\n\t\t\t * @default Showing _START_ to _END_ of _TOTAL_ entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.info\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"info\": \"Showing page _PAGE_ of _PAGES_\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfo\": \"Showing _START_ to _END_ of _TOTAL_ entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Display information string for when the table is empty. Typically the\r\n\t\t\t * format of this string should match `info`.\r\n\t\t\t * @type string\r\n\t\t\t * @default Showing 0 to 0 of 0 entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoEmpty\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoEmpty\": \"No entries to show\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoEmpty\": \"Showing 0 to 0 of 0 entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * When a user filters the information in a table, this string is appended\r\n\t\t\t * to the information (`info`) to give an idea of how strong the filtering\r\n\t\t\t * is. The variable _MAX_ is dynamically updated.\r\n\t\t\t * @type string\r\n\t\t\t * @default (filtered from _MAX_ total entries)\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoFiltered\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoFiltered\": \" - filtering from _MAX_ records\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoFiltered\": \"(filtered from _MAX_ total entries)\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * If can be useful to append extra information to the info string at times,\r\n\t\t\t * and this variable does exactly that. This information will be appended to\r\n\t\t\t * the `info` (`infoEmpty` and `infoFiltered` in whatever combination they are\r\n\t\t\t * being used) at all times.\r\n\t\t\t * @type string\r\n\t\t\t * @default Empty string\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoPostFix\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoPostFix\": \"All records shown are derived from real information.\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoPostFix\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This decimal place operator is a little different from the other\r\n\t\t\t * language options since DataTables doesn't output floating point\r\n\t\t\t * numbers, so it won't ever use this for display of a number. Rather,\r\n\t\t\t * what this parameter does is modify the sort methods of the table so\r\n\t\t\t * that numbers which are in a format which has a character other than\r\n\t\t\t * a period (`.`) as a decimal place will be sorted numerically.\r\n\t\t\t *\r\n\t\t\t * Note that numbers with different decimal places cannot be shown in\r\n\t\t\t * the same table and still be sortable, the table must be consistent.\r\n\t\t\t * However, multiple different tables on the page can use different\r\n\t\t\t * decimal place characters.\r\n\t\t\t * @type string\r\n\t\t\t * @default \r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.decimal\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"decimal\": \",\"\r\n\t\t\t * \"thousands\": \".\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sDecimal\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * DataTables has a build in number formatter (`formatNumber`) which is\r\n\t\t\t * used to format large numbers that are used in the table information.\r\n\t\t\t * By default a comma is used, but this can be trivially changed to any\r\n\t\t\t * character you wish with this parameter.\r\n\t\t\t * @type string\r\n\t\t\t * @default ,\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.thousands\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"thousands\": \"'\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sThousands\": \",\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Detail the action that will be taken when the drop down menu for the\r\n\t\t\t * pagination length option is changed. The '_MENU_' variable is replaced\r\n\t\t\t * with a default select list of 10, 25, 50 and 100, and can be replaced\r\n\t\t\t * with a custom select box if required.\r\n\t\t\t * @type string\r\n\t\t\t * @default Show _MENU_ entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.lengthMenu\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Language change only\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"lengthMenu\": \"Display _MENU_ records\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Language and options change\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"lengthMenu\": 'Display records'\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sLengthMenu\": \"Show _MENU_ entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * When using Ajax sourced data and during the first draw when DataTables is\r\n\t\t\t * gathering the data, this message is shown in an empty row in the table to\r\n\t\t\t * indicate to the end user the the data is being loaded. Note that this\r\n\t\t\t * parameter is not used when loading data by server-side processing, just\r\n\t\t\t * Ajax sourced data with client-side processing.\r\n\t\t\t * @type string\r\n\t\t\t * @default Loading...\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.loadingRecords\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"loadingRecords\": \"Please wait - loading...\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sLoadingRecords\": \"Loading...\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Text which is displayed when the table is processing a user action\r\n\t\t\t * (usually a sort command or similar).\r\n\t\t\t * @type string\r\n\t\t\t * @default Processing...\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.processing\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"processing\": \"DataTables is currently busy\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sProcessing\": \"Processing...\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Details the actions that will be taken when the user types into the\r\n\t\t\t * filtering input text box. The variable \"_INPUT_\", if used in the string,\r\n\t\t\t * is replaced with the HTML text box for the filtering input allowing\r\n\t\t\t * control over where it appears in the string. If \"_INPUT_\" is not given\r\n\t\t\t * then the input box is appended to the string automatically.\r\n\t\t\t * @type string\r\n\t\t\t * @default Search:\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.search\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Input text box will be appended at the end automatically\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"search\": \"Filter records:\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Specify where the filter should appear\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"search\": \"Apply filter _INPUT_ to table\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sSearch\": \"Search:\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Assign a `placeholder` attribute to the search `input` element\r\n\t\t\t * @type string\r\n\t\t\t * @default \r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.searchPlaceholder\r\n\t\t\t */\r\n\t\t\t\"sSearchPlaceholder\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * All of the language information can be stored in a file on the\r\n\t\t\t * server-side, which DataTables will look up if this parameter is passed.\r\n\t\t\t * It must store the URL of the language file, which is in a JSON format,\r\n\t\t\t * and the object has the same properties as the oLanguage object in the\r\n\t\t\t * initialiser object (i.e. the above parameters). Please refer to one of\r\n\t\t\t * the example language files to see how this works in action.\r\n\t\t\t * @type string\r\n\t\t\t * @default Empty string - i.e. disabled\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.url\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"url\": \"http://www.sprymedia.co.uk/dataTables/lang.txt\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sUrl\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Text shown inside the table records when the is no information to be\r\n\t\t\t * displayed after filtering. `emptyTable` is shown when there is simply no\r\n\t\t\t * information in the table at all (regardless of filtering).\r\n\t\t\t * @type string\r\n\t\t\t * @default No matching records found\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.zeroRecords\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"zeroRecords\": \"No records to display\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sZeroRecords\": \"No matching records found\"\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter allows you to have define the global filtering state at\r\n\t\t * initialisation time. As an object the `search` parameter must be\r\n\t\t * defined, but all other parameters are optional. When `regex` is true,\r\n\t\t * the search string will be treated as a regular expression, when false\r\n\t\t * (default) it will be treated as a straight string. When `smart`\r\n\t\t * DataTables will use it's smart filtering methods (to word match at\r\n\t\t * any point in the data), when false this will not be done.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.models.oSearch\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.search\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"search\": {\"search\": \"Initial search\"}\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"oSearch\": $.extend( {}, DataTable.models.oSearch ),\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * By default DataTables will look for the property `data` (or `aaData` for\r\n\t\t * compatibility with DataTables 1.9-) when obtaining data from an Ajax\r\n\t\t * source or for server-side processing - this parameter allows that\r\n\t\t * property to be changed. You can use Javascript dotted object notation to\r\n\t\t * get a data source for multiple levels of nesting.\r\n\t\t * @type string\r\n\t\t * @default data\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.ajaxDataProp\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sAjaxDataProp\": \"data\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * You can instruct DataTables to load data from an external\r\n\t\t * source using this parameter (use aData if you want to pass data in you\r\n\t\t * already have). Simply provide a url a JSON object can be obtained from.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.ajaxSource\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sAjaxSource\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This initialisation variable allows you to specify exactly where in the\r\n\t\t * DOM you want DataTables to inject the various controls it adds to the page\r\n\t\t * (for example you might want the pagination controls at the top of the\r\n\t\t * table). DIV elements (with or without a custom class) can also be added to\r\n\t\t * aid styling. The follow syntax is used:\r\n\t\t * \r\n\t\t * - The following options are allowed:\r\n\t\t *
\r\n\t\t * - 'l' - Length changing
\r\n\t\t * - 'f' - Filtering input
\r\n\t\t * - 't' - The table!
\r\n\t\t * - 'i' - Information
\r\n\t\t * - 'p' - Pagination
\r\n\t\t * - 'r' - pRocessing
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - The following constants are allowed:\r\n\t\t *
\r\n\t\t * - 'H' - jQueryUI theme \"header\" classes ('fg-toolbar ui-widget-header ui-corner-tl ui-corner-tr ui-helper-clearfix')
\r\n\t\t * - 'F' - jQueryUI theme \"footer\" classes ('fg-toolbar ui-widget-header ui-corner-bl ui-corner-br ui-helper-clearfix')
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - The following syntax is expected:\r\n\t\t *
\r\n\t\t * - '<' and '>' - div elements
\r\n\t\t * - '<\"class\" and '>' - div with a class
\r\n\t\t * - '<\"#id\" and '>' - div with an ID
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - Examples:\r\n\t\t *
\r\n\t\t * - '<\"wrapper\"flipt>'
\r\n\t\t * - '<lf<t>ip>'
\r\n\t\t *
\r\n\t\t * \r\n\t\t *
\r\n\t\t * @type string\r\n\t\t * @default lfrtip (when `jQueryUI` is false) or\r\n\t\t * <\"H\"lfr>t<\"F\"ip> (when `jQueryUI` is true)\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.dom\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"dom\": '<\"top\"i>rt<\"bottom\"flp><\"clear\">'\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sDom\": \"lfrtip\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Search delay option. This will throttle full table searches that use the\r\n\t\t * DataTables provided search input element (it does not effect calls to\r\n\t\t * `dt-api search()`, providing a delay before the search is made.\r\n\t\t * @type integer\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.searchDelay\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searchDelay\": 200\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"searchDelay\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables features six different built-in options for the buttons to\r\n\t\t * display for pagination control:\r\n\t\t *\r\n\t\t * * `numbers` - Page number buttons only\r\n\t\t * * `simple` - 'Previous' and 'Next' buttons only\r\n\t\t * * 'simple_numbers` - 'Previous' and 'Next' buttons, plus page numbers\r\n\t\t * * `full` - 'First', 'Previous', 'Next' and 'Last' buttons\r\n\t\t * * `full_numbers` - 'First', 'Previous', 'Next' and 'Last' buttons, plus page numbers\r\n\t\t * * `first_last_numbers` - 'First' and 'Last' buttons, plus page numbers\r\n\t\t * \r\n\t\t * Further methods can be added using {@link DataTable.ext.oPagination}.\r\n\t\t * @type string\r\n\t\t * @default simple_numbers\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.pagingType\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"pagingType\": \"full_numbers\"\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"sPaginationType\": \"simple_numbers\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable horizontal scrolling. When a table is too wide to fit into a\r\n\t\t * certain layout, or you have a large number of columns in the table, you\r\n\t\t * can enable x-scrolling to show the table in a viewport, which can be\r\n\t\t * scrolled. This property can be `true` which will allow the table to\r\n\t\t * scroll horizontally when needed, or any CSS unit, or a number (in which\r\n\t\t * case it will be treated as a pixel measurement). Setting as simply `true`\r\n\t\t * is recommended.\r\n\t\t * @type boolean|string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.scrollX\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollX\": true,\r\n\t\t * \"scrollCollapse\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollX\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property can be used to force a DataTable to use more width than it\r\n\t\t * might otherwise do when x-scrolling is enabled. For example if you have a\r\n\t\t * table which requires to be well spaced, this parameter is useful for\r\n\t\t * \"over-sizing\" the table, and thus forcing scrolling. This property can by\r\n\t\t * any CSS unit, or a number (in which case it will be treated as a pixel\r\n\t\t * measurement).\r\n\t\t * @type string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.scrollXInner\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollX\": \"100%\",\r\n\t\t * \"scrollXInner\": \"110%\"\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollXInner\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable vertical scrolling. Vertical scrolling will constrain the DataTable\r\n\t\t * to the given height, and enable scrolling for any data which overflows the\r\n\t\t * current viewport. This can be used as an alternative to paging to display\r\n\t\t * a lot of data in a small area (although paging and scrolling can both be\r\n\t\t * enabled at the same time). This property can be any CSS unit, or a number\r\n\t\t * (in which case it will be treated as a pixel measurement).\r\n\t\t * @type string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.scrollY\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200px\",\r\n\t\t * \"paginate\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollY\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * Set the HTTP method that is used to make the Ajax call for server-side\r\n\t\t * processing or Ajax sourced data.\r\n\t\t * @type string\r\n\t\t * @default GET\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverMethod\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sServerMethod\": \"GET\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables makes use of renderers when displaying HTML elements for\r\n\t\t * a table. These renderers can be added or modified by plug-ins to\r\n\t\t * generate suitable mark-up for a site. For example the Bootstrap\r\n\t\t * integration plug-in for DataTables uses a paging button renderer to\r\n\t\t * display pagination buttons in the mark-up required by Bootstrap.\r\n\t\t *\r\n\t\t * For further information about the renderers available see\r\n\t\t * DataTable.ext.renderer\r\n\t\t * @type string|object\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @name DataTable.defaults.renderer\r\n\t\t *\r\n\t\t */\r\n\t\t\"renderer\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Set the data property name that DataTables should use to get a row's id\r\n\t\t * to set as the `id` property in the node.\r\n\t\t * @type string\r\n\t\t * @default DT_RowId\r\n\t\t *\r\n\t\t * @name DataTable.defaults.rowId\r\n\t\t */\r\n\t\t\"rowId\": \"DT_RowId\"\r\n\t};\r\n\t\r\n\t_fnHungarianMap( DataTable.defaults );\r\n\t\r\n\t\r\n\t\r\n\t/*\r\n\t * Developer note - See note in model.defaults.js about the use of Hungarian\r\n\t * notation and camel case.\r\n\t */\r\n\t\r\n\t/**\r\n\t * Column options that can be given to DataTables at initialisation time.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.defaults.column = {\r\n\t\t/**\r\n\t\t * Define which column(s) an order will occur on for this column. This\r\n\t\t * allows a column's ordering to take multiple columns into account when\r\n\t\t * doing a sort or use the data from a different column. For example first\r\n\t\t * name / last name columns make sense to do a multi-column sort over the\r\n\t\t * two columns.\r\n\t\t * @type array|int\r\n\t\t * @default null Takes the value of the column index automatically\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderData\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderData\": [ 0, 1 ], \"targets\": [ 0 ] },\r\n\t\t * { \"orderData\": [ 1, 0 ], \"targets\": [ 1 ] },\r\n\t\t * { \"orderData\": 2, \"targets\": [ 2 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"orderData\": [ 0, 1 ] },\r\n\t\t * { \"orderData\": [ 1, 0 ] },\r\n\t\t * { \"orderData\": 2 },\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aDataSort\": null,\r\n\t\t\"iDataSort\": -1,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * You can control the default ordering direction, and even alter the\r\n\t\t * behaviour of the sort handler (i.e. only allow ascending ordering etc)\r\n\t\t * using this parameter.\r\n\t\t * @type array\r\n\t\t * @default [ 'asc', 'desc' ]\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderSequence\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderSequence\": [ \"asc\" ], \"targets\": [ 1 ] },\r\n\t\t * { \"orderSequence\": [ \"desc\", \"asc\", \"asc\" ], \"targets\": [ 2 ] },\r\n\t\t * { \"orderSequence\": [ \"desc\" ], \"targets\": [ 3 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * { \"orderSequence\": [ \"asc\" ] },\r\n\t\t * { \"orderSequence\": [ \"desc\", \"asc\", \"asc\" ] },\r\n\t\t * { \"orderSequence\": [ \"desc\" ] },\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"asSorting\": [ 'asc', 'desc' ],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable filtering on the data in this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.searchable\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"searchable\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"searchable\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSearchable\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable ordering on this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderable\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderable\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"orderable\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortable\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the display of this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.visible\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"visible\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"visible\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bVisible\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Developer definable function that is called whenever a cell is created (Ajax source,\r\n\t\t * etc) or processed for input (DOM source). This can be used as a compliment to mRender\r\n\t\t * allowing you to modify the DOM element (add background colour for example) when the\r\n\t\t * element is available.\r\n\t\t * @type function\r\n\t\t * @param {element} td The TD node that has been created\r\n\t\t * @param {*} cellData The Data for the cell\r\n\t\t * @param {array|object} rowData The data for the whole row\r\n\t\t * @param {int} row The row index for the aoData data store\r\n\t\t * @param {int} col The column index for aoColumns\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.createdCell\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [3],\r\n\t\t * \"createdCell\": function (td, cellData, rowData, row, col) {\r\n\t\t * if ( cellData == \"1.7\" ) {\r\n\t\t * $(td).css('color', 'blue')\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * });\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnCreatedCell\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter has been replaced by `data` in DataTables to ensure naming\r\n\t\t * consistency. `dataProp` can still be used, as there is backwards\r\n\t\t * compatibility in DataTables for this option, but it is strongly\r\n\t\t * recommended that you use `data` in preference to `dataProp`.\r\n\t\t * @name DataTable.defaults.column.dataProp\r\n\t\t */\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property can be used to read data from any data source property,\r\n\t\t * including deeply nested objects / properties. `data` can be given in a\r\n\t\t * number of different ways which effect its behaviour:\r\n\t\t *\r\n\t\t * * `integer` - treated as an array index for the data source. This is the\r\n\t\t * default that DataTables uses (incrementally increased for each column).\r\n\t\t * * `string` - read an object property from the data source. There are\r\n\t\t * three 'special' options that can be used in the string to alter how\r\n\t\t * DataTables reads the data from the source object:\r\n\t\t * * `.` - Dotted Javascript notation. Just as you use a `.` in\r\n\t\t * Javascript to read from nested objects, so to can the options\r\n\t\t * specified in `data`. For example: `browser.version` or\r\n\t\t * `browser.name`. If your object parameter name contains a period, use\r\n\t\t * `\\\\` to escape it - i.e. `first\\\\.name`.\r\n\t\t * * `[]` - Array notation. DataTables can automatically combine data\r\n\t\t * from and array source, joining the data with the characters provided\r\n\t\t * between the two brackets. For example: `name[, ]` would provide a\r\n\t\t * comma-space separated list from the source array. If no characters\r\n\t\t * are provided between the brackets, the original array source is\r\n\t\t * returned.\r\n\t\t * * `()` - Function notation. Adding `()` to the end of a parameter will\r\n\t\t * execute a function of the name given. For example: `browser()` for a\r\n\t\t * simple function on the data source, `browser.version()` for a\r\n\t\t * function in a nested property or even `browser().version` to get an\r\n\t\t * object property if the function called returns an object. Note that\r\n\t\t * function notation is recommended for use in `render` rather than\r\n\t\t * `data` as it is much simpler to use as a renderer.\r\n\t\t * * `null` - use the original data source for the row rather than plucking\r\n\t\t * data directly from it. This action has effects on two other\r\n\t\t * initialisation options:\r\n\t\t * * `defaultContent` - When null is given as the `data` option and\r\n\t\t * `defaultContent` is specified for the column, the value defined by\r\n\t\t * `defaultContent` will be used for the cell.\r\n\t\t * * `render` - When null is used for the `data` option and the `render`\r\n\t\t * option is specified for the column, the whole data source for the\r\n\t\t * row is used for the renderer.\r\n\t\t * * `function` - the function given will be executed whenever DataTables\r\n\t\t * needs to set or get the data for a cell in the column. The function\r\n\t\t * takes three parameters:\r\n\t\t * * Parameters:\r\n\t\t * * `{array|object}` The data source for the row\r\n\t\t * * `{string}` The type call data requested - this will be 'set' when\r\n\t\t * setting data or 'filter', 'display', 'type', 'sort' or undefined\r\n\t\t * when gathering data. Note that when `undefined` is given for the\r\n\t\t * type DataTables expects to get the raw data for the object back<\r\n\t\t * * `{*}` Data to set when the second parameter is 'set'.\r\n\t\t * * Return:\r\n\t\t * * The return value from the function is not required when 'set' is\r\n\t\t * the type of call, but otherwise the return is what will be used\r\n\t\t * for the data requested.\r\n\t\t *\r\n\t\t * Note that `data` is a getter and setter option. If you just require\r\n\t\t * formatting of data for output, you will likely want to use `render` which\r\n\t\t * is simply a getter and thus simpler to use.\r\n\t\t *\r\n\t\t * Note that prior to DataTables 1.9.2 `data` was called `mDataProp`. The\r\n\t\t * name change reflects the flexibility of this property and is consistent\r\n\t\t * with the naming of mRender. If 'mDataProp' is given, then it will still\r\n\t\t * be used by DataTables, as it automatically maps the old name to the new\r\n\t\t * if required.\r\n\t\t *\r\n\t\t * @type string|int|function|null\r\n\t\t * @default null Use automatically calculated column index\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.data\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Read table data from objects\r\n\t\t * // JSON structure for each row:\r\n\t\t * // {\r\n\t\t * // \"engine\": {value},\r\n\t\t * // \"browser\": {value},\r\n\t\t * // \"platform\": {value},\r\n\t\t * // \"version\": {value},\r\n\t\t * // \"grade\": {value}\r\n\t\t * // }\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/objects.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * { \"data\": \"platform\" },\r\n\t\t * { \"data\": \"version\" },\r\n\t\t * { \"data\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Read information from deeply nested objects\r\n\t\t * // JSON structure for each row:\r\n\t\t * // {\r\n\t\t * // \"engine\": {value},\r\n\t\t * // \"browser\": {value},\r\n\t\t * // \"platform\": {\r\n\t\t * // \"inner\": {value}\r\n\t\t * // },\r\n\t\t * // \"details\": [\r\n\t\t * // {value}, {value}\r\n\t\t * // ]\r\n\t\t * // }\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/deep.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * { \"data\": \"platform.inner\" },\r\n\t\t * { \"data\": \"platform.details.0\" },\r\n\t\t * { \"data\": \"platform.details.1\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `data` as a function to provide different information for\r\n\t\t * // sorting, filtering and display. In this case, currency (price)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": function ( source, type, val ) {\r\n\t\t * if (type === 'set') {\r\n\t\t * source.price = val;\r\n\t\t * // Store the computed dislay and filter values for efficiency\r\n\t\t * source.price_display = val==\"\" ? \"\" : \"$\"+numberFormat(val);\r\n\t\t * source.price_filter = val==\"\" ? \"\" : \"$\"+numberFormat(val)+\" \"+val;\r\n\t\t * return;\r\n\t\t * }\r\n\t\t * else if (type === 'display') {\r\n\t\t * return source.price_display;\r\n\t\t * }\r\n\t\t * else if (type === 'filter') {\r\n\t\t * return source.price_filter;\r\n\t\t * }\r\n\t\t * // 'sort', 'type' and undefined all just use the integer\r\n\t\t * return source.price;\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using default content\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Click to edit\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using array notation - outputting a list from an array\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": \"name[, ]\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t */\r\n\t\t\"mData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property is the rendering partner to `data` and it is suggested that\r\n\t\t * when you want to manipulate data for display (including filtering,\r\n\t\t * sorting etc) without altering the underlying data for the table, use this\r\n\t\t * property. `render` can be considered to be the the read only companion to\r\n\t\t * `data` which is read / write (then as such more complex). Like `data`\r\n\t\t * this option can be given in a number of different ways to effect its\r\n\t\t * behaviour:\r\n\t\t *\r\n\t\t * * `integer` - treated as an array index for the data source. This is the\r\n\t\t * default that DataTables uses (incrementally increased for each column).\r\n\t\t * * `string` - read an object property from the data source. There are\r\n\t\t * three 'special' options that can be used in the string to alter how\r\n\t\t * DataTables reads the data from the source object:\r\n\t\t * * `.` - Dotted Javascript notation. Just as you use a `.` in\r\n\t\t * Javascript to read from nested objects, so to can the options\r\n\t\t * specified in `data`. For example: `browser.version` or\r\n\t\t * `browser.name`. If your object parameter name contains a period, use\r\n\t\t * `\\\\` to escape it - i.e. `first\\\\.name`.\r\n\t\t * * `[]` - Array notation. DataTables can automatically combine data\r\n\t\t * from and array source, joining the data with the characters provided\r\n\t\t * between the two brackets. For example: `name[, ]` would provide a\r\n\t\t * comma-space separated list from the source array. If no characters\r\n\t\t * are provided between the brackets, the original array source is\r\n\t\t * returned.\r\n\t\t * * `()` - Function notation. Adding `()` to the end of a parameter will\r\n\t\t * execute a function of the name given. For example: `browser()` for a\r\n\t\t * simple function on the data source, `browser.version()` for a\r\n\t\t * function in a nested property or even `browser().version` to get an\r\n\t\t * object property if the function called returns an object.\r\n\t\t * * `object` - use different data for the different data types requested by\r\n\t\t * DataTables ('filter', 'display', 'type' or 'sort'). The property names\r\n\t\t * of the object is the data type the property refers to and the value can\r\n\t\t * defined using an integer, string or function using the same rules as\r\n\t\t * `render` normally does. Note that an `_` option _must_ be specified.\r\n\t\t * This is the default value to use if you haven't specified a value for\r\n\t\t * the data type requested by DataTables.\r\n\t\t * * `function` - the function given will be executed whenever DataTables\r\n\t\t * needs to set or get the data for a cell in the column. The function\r\n\t\t * takes three parameters:\r\n\t\t * * Parameters:\r\n\t\t * * {array|object} The data source for the row (based on `data`)\r\n\t\t * * {string} The type call data requested - this will be 'filter',\r\n\t\t * 'display', 'type' or 'sort'.\r\n\t\t * * {array|object} The full data source for the row (not based on\r\n\t\t * `data`)\r\n\t\t * * Return:\r\n\t\t * * The return value from the function is what will be used for the\r\n\t\t * data requested.\r\n\t\t *\r\n\t\t * @type string|int|function|object|null\r\n\t\t * @default null Use the data source value.\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.render\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Create a comma separated list from an array of objects\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/deep.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * {\r\n\t\t * \"data\": \"platform\",\r\n\t\t * \"render\": \"[, ].name\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Execute a function to obtain data\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null, // Use the full data source object for the renderer's source\r\n\t\t * \"render\": \"browserName()\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // As an object, extracting different data for the different types\r\n\t\t * // This would be used with a data source such as:\r\n\t\t * // { \"phone\": 5552368, \"phone_filter\": \"5552368 555-2368\", \"phone_display\": \"555-2368\" }\r\n\t\t * // Here the `phone` integer is used for sorting and type detection, while `phone_filter`\r\n\t\t * // (which has both forms) is used for filtering for if a user inputs either format, while\r\n\t\t * // the formatted phone number is the one that is shown in the table.\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null, // Use the full data source object for the renderer's source\r\n\t\t * \"render\": {\r\n\t\t * \"_\": \"phone\",\r\n\t\t * \"filter\": \"phone_filter\",\r\n\t\t * \"display\": \"phone_display\"\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Use as a function to create a link from the data source\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": \"download_link\",\r\n\t\t * \"render\": function ( data, type, full ) {\r\n\t\t * return 'Download';\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"mRender\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Change the cell type created for the column - either TD cells or TH cells. This\r\n\t\t * can be useful as TH cells have semantic meaning in the table body, allowing them\r\n\t\t * to act as a header for a row (you may wish to add scope='row' to the TH elements).\r\n\t\t * @type string\r\n\t\t * @default td\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.cellType\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Make the first column use TH cells\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"cellType\": \"th\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sCellType\": \"td\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Class to give to each cell in this column.\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.class\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"class\": \"my_class\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"class\": \"my_class\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sClass\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * When DataTables calculates the column widths to assign to each column,\r\n\t\t * it finds the longest string in each column and then constructs a\r\n\t\t * temporary table and reads the widths from that. The problem with this\r\n\t\t * is that \"mmm\" is much wider then \"iiii\", but the latter is a longer\r\n\t\t * string - thus the calculation can go wrong (doing it properly and putting\r\n\t\t * it into an DOM object and measuring that is horribly(!) slow). Thus as\r\n\t\t * a \"work around\" we provide this option. It will append its value to the\r\n\t\t * text that is found to be the longest string for the column - i.e. padding.\r\n\t\t * Generally you shouldn't need this!\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.contentPadding\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * {\r\n\t\t * \"contentPadding\": \"mmm\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sContentPadding\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows a default value to be given for a column's data, and will be used\r\n\t\t * whenever a null data source is encountered (this can be because `data`\r\n\t\t * is set to null, or because the data source itself is null).\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.defaultContent\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * {\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Edit\",\r\n\t\t * \"targets\": [ -1 ]\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * {\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Edit\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sDefaultContent\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter is only used in DataTables' server-side processing. It can\r\n\t\t * be exceptionally useful to know what columns are being displayed on the\r\n\t\t * client side, and to map these to database fields. When defined, the names\r\n\t\t * also allow DataTables to reorder information from the server if it comes\r\n\t\t * back in an unexpected order (i.e. if you switch your columns around on the\r\n\t\t * client-side, your server-side code does not also need updating).\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.name\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"name\": \"engine\", \"targets\": [ 0 ] },\r\n\t\t * { \"name\": \"browser\", \"targets\": [ 1 ] },\r\n\t\t * { \"name\": \"platform\", \"targets\": [ 2 ] },\r\n\t\t * { \"name\": \"version\", \"targets\": [ 3 ] },\r\n\t\t * { \"name\": \"grade\", \"targets\": [ 4 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"name\": \"engine\" },\r\n\t\t * { \"name\": \"browser\" },\r\n\t\t * { \"name\": \"platform\" },\r\n\t\t * { \"name\": \"version\" },\r\n\t\t * { \"name\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sName\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Defines a data source type for the ordering which can be used to read\r\n\t\t * real-time information from the table (updating the internally cached\r\n\t\t * version) prior to ordering. This allows ordering to occur on user\r\n\t\t * editable elements such as form inputs.\r\n\t\t * @type string\r\n\t\t * @default std\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderDataType\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderDataType\": \"dom-text\", \"targets\": [ 2, 3 ] },\r\n\t\t * { \"type\": \"numeric\", \"targets\": [ 3 ] },\r\n\t\t * { \"orderDataType\": \"dom-select\", \"targets\": [ 4 ] },\r\n\t\t * { \"orderDataType\": \"dom-checkbox\", \"targets\": [ 5 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * { \"orderDataType\": \"dom-text\" },\r\n\t\t * { \"orderDataType\": \"dom-text\", \"type\": \"numeric\" },\r\n\t\t * { \"orderDataType\": \"dom-select\" },\r\n\t\t * { \"orderDataType\": \"dom-checkbox\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sSortDataType\": \"std\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The title of this column.\r\n\t\t * @type string\r\n\t\t * @default null Derived from the 'TH' value for this column in the\r\n\t\t * original HTML table.\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.title\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"title\": \"My column title\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"My column title\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sTitle\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The type allows you to specify how the data for this column will be\r\n\t\t * ordered. Four types (string, numeric, date and html (which will strip\r\n\t\t * HTML tags before ordering)) are currently available. Note that only date\r\n\t\t * formats understood by Javascript's Date() object will be accepted as type\r\n\t\t * date. For example: \"Mar 26, 2008 5:03 PM\". May take the values: 'string',\r\n\t\t * 'numeric', 'date' or 'html' (by default). Further types can be adding\r\n\t\t * through plug-ins.\r\n\t\t * @type string\r\n\t\t * @default null Auto-detected from raw data\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.type\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"type\": \"html\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"type\": \"html\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sType\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Defining the width of the column, this parameter may take any CSS value\r\n\t\t * (3em, 20px etc). DataTables applies 'smart' widths to columns which have not\r\n\t\t * been given a specific width through this interface ensuring that the table\r\n\t\t * remains readable.\r\n\t\t * @type string\r\n\t\t * @default null Automatic\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.width\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"width\": \"20%\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"width\": \"20%\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sWidth\": null\r\n\t};\r\n\t\r\n\t_fnHungarianMap( DataTable.defaults.column );\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables settings object - this holds all the information needed for a\r\n\t * given table, including configuration, data and current application of the\r\n\t * table options. DataTables does not have a single instance for each DataTable\r\n\t * with the settings attached to that instance, but rather instances of the\r\n\t * DataTable \"class\" are created on-the-fly as needed (typically by a\r\n\t * $().dataTable() call) and the settings object is then applied to that\r\n\t * instance.\r\n\t *\r\n\t * Note that this object is related to {@link DataTable.defaults} but this\r\n\t * one is the internal data store for DataTables's cache of columns. It should\r\n\t * NOT be manipulated outside of DataTables. Any configuration should be done\r\n\t * through the initialisation options.\r\n\t * @namespace\r\n\t * @todo Really should attach the settings object to individual instances so we\r\n\t * don't need to create new instances on each $().dataTable() call (if the\r\n\t * table already exists). It would also save passing oSettings around and\r\n\t * into every single function. However, this is a very significant\r\n\t * architecture change for DataTables and will almost certainly break\r\n\t * backwards compatibility with older installations. This is something that\r\n\t * will be done in 2.0.\r\n\t */\r\n\tDataTable.models.oSettings = {\r\n\t\t/**\r\n\t\t * Primary features of DataTables and their enablement state.\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oFeatures\": {\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Flag to say if DataTables should automatically try to calculate the\r\n\t\t\t * optimum table and columns widths (true) or not (false).\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bAutoWidth\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Delay the creation of TR and TD elements until they are actually\r\n\t\t\t * needed by a driven page draw. This can give a significant speed\r\n\t\t\t * increase for Ajax source and Javascript source data, but makes no\r\n\t\t\t * difference at all fro DOM and server-side processing tables.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bDeferRender\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Enable filtering on the table or not. Note that if this is disabled\r\n\t\t\t * then there is no filtering at all on the table, including fnFilter.\r\n\t\t\t * To just remove the filtering input use sDom and remove the 'f' option.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bFilter\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Table information element (the 'Showing x of y records' div) enable\r\n\t\t\t * flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bInfo\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Present a user control allowing the end user to change the page size\r\n\t\t\t * when pagination is enabled.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bLengthChange\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Pagination enabled or not. Note that if this is disabled then length\r\n\t\t\t * changing must also be disabled.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bPaginate\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Processing indicator enable flag whenever DataTables is enacting a\r\n\t\t\t * user request - typically an Ajax request for server-side processing.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bProcessing\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Server-side processing enabled flag - when enabled DataTables will\r\n\t\t\t * get all data from the server for every draw - there is no filtering,\r\n\t\t\t * sorting or paging done on the client-side.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bServerSide\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Sorting enablement flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSort\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Multi-column sorting\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSortMulti\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Apply a class to the columns which are being sorted to provide a\r\n\t\t\t * visual highlight or not. This can slow things down when enabled since\r\n\t\t\t * there is a lot of DOM interaction.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSortClasses\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * State saving enablement flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bStateSave\": null\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Scrolling settings for a table.\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oScroll\": {\r\n\t\t\t/**\r\n\t\t\t * When the table is shorter in height than sScrollY, collapse the\r\n\t\t\t * table container down to the height of the table (when true).\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bCollapse\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Width of the scrollbar for the web-browser's platform. Calculated\r\n\t\t\t * during table initialisation.\r\n\t\t\t * @type int\r\n\t\t\t * @default 0\r\n\t\t\t */\r\n\t\t\t\"iBarWidth\": 0,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Viewport width for horizontal scrolling. Horizontal scrolling is\r\n\t\t\t * disabled if an empty string.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t */\r\n\t\t\t\"sX\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Width to expand the table to when using x-scrolling. Typically you\r\n\t\t\t * should not need to use this.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t * @deprecated\r\n\t\t\t */\r\n\t\t\t\"sXInner\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Viewport height for vertical scrolling. Vertical scrolling is disabled\r\n\t\t\t * if an empty string.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t */\r\n\t\t\t\"sY\": null\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Language information for the table.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.defaults.oLanguage\r\n\t\t */\r\n\t\t\"oLanguage\": {\r\n\t\t\t/**\r\n\t\t\t * Information callback function. See\r\n\t\t\t * {@link DataTable.defaults.fnInfoCallback}\r\n\t\t\t * @type function\r\n\t\t\t * @default null\r\n\t\t\t */\r\n\t\t\t\"fnInfoCallback\": null\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Browser support parameters\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oBrowser\": {\r\n\t\t\t/**\r\n\t\t\t * Indicate if the browser incorrectly calculates width:100% inside a\r\n\t\t\t * scrolling element (IE6/7)\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bScrollOversize\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Determine if the vertical scrollbar is on the right or left of the\r\n\t\t\t * scrolling container - needed for rtl language layout, although not\r\n\t\t\t * all browsers move the scrollbar (Safari).\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bScrollbarLeft\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Flag for if `getBoundingClientRect` is fully supported or not\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bBounding\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Browser scrollbar width\r\n\t\t\t * @type integer\r\n\t\t\t * @default 0\r\n\t\t\t */\r\n\t\t\t\"barWidth\": 0\r\n\t\t},\r\n\t\r\n\t\r\n\t\t\"ajax\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Array referencing the nodes which are used for the features. The\r\n\t\t * parameters of this object match what is allowed by sDom - i.e.\r\n\t\t * \r\n\t\t * - 'l' - Length changing
\r\n\t\t * - 'f' - Filtering input
\r\n\t\t * - 't' - The table!
\r\n\t\t * - 'i' - Information
\r\n\t\t * - 'p' - Pagination
\r\n\t\t * - 'r' - pRocessing
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aanFeatures\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store data information - see {@link DataTable.models.oRow} for detailed\r\n\t\t * information.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoData\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of indexes which are in the current display (after filtering etc)\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aiDisplay\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of indexes for display - no filtering\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aiDisplayMaster\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Map of row ids to data indexes\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"aIds\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Store information about each column that is in use\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoColumns\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store information about the table's header\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoHeader\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store information about the table's footer\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoFooter\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store the applied global search information in case we want to force a\r\n\t\t * research or compare the old search to a new one.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.models.oSearch\r\n\t\t */\r\n\t\t\"oPreviousSearch\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Store the applied search for each column - see\r\n\t\t * {@link DataTable.models.oSearch} for the format that is used for the\r\n\t\t * filtering information for each column.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoPreSearchCols\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Sorting that is applied to the table. Note that the inner arrays are\r\n\t\t * used in the following manner:\r\n\t\t * \r\n\t\t * - Index 0 - column number
\r\n\t\t * - Index 1 - current sorting direction
\r\n\t\t *
\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @todo These inner arrays should really be objects\r\n\t\t */\r\n\t\t\"aaSorting\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Sorting that is always applied to the table (i.e. prefixed in front of\r\n\t\t * aaSorting).\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aaSortingFixed\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Classes to use for the striping of a table.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"asStripeClasses\": null,\r\n\t\r\n\t\t/**\r\n\t\t * If restoring a table - we should restore its striping classes as well\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"asDestroyStripes\": [],\r\n\t\r\n\t\t/**\r\n\t\t * If restoring a table - we should restore its width\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"sDestroyWidth\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions array for every time a row is inserted (i.e. on a draw).\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoRowCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for the header on each draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoHeaderCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback function for the footer on each draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoFooterCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for draw callback functions\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoDrawCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for row created function\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoRowCreatedCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for just before the table is redrawn. A return of\r\n\t\t * false will be used to cancel the draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoPreDrawCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for when the table has been initialised.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoInitComplete\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for modifying the settings to be stored for state saving, prior to\r\n\t\t * saving state.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateSaveParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for modifying the settings that have been stored for state saving\r\n\t\t * prior to using the stored values to restore the state.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoadParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for operating on the settings object once the saved state has been\r\n\t\t * loaded\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoaded\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Cache the table ID for quick access\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t */\r\n\t\t\"sTableId\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * The TABLE node for the main table\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the thead element\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTHead\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the tfoot element - if it exists\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTFoot\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the tbody element\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTBody\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Cache the wrapper node (contains all DataTables controlled elements)\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTableWrapper\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if when using server-side processing the loading of data\r\n\t\t * should be deferred until the second draw.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bDeferLoading\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if all required information has been read in\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bInitialised\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Information about open rows. Each object in the array has the parameters\r\n\t\t * 'nTr' and 'nParent'\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoOpenRows\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Dictate the positioning of DataTables' control elements - see\r\n\t\t * {@link DataTable.model.oInit.sDom}.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sDom\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Search delay (in mS)\r\n\t\t * @type integer\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"searchDelay\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Which type of pagination should be used.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default two_button\r\n\t\t */\r\n\t\t\"sPaginationType\": \"two_button\",\r\n\t\r\n\t\t/**\r\n\t\t * The state duration (for `stateSave`) in seconds.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"iStateDuration\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for state saving. Each array element is an\r\n\t\t * object with the following parameters:\r\n\t\t * \r\n\t\t * - function:fn - function to call. Takes two parameters, oSettings\r\n\t\t * and the JSON string to save that has been thus far created. Returns\r\n\t\t * a JSON string to be inserted into a json object\r\n\t\t * (i.e. '\"param\": [ 0, 1, 2]')
\r\n\t\t * - string:sName - name of callback
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateSave\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for state loading. Each array element is an\r\n\t\t * object with the following parameters:\r\n\t\t * \r\n\t\t * - function:fn - function to call. Takes two parameters, oSettings\r\n\t\t * and the object stored. May return false to cancel state loading
\r\n\t\t * - string:sName - name of callback
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoad\": [],\r\n\t\r\n\t\t/**\r\n\t\t * State that was saved. Useful for back reference\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oSavedState\": null,\r\n\t\r\n\t\t/**\r\n\t\t * State that was loaded. Useful for back reference\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oLoadedState\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Source url for AJAX data for the table.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sAjaxSource\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Property from a given object from which to read the table data from. This\r\n\t\t * can be an empty string (when not server-side processing), in which case\r\n\t\t * it is assumed an an array is given directly.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sAjaxDataProp\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Note if draw should be blocked while getting data\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bAjaxDataGet\": true,\r\n\t\r\n\t\t/**\r\n\t\t * The last jQuery XHR object that was used for server-side data gathering.\r\n\t\t * This can be used for working with the XHR information in one of the\r\n\t\t * callbacks\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"jqXHR\": null,\r\n\t\r\n\t\t/**\r\n\t\t * JSON returned from the server in the last Ajax request\r\n\t\t * @type object\r\n\t\t * @default undefined\r\n\t\t */\r\n\t\t\"json\": undefined,\r\n\t\r\n\t\t/**\r\n\t\t * Data submitted as part of the last Ajax request\r\n\t\t * @type object\r\n\t\t * @default undefined\r\n\t\t */\r\n\t\t\"oAjaxData\": undefined,\r\n\t\r\n\t\t/**\r\n\t\t * Function to get the server-side data.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnServerData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Functions which are called prior to sending an Ajax request so extra\r\n\t\t * parameters can easily be sent to the server\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoServerParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Send the XHR HTTP method - GET or POST (could be PUT or DELETE if\r\n\t\t * required).\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sServerMethod\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Format numbers for display.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnFormatNumber\": null,\r\n\t\r\n\t\t/**\r\n\t\t * List of options that can be used for the user selectable length menu.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aLengthMenu\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Counter for the draws that the table does. Also used as a tracker for\r\n\t\t * server-side processing\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"iDraw\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if a redraw is being done - useful for Ajax\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bDrawing\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Draw index (iDraw) of the last error when parsing the returned data\r\n\t\t * @type int\r\n\t\t * @default -1\r\n\t\t */\r\n\t\t\"iDrawError\": -1,\r\n\t\r\n\t\t/**\r\n\t\t * Paging display length\r\n\t\t * @type int\r\n\t\t * @default 10\r\n\t\t */\r\n\t\t\"_iDisplayLength\": 10,\r\n\t\r\n\t\t/**\r\n\t\t * Paging start point - aiDisplay index\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"_iDisplayStart\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Server-side processing - number of records in the result set\r\n\t\t * (i.e. before filtering), Use fnRecordsTotal rather than\r\n\t\t * this property to get the value of the number of records, regardless of\r\n\t\t * the server-side processing setting.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_iRecordsTotal\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Server-side processing - number of records in the current display set\r\n\t\t * (i.e. after filtering). Use fnRecordsDisplay rather than\r\n\t\t * this property to get the value of the number of records, regardless of\r\n\t\t * the server-side processing setting.\r\n\t\t * @type boolean\r\n\t\t * @default 0\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_iRecordsDisplay\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * The classes to use for the table\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"oClasses\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Flag attached to the settings object so you can check in the draw\r\n\t\t * callback if filtering has been done in the draw. Deprecated in favour of\r\n\t\t * events.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @deprecated\r\n\t\t */\r\n\t\t\"bFiltered\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Flag attached to the settings object so you can check in the draw\r\n\t\t * callback if sorting has been done in the draw. Deprecated in favour of\r\n\t\t * events.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @deprecated\r\n\t\t */\r\n\t\t\"bSorted\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate that if multiple rows are in the header and there is more than\r\n\t\t * one unique cell per column, if the top one (true) or bottom one (false)\r\n\t\t * should be used for sorting / title by DataTables.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSortCellsTop\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Initialisation object that is used for the table\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oInit\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Destroy callback functions - for plug-ins to attach themselves to the\r\n\t\t * destroy so they can clean up markup and events.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoDestroyCallback\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Get the number of records in the current record set, before filtering\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnRecordsTotal\": function ()\r\n\t\t{\r\n\t\t\treturn _fnDataSource( this ) == 'ssp' ?\r\n\t\t\t\tthis._iRecordsTotal * 1 :\r\n\t\t\t\tthis.aiDisplayMaster.length;\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Get the number of records in the current record set, after filtering\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnRecordsDisplay\": function ()\r\n\t\t{\r\n\t\t\treturn _fnDataSource( this ) == 'ssp' ?\r\n\t\t\t\tthis._iRecordsDisplay * 1 :\r\n\t\t\t\tthis.aiDisplay.length;\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Get the display end point - aiDisplay index\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnDisplayEnd\": function ()\r\n\t\t{\r\n\t\t\tvar\r\n\t\t\t\tlen = this._iDisplayLength,\r\n\t\t\t\tstart = this._iDisplayStart,\r\n\t\t\t\tcalc = start + len,\r\n\t\t\t\trecords = this.aiDisplay.length,\r\n\t\t\t\tfeatures = this.oFeatures,\r\n\t\t\t\tpaginate = features.bPaginate;\r\n\t\r\n\t\t\tif ( features.bServerSide ) {\r\n\t\t\t\treturn paginate === false || len === -1 ?\r\n\t\t\t\t\tstart + records :\r\n\t\t\t\t\tMath.min( start+len, this._iRecordsDisplay );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\treturn ! paginate || calc>records || len===-1 ?\r\n\t\t\t\t\trecords :\r\n\t\t\t\t\tcalc;\r\n\t\t\t}\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * The DataTables object for this table\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oInstance\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique identifier for each instance of the DataTables object. If there\r\n\t\t * is an ID on the table node, then it takes that value, otherwise an\r\n\t\t * incrementing internal counter is used.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sInstance\": null,\r\n\t\r\n\t\t/**\r\n\t\t * tabindex attribute value that is added to DataTables control elements, allowing\r\n\t\t * keyboard navigation of the table and its controls.\r\n\t\t */\r\n\t\t\"iTabIndex\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * DIV container for the footer scrolling table if scrolling\r\n\t\t */\r\n\t\t\"nScrollHead\": null,\r\n\t\r\n\t\t/**\r\n\t\t * DIV container for the footer scrolling table if scrolling\r\n\t\t */\r\n\t\t\"nScrollFoot\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Last applied sort\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aLastSort\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Stored plug-in instances\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"oPlugins\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Function used to get a row's id from the row's data\r\n\t\t * @type function\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"rowIdFn\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Data location where to store a row's id\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"rowId\": null\r\n\t};\r\n\r\n\t/**\r\n\t * Extension object for DataTables that is used to provide all extension\r\n\t * options.\r\n\t *\r\n\t * Note that the `DataTable.ext` object is available through\r\n\t * `jQuery.fn.dataTable.ext` where it may be accessed and manipulated. It is\r\n\t * also aliased to `jQuery.fn.dataTableExt` for historic reasons.\r\n\t * @namespace\r\n\t * @extends DataTable.models.ext\r\n\t */\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables extensions\r\n\t * \r\n\t * This namespace acts as a collection area for plug-ins that can be used to\r\n\t * extend DataTables capabilities. Indeed many of the build in methods\r\n\t * use this method to provide their own capabilities (sorting methods for\r\n\t * example).\r\n\t *\r\n\t * Note that this namespace is aliased to `jQuery.fn.dataTableExt` for legacy\r\n\t * reasons\r\n\t *\r\n\t * @namespace\r\n\t */\r\n\tDataTable.ext = _ext = {\r\n\t\t/**\r\n\t\t * Buttons. For use with the Buttons extension for DataTables. This is\r\n\t\t * defined here so other extensions can define buttons regardless of load\r\n\t\t * order. It is _not_ used by DataTables core.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tbuttons: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Element class names\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tclasses: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables build type (expanded by the download builder)\r\n\t\t *\r\n\t\t * @type string\r\n\t\t */\r\n\t\tbuild:\"dt/dt-1.10.16\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Error reporting.\r\n\t\t * \r\n\t\t * How should DataTables report an error. Can take the value 'alert',\r\n\t\t * 'throw', 'none' or a function.\r\n\t\t *\r\n\t\t * @type string|function\r\n\t\t * @default alert\r\n\t\t */\r\n\t\terrMode: \"alert\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Feature plug-ins.\r\n\t\t * \r\n\t\t * This is an array of objects which describe the feature plug-ins that are\r\n\t\t * available to DataTables. These feature plug-ins are then available for\r\n\t\t * use through the `dom` initialisation option.\r\n\t\t * \r\n\t\t * Each feature plug-in is described by an object which must have the\r\n\t\t * following properties:\r\n\t\t * \r\n\t\t * * `fnInit` - function that is used to initialise the plug-in,\r\n\t\t * * `cFeature` - a character so the feature can be enabled by the `dom`\r\n\t\t * instillation option. This is case sensitive.\r\n\t\t *\r\n\t\t * The `fnInit` function has the following input parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t *\r\n\t\t * And the following return is expected:\r\n\t\t * \r\n\t\t * * {node|null} The element which contains your feature. Note that the\r\n\t\t * return may also be void if your plug-in does not require to inject any\r\n\t\t * DOM elements into DataTables control (`dom`) - for example this might\r\n\t\t * be useful when developing a plug-in which allows table control via\r\n\t\t * keyboard entry\r\n\t\t *\r\n\t\t * @type array\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $.fn.dataTable.ext.features.push( {\r\n\t\t * \"fnInit\": function( oSettings ) {\r\n\t\t * return new TableTools( { \"oDTSettings\": oSettings } );\r\n\t\t * },\r\n\t\t * \"cFeature\": \"T\"\r\n\t\t * } );\r\n\t\t */\r\n\t\tfeature: [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Row searching.\r\n\t\t * \r\n\t\t * This method of searching is complimentary to the default type based\r\n\t\t * searching, and a lot more comprehensive as it allows you complete control\r\n\t\t * over the searching logic. Each element in this array is a function\r\n\t\t * (parameters described below) that is called for every row in the table,\r\n\t\t * and your logic decides if it should be included in the searching data set\r\n\t\t * or not.\r\n\t\t *\r\n\t\t * Searching functions have the following input parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * 2. `{array|object}` Data for the row to be processed (same as the\r\n\t\t * original format that was passed in as the data source, or an array\r\n\t\t * from a DOM data source\r\n\t\t * 3. `{int}` Row index ({@link DataTable.models.oSettings.aoData}), which\r\n\t\t * can be useful to retrieve the `TR` element if you need DOM interaction.\r\n\t\t *\r\n\t\t * And the following return is expected:\r\n\t\t *\r\n\t\t * * {boolean} Include the row in the searched result set (true) or not\r\n\t\t * (false)\r\n\t\t *\r\n\t\t * Note that as with the main search ability in DataTables, technically this\r\n\t\t * is \"filtering\", since it is subtractive. However, for consistency in\r\n\t\t * naming we call it searching here.\r\n\t\t *\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // The following example shows custom search being applied to the\r\n\t\t * // fourth column (i.e. the data[3] index) based on two input values\r\n\t\t * // from the end-user, matching the data in a certain range.\r\n\t\t * $.fn.dataTable.ext.search.push(\r\n\t\t * function( settings, data, dataIndex ) {\r\n\t\t * var min = document.getElementById('min').value * 1;\r\n\t\t * var max = document.getElementById('max').value * 1;\r\n\t\t * var version = data[3] == \"-\" ? 0 : data[3]*1;\r\n\t\t *\r\n\t\t * if ( min == \"\" && max == \"\" ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min == \"\" && version < max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min < version && \"\" == max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min < version && version < max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * );\r\n\t\t */\r\n\t\tsearch: [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Selector extensions\r\n\t\t *\r\n\t\t * The `selector` option can be used to extend the options available for the\r\n\t\t * selector modifier options (`selector-modifier` object data type) that\r\n\t\t * each of the three built in selector types offer (row, column and cell +\r\n\t\t * their plural counterparts). For example the Select extension uses this\r\n\t\t * mechanism to provide an option to select only rows, columns and cells\r\n\t\t * that have been marked as selected by the end user (`{selected: true}`),\r\n\t\t * which can be used in conjunction with the existing built in selector\r\n\t\t * options.\r\n\t\t *\r\n\t\t * Each property is an array to which functions can be pushed. The functions\r\n\t\t * take three attributes:\r\n\t\t *\r\n\t\t * * Settings object for the host table\r\n\t\t * * Options object (`selector-modifier` object type)\r\n\t\t * * Array of selected item indexes\r\n\t\t *\r\n\t\t * The return is an array of the resulting item indexes after the custom\r\n\t\t * selector has been applied.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t */\r\n\t\tselector: {\r\n\t\t\tcell: [],\r\n\t\t\tcolumn: [],\r\n\t\t\trow: []\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Internal functions, exposed for used in plug-ins.\r\n\t\t * \r\n\t\t * Please note that you should not need to use the internal methods for\r\n\t\t * anything other than a plug-in (and even then, try to avoid if possible).\r\n\t\t * The internal function may change between releases.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tinternal: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Legacy configuration options. Enable and disable legacy options that\r\n\t\t * are available in DataTables.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t */\r\n\t\tlegacy: {\r\n\t\t\t/**\r\n\t\t\t * Enable / disable DataTables 1.9 compatible server-side processing\r\n\t\t\t * requests\r\n\t\t\t *\r\n\t\t\t * @type boolean\r\n\t\t\t * @default null\r\n\t\t\t */\r\n\t\t\tajax: null\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Pagination plug-in methods.\r\n\t\t * \r\n\t\t * Each entry in this object is a function and defines which buttons should\r\n\t\t * be shown by the pagination rendering method that is used for the table:\r\n\t\t * {@link DataTable.ext.renderer.pageButton}. The renderer addresses how the\r\n\t\t * buttons are displayed in the document, while the functions here tell it\r\n\t\t * what buttons to display. This is done by returning an array of button\r\n\t\t * descriptions (what each button will do).\r\n\t\t *\r\n\t\t * Pagination types (the four built in options and any additional plug-in\r\n\t\t * options defined here) can be used through the `paginationType`\r\n\t\t * initialisation parameter.\r\n\t\t *\r\n\t\t * The functions defined take two parameters:\r\n\t\t *\r\n\t\t * 1. `{int} page` The current page index\r\n\t\t * 2. `{int} pages` The number of pages in the table\r\n\t\t *\r\n\t\t * Each function is expected to return an array where each element of the\r\n\t\t * array can be one of:\r\n\t\t *\r\n\t\t * * `first` - Jump to first page when activated\r\n\t\t * * `last` - Jump to last page when activated\r\n\t\t * * `previous` - Show previous page when activated\r\n\t\t * * `next` - Show next page when activated\r\n\t\t * * `{int}` - Show page of the index given\r\n\t\t * * `{array}` - A nested array containing the above elements to add a\r\n\t\t * containing 'DIV' element (might be useful for styling).\r\n\t\t *\r\n\t\t * Note that DataTables v1.9- used this object slightly differently whereby\r\n\t\t * an object with two functions would be defined for each plug-in. That\r\n\t\t * ability is still supported by DataTables 1.10+ to provide backwards\r\n\t\t * compatibility, but this option of use is now decremented and no longer\r\n\t\t * documented in DataTables 1.10+.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Show previous, next and current page buttons only\r\n\t\t * $.fn.dataTableExt.oPagination.current = function ( page, pages ) {\r\n\t\t * return [ 'previous', page, 'next' ];\r\n\t\t * };\r\n\t\t */\r\n\t\tpager: {},\r\n\t\r\n\t\r\n\t\trenderer: {\r\n\t\t\tpageButton: {},\r\n\t\t\theader: {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Ordering plug-ins - custom data source\r\n\t\t * \r\n\t\t * The extension options for ordering of data available here is complimentary\r\n\t\t * to the default type based ordering that DataTables typically uses. It\r\n\t\t * allows much greater control over the the data that is being used to\r\n\t\t * order a column, but is necessarily therefore more complex.\r\n\t\t * \r\n\t\t * This type of ordering is useful if you want to do ordering based on data\r\n\t\t * live from the DOM (for example the contents of an 'input' element) rather\r\n\t\t * than just the static string that DataTables knows of.\r\n\t\t * \r\n\t\t * The way these plug-ins work is that you create an array of the values you\r\n\t\t * wish to be ordering for the column in question and then return that\r\n\t\t * array. The data in the array much be in the index order of the rows in\r\n\t\t * the table (not the currently ordering order!). Which order data gathering\r\n\t\t * function is run here depends on the `dt-init columns.orderDataType`\r\n\t\t * parameter that is used for the column (if any).\r\n\t\t *\r\n\t\t * The functions defined take two parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * 2. `{int}` Target column index\r\n\t\t *\r\n\t\t * Each function is expected to return an array:\r\n\t\t *\r\n\t\t * * `{array}` Data for the column to be ordering upon\r\n\t\t *\r\n\t\t * @type array\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Ordering using `input` node values\r\n\t\t * $.fn.dataTable.ext.order['dom-text'] = function ( settings, col )\r\n\t\t * {\r\n\t\t * return this.api().column( col, {order:'index'} ).nodes().map( function ( td, i ) {\r\n\t\t * return $('input', td).val();\r\n\t\t * } );\r\n\t\t * }\r\n\t\t */\r\n\t\torder: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Type based plug-ins.\r\n\t\t *\r\n\t\t * Each column in DataTables has a type assigned to it, either by automatic\r\n\t\t * detection or by direct assignment using the `type` option for the column.\r\n\t\t * The type of a column will effect how it is ordering and search (plug-ins\r\n\t\t * can also make use of the column type if required).\r\n\t\t *\r\n\t\t * @namespace\r\n\t\t */\r\n\t\ttype: {\r\n\t\t\t/**\r\n\t\t\t * Type detection functions.\r\n\t\t\t *\r\n\t\t\t * The functions defined in this object are used to automatically detect\r\n\t\t\t * a column's type, making initialisation of DataTables super easy, even\r\n\t\t\t * when complex data is in the table.\r\n\t\t\t *\r\n\t\t\t * The functions defined take two parameters:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be analysed\r\n\t\t * 2. `{settings}` DataTables settings object. This can be used to\r\n\t\t * perform context specific type detection - for example detection\r\n\t\t * based on language settings such as using a comma for a decimal\r\n\t\t * place. Generally speaking the options from the settings will not\r\n\t\t * be required\r\n\t\t\t *\r\n\t\t\t * Each function is expected to return:\r\n\t\t\t *\r\n\t\t\t * * `{string|null}` Data type detected, or null if unknown (and thus\r\n\t\t\t * pass it on to the other type detection functions.\r\n\t\t\t *\r\n\t\t\t * @type array\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Currency type detection plug-in:\r\n\t\t\t * $.fn.dataTable.ext.type.detect.push(\r\n\t\t\t * function ( data, settings ) {\r\n\t\t\t * // Check the numeric part\r\n\t\t\t * if ( ! $.isNumeric( data.substring(1) ) ) {\r\n\t\t\t * return null;\r\n\t\t\t * }\r\n\t\t\t *\r\n\t\t\t * // Check prefixed by currency\r\n\t\t\t * if ( data.charAt(0) == '$' || data.charAt(0) == '£' ) {\r\n\t\t\t * return 'currency';\r\n\t\t\t * }\r\n\t\t\t * return null;\r\n\t\t\t * }\r\n\t\t\t * );\r\n\t\t\t */\r\n\t\t\tdetect: [],\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Type based search formatting.\r\n\t\t\t *\r\n\t\t\t * The type based searching functions can be used to pre-format the\r\n\t\t\t * data to be search on. For example, it can be used to strip HTML\r\n\t\t\t * tags or to de-format telephone numbers for numeric only searching.\r\n\t\t\t *\r\n\t\t\t * Note that is a search is not defined for a column of a given type,\r\n\t\t\t * no search formatting will be performed.\r\n\t\t\t * \r\n\t\t\t * Pre-processing of searching data plug-ins - When you assign the sType\r\n\t\t\t * for a column (or have it automatically detected for you by DataTables\r\n\t\t\t * or a type detection plug-in), you will typically be using this for\r\n\t\t\t * custom sorting, but it can also be used to provide custom searching\r\n\t\t\t * by allowing you to pre-processing the data and returning the data in\r\n\t\t\t * the format that should be searched upon. This is done by adding\r\n\t\t\t * functions this object with a parameter name which matches the sType\r\n\t\t\t * for that target column. This is the corollary of afnSortData\r\n\t\t\t * for searching data.\r\n\t\t\t *\r\n\t\t\t * The functions defined take a single parameter:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be prepared for searching\r\n\t\t\t *\r\n\t\t\t * Each function is expected to return:\r\n\t\t\t *\r\n\t\t\t * * `{string|null}` Formatted string that will be used for the searching.\r\n\t\t\t *\r\n\t\t\t * @type object\r\n\t\t\t * @default {}\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $.fn.dataTable.ext.type.search['title-numeric'] = function ( d ) {\r\n\t\t\t * return d.replace(/\\n/g,\" \").replace( /<.*?>/g, \"\" );\r\n\t\t\t * }\r\n\t\t\t */\r\n\t\t\tsearch: {},\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Type based ordering.\r\n\t\t\t *\r\n\t\t\t * The column type tells DataTables what ordering to apply to the table\r\n\t\t\t * when a column is sorted upon. The order for each type that is defined,\r\n\t\t\t * is defined by the functions available in this object.\r\n\t\t\t *\r\n\t\t\t * Each ordering option can be described by three properties added to\r\n\t\t\t * this object:\r\n\t\t\t *\r\n\t\t\t * * `{type}-pre` - Pre-formatting function\r\n\t\t\t * * `{type}-asc` - Ascending order function\r\n\t\t\t * * `{type}-desc` - Descending order function\r\n\t\t\t *\r\n\t\t\t * All three can be used together, only `{type}-pre` or only\r\n\t\t\t * `{type}-asc` and `{type}-desc` together. It is generally recommended\r\n\t\t\t * that only `{type}-pre` is used, as this provides the optimal\r\n\t\t\t * implementation in terms of speed, although the others are provided\r\n\t\t\t * for compatibility with existing Javascript sort functions.\r\n\t\t\t *\r\n\t\t\t * `{type}-pre`: Functions defined take a single parameter:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be prepared for ordering\r\n\t\t\t *\r\n\t\t\t * And return:\r\n\t\t\t *\r\n\t\t\t * * `{*}` Data to be sorted upon\r\n\t\t\t *\r\n\t\t\t * `{type}-asc` and `{type}-desc`: Functions are typical Javascript sort\r\n\t\t\t * functions, taking two parameters:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data to compare to the second parameter\r\n\t\t * 2. `{*}` Data to compare to the first parameter\r\n\t\t\t *\r\n\t\t\t * And returning:\r\n\t\t\t *\r\n\t\t\t * * `{*}` Ordering match: <0 if first parameter should be sorted lower\r\n\t\t\t * than the second parameter, ===0 if the two parameters are equal and\r\n\t\t\t * >0 if the first parameter should be sorted height than the second\r\n\t\t\t * parameter.\r\n\t\t\t * \r\n\t\t\t * @type object\r\n\t\t\t * @default {}\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Numeric ordering of formatted numbers with a pre-formatter\r\n\t\t\t * $.extend( $.fn.dataTable.ext.type.order, {\r\n\t\t\t * \"string-pre\": function(x) {\r\n\t\t\t * a = (a === \"-\" || a === \"\") ? 0 : a.replace( /[^\\d\\-\\.]/g, \"\" );\r\n\t\t\t * return parseFloat( a );\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Case-sensitive string ordering, with no pre-formatting method\r\n\t\t\t * $.extend( $.fn.dataTable.ext.order, {\r\n\t\t\t * \"string-case-asc\": function(x,y) {\r\n\t\t\t * return ((x < y) ? -1 : ((x > y) ? 1 : 0));\r\n\t\t\t * },\r\n\t\t\t * \"string-case-desc\": function(x,y) {\r\n\t\t\t * return ((x < y) ? 1 : ((x > y) ? -1 : 0));\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\torder: {}\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Unique DataTables instance counter\r\n\t\t *\r\n\t\t * @type int\r\n\t\t * @private\r\n\t\t */\r\n\t\t_unique: 0,\r\n\t\r\n\t\r\n\t\t//\r\n\t\t// Depreciated\r\n\t\t// The following properties are retained for backwards compatiblity only.\r\n\t\t// The should not be used in new projects and will be removed in a future\r\n\t\t// version\r\n\t\t//\r\n\t\r\n\t\t/**\r\n\t\t * Version check function.\r\n\t\t * @type function\r\n\t\t * @depreciated Since 1.10\r\n\t\t */\r\n\t\tfnVersionCheck: DataTable.fnVersionCheck,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Index for what 'this' index API functions should use\r\n\t\t * @type int\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\tiApiIndex: 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * jQuery UI class container\r\n\t\t * @type object\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\toJUIClasses: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Software version\r\n\t\t * @type string\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\tsVersion: DataTable.version\r\n\t};\r\n\t\r\n\t\r\n\t//\r\n\t// Backwards compatibility. Alias to pre 1.10 Hungarian notation counter parts\r\n\t//\r\n\t$.extend( _ext, {\r\n\t\tafnFiltering: _ext.search,\r\n\t\taTypes: _ext.type.detect,\r\n\t\tofnSearch: _ext.type.search,\r\n\t\toSort: _ext.type.order,\r\n\t\tafnSortData: _ext.order,\r\n\t\taoFeatures: _ext.feature,\r\n\t\toApi: _ext.internal,\r\n\t\toStdClasses: _ext.classes,\r\n\t\toPagination: _ext.pager\r\n\t} );\r\n\t\r\n\t\r\n\t$.extend( DataTable.ext.classes, {\r\n\t\t\"sTable\": \"dataTable\",\r\n\t\t\"sNoFooter\": \"no-footer\",\r\n\t\r\n\t\t/* Paging buttons */\r\n\t\t\"sPageButton\": \"paginate_button\",\r\n\t\t\"sPageButtonActive\": \"current\",\r\n\t\t\"sPageButtonDisabled\": \"disabled\",\r\n\t\r\n\t\t/* Striping classes */\r\n\t\t\"sStripeOdd\": \"odd\",\r\n\t\t\"sStripeEven\": \"even\",\r\n\t\r\n\t\t/* Empty row */\r\n\t\t\"sRowEmpty\": \"dataTables_empty\",\r\n\t\r\n\t\t/* Features */\r\n\t\t\"sWrapper\": \"dataTables_wrapper\",\r\n\t\t\"sFilter\": \"dataTables_filter\",\r\n\t\t\"sInfo\": \"dataTables_info\",\r\n\t\t\"sPaging\": \"dataTables_paginate paging_\", /* Note that the type is postfixed */\r\n\t\t\"sLength\": \"dataTables_length\",\r\n\t\t\"sProcessing\": \"dataTables_processing\",\r\n\t\r\n\t\t/* Sorting */\r\n\t\t\"sSortAsc\": \"sorting_asc\",\r\n\t\t\"sSortDesc\": \"sorting_desc\",\r\n\t\t\"sSortable\": \"sorting\", /* Sortable in both directions */\r\n\t\t\"sSortableAsc\": \"sorting_asc_disabled\",\r\n\t\t\"sSortableDesc\": \"sorting_desc_disabled\",\r\n\t\t\"sSortableNone\": \"sorting_disabled\",\r\n\t\t\"sSortColumn\": \"sorting_\", /* Note that an int is postfixed for the sorting order */\r\n\t\r\n\t\t/* Filtering */\r\n\t\t\"sFilterInput\": \"\",\r\n\t\r\n\t\t/* Page length */\r\n\t\t\"sLengthSelect\": \"\",\r\n\t\r\n\t\t/* Scrolling */\r\n\t\t\"sScrollWrapper\": \"dataTables_scroll\",\r\n\t\t\"sScrollHead\": \"dataTables_scrollHead\",\r\n\t\t\"sScrollHeadInner\": \"dataTables_scrollHeadInner\",\r\n\t\t\"sScrollBody\": \"dataTables_scrollBody\",\r\n\t\t\"sScrollFoot\": \"dataTables_scrollFoot\",\r\n\t\t\"sScrollFootInner\": \"dataTables_scrollFootInner\",\r\n\t\r\n\t\t/* Misc */\r\n\t\t\"sHeaderTH\": \"\",\r\n\t\t\"sFooterTH\": \"\",\r\n\t\r\n\t\t// Deprecated\r\n\t\t\"sSortJUIAsc\": \"\",\r\n\t\t\"sSortJUIDesc\": \"\",\r\n\t\t\"sSortJUI\": \"\",\r\n\t\t\"sSortJUIAscAllowed\": \"\",\r\n\t\t\"sSortJUIDescAllowed\": \"\",\r\n\t\t\"sSortJUIWrapper\": \"\",\r\n\t\t\"sSortIcon\": \"\",\r\n\t\t\"sJUIHeader\": \"\",\r\n\t\t\"sJUIFooter\": \"\"\r\n\t} );\r\n\t\r\n\t\r\n\tvar extPagination = DataTable.ext.pager;\r\n\t\r\n\tfunction _numbers ( page, pages ) {\r\n\t\tvar\r\n\t\t\tnumbers = [],\r\n\t\t\tbuttons = extPagination.numbers_length,\r\n\t\t\thalf = Math.floor( buttons / 2 ),\r\n\t\t\ti = 1;\r\n\t\r\n\t\tif ( pages <= buttons ) {\r\n\t\t\tnumbers = _range( 0, pages );\r\n\t\t}\r\n\t\telse if ( page <= half ) {\r\n\t\t\tnumbers = _range( 0, buttons-2 );\r\n\t\t\tnumbers.push( 'ellipsis' );\r\n\t\t\tnumbers.push( pages-1 );\r\n\t\t}\r\n\t\telse if ( page >= pages - 1 - half ) {\r\n\t\t\tnumbers = _range( pages-(buttons-2), pages );\r\n\t\t\tnumbers.splice( 0, 0, 'ellipsis' ); // no unshift in ie6\r\n\t\t\tnumbers.splice( 0, 0, 0 );\r\n\t\t}\r\n\t\telse {\r\n\t\t\tnumbers = _range( page-half+2, page+half-1 );\r\n\t\t\tnumbers.push( 'ellipsis' );\r\n\t\t\tnumbers.push( pages-1 );\r\n\t\t\tnumbers.splice( 0, 0, 'ellipsis' );\r\n\t\t\tnumbers.splice( 0, 0, 0 );\r\n\t\t}\r\n\t\r\n\t\tnumbers.DT_el = 'span';\r\n\t\treturn numbers;\r\n\t}\r\n\t\r\n\t\r\n\t$.extend( extPagination, {\r\n\t\tsimple: function ( page, pages ) {\r\n\t\t\treturn [ 'previous', 'next' ];\r\n\t\t},\r\n\t\r\n\t\tfull: function ( page, pages ) {\r\n\t\t\treturn [ 'first', 'previous', 'next', 'last' ];\r\n\t\t},\r\n\t\r\n\t\tnumbers: function ( page, pages ) {\r\n\t\t\treturn [ _numbers(page, pages) ];\r\n\t\t},\r\n\t\r\n\t\tsimple_numbers: function ( page, pages ) {\r\n\t\t\treturn [ 'previous', _numbers(page, pages), 'next' ];\r\n\t\t},\r\n\t\r\n\t\tfull_numbers: function ( page, pages ) {\r\n\t\t\treturn [ 'first', 'previous', _numbers(page, pages), 'next', 'last' ];\r\n\t\t},\r\n\t\t\r\n\t\tfirst_last_numbers: function (page, pages) {\r\n\t \t\treturn ['first', _numbers(page, pages), 'last'];\r\n\t \t},\r\n\t\r\n\t\t// For testing and plug-ins to use\r\n\t\t_numbers: _numbers,\r\n\t\r\n\t\t// Number of number buttons (including ellipsis) to show. _Must be odd!_\r\n\t\tnumbers_length: 7\r\n\t} );\r\n\t\r\n\t\r\n\t$.extend( true, DataTable.ext.renderer, {\r\n\t\tpageButton: {\r\n\t\t\t_: function ( settings, host, idx, buttons, page, pages ) {\r\n\t\t\t\tvar classes = settings.oClasses;\r\n\t\t\t\tvar lang = settings.oLanguage.oPaginate;\r\n\t\t\t\tvar aria = settings.oLanguage.oAria.paginate || {};\r\n\t\t\t\tvar btnDisplay, btnClass, counter=0;\r\n\t\r\n\t\t\t\tvar attach = function( container, buttons ) {\r\n\t\t\t\t\tvar i, ien, node, button;\r\n\t\t\t\t\tvar clickHandler = function ( e ) {\r\n\t\t\t\t\t\t_fnPageChange( settings, e.data.action, true );\r\n\t\t\t\t\t};\r\n\t\r\n\t\t\t\t\tfor ( i=0, ien=buttons.length ; i' )\r\n\t\t\t\t\t\t\t\t.appendTo( container );\r\n\t\t\t\t\t\t\tattach( inner, button );\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t\telse {\r\n\t\t\t\t\t\t\tbtnDisplay = null;\r\n\t\t\t\t\t\t\tbtnClass = '';\r\n\t\r\n\t\t\t\t\t\t\tswitch ( button ) {\r\n\t\t\t\t\t\t\t\tcase 'ellipsis':\r\n\t\t\t\t\t\t\t\t\tcontainer.append('…');\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'first':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sFirst;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page > 0 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'previous':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sPrevious;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page > 0 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'next':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sNext;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page < pages-1 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'last':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sLast;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page < pages-1 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tdefault:\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = button + 1;\r\n\t\t\t\t\t\t\t\t\tbtnClass = page === button ?\r\n\t\t\t\t\t\t\t\t\t\tclasses.sPageButtonActive : '';\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\t\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t\t\tif ( btnDisplay !== null ) {\r\n\t\t\t\t\t\t\t\tnode = $('', {\r\n\t\t\t\t\t\t\t\t\t\t'class': classes.sPageButton+' '+btnClass,\r\n\t\t\t\t\t\t\t\t\t\t'aria-controls': settings.sTableId,\r\n\t\t\t\t\t\t\t\t\t\t'aria-label': aria[ button ],\r\n\t\t\t\t\t\t\t\t\t\t'data-dt-idx': counter,\r\n\t\t\t\t\t\t\t\t\t\t'tabindex': settings.iTabIndex,\r\n\t\t\t\t\t\t\t\t\t\t'id': idx === 0 && typeof button === 'string' ?\r\n\t\t\t\t\t\t\t\t\t\t\tsettings.sTableId +'_'+ button :\r\n\t\t\t\t\t\t\t\t\t\t\tnull\r\n\t\t\t\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t\t\t\t.html( btnDisplay )\r\n\t\t\t\t\t\t\t\t\t.appendTo( container );\r\n\t\r\n\t\t\t\t\t\t\t\t_fnBindAction(\r\n\t\t\t\t\t\t\t\t\tnode, {action: button}, clickHandler\r\n\t\t\t\t\t\t\t\t);\r\n\t\r\n\t\t\t\t\t\t\t\tcounter++;\r\n\t\t\t\t\t\t\t}\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t}\r\n\t\t\t\t};\r\n\t\r\n\t\t\t\t// IE9 throws an 'unknown error' if document.activeElement is used\r\n\t\t\t\t// inside an iframe or frame. Try / catch the error. Not good for\r\n\t\t\t\t// accessibility, but neither are frames.\r\n\t\t\t\tvar activeEl;\r\n\t\r\n\t\t\t\ttry {\r\n\t\t\t\t\t// Because this approach is destroying and recreating the paging\r\n\t\t\t\t\t// elements, focus is lost on the select button which is bad for\r\n\t\t\t\t\t// accessibility. So we want to restore focus once the draw has\r\n\t\t\t\t\t// completed\r\n\t\t\t\t\tactiveEl = $(host).find(document.activeElement).data('dt-idx');\r\n\t\t\t\t}\r\n\t\t\t\tcatch (e) {}\r\n\t\r\n\t\t\t\tattach( $(host).empty(), buttons );\r\n\t\r\n\t\t\t\tif ( activeEl !== undefined ) {\r\n\t\t\t\t\t$(host).find( '[data-dt-idx='+activeEl+']' ).focus();\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\t// Built in type detection. See model.ext.aTypes for information about\r\n\t// what is required from this methods.\r\n\t$.extend( DataTable.ext.type.detect, [\r\n\t\t// Plain numbers - first since V8 detects some plain numbers as dates\r\n\t\t// e.g. Date.parse('55') (but not all, e.g. Date.parse('22')...).\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _isNumber( d, decimal ) ? 'num'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// Dates (only those recognised by the browser's Date.parse)\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\t// V8 tries _very_ hard to make a string passed into `Date.parse()`\r\n\t\t\t// valid, so we need to use a regex to restrict date formats. Use a\r\n\t\t\t// plug-in for anything other than ISO8601 style strings\r\n\t\t\tif ( d && !(d instanceof Date) && ! _re_date.test(d) ) {\r\n\t\t\t\treturn null;\r\n\t\t\t}\r\n\t\t\tvar parsed = Date.parse(d);\r\n\t\t\treturn (parsed !== null && !isNaN(parsed)) || _empty(d) ? 'date' : null;\r\n\t\t},\r\n\t\r\n\t\t// Formatted numbers\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _isNumber( d, decimal, true ) ? 'num-fmt'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML numeric\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _htmlNumeric( d, decimal ) ? 'html-num'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML numeric, formatted\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _htmlNumeric( d, decimal, true ) ? 'html-num-fmt'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML (this is strict checking - there must be html)\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\treturn _empty( d ) || (typeof d === 'string' && d.indexOf('<') !== -1) ?\r\n\t\t\t\t'html' : null;\r\n\t\t}\r\n\t] );\r\n\t\r\n\t\r\n\t\r\n\t// Filter formatting functions. See model.ext.ofnSearch for information about\r\n\t// what is required from these methods.\r\n\t// \r\n\t// Note that additional search methods are added for the html numbers and\r\n\t// html formatted numbers by `_addNumericSort()` when we know what the decimal\r\n\t// place is\r\n\t\r\n\t\r\n\t$.extend( DataTable.ext.type.search, {\r\n\t\thtml: function ( data ) {\r\n\t\t\treturn _empty(data) ?\r\n\t\t\t\tdata :\r\n\t\t\t\ttypeof data === 'string' ?\r\n\t\t\t\t\tdata\r\n\t\t\t\t\t\t.replace( _re_new_lines, \" \" )\r\n\t\t\t\t\t\t.replace( _re_html, \"\" ) :\r\n\t\t\t\t\t'';\r\n\t\t},\r\n\t\r\n\t\tstring: function ( data ) {\r\n\t\t\treturn _empty(data) ?\r\n\t\t\t\tdata :\r\n\t\t\t\ttypeof data === 'string' ?\r\n\t\t\t\t\tdata.replace( _re_new_lines, \" \" ) :\r\n\t\t\t\t\tdata;\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\tvar __numericReplace = function ( d, decimalPlace, re1, re2 ) {\r\n\t\tif ( d !== 0 && (!d || d === '-') ) {\r\n\t\t\treturn -Infinity;\r\n\t\t}\r\n\t\r\n\t\t// If a decimal place other than `.` is used, it needs to be given to the\r\n\t\t// function so we can detect it and replace with a `.` which is the only\r\n\t\t// decimal place Javascript recognises - it is not locale aware.\r\n\t\tif ( decimalPlace ) {\r\n\t\t\td = _numToDecimal( d, decimalPlace );\r\n\t\t}\r\n\t\r\n\t\tif ( d.replace ) {\r\n\t\t\tif ( re1 ) {\r\n\t\t\t\td = d.replace( re1, '' );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( re2 ) {\r\n\t\t\t\td = d.replace( re2, '' );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn d * 1;\r\n\t};\r\n\t\r\n\t\r\n\t// Add the numeric 'deformatting' functions for sorting and search. This is done\r\n\t// in a function to provide an easy ability for the language options to add\r\n\t// additional methods if a non-period decimal place is used.\r\n\tfunction _addNumericSort ( decimalPlace ) {\r\n\t\t$.each(\r\n\t\t\t{\r\n\t\t\t\t// Plain numbers\r\n\t\t\t\t\"num\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// Formatted numbers\r\n\t\t\t\t\"num-fmt\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_formatted_numeric );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// HTML numeric\r\n\t\t\t\t\"html-num\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_html );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// HTML numeric, formatted\r\n\t\t\t\t\"html-num-fmt\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_html, _re_formatted_numeric );\r\n\t\t\t\t}\r\n\t\t\t},\r\n\t\t\tfunction ( key, fn ) {\r\n\t\t\t\t// Add the ordering method\r\n\t\t\t\t_ext.type.order[ key+decimalPlace+'-pre' ] = fn;\r\n\t\r\n\t\t\t\t// For HTML types add a search formatter that will strip the HTML\r\n\t\t\t\tif ( key.match(/^html\\-/) ) {\r\n\t\t\t\t\t_ext.type.search[ key+decimalPlace ] = _ext.type.search.html;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t);\r\n\t}\r\n\t\r\n\t\r\n\t// Default sort methods\r\n\t$.extend( _ext.type.order, {\r\n\t\t// Dates\r\n\t\t\"date-pre\": function ( d ) {\r\n\t\t\treturn Date.parse( d ) || -Infinity;\r\n\t\t},\r\n\t\r\n\t\t// html\r\n\t\t\"html-pre\": function ( a ) {\r\n\t\t\treturn _empty(a) ?\r\n\t\t\t\t'' :\r\n\t\t\t\ta.replace ?\r\n\t\t\t\t\ta.replace( /<.*?>/g, \"\" ).toLowerCase() :\r\n\t\t\t\t\ta+'';\r\n\t\t},\r\n\t\r\n\t\t// string\r\n\t\t\"string-pre\": function ( a ) {\r\n\t\t\t// This is a little complex, but faster than always calling toString,\r\n\t\t\t// http://jsperf.com/tostring-v-check\r\n\t\t\treturn _empty(a) ?\r\n\t\t\t\t'' :\r\n\t\t\t\ttypeof a === 'string' ?\r\n\t\t\t\t\ta.toLowerCase() :\r\n\t\t\t\t\t! a.toString ?\r\n\t\t\t\t\t\t'' :\r\n\t\t\t\t\t\ta.toString();\r\n\t\t},\r\n\t\r\n\t\t// string-asc and -desc are retained only for compatibility with the old\r\n\t\t// sort methods\r\n\t\t\"string-asc\": function ( x, y ) {\r\n\t\t\treturn ((x < y) ? -1 : ((x > y) ? 1 : 0));\r\n\t\t},\r\n\t\r\n\t\t\"string-desc\": function ( x, y ) {\r\n\t\t\treturn ((x < y) ? 1 : ((x > y) ? -1 : 0));\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t// Numeric sorting types - order doesn't matter here\r\n\t_addNumericSort( '' );\r\n\t\r\n\t\r\n\t$.extend( true, DataTable.ext.renderer, {\r\n\t\theader: {\r\n\t\t\t_: function ( settings, cell, column, classes ) {\r\n\t\t\t\t// No additional mark-up required\r\n\t\t\t\t// Attach a sort listener to update on sort - note that using the\r\n\t\t\t\t// `DT` namespace will allow the event to be removed automatically\r\n\t\t\t\t// on destroy, while the `dt` namespaced event is the one we are\r\n\t\t\t\t// listening for\r\n\t\t\t\t$(settings.nTable).on( 'order.dt.DT', function ( e, ctx, sorting, columns ) {\r\n\t\t\t\t\tif ( settings !== ctx ) { // need to check this this is the host\r\n\t\t\t\t\t\treturn; // table, not a nested one\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar colIdx = column.idx;\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.removeClass(\r\n\t\t\t\t\t\t\tcolumn.sSortingClass +' '+\r\n\t\t\t\t\t\t\tclasses.sSortAsc +' '+\r\n\t\t\t\t\t\t\tclasses.sSortDesc\r\n\t\t\t\t\t\t)\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClass\r\n\t\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t},\r\n\t\r\n\t\t\tjqueryui: function ( settings, cell, column, classes ) {\r\n\t\t\t\t$('')\r\n\t\t\t\t\t.addClass( classes.sSortJUIWrapper )\r\n\t\t\t\t\t.append( cell.contents() )\r\n\t\t\t\t\t.append( $('')\r\n\t\t\t\t\t\t.addClass( classes.sSortIcon+' '+column.sSortingClassJUI )\r\n\t\t\t\t\t)\r\n\t\t\t\t\t.appendTo( cell );\r\n\t\r\n\t\t\t\t// Attach a sort listener to update on sort\r\n\t\t\t\t$(settings.nTable).on( 'order.dt.DT', function ( e, ctx, sorting, columns ) {\r\n\t\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\t\treturn;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar colIdx = column.idx;\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.removeClass( classes.sSortAsc +\" \"+classes.sSortDesc )\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClass\r\n\t\t\t\t\t\t);\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.find( 'span.'+classes.sSortIcon )\r\n\t\t\t\t\t\t.removeClass(\r\n\t\t\t\t\t\t\tclasses.sSortJUIAsc +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIDesc +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUI +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIAscAllowed +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIDescAllowed\r\n\t\t\t\t\t\t)\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortJUIAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortJUIDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClassJUI\r\n\t\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t}\r\n\t} );\r\n\t\r\n\t/*\r\n\t * Public helper functions. These aren't used internally by DataTables, or\r\n\t * called by any of the options passed into DataTables, but they can be used\r\n\t * externally by developers working with DataTables. They are helper functions\r\n\t * to make working with DataTables a little bit easier.\r\n\t */\r\n\t\r\n\tvar __htmlEscapeEntities = function ( d ) {\r\n\t\treturn typeof d === 'string' ?\r\n\t\t\td.replace(//g, '>').replace(/\"/g, '"') :\r\n\t\t\td;\r\n\t};\r\n\t\r\n\t/**\r\n\t * Helpers for `columns.render`.\r\n\t *\r\n\t * The options defined here can be used with the `columns.render` initialisation\r\n\t * option to provide a display renderer. The following functions are defined:\r\n\t *\r\n\t * * `number` - Will format numeric data (defined by `columns.data`) for\r\n\t * display, retaining the original unformatted data for sorting and filtering.\r\n\t * It takes 5 parameters:\r\n\t * * `string` - Thousands grouping separator\r\n\t * * `string` - Decimal point indicator\r\n\t * * `integer` - Number of decimal points to show\r\n\t * * `string` (optional) - Prefix.\r\n\t * * `string` (optional) - Postfix (/suffix).\r\n\t * * `text` - Escape HTML to help prevent XSS attacks. It has no optional\r\n\t * parameters.\r\n\t *\r\n\t * @example\r\n\t * // Column definition using the number renderer\r\n\t * {\r\n\t * data: \"salary\",\r\n\t * render: $.fn.dataTable.render.number( '\\'', '.', 0, '$' )\r\n\t * }\r\n\t *\r\n\t * @namespace\r\n\t */\r\n\tDataTable.render = {\r\n\t\tnumber: function ( thousands, decimal, precision, prefix, postfix ) {\r\n\t\t\treturn {\r\n\t\t\t\tdisplay: function ( d ) {\r\n\t\t\t\t\tif ( typeof d !== 'number' && typeof d !== 'string' ) {\r\n\t\t\t\t\t\treturn d;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar negative = d < 0 ? '-' : '';\r\n\t\t\t\t\tvar flo = parseFloat( d );\r\n\t\r\n\t\t\t\t\t// If NaN then there isn't much formatting that we can do - just\r\n\t\t\t\t\t// return immediately, escaping any HTML (this was supposed to\r\n\t\t\t\t\t// be a number after all)\r\n\t\t\t\t\tif ( isNaN( flo ) ) {\r\n\t\t\t\t\t\treturn __htmlEscapeEntities( d );\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tflo = flo.toFixed( precision );\r\n\t\t\t\t\td = Math.abs( flo );\r\n\t\r\n\t\t\t\t\tvar intPart = parseInt( d, 10 );\r\n\t\t\t\t\tvar floatPart = precision ?\r\n\t\t\t\t\t\tdecimal+(d - intPart).toFixed( precision ).substring( 2 ):\r\n\t\t\t\t\t\t'';\r\n\t\r\n\t\t\t\t\treturn negative + (prefix||'') +\r\n\t\t\t\t\t\tintPart.toString().replace(\r\n\t\t\t\t\t\t\t/\\B(?=(\\d{3})+(?!\\d))/g, thousands\r\n\t\t\t\t\t\t) +\r\n\t\t\t\t\t\tfloatPart +\r\n\t\t\t\t\t\t(postfix||'');\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\t},\r\n\t\r\n\t\ttext: function () {\r\n\t\t\treturn {\r\n\t\t\t\tdisplay: __htmlEscapeEntities\r\n\t\t\t};\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\t/*\r\n\t * This is really a good bit rubbish this method of exposing the internal methods\r\n\t * publicly... - To be fixed in 2.0 using methods on the prototype\r\n\t */\r\n\t\r\n\t\r\n\t/**\r\n\t * Create a wrapper function for exporting an internal functions to an external API.\r\n\t * @param {string} fn API function name\r\n\t * @returns {function} wrapped function\r\n\t * @memberof DataTable#internal\r\n\t */\r\n\tfunction _fnExternApiFunc (fn)\r\n\t{\r\n\t\treturn function() {\r\n\t\t\tvar args = [_fnSettingsFromNode( this[DataTable.ext.iApiIndex] )].concat(\r\n\t\t\t\tArray.prototype.slice.call(arguments)\r\n\t\t\t);\r\n\t\t\treturn DataTable.ext.internal[fn].apply( this, args );\r\n\t\t};\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Reference to internal functions for use by plug-in developers. Note that\r\n\t * these methods are references to internal functions and are considered to be\r\n\t * private. If you use these methods, be aware that they are liable to change\r\n\t * between versions.\r\n\t * @namespace\r\n\t */\r\n\t$.extend( DataTable.ext.internal, {\r\n\t\t_fnExternApiFunc: _fnExternApiFunc,\r\n\t\t_fnBuildAjax: _fnBuildAjax,\r\n\t\t_fnAjaxUpdate: _fnAjaxUpdate,\r\n\t\t_fnAjaxParameters: _fnAjaxParameters,\r\n\t\t_fnAjaxUpdateDraw: _fnAjaxUpdateDraw,\r\n\t\t_fnAjaxDataSrc: _fnAjaxDataSrc,\r\n\t\t_fnAddColumn: _fnAddColumn,\r\n\t\t_fnColumnOptions: _fnColumnOptions,\r\n\t\t_fnAdjustColumnSizing: _fnAdjustColumnSizing,\r\n\t\t_fnVisibleToColumnIndex: _fnVisibleToColumnIndex,\r\n\t\t_fnColumnIndexToVisible: _fnColumnIndexToVisible,\r\n\t\t_fnVisbleColumns: _fnVisbleColumns,\r\n\t\t_fnGetColumns: _fnGetColumns,\r\n\t\t_fnColumnTypes: _fnColumnTypes,\r\n\t\t_fnApplyColumnDefs: _fnApplyColumnDefs,\r\n\t\t_fnHungarianMap: _fnHungarianMap,\r\n\t\t_fnCamelToHungarian: _fnCamelToHungarian,\r\n\t\t_fnLanguageCompat: _fnLanguageCompat,\r\n\t\t_fnBrowserDetect: _fnBrowserDetect,\r\n\t\t_fnAddData: _fnAddData,\r\n\t\t_fnAddTr: _fnAddTr,\r\n\t\t_fnNodeToDataIndex: _fnNodeToDataIndex,\r\n\t\t_fnNodeToColumnIndex: _fnNodeToColumnIndex,\r\n\t\t_fnGetCellData: _fnGetCellData,\r\n\t\t_fnSetCellData: _fnSetCellData,\r\n\t\t_fnSplitObjNotation: _fnSplitObjNotation,\r\n\t\t_fnGetObjectDataFn: _fnGetObjectDataFn,\r\n\t\t_fnSetObjectDataFn: _fnSetObjectDataFn,\r\n\t\t_fnGetDataMaster: _fnGetDataMaster,\r\n\t\t_fnClearTable: _fnClearTable,\r\n\t\t_fnDeleteIndex: _fnDeleteIndex,\r\n\t\t_fnInvalidate: _fnInvalidate,\r\n\t\t_fnGetRowElements: _fnGetRowElements,\r\n\t\t_fnCreateTr: _fnCreateTr,\r\n\t\t_fnBuildHead: _fnBuildHead,\r\n\t\t_fnDrawHead: _fnDrawHead,\r\n\t\t_fnDraw: _fnDraw,\r\n\t\t_fnReDraw: _fnReDraw,\r\n\t\t_fnAddOptionsHtml: _fnAddOptionsHtml,\r\n\t\t_fnDetectHeader: _fnDetectHeader,\r\n\t\t_fnGetUniqueThs: _fnGetUniqueThs,\r\n\t\t_fnFeatureHtmlFilter: _fnFeatureHtmlFilter,\r\n\t\t_fnFilterComplete: _fnFilterComplete,\r\n\t\t_fnFilterCustom: _fnFilterCustom,\r\n\t\t_fnFilterColumn: _fnFilterColumn,\r\n\t\t_fnFilter: _fnFilter,\r\n\t\t_fnFilterCreateSearch: _fnFilterCreateSearch,\r\n\t\t_fnEscapeRegex: _fnEscapeRegex,\r\n\t\t_fnFilterData: _fnFilterData,\r\n\t\t_fnFeatureHtmlInfo: _fnFeatureHtmlInfo,\r\n\t\t_fnUpdateInfo: _fnUpdateInfo,\r\n\t\t_fnInfoMacros: _fnInfoMacros,\r\n\t\t_fnInitialise: _fnInitialise,\r\n\t\t_fnInitComplete: _fnInitComplete,\r\n\t\t_fnLengthChange: _fnLengthChange,\r\n\t\t_fnFeatureHtmlLength: _fnFeatureHtmlLength,\r\n\t\t_fnFeatureHtmlPaginate: _fnFeatureHtmlPaginate,\r\n\t\t_fnPageChange: _fnPageChange,\r\n\t\t_fnFeatureHtmlProcessing: _fnFeatureHtmlProcessing,\r\n\t\t_fnProcessingDisplay: _fnProcessingDisplay,\r\n\t\t_fnFeatureHtmlTable: _fnFeatureHtmlTable,\r\n\t\t_fnScrollDraw: _fnScrollDraw,\r\n\t\t_fnApplyToChildren: _fnApplyToChildren,\r\n\t\t_fnCalculateColumnWidths: _fnCalculateColumnWidths,\r\n\t\t_fnThrottle: _fnThrottle,\r\n\t\t_fnConvertToWidth: _fnConvertToWidth,\r\n\t\t_fnGetWidestNode: _fnGetWidestNode,\r\n\t\t_fnGetMaxLenString: _fnGetMaxLenString,\r\n\t\t_fnStringToCss: _fnStringToCss,\r\n\t\t_fnSortFlatten: _fnSortFlatten,\r\n\t\t_fnSort: _fnSort,\r\n\t\t_fnSortAria: _fnSortAria,\r\n\t\t_fnSortListener: _fnSortListener,\r\n\t\t_fnSortAttachListener: _fnSortAttachListener,\r\n\t\t_fnSortingClasses: _fnSortingClasses,\r\n\t\t_fnSortData: _fnSortData,\r\n\t\t_fnSaveState: _fnSaveState,\r\n\t\t_fnLoadState: _fnLoadState,\r\n\t\t_fnSettingsFromNode: _fnSettingsFromNode,\r\n\t\t_fnLog: _fnLog,\r\n\t\t_fnMap: _fnMap,\r\n\t\t_fnBindAction: _fnBindAction,\r\n\t\t_fnCallbackReg: _fnCallbackReg,\r\n\t\t_fnCallbackFire: _fnCallbackFire,\r\n\t\t_fnLengthOverflow: _fnLengthOverflow,\r\n\t\t_fnRenderer: _fnRenderer,\r\n\t\t_fnDataSource: _fnDataSource,\r\n\t\t_fnRowAttributes: _fnRowAttributes,\r\n\t\t_fnCalculateEnd: function () {} // Used by a lot of plug-ins, but redundant\r\n\t\t // in 1.10, so this dead-end function is\r\n\t\t // added to prevent errors\r\n\t} );\r\n\t\r\n\r\n\t// jQuery access\r\n\t$.fn.dataTable = DataTable;\r\n\r\n\t// Provide access to the host jQuery object (circular reference)\r\n\tDataTable.$ = $;\r\n\r\n\t// Legacy aliases\r\n\t$.fn.dataTableSettings = DataTable.settings;\r\n\t$.fn.dataTableExt = DataTable.ext;\r\n\r\n\t// With a capital `D` we return a DataTables API instance rather than a\r\n\t// jQuery object\r\n\t$.fn.DataTable = function ( opts ) {\r\n\t\treturn $(this).dataTable( opts ).api();\r\n\t};\r\n\r\n\t// All properties that are available to $.fn.dataTable should also be\r\n\t// available on $.fn.DataTable\r\n\t$.each( DataTable, function ( prop, val ) {\r\n\t\t$.fn.DataTable[ prop ] = val;\r\n\t} );\r\n\r\n\r\n\t// Information about events fired by DataTables - for documentation.\r\n\t/**\r\n\t * Draw event, fired whenever the table is redrawn on the page, at the same\r\n\t * point as fnDrawCallback. This may be useful for binding events or\r\n\t * performing calculations when the table is altered at all.\r\n\t * @name DataTable#draw.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Search event, fired when the searching applied to the table (using the\r\n\t * built-in global search, or column filters) is altered.\r\n\t * @name DataTable#search.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Page change event, fired when the paging of the table is altered.\r\n\t * @name DataTable#page.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Order event, fired when the ordering applied to the table is altered.\r\n\t * @name DataTable#order.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * DataTables initialisation complete event, fired when the table is fully\r\n\t * drawn, including Ajax data loaded, if Ajax data is required.\r\n\t * @name DataTable#init.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The JSON object request from the server - only\r\n\t * present if client-side Ajax sourced data is used\r\n\t */\r\n\r\n\t/**\r\n\t * State save event, fired when the table has changed state a new state save\r\n\t * is required. This event allows modification of the state saving object\r\n\t * prior to actually doing the save, including addition or other state\r\n\t * properties (for plug-ins) or modification of a DataTables core property.\r\n\t * @name DataTable#stateSaveParams.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The state information to be saved\r\n\t */\r\n\r\n\t/**\r\n\t * State load event, fired when the table is loading state from the stored\r\n\t * data, but prior to the settings object being modified by the saved state\r\n\t * - allowing modification of the saved state is required or loading of\r\n\t * state for a plug-in.\r\n\t * @name DataTable#stateLoadParams.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The saved state information\r\n\t */\r\n\r\n\t/**\r\n\t * State loaded event, fired when state has been loaded from stored data and\r\n\t * the settings object has been modified by the loaded data.\r\n\t * @name DataTable#stateLoaded.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The saved state information\r\n\t */\r\n\r\n\t/**\r\n\t * Processing event, fired when DataTables is doing some kind of processing\r\n\t * (be it, order, searcg or anything else). It can be used to indicate to\r\n\t * the end user that there is something happening, or that something has\r\n\t * finished.\r\n\t * @name DataTable#processing.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {boolean} bShow Flag for if DataTables is doing processing or not\r\n\t */\r\n\r\n\t/**\r\n\t * Ajax (XHR) event, fired whenever an Ajax request is completed from a\r\n\t * request to made to the server for new data. This event is called before\r\n\t * DataTables processed the returned data, so it can also be used to pre-\r\n\t * process the data returned from the server, if needed.\r\n\t *\r\n\t * Note that this trigger is called in `fnServerData`, if you override\r\n\t * `fnServerData` and which to use this event, you need to trigger it in you\r\n\t * success function.\r\n\t * @name DataTable#xhr.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t * @param {object} json JSON returned from the server\r\n\t *\r\n\t * @example\r\n\t * // Use a custom property returned from the server in another DOM element\r\n\t * $('#table').dataTable().on('xhr.dt', function (e, settings, json) {\r\n\t * $('#status').html( json.status );\r\n\t * } );\r\n\t *\r\n\t * @example\r\n\t * // Pre-process the data returned from the server\r\n\t * $('#table').dataTable().on('xhr.dt', function (e, settings, json) {\r\n\t * for ( var i=0, ien=json.aaData.length ; i {\r\n if (result) {\r\n this.submitAddSubscriptions();\r\n }\r\n });\r\n },\r\n editSubscriptions() {\r\n this.$validator.validateAll().then(result => {\r\n if (result) {\r\n this.submitEditSubscriptions();\r\n }\r\n });\r\n },\r\n removeSubscriptions() {\r\n this.$validator.validateAll().then(result => {\r\n if (result) {\r\n this.submitRemoveSubscriptions();\r\n }\r\n });\r\n },\r\n goToEditSubscriptions() {\r\n this.$validator.validate(\"tags-email-input\").then(result => {\r\n if (result) {\r\n this.submitGoToEditSubscriptions();\r\n }\r\n });\r\n },\r\n submitAddSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-update-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n if (window.grecaptcha) {\r\n window.grecaptcha.reset();\r\n }\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n //redirectToEditPage(data.UserId);\r\n $(\"#tags-subscription-form\")\r\n .find(\".add-subscription\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitEditSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-edit-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n window.grecaptcha.reset();\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n $(\"#tags-subscription-form\")\r\n .find(\".edit-subscription\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitRemoveSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-remove-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n window.grecaptcha.reset();\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n redirectAfterUnsubscribing();\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitGoToEditSubscriptions() {\r\n this.loading = true;\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-go-to-edit-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: $(\"#tags-subscription-form\").serialize(),\r\n success: function(data) {\r\n if (window.grecaptcha) {\r\n window.grecaptcha.reset();\r\n }\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n $(\"#tags-subscription-form\")\r\n .find(\".go-to-edit-notification\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n checkAll(e) {\r\n var input = $(e.target);\r\n var checkboxVal = input[0].checked;\r\n var tagList = input.closest(\".tag--list\");\r\n var checkboxes = $(\"input[type='checkbox']\", tagList).not(\r\n \"form-control__all\"\r\n );\r\n\r\n checkboxes.attr(\"checked\", checkboxVal);\r\n }\r\n }\r\n });\r\n\r\n //Initial tags slice\r\n $(\".tag--items\").each(function() {\r\n var $ps = $(this).find(\".tag--item-form-group\");\r\n $ps.slice(7).hide();\r\n });\r\n\r\n //Toggle visibility button\r\n $(\".tag--items-btn\").click(function() {\r\n var $ps = $(this)\r\n .closest(\".tag--items\")\r\n .find(\".tag--item-form-group\");\r\n $ps.slice(7).toggle();\r\n $(this).hide();\r\n });\r\n\r\n $(\".tag--subscription-form\").submit(function(e) {\r\n e.preventDefault();\r\n });\r\n});\r\n","import \"./../_polyfill/Array_from\";\r\nimport \"./../_polyfill/Array_find\";\r\nimport \"./../_polyfill/Promise\";\r\nimport flatpickr from \"flatpickr\";\r\nimport { Danish } from \"flatpickr/dist/l10n/da.js\";\r\nimport { Chinese } from \"flatpickr/dist/l10n/zh.js\";\r\n\r\nimport { getParameterByName } from \"./helperFunctions\";\r\n\r\nexport default class TaxonomyDropdown {\r\n // Inititialize TaxonomyList for a selection of lists\r\n static init(querySelector = \".module-taxonomy-dropdown-body\") {\r\n Array.prototype.forEach.call(\r\n document.querySelectorAll(querySelector),\r\n taxonomyDropdown => {\r\n new TaxonomyDropdown(taxonomyDropdown);\r\n }\r\n );\r\n }\r\n\r\n constructor(element) {\r\n this.element = element;\r\n this.tags = this.element.getAttribute(\"data-tags\");\r\n this.selects = Array.from(\r\n this.element.querySelectorAll(\".select-module select\")\r\n );\r\n this.yearSelect = this.element.querySelector(\".years-filter select\");\r\n this.fromDate = this.element.querySelector(\".fromdate\");\r\n this.fromPicker;\r\n this.toDate = this.element.querySelector(\".todate\");\r\n this.toPicker;\r\n this.dataSourceId = element.getAttribute(\"data-source-id\");\r\n this.currentPageId = this.element.getAttribute(\"data-current-page-id\");\r\n this.preSelectedTagId = this.element.getAttribute(\r\n \"data-pre-selected-tag-id\"\r\n );\r\n this.taxonomyListIds = Array.from(\r\n document.querySelectorAll([\".item-list[data-source-id]\"])\r\n ).map(x => x.getAttribute(\"data-source-id\"));\r\n\r\n // Initial fetch\r\n var pattern = /(\\d{2})\\-(\\d{2})\\-(\\d{4})/;\r\n var filterTags = getParameterByName(\"filter\")\r\n ? getParameterByName(\"filter\").split(\" \")\r\n : [];\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(filterTags)\r\n .filter(x => !!x);\r\n var year = getParameterByName(\"year\") || undefined;\r\n var fromDate = getParameterByName(\"fromDate\")\r\n ? new Date(\r\n getParameterByName(\"fromDate\").replace(pattern, \"$3-$2-$1\")\r\n )\r\n : undefined;\r\n var toDate = getParameterByName(\"toDate\")\r\n ? new Date(\r\n getParameterByName(\"toDate\").replace(pattern, \"$3-$2-$1\")\r\n )\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects.map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n // Hide the entire dropdown module if there are no valid options to pick from\r\n if (\r\n result.collections.reduce(\r\n (t, tagCollection) => t + tagCollection.tags.length,\r\n 0\r\n ) === 0 &&\r\n (result.years === undefined || result.years.length <= 1)\r\n ) {\r\n $(this.element)\r\n .closest(\".module\")\r\n .addClass(\"dropdown--no-results\");\r\n } else {\r\n // Else populate the filters, and select the filter-values from the url, if any\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderValuesFromParamter();\r\n this.renderDatepickers(fromDate, toDate);\r\n }\r\n });\r\n\r\n this.selects.forEach(select => {\r\n jQuery(select).on(\"change\", event => {\r\n // Refetch on change\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\r\n \".select-module option:checked\"\r\n )\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var year = this.yearSelect ? this.yearSelect.value : undefined;\r\n var fromDate = this.fromDate\r\n ? new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n var toDate = this.toDate\r\n ? new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n });\r\n });\r\n if (this.yearSelect) {\r\n jQuery(this.yearSelect).on(\"change\", event => {\r\n // Refetch on change\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\r\n \".select-module option:checked\"\r\n )\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var fromDate = this.fromDate\r\n ? new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n var toDate = this.toDate\r\n ? new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n this.yearSelect.value,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n });\r\n }\r\n if (this.fromDate) {\r\n var lang = $(\"html\").attr(\"lang\");\r\n const langMap = {\r\n da: Danish,\r\n zh: Chinese,\r\n en: \"\"\r\n };\r\n if (lang !== \"en\") {\r\n flatpickr.localize(langMap[lang]);\r\n } else {\r\n flatpickr.l10ns.default.firstDayOfWeek = 1;\r\n }\r\n var _self = this;\r\n this.fromPicker = flatpickr(this.fromDate, {\r\n dateFormat: \"d-m-Y\",\r\n altInput: true,\r\n altFormat: \"F j, Y\",\r\n // onChange: function (selectedDates, dateStr, instance) {\r\n // // _self.toPicker.set('minDate', dateStr)\r\n // _self.datepickersChanged()\r\n // },\r\n onDayCreate: function(dObj, dStr, fp, dayElem) {\r\n if (\r\n _self.toPicker &&\r\n +_self.toPicker.selectedDates[0] === +dayElem.dateObj\r\n ) {\r\n dayElem.className += \" flatpickr-highlight\";\r\n }\r\n }\r\n });\r\n this.toPicker = flatpickr(this.toDate, {\r\n dateFormat: \"d-m-Y\",\r\n altInput: true,\r\n altFormat: \"F j, Y\",\r\n // onChange: function (selectedDates, dateStr, instance) {\r\n // // _self.fromPicker.set('maxDate', dateStr)\r\n // _self.datepickersChanged()\r\n // },\r\n onDayCreate: function(dObj, dStr, fp, dayElem) {\r\n if (\r\n _self.fromPicker &&\r\n +_self.fromPicker.selectedDates[0] === +dayElem.dateObj\r\n ) {\r\n dayElem.className += \" flatpickr-highlight\";\r\n }\r\n }\r\n });\r\n if (fromDate) {\r\n this.fromPicker.setDate(fromDate);\r\n this.toPicker.set(\"minDate\", fromDate);\r\n }\r\n if (toDate) {\r\n this.toPicker.setDate(toDate);\r\n this.fromPicker.set(\"maxDate\", toDate);\r\n }\r\n }\r\n\r\n this.element.querySelector(\"form\").addEventListener(\"submit\", event => {\r\n event.preventDefault();\r\n this.updateFilterParameter();\r\n });\r\n }\r\n\r\n renderFilterOptions(collections) {\r\n // Else we populate each dropdown\r\n collections.forEach(tagCollection => {\r\n var select = this.selects.find(x => x.name === tagCollection.id);\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n );\r\n\r\n // Render new select-values and make sure previous value is still selected\r\n while (select.options.length) {\r\n select.options.remove(0);\r\n }\r\n let o = new Option(`${tagCollection.title}`, \"\");\r\n select.options.add(o);\r\n o.setAttribute(\"data-title\", tagCollection.title);\r\n tagCollection.tags.forEach(tag => {\r\n let t = new Option(`${tag.title} (${tag.facetCount})`, tag.id);\r\n select.options.add(t);\r\n t.setAttribute(\"data-title\", tag.title);\r\n });\r\n\r\n // Move items into an array\r\n var elements = Array.prototype.slice.call(select.options);\r\n\r\n // Sort the array alphabetically\r\n elements.sort(function(a, b) {\r\n return a.textContent.localeCompare(b.textContent);\r\n });\r\n\r\n // Reattach sorted items\r\n for (var i = 0, len = elements.length; i < len; i++) {\r\n var parent = elements[i].parentNode;\r\n var detatchedItem = parent.removeChild(elements[i]);\r\n parent.appendChild(detatchedItem);\r\n }\r\n let newOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option\")\r\n );\r\n selectedOptions.forEach(selectedOption => {\r\n let newOp = newOptions.find(\r\n newOption =>\r\n newOption.dataset.title === selectedOption.dataset.title\r\n );\r\n if (newOp) {\r\n newOp.selected = true;\r\n }\r\n });\r\n jQuery(select).niceSelect(\"update\");\r\n\r\n // Let's hide the select if there are no options\r\n if (select.options.length <= 1) {\r\n select.parentElement.style.display = \"none\";\r\n } else {\r\n select.parentElement.style.display = \"\";\r\n }\r\n });\r\n }\r\n\r\n renderYearOptions(years) {\r\n if (this.yearSelect) {\r\n var selectedValue = this.yearSelect.value;\r\n // Render new select-values and make sure previous value is still selected\r\n while (this.yearSelect.options.length) {\r\n this.yearSelect.options.remove(0);\r\n }\r\n\r\n var isDefaultOption = true;\r\n years.forEach(year => {\r\n if (isDefaultOption) {\r\n let o = new Option(`${year.title}` || \"\", year.id);\r\n this.yearSelect.options.add(o);\r\n o.setAttribute(\"data-title\", year.title);\r\n isDefaultOption = false;\r\n } else {\r\n let y = new Option(\r\n `${year.title} (${year.facetCount})` || \"\",\r\n year.id\r\n );\r\n this.yearSelect.options.add(y);\r\n y.setAttribute(\"data-title\", year.title);\r\n }\r\n });\r\n\r\n this.yearSelect.value = selectedValue;\r\n if (!this.yearSelect.value && this.yearSelect.options.length > 0) {\r\n this.yearSelect.options[0].selected = \"selected\";\r\n }\r\n jQuery(this.yearSelect).niceSelect(\"update\");\r\n\r\n if (this.yearSelect.options.length <= 2) {\r\n this.yearSelect.parentElement.style.display = \"none\";\r\n } else {\r\n this.yearSelect.parentElement.style.display = \"\";\r\n }\r\n }\r\n }\r\n\r\n requestFilterOptions(\r\n DropDownDataSourceId,\r\n DataSourcesIds,\r\n TagCollectionsIds,\r\n TagsIds,\r\n Tags,\r\n Year,\r\n FromDate,\r\n ToDate\r\n ) {\r\n return new Promise((resolve, reject) => {\r\n jQuery.ajax({\r\n type: \"POST\",\r\n url: `/api/taxonomylist/GetDroprdownTagCollections?sc_itemid=${this.currentPageId}`,\r\n data: JSON.stringify({\r\n DropDownDataSourceId,\r\n DataSourcesIds,\r\n TagCollectionsIds,\r\n TagsIds,\r\n Tags,\r\n Year,\r\n FromDate,\r\n ToDate\r\n }),\r\n success: resolve,\r\n failure: reject,\r\n dataType: \"json\",\r\n contentType: \"application/json\"\r\n });\r\n });\r\n }\r\n\r\n renderDatepickers(from, to) {\r\n if (this.fromDate) {\r\n if (from !== \"null\") {\r\n this.toPicker.set(\"minDate\", from);\r\n }\r\n if (to !== \"null\") {\r\n this.fromPicker.set(\"maxDate\", to);\r\n }\r\n }\r\n }\r\n\r\n renderValuesFromParamter() {\r\n if (getParameterByName(\"filter\")) {\r\n var taxonomyDropdownFilters = getParameterByName(\"filter\")\r\n .split(\" \")\r\n .filter(x => x !== \"\");\r\n taxonomyDropdownFilters.forEach(filter => {\r\n this.selects.forEach(select => {\r\n var optionWithFilter = Array.from(select.options).find(\r\n option => option.value === filter\r\n );\r\n if (optionWithFilter) {\r\n select.value = optionWithFilter.value;\r\n jQuery(select).niceSelect(\"update\");\r\n }\r\n });\r\n });\r\n }\r\n if (this.yearSelect && getParameterByName(\"year\")) {\r\n this.yearSelect.value = getParameterByName(\"year\");\r\n jQuery(this.yearSelect).niceSelect(\"update\");\r\n }\r\n }\r\n\r\n updateFilterParameter() {\r\n var taxonomyDropdownFilters = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n )\r\n .map(filterElement => {\r\n return filterElement.value;\r\n })\r\n .filter(x => x !== \"\");\r\n\r\n var params = [];\r\n if (taxonomyDropdownFilters.length > 0) {\r\n params.push(`filter=${taxonomyDropdownFilters.join(\"+\")}`);\r\n }\r\n if (this.yearSelect && this.yearSelect.value !== \"\") {\r\n params.push(`year=${this.yearSelect.value}`);\r\n }\r\n if (this.fromDate && this.fromDate.value !== \"\") {\r\n params.push(`fromDate=${this.fromDate.value}`);\r\n }\r\n if (this.toDate && this.toDate.value !== \"\") {\r\n params.push(`toDate=${this.toDate.value}`);\r\n }\r\n if (this.fromDate && this.toDate) {\r\n this.renderDatepickers(this.fromDate.value, this.toDate.value);\r\n }\r\n if (location.hash !== params.join(\"&\")) {\r\n location.hash = params.join(\"&\");\r\n }\r\n }\r\n\r\n /* Not used currently */\r\n datepickersChanged() {\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var year = this.yearSelect ? this.yearSelect.value : undefined;\r\n var fromDate = this.fromDate\r\n ? JSON.stringify(\r\n new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n )\r\n : undefined;\r\n var toDate = this.toDate\r\n ? JSON.stringify(\r\n new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n )\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n }\r\n}\r\n","export function toggleClass(elem, className, bool) {\n if (bool === true)\n return elem.classList.add(className);\n elem.classList.remove(className);\n}\nexport function createElement(tag, className, content) {\n const e = window.document.createElement(tag);\n className = className || \"\";\n content = content || \"\";\n e.className = className;\n if (content !== undefined)\n e.textContent = content;\n return e;\n}\nexport function clearNode(node) {\n while (node.firstChild)\n node.removeChild(node.firstChild);\n}\nexport function findParent(node, condition) {\n if (condition(node))\n return node;\n else if (node.parentNode)\n return findParent(node.parentNode, condition);\n return undefined;\n}\nexport function createNumberInput(inputClassName, opts) {\n const wrapper = createElement(\"div\", \"numInputWrapper\"), numInput = createElement(\"input\", \"numInput \" + inputClassName), arrowUp = createElement(\"span\", \"arrowUp\"), arrowDown = createElement(\"span\", \"arrowDown\");\n if (navigator.userAgent.indexOf(\"MSIE 9.0\") === -1) {\n numInput.type = \"number\";\n }\n else {\n numInput.type = \"text\";\n numInput.pattern = \"\\\\d*\";\n }\n if (opts !== undefined)\n for (const key in opts)\n numInput.setAttribute(key, opts[key]);\n wrapper.appendChild(numInput);\n wrapper.appendChild(arrowUp);\n wrapper.appendChild(arrowDown);\n return wrapper;\n}\nexport function getEventTarget(event) {\n try {\n if (typeof event.composedPath === \"function\") {\n const path = event.composedPath();\n return path[0];\n }\n return event.target;\n }\n catch (error) {\n return event.target;\n }\n}\n","import { tokenRegex, revFormat, formats, } from \"./formatting\";\nimport { defaults } from \"../types/options\";\nimport { english } from \"../l10n/default\";\nexport const createDateFormatter = ({ config = defaults, l10n = english, isMobile = false, }) => (dateObj, frmt, overrideLocale) => {\n const locale = overrideLocale || l10n;\n if (config.formatDate !== undefined && !isMobile) {\n return config.formatDate(dateObj, frmt, locale);\n }\n return frmt\n .split(\"\")\n .map((c, i, arr) => formats[c] && arr[i - 1] !== \"\\\\\"\n ? formats[c](dateObj, locale, config)\n : c !== \"\\\\\"\n ? c\n : \"\")\n .join(\"\");\n};\nexport const createDateParser = ({ config = defaults, l10n = english }) => (date, givenFormat, timeless, customLocale) => {\n if (date !== 0 && !date)\n return undefined;\n const locale = customLocale || l10n;\n let parsedDate;\n const dateOrig = date;\n if (date instanceof Date)\n parsedDate = new Date(date.getTime());\n else if (typeof date !== \"string\" &&\n date.toFixed !== undefined)\n parsedDate = new Date(date);\n else if (typeof date === \"string\") {\n const format = givenFormat || (config || defaults).dateFormat;\n const datestr = String(date).trim();\n if (datestr === \"today\") {\n parsedDate = new Date();\n timeless = true;\n }\n else if (/Z$/.test(datestr) ||\n /GMT$/.test(datestr))\n parsedDate = new Date(date);\n else if (config && config.parseDate)\n parsedDate = config.parseDate(date, format);\n else {\n parsedDate =\n !config || !config.noCalendar\n ? new Date(new Date().getFullYear(), 0, 1, 0, 0, 0, 0)\n : new Date(new Date().setHours(0, 0, 0, 0));\n let matched, ops = [];\n for (let i = 0, matchIndex = 0, regexStr = \"\"; i < format.length; i++) {\n const token = format[i];\n const isBackSlash = token === \"\\\\\";\n const escaped = format[i - 1] === \"\\\\\" || isBackSlash;\n if (tokenRegex[token] && !escaped) {\n regexStr += tokenRegex[token];\n const match = new RegExp(regexStr).exec(date);\n if (match && (matched = true)) {\n ops[token !== \"Y\" ? \"push\" : \"unshift\"]({\n fn: revFormat[token],\n val: match[++matchIndex],\n });\n }\n }\n else if (!isBackSlash)\n regexStr += \".\";\n ops.forEach(({ fn, val }) => (parsedDate = fn(parsedDate, val, locale) || parsedDate));\n }\n parsedDate = matched ? parsedDate : undefined;\n }\n }\n if (!(parsedDate instanceof Date && !isNaN(parsedDate.getTime()))) {\n config.errorHandler(new Error(`Invalid date provided: ${dateOrig}`));\n return undefined;\n }\n if (timeless === true)\n parsedDate.setHours(0, 0, 0, 0);\n return parsedDate;\n};\nexport function compareDates(date1, date2, timeless = true) {\n if (timeless !== false) {\n return (new Date(date1.getTime()).setHours(0, 0, 0, 0) -\n new Date(date2.getTime()).setHours(0, 0, 0, 0));\n }\n return date1.getTime() - date2.getTime();\n}\nexport function compareTimes(date1, date2) {\n return (3600 * (date1.getHours() - date2.getHours()) +\n 60 * (date1.getMinutes() - date2.getMinutes()) +\n date1.getSeconds() -\n date2.getSeconds());\n}\nexport const isBetween = (ts, ts1, ts2) => {\n return ts > Math.min(ts1, ts2) && ts < Math.max(ts1, ts2);\n};\nexport const duration = {\n DAY: 86400000,\n};\nexport function getDefaultHours(config) {\n let hours = config.defaultHour;\n let minutes = config.defaultMinute;\n let seconds = config.defaultSeconds;\n if (config.minDate !== undefined) {\n const minHour = config.minDate.getHours();\n const minMinutes = config.minDate.getMinutes();\n const minSeconds = config.minDate.getSeconds();\n if (hours < minHour) {\n hours = minHour;\n }\n if (hours === minHour && minutes < minMinutes) {\n minutes = minMinutes;\n }\n if (hours === minHour && minutes === minMinutes && seconds < minSeconds)\n seconds = config.minDate.getSeconds();\n }\n if (config.maxDate !== undefined) {\n const maxHr = config.maxDate.getHours();\n const maxMinutes = config.maxDate.getMinutes();\n hours = Math.min(hours, maxHr);\n if (hours === maxHr)\n minutes = Math.min(maxMinutes, minutes);\n if (hours === maxHr && minutes === maxMinutes)\n seconds = config.maxDate.getSeconds();\n }\n return { hours, minutes, seconds };\n}\n","\"use strict\";\nif (typeof Object.assign !== \"function\") {\n Object.assign = function (target, ...args) {\n if (!target) {\n throw TypeError(\"Cannot convert undefined or null to object\");\n }\n for (const source of args) {\n if (source) {\n Object.keys(source).forEach((key) => (target[key] = source[key]));\n }\n }\n return target;\n };\n}\n","(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.da = {}));\n}(this, (function (exports) { 'use strict';\n\n var fp = typeof window !== \"undefined\" && window.flatpickr !== undefined\n ? window.flatpickr\n : {\n l10ns: {},\n };\n var Danish = {\n weekdays: {\n shorthand: [\"søn\", \"man\", \"tir\", \"ons\", \"tors\", \"fre\", \"lør\"],\n longhand: [\n \"søndag\",\n \"mandag\",\n \"tirsdag\",\n \"onsdag\",\n \"torsdag\",\n \"fredag\",\n \"lørdag\",\n ],\n },\n months: {\n shorthand: [\n \"jan\",\n \"feb\",\n \"mar\",\n \"apr\",\n \"maj\",\n \"jun\",\n \"jul\",\n \"aug\",\n \"sep\",\n \"okt\",\n \"nov\",\n \"dec\",\n ],\n longhand: [\n \"januar\",\n \"februar\",\n \"marts\",\n \"april\",\n \"maj\",\n \"juni\",\n \"juli\",\n \"august\",\n \"september\",\n \"oktober\",\n \"november\",\n \"december\",\n ],\n },\n ordinal: function () {\n return \".\";\n },\n firstDayOfWeek: 1,\n rangeSeparator: \" til \",\n weekAbbreviation: \"uge\",\n time_24hr: true,\n };\n fp.l10ns.da = Danish;\n var da = fp.l10ns;\n\n exports.Danish = Danish;\n exports.default = da;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n})));\n","(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.zh = {}));\n}(this, (function (exports) { 'use strict';\n\n var fp = typeof window !== \"undefined\" && window.flatpickr !== undefined\n ? window.flatpickr\n : {\n l10ns: {},\n };\n var Mandarin = {\n weekdays: {\n shorthand: [\"周日\", \"周一\", \"周二\", \"周三\", \"周四\", \"周五\", \"周六\"],\n longhand: [\n \"星期日\",\n \"星期一\",\n \"星期二\",\n \"星期三\",\n \"星期四\",\n \"星期五\",\n \"星期六\",\n ],\n },\n months: {\n shorthand: [\n \"一月\",\n \"二月\",\n \"三月\",\n \"四月\",\n \"五月\",\n \"六月\",\n \"七月\",\n \"八月\",\n \"九月\",\n \"十月\",\n \"十一月\",\n \"十二月\",\n ],\n longhand: [\n \"一月\",\n \"二月\",\n \"三月\",\n \"四月\",\n \"五月\",\n \"六月\",\n \"七月\",\n \"八月\",\n \"九月\",\n \"十月\",\n \"十一月\",\n \"十二月\",\n ],\n },\n rangeSeparator: \" 至 \",\n weekAbbreviation: \"周\",\n scrollTitle: \"滚动切换\",\n toggleTitle: \"点击切换 12/24 小时时制\",\n };\n fp.l10ns.zh = Mandarin;\n var zh = fp.l10ns;\n\n exports.Mandarin = Mandarin;\n exports.default = zh;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n})));\n","/* jQuery Nice Select - v1.1.0\r\n https://github.com/hernansartorio/jquery-nice-select\r\n Made by Hernán Sartorio */\r\n\r\n(function ($) {\r\n\r\n $.fn.niceSelect = function (method, openCallback) {\r\n\r\n // Methods\r\n if (typeof method == 'string') {\r\n if (method == 'update') {\r\n this.each(function () {\r\n var $select = $(this);\r\n var $dropdown = $(this).next('.nice-select');\r\n var open = $dropdown.hasClass('open');\r\n\r\n if ($dropdown.length) {\r\n $dropdown.remove();\r\n create_nice_select($select);\r\n\r\n if (open) {\r\n $select.next().trigger('click');\r\n }\r\n }\r\n });\r\n } else if (method == 'destroy') {\r\n this.each(function () {\r\n var $select = $(this);\r\n var $dropdown = $(this).next('.nice-select');\r\n\r\n if ($dropdown.length) {\r\n $dropdown.remove();\r\n $select.css('display', '');\r\n }\r\n });\r\n if ($('.nice-select').length == 0) {\r\n $(document).off('.nice_select');\r\n }\r\n } else {\r\n console.log('Method \"' + method + '\" does not exist.')\r\n }\r\n return this;\r\n }\r\n\r\n // Hide native select\r\n this.hide();\r\n\r\n // Create custom markup\r\n this.each(function () {\r\n var $select = $(this);\r\n\r\n if (!$select.next().hasClass('nice-select')) {\r\n create_nice_select($select);\r\n }\r\n });\r\n\r\n function create_nice_select($select) {\r\n $select.after($('')\r\n .addClass('nice-select')\r\n .addClass($select.attr('class') || '')\r\n .addClass($select.attr('disabled') ? 'disabled' : '')\r\n .attr('tabindex', $select.attr('disabled') ? null : '0')\r\n .html($select.attr('search') !== undefined ? '' : '')\r\n );\r\n\r\n var $dropdown = $select.next();\r\n var $options = $select.find('option');\r\n var $selected = $select.find('option:selected');\r\n\r\n $dropdown.find('.current').html($selected.data('display') || $selected.text());\r\n\r\n $options.each(function (i) {\r\n var $option = $(this);\r\n var display = $option.data('display') || null;\r\n\r\n var attributes = $option.prop(\"attributes\");\r\n var $optionListItem = $('/')\r\n .attr('data-display', (display || null))\r\n .addClass('option' +\r\n ($option.is(':selected') ? ' selected' : '') +\r\n ($option.is(':disabled') ? ' disabled' : ''))\r\n .addClass($option.attr('class'))\r\n .html($option.text());\r\n $.each(attributes, function () {\r\n $optionListItem.attr(this.name, this.value);\r\n });\r\n $optionListItem.data($.extend($option.data(), {\r\n value: $option.val(),\r\n display: display\r\n }));\r\n var ul = $dropdown.find('ul')\r\n ul.append($($optionListItem))\r\n });\r\n }\r\n\r\n /* Event listeners */\r\n\r\n // Unbind existing events in case that the plugin has been initialized before\r\n $(document).off('.nice_select');\r\n\r\n // Open/close\r\n $(document).on('click.nice_select', '.nice-select', function (event) {\r\n var $dropdown = $(this);\r\n\r\n $('.nice-select').not($dropdown).removeClass('open');\r\n $dropdown.toggleClass('open');\r\n\r\n if ($dropdown.hasClass('open')) {\r\n $dropdown.find('.option');\r\n $dropdown.find('.focus').removeClass('focus');\r\n $dropdown.find('.selected').addClass('focus');\r\n if ($dropdown.prev().attr('search') !== undefined) {\r\n var search = $dropdown.find('.nice-select-search')[0];\r\n var $options = $dropdown.find('ul li');\r\n $options.show().removeClass(\"disabled\");\r\n setTimeout(function () {\r\n $(search).val('');\r\n $(search).focus();\r\n }, 100)\r\n }\r\n openCallback($dropdown)\r\n } else {\r\n $dropdown.focus();\r\n }\r\n });\r\n\r\n // Custom search functions\r\n $(document).on('click', '.nice-select-search-box', function (event) {\r\n event.stopPropagation();\r\n return false;\r\n });\r\n $(document).on('keyup', '.nice-select-search', function (event) {\r\n var $self = $(this).parent().parent();\r\n var $text = $(this).val();\r\n var $options = $self.find('ul li');\r\n if ($text == '') {\r\n $options.show().removeClass(\"disabled\");\r\n } else if ($self.hasClass('open')) {\r\n $text = $text.toLowerCase();\r\n var $matchReg = new RegExp($text);\r\n if (0 < $options.length) {\r\n $options.each(function () {\r\n var $this = $(this);\r\n var $optionText = $this.text().toLowerCase();\r\n var $matchCheck = $matchReg.test($optionText);\r\n if ($matchCheck) {\r\n $this.show().removeClass(\"disabled\");\r\n } else {\r\n $this.hide().addClass(\"disabled\");\r\n }\r\n })\r\n } else {\r\n $options.show();\r\n }\r\n }\r\n });\r\n\r\n // Close when clicking outside\r\n $(document).on('click.nice_select', function (event) {\r\n if ($(event.target).closest('.nice-select').length === 0) {\r\n $('.nice-select').removeClass('open').find('.option');\r\n }\r\n });\r\n\r\n // Option click\r\n $(document).on('click.nice_select', '.nice-select .option:not(.disabled)', function (event) {\r\n var $option = $(this);\r\n var $dropdown = $option.closest('.nice-select');\r\n\r\n $dropdown.find('.selected').removeClass('selected');\r\n $option.addClass('selected');\r\n\r\n var text = $option.data('display') || $option.text();\r\n $dropdown.find('.current').text(text);\r\n\r\n $dropdown.prev('select').val($option.data('value')).trigger('change');\r\n });\r\n\r\n // Keyboard events\r\n $(document).on('keydown.nice_select', '.nice-select', function (event) {\r\n var $dropdown = $(this);\r\n var $focused_option = $($dropdown.find('.focus') || $dropdown.find('.list .option.selected'));\r\n\r\n // Space or Enter\r\n if (event.keyCode == 13) {\r\n if ($dropdown.hasClass('open')) {\r\n $focused_option.trigger('click');\r\n } else {\r\n $dropdown.trigger('click');\r\n }\r\n return false;\r\n // Down\r\n } else if (event.keyCode == 40) {\r\n if (!$dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n } else {\r\n var $next = $focused_option.nextAll('.option:not(.disabled)').first();\r\n if ($next.length > 0) {\r\n $dropdown.find('.focus').removeClass('focus');\r\n $next.addClass('focus');\r\n }\r\n }\r\n return false;\r\n // Up\r\n } else if (event.keyCode == 38) {\r\n if (!$dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n } else {\r\n var $prev = $focused_option.prevAll('.option:not(.disabled)').first();\r\n if ($prev.length > 0) {\r\n $dropdown.find('.focus').removeClass('focus');\r\n $prev.addClass('focus');\r\n }\r\n }\r\n return false;\r\n // Esc\r\n } else if (event.keyCode == 27) {\r\n if ($dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n }\r\n // Tab\r\n } else if (event.keyCode == 9) {\r\n if ($dropdown.hasClass('open')) {\r\n return false;\r\n }\r\n }\r\n });\r\n\r\n // Detect CSS pointer-events support, for IE <= 10. From Modernizr.\r\n var style = document.createElement('a').style;\r\n style.cssText = 'pointer-events:auto';\r\n if (style.pointerEvents !== 'auto') {\r\n $('html').addClass('no-csspointerevents');\r\n }\r\n\r\n return this;\r\n\r\n };\r\n\r\n}(jQuery));","import TaxonomyList from \"./TaxonomyList\"\r\n\r\nexport default class ContactPeopleTaxonomyList extends TaxonomyList {\r\n static init (querySelector = '.contact-people-list[data-source-id]') {\r\n Array.prototype.forEach.call(document.querySelectorAll(querySelector), element => {\r\n new ContactPeopleTaxonomyList(element)})\r\n }\r\n \r\n render (containerElement, groupsToRender) {\r\n var itemIndex = 0\r\n containerElement.innerHTML = ''\r\n groupsToRender.forEach((group) => {\r\n if (this.groupBy === 'True') {\r\n if (this.showGroupsCondensed === 'False') {\r\n var groupElement = document.createElement(\"li\")\r\n groupElement.classList.add('col-12')\r\n groupElement.innerHTML =\r\n ``;\r\n\r\n containerElement.appendChild(groupElement)\r\n }\r\n else if (this.showGroupsCondensed === 'True') {\r\n containerElement.classList.add('display-condensed')\r\n }\r\n }\r\n\r\n group.Items.forEach((item) => {\r\n itemIndex++\r\n\r\n var itemElement = document.createElement(\"li\")\r\n itemElement.classList.add('col-6')\r\n\r\n itemElement.style.opacity = itemIndex >= this.totalNumber ? 0 : 1\r\n itemElement.style.transition = `opacity 500ms ease-in`\r\n\r\n if (this.groupBy !== 'False' && group.GroupLabel) {\r\n itemElement.classList.add(group.GroupLabel.replace(' ', '-'));\r\n }\r\n\r\n itemElement.innerHTML =\r\n (``);\r\n\r\n containerElement.appendChild(itemElement)\r\n\r\n setTimeout(() => {\r\n itemElement.style.opacity = 1\r\n var imgForUpdate = itemElement.querySelector('img');\r\n if (imgForUpdate !== null && imgForUpdate !== 'undefined') {\r\n window.bLazy.load(itemElement.querySelector('img'), true);\r\n }\r\n\r\n if (itemElement.nextElementSibling !== null && this.groupBy === 'True' && this.showGroupsCondensed === 'True') {\r\n if (itemElement.className !== itemElement.nextElementSibling.className) {\r\n itemElement.setAttribute('data-last-in-group', 'True')\r\n }\r\n }\r\n if (itemElement.previousElementSibling !== null && this.groupBy === 'True' && this.showGroupsCondensed === 'True') {\r\n if (itemElement.className !== itemElement.previousElementSibling.className) {\r\n itemElement.setAttribute('data-first-in-group', 'True')\r\n }\r\n }\r\n }, itemIndex >= this.totalNumber ? ~~(Math.sqrt(itemIndex) * 115) : 0)\r\n })\r\n })\r\n }\r\n}","/*!\r\n * @overview es6-promise - a tiny implementation of Promises/A+.\r\n * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)\r\n * @license Licensed under MIT license\r\n * See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE\r\n * @version v4.2.4+314e4831\r\n */\r\n\r\n(function (global, factory) {\r\n typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :\r\n\ttypeof define === 'function' && define.amd ? define(factory) :\r\n\t(global.ES6Promise = factory());\r\n}(this, (function () {\r\n 'use strict';\r\n\r\n function objectOrFunction(x) {\r\n var type = typeof x;\r\n return x !== null && (type === 'object' || type === 'function');\r\n }\r\n\r\n function isFunction(x) {\r\n return typeof x === 'function';\r\n }\r\n\r\n\r\n\r\n var _isArray = void 0;\r\n if (Array.isArray) {\r\n _isArray = Array.isArray;\r\n } else {\r\n _isArray = function (x) {\r\n return Object.prototype.toString.call(x) === '[object Array]';\r\n };\r\n }\r\n\r\n var isArray = _isArray;\r\n\r\n var len = 0;\r\n var vertxNext = void 0;\r\n var customSchedulerFn = void 0;\r\n\r\n var asap = function asap(callback, arg) {\r\n queue[len] = callback;\r\n queue[len + 1] = arg;\r\n len += 2;\r\n if (len === 2) {\r\n // If len is 2, that means that we need to schedule an async flush.\r\n // If additional callbacks are queued before the queue is flushed, they\r\n // will be processed by this flush that we are scheduling.\r\n if (customSchedulerFn) {\r\n customSchedulerFn(flush);\r\n } else {\r\n scheduleFlush();\r\n }\r\n }\r\n };\r\n\r\n function setScheduler(scheduleFn) {\r\n customSchedulerFn = scheduleFn;\r\n }\r\n\r\n function setAsap(asapFn) {\r\n asap = asapFn;\r\n }\r\n\r\n var browserWindow = typeof window !== 'undefined' ? window : undefined;\r\n var browserGlobal = browserWindow || {};\r\n var BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;\r\n var isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\r\n\r\n // test for web worker but not in IE10\r\n var isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';\r\n\r\n // node\r\n function useNextTick() {\r\n // node version 0.10.x displays a deprecation warning when nextTick is used recursively\r\n // see https://github.com/cujojs/when/issues/410 for details\r\n return function () {\r\n return process.nextTick(flush);\r\n };\r\n }\r\n\r\n // vertx\r\n function useVertxTimer() {\r\n if (typeof vertxNext !== 'undefined') {\r\n return function () {\r\n vertxNext(flush);\r\n };\r\n }\r\n\r\n return useSetTimeout();\r\n }\r\n\r\n function useMutationObserver() {\r\n var iterations = 0;\r\n var observer = new BrowserMutationObserver(flush);\r\n var node = document.createTextNode('');\r\n observer.observe(node, { characterData: true });\r\n\r\n return function () {\r\n node.data = iterations = ++iterations % 2;\r\n };\r\n }\r\n\r\n // web worker\r\n function useMessageChannel() {\r\n var channel = new MessageChannel();\r\n channel.port1.onmessage = flush;\r\n return function () {\r\n return channel.port2.postMessage(0);\r\n };\r\n }\r\n\r\n function useSetTimeout() {\r\n // Store setTimeout reference so es6-promise will be unaffected by\r\n // other code modifying setTimeout (like sinon.useFakeTimers())\r\n var globalSetTimeout = setTimeout;\r\n return function () {\r\n return globalSetTimeout(flush, 1);\r\n };\r\n }\r\n\r\n var queue = new Array(1000);\r\n function flush() {\r\n for (var i = 0; i < len; i += 2) {\r\n var callback = queue[i];\r\n var arg = queue[i + 1];\r\n\r\n callback(arg);\r\n\r\n queue[i] = undefined;\r\n queue[i + 1] = undefined;\r\n }\r\n\r\n len = 0;\r\n }\r\n\r\n function attemptVertx() {\r\n try {\r\n var vertx = Function('return this')().require('vertx');\r\n vertxNext = vertx.runOnLoop || vertx.runOnContext;\r\n return useVertxTimer();\r\n } catch (e) {\r\n return useSetTimeout();\r\n }\r\n }\r\n\r\n var scheduleFlush = void 0;\r\n // Decide what async method to use to triggering processing of queued callbacks:\r\n if (isNode) {\r\n scheduleFlush = useNextTick();\r\n } else if (BrowserMutationObserver) {\r\n scheduleFlush = useMutationObserver();\r\n } else if (isWorker) {\r\n scheduleFlush = useMessageChannel();\r\n } else if (browserWindow === undefined && typeof require === 'function') {\r\n scheduleFlush = attemptVertx();\r\n } else {\r\n scheduleFlush = useSetTimeout();\r\n }\r\n\r\n function then(onFulfillment, onRejection) {\r\n var parent = this;\r\n\r\n var child = new this.constructor(noop);\r\n\r\n if (child[PROMISE_ID] === undefined) {\r\n makePromise(child);\r\n }\r\n\r\n var _state = parent._state;\r\n\r\n\r\n if (_state) {\r\n var callback = arguments[_state - 1];\r\n asap(function () {\r\n return invokeCallback(_state, child, callback, parent._result);\r\n });\r\n } else {\r\n subscribe(parent, child, onFulfillment, onRejection);\r\n }\r\n\r\n return child;\r\n }\r\n\r\n /**\r\n `Promise.resolve` returns a promise that will become resolved with the\r\n passed `value`. It is shorthand for the following:\r\n \r\n ```javascript\r\n let promise = new Promise(function(resolve, reject){\r\n resolve(1);\r\n });\r\n \r\n promise.then(function(value){\r\n // value === 1\r\n });\r\n ```\r\n \r\n Instead of writing the above, your code now simply becomes the following:\r\n \r\n ```javascript\r\n let promise = Promise.resolve(1);\r\n \r\n promise.then(function(value){\r\n // value === 1\r\n });\r\n ```\r\n \r\n @method resolve\r\n @static\r\n @param {Any} value value that the returned promise will be resolved with\r\n Useful for tooling.\r\n @return {Promise} a promise that will become fulfilled with the given\r\n `value`\r\n */\r\n function resolve$1(object) {\r\n /*jshint validthis:true */\r\n var Constructor = this;\r\n\r\n if (object && typeof object === 'object' && object.constructor === Constructor) {\r\n return object;\r\n }\r\n\r\n var promise = new Constructor(noop);\r\n resolve(promise, object);\r\n return promise;\r\n }\r\n\r\n var PROMISE_ID = Math.random().toString(36).substring(2);\r\n\r\n function noop() { }\r\n\r\n var PENDING = void 0;\r\n var FULFILLED = 1;\r\n var REJECTED = 2;\r\n\r\n var TRY_CATCH_ERROR = { error: null };\r\n\r\n function selfFulfillment() {\r\n return new TypeError(\"You cannot resolve a promise with itself\");\r\n }\r\n\r\n function cannotReturnOwn() {\r\n return new TypeError('A promises callback cannot return that same promise.');\r\n }\r\n\r\n function getThen(promise) {\r\n try {\r\n return promise.then;\r\n } catch (error) {\r\n TRY_CATCH_ERROR.error = error;\r\n return TRY_CATCH_ERROR;\r\n }\r\n }\r\n\r\n function tryThen(then$$1, value, fulfillmentHandler, rejectionHandler) {\r\n try {\r\n then$$1.call(value, fulfillmentHandler, rejectionHandler);\r\n } catch (e) {\r\n return e;\r\n }\r\n }\r\n\r\n function handleForeignThenable(promise, thenable, then$$1) {\r\n asap(function (promise) {\r\n var sealed = false;\r\n var error = tryThen(then$$1, thenable, function (value) {\r\n if (sealed) {\r\n return;\r\n }\r\n sealed = true;\r\n if (thenable !== value) {\r\n resolve(promise, value);\r\n } else {\r\n fulfill(promise, value);\r\n }\r\n }, function (reason) {\r\n if (sealed) {\r\n return;\r\n }\r\n sealed = true;\r\n\r\n reject(promise, reason);\r\n }, 'Settle: ' + (promise._label || ' unknown promise'));\r\n\r\n if (!sealed && error) {\r\n sealed = true;\r\n reject(promise, error);\r\n }\r\n }, promise);\r\n }\r\n\r\n function handleOwnThenable(promise, thenable) {\r\n if (thenable._state === FULFILLED) {\r\n fulfill(promise, thenable._result);\r\n } else if (thenable._state === REJECTED) {\r\n reject(promise, thenable._result);\r\n } else {\r\n subscribe(thenable, undefined, function (value) {\r\n return resolve(promise, value);\r\n }, function (reason) {\r\n return reject(promise, reason);\r\n });\r\n }\r\n }\r\n\r\n function handleMaybeThenable(promise, maybeThenable, then$$1) {\r\n if (maybeThenable.constructor === promise.constructor && then$$1 === then && maybeThenable.constructor.resolve === resolve$1) {\r\n handleOwnThenable(promise, maybeThenable);\r\n } else {\r\n if (then$$1 === TRY_CATCH_ERROR) {\r\n reject(promise, TRY_CATCH_ERROR.error);\r\n TRY_CATCH_ERROR.error = null;\r\n } else if (then$$1 === undefined) {\r\n fulfill(promise, maybeThenable);\r\n } else if (isFunction(then$$1)) {\r\n handleForeignThenable(promise, maybeThenable, then$$1);\r\n } else {\r\n fulfill(promise, maybeThenable);\r\n }\r\n }\r\n }\r\n\r\n function resolve(promise, value) {\r\n if (promise === value) {\r\n reject(promise, selfFulfillment());\r\n } else if (objectOrFunction(value)) {\r\n handleMaybeThenable(promise, value, getThen(value));\r\n } else {\r\n fulfill(promise, value);\r\n }\r\n }\r\n\r\n function publishRejection(promise) {\r\n if (promise._onerror) {\r\n promise._onerror(promise._result);\r\n }\r\n\r\n publish(promise);\r\n }\r\n\r\n function fulfill(promise, value) {\r\n if (promise._state !== PENDING) {\r\n return;\r\n }\r\n\r\n promise._result = value;\r\n promise._state = FULFILLED;\r\n\r\n if (promise._subscribers.length !== 0) {\r\n asap(publish, promise);\r\n }\r\n }\r\n\r\n function reject(promise, reason) {\r\n if (promise._state !== PENDING) {\r\n return;\r\n }\r\n promise._state = REJECTED;\r\n promise._result = reason;\r\n\r\n asap(publishRejection, promise);\r\n }\r\n\r\n function subscribe(parent, child, onFulfillment, onRejection) {\r\n var _subscribers = parent._subscribers;\r\n var length = _subscribers.length;\r\n\r\n\r\n parent._onerror = null;\r\n\r\n _subscribers[length] = child;\r\n _subscribers[length + FULFILLED] = onFulfillment;\r\n _subscribers[length + REJECTED] = onRejection;\r\n\r\n if (length === 0 && parent._state) {\r\n asap(publish, parent);\r\n }\r\n }\r\n\r\n function publish(promise) {\r\n var subscribers = promise._subscribers;\r\n var settled = promise._state;\r\n\r\n if (subscribers.length === 0) {\r\n return;\r\n }\r\n\r\n var child = void 0,\r\n callback = void 0,\r\n detail = promise._result;\r\n\r\n for (var i = 0; i < subscribers.length; i += 3) {\r\n child = subscribers[i];\r\n callback = subscribers[i + settled];\r\n\r\n if (child) {\r\n invokeCallback(settled, child, callback, detail);\r\n } else {\r\n callback(detail);\r\n }\r\n }\r\n\r\n promise._subscribers.length = 0;\r\n }\r\n\r\n function tryCatch(callback, detail) {\r\n try {\r\n return callback(detail);\r\n } catch (e) {\r\n TRY_CATCH_ERROR.error = e;\r\n return TRY_CATCH_ERROR;\r\n }\r\n }\r\n\r\n function invokeCallback(settled, promise, callback, detail) {\r\n var hasCallback = isFunction(callback),\r\n value = void 0,\r\n error = void 0,\r\n succeeded = void 0,\r\n failed = void 0;\r\n\r\n if (hasCallback) {\r\n value = tryCatch(callback, detail);\r\n\r\n if (value === TRY_CATCH_ERROR) {\r\n failed = true;\r\n error = value.error;\r\n value.error = null;\r\n } else {\r\n succeeded = true;\r\n }\r\n\r\n if (promise === value) {\r\n reject(promise, cannotReturnOwn());\r\n return;\r\n }\r\n } else {\r\n value = detail;\r\n succeeded = true;\r\n }\r\n\r\n if (promise._state !== PENDING) {\r\n // noop\r\n } else if (hasCallback && succeeded) {\r\n resolve(promise, value);\r\n } else if (failed) {\r\n reject(promise, error);\r\n } else if (settled === FULFILLED) {\r\n fulfill(promise, value);\r\n } else if (settled === REJECTED) {\r\n reject(promise, value);\r\n }\r\n }\r\n\r\n function initializePromise(promise, resolver) {\r\n try {\r\n resolver(function resolvePromise(value) {\r\n resolve(promise, value);\r\n }, function rejectPromise(reason) {\r\n reject(promise, reason);\r\n });\r\n } catch (e) {\r\n reject(promise, e);\r\n }\r\n }\r\n\r\n var id = 0;\r\n function nextId() {\r\n return id++;\r\n }\r\n\r\n function makePromise(promise) {\r\n promise[PROMISE_ID] = id++;\r\n promise._state = undefined;\r\n promise._result = undefined;\r\n promise._subscribers = [];\r\n }\r\n\r\n function validationError() {\r\n return new Error('Array Methods must be provided an Array');\r\n }\r\n\r\n var Enumerator = function () {\r\n function Enumerator(Constructor, input) {\r\n this._instanceConstructor = Constructor;\r\n this.promise = new Constructor(noop);\r\n\r\n if (!this.promise[PROMISE_ID]) {\r\n makePromise(this.promise);\r\n }\r\n\r\n if (isArray(input)) {\r\n this.length = input.length;\r\n this._remaining = input.length;\r\n\r\n this._result = new Array(this.length);\r\n\r\n if (this.length === 0) {\r\n fulfill(this.promise, this._result);\r\n } else {\r\n this.length = this.length || 0;\r\n this._enumerate(input);\r\n if (this._remaining === 0) {\r\n fulfill(this.promise, this._result);\r\n }\r\n }\r\n } else {\r\n reject(this.promise, validationError());\r\n }\r\n }\r\n\r\n Enumerator.prototype._enumerate = function _enumerate(input) {\r\n for (var i = 0; this._state === PENDING && i < input.length; i++) {\r\n this._eachEntry(input[i], i);\r\n }\r\n };\r\n\r\n Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {\r\n var c = this._instanceConstructor;\r\n var resolve$$1 = c.resolve;\r\n\r\n\r\n if (resolve$$1 === resolve$1) {\r\n var _then = getThen(entry);\r\n\r\n if (_then === then && entry._state !== PENDING) {\r\n this._settledAt(entry._state, i, entry._result);\r\n } else if (typeof _then !== 'function') {\r\n this._remaining--;\r\n this._result[i] = entry;\r\n } else if (c === Promise$2) {\r\n var promise = new c(noop);\r\n handleMaybeThenable(promise, entry, _then);\r\n this._willSettleAt(promise, i);\r\n } else {\r\n this._willSettleAt(new c(function (resolve$$1) {\r\n return resolve$$1(entry);\r\n }), i);\r\n }\r\n } else {\r\n this._willSettleAt(resolve$$1(entry), i);\r\n }\r\n };\r\n\r\n Enumerator.prototype._settledAt = function _settledAt(state, i, value) {\r\n var promise = this.promise;\r\n\r\n\r\n if (promise._state === PENDING) {\r\n this._remaining--;\r\n\r\n if (state === REJECTED) {\r\n reject(promise, value);\r\n } else {\r\n this._result[i] = value;\r\n }\r\n }\r\n\r\n if (this._remaining === 0) {\r\n fulfill(promise, this._result);\r\n }\r\n };\r\n\r\n Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {\r\n var enumerator = this;\r\n\r\n subscribe(promise, undefined, function (value) {\r\n return enumerator._settledAt(FULFILLED, i, value);\r\n }, function (reason) {\r\n return enumerator._settledAt(REJECTED, i, reason);\r\n });\r\n };\r\n\r\n return Enumerator;\r\n }();\r\n\r\n /**\r\n `Promise.all` accepts an array of promises, and returns a new promise which\r\n is fulfilled with an array of fulfillment values for the passed promises, or\r\n rejected with the reason of the first passed promise to be rejected. It casts all\r\n elements of the passed iterable to promises as it runs this algorithm.\r\n \r\n Example:\r\n \r\n ```javascript\r\n let promise1 = resolve(1);\r\n let promise2 = resolve(2);\r\n let promise3 = resolve(3);\r\n let promises = [ promise1, promise2, promise3 ];\r\n \r\n Promise.all(promises).then(function(array){\r\n // The array here would be [ 1, 2, 3 ];\r\n });\r\n ```\r\n \r\n If any of the `promises` given to `all` are rejected, the first promise\r\n that is rejected will be given as an argument to the returned promises's\r\n rejection handler. For example:\r\n \r\n Example:\r\n \r\n ```javascript\r\n let promise1 = resolve(1);\r\n let promise2 = reject(new Error(\"2\"));\r\n let promise3 = reject(new Error(\"3\"));\r\n let promises = [ promise1, promise2, promise3 ];\r\n \r\n Promise.all(promises).then(function(array){\r\n // Code here never runs because there are rejected promises!\r\n }, function(error) {\r\n // error.message === \"2\"\r\n });\r\n ```\r\n \r\n @method all\r\n @static\r\n @param {Array} entries array of promises\r\n @param {String} label optional string for labeling the promise.\r\n Useful for tooling.\r\n @return {Promise} promise that is fulfilled when all `promises` have been\r\n fulfilled, or rejected if any of them become rejected.\r\n @static\r\n */\r\n function all(entries) {\r\n return new Enumerator(this, entries).promise;\r\n }\r\n\r\n /**\r\n `Promise.race` returns a new promise which is settled in the same way as the\r\n first passed promise to settle.\r\n \r\n Example:\r\n \r\n ```javascript\r\n let promise1 = new Promise(function(resolve, reject){\r\n setTimeout(function(){\r\n resolve('promise 1');\r\n }, 200);\r\n });\r\n \r\n let promise2 = new Promise(function(resolve, reject){\r\n setTimeout(function(){\r\n resolve('promise 2');\r\n }, 100);\r\n });\r\n \r\n Promise.race([promise1, promise2]).then(function(result){\r\n // result === 'promise 2' because it was resolved before promise1\r\n // was resolved.\r\n });\r\n ```\r\n \r\n `Promise.race` is deterministic in that only the state of the first\r\n settled promise matters. For example, even if other promises given to the\r\n `promises` array argument are resolved, but the first settled promise has\r\n become rejected before the other promises became fulfilled, the returned\r\n promise will become rejected:\r\n \r\n ```javascript\r\n let promise1 = new Promise(function(resolve, reject){\r\n setTimeout(function(){\r\n resolve('promise 1');\r\n }, 200);\r\n });\r\n \r\n let promise2 = new Promise(function(resolve, reject){\r\n setTimeout(function(){\r\n reject(new Error('promise 2'));\r\n }, 100);\r\n });\r\n \r\n Promise.race([promise1, promise2]).then(function(result){\r\n // Code here never runs\r\n }, function(reason){\r\n // reason.message === 'promise 2' because promise 2 became rejected before\r\n // promise 1 became fulfilled\r\n });\r\n ```\r\n \r\n An example real-world use case is implementing timeouts:\r\n \r\n ```javascript\r\n Promise.race([ajax('foo.json'), timeout(5000)])\r\n ```\r\n \r\n @method race\r\n @static\r\n @param {Array} promises array of promises to observe\r\n Useful for tooling.\r\n @return {Promise} a promise which settles in the same way as the first passed\r\n promise to settle.\r\n */\r\n function race(entries) {\r\n /*jshint validthis:true */\r\n var Constructor = this;\r\n\r\n if (!isArray(entries)) {\r\n return new Constructor(function (_, reject) {\r\n return reject(new TypeError('You must pass an array to race.'));\r\n });\r\n } else {\r\n return new Constructor(function (resolve, reject) {\r\n var length = entries.length;\r\n for (var i = 0; i < length; i++) {\r\n Constructor.resolve(entries[i]).then(resolve, reject);\r\n }\r\n });\r\n }\r\n }\r\n\r\n /**\r\n `Promise.reject` returns a promise rejected with the passed `reason`.\r\n It is shorthand for the following:\r\n \r\n ```javascript\r\n let promise = new Promise(function(resolve, reject){\r\n reject(new Error('WHOOPS'));\r\n });\r\n \r\n promise.then(function(value){\r\n // Code here doesn't run because the promise is rejected!\r\n }, function(reason){\r\n // reason.message === 'WHOOPS'\r\n });\r\n ```\r\n \r\n Instead of writing the above, your code now simply becomes the following:\r\n \r\n ```javascript\r\n let promise = Promise.reject(new Error('WHOOPS'));\r\n \r\n promise.then(function(value){\r\n // Code here doesn't run because the promise is rejected!\r\n }, function(reason){\r\n // reason.message === 'WHOOPS'\r\n });\r\n ```\r\n \r\n @method reject\r\n @static\r\n @param {Any} reason value that the returned promise will be rejected with.\r\n Useful for tooling.\r\n @return {Promise} a promise rejected with the given `reason`.\r\n */\r\n function reject$1(reason) {\r\n /*jshint validthis:true */\r\n var Constructor = this;\r\n var promise = new Constructor(noop);\r\n reject(promise, reason);\r\n return promise;\r\n }\r\n\r\n function needsResolver() {\r\n throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');\r\n }\r\n\r\n function needsNew() {\r\n throw new TypeError(\"Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.\");\r\n }\r\n\r\n /**\r\n Promise objects represent the eventual result of an asynchronous operation. The\r\n primary way of interacting with a promise is through its `then` method, which\r\n registers callbacks to receive either a promise's eventual value or the reason\r\n why the promise cannot be fulfilled.\r\n \r\n Terminology\r\n -----------\r\n \r\n - `promise` is an object or function with a `then` method whose behavior conforms to this specification.\r\n - `thenable` is an object or function that defines a `then` method.\r\n - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).\r\n - `exception` is a value that is thrown using the throw statement.\r\n - `reason` is a value that indicates why a promise was rejected.\r\n - `settled` the final resting state of a promise, fulfilled or rejected.\r\n \r\n A promise can be in one of three states: pending, fulfilled, or rejected.\r\n \r\n Promises that are fulfilled have a fulfillment value and are in the fulfilled\r\n state. Promises that are rejected have a rejection reason and are in the\r\n rejected state. A fulfillment value is never a thenable.\r\n \r\n Promises can also be said to *resolve* a value. If this value is also a\r\n promise, then the original promise's settled state will match the value's\r\n settled state. So a promise that *resolves* a promise that rejects will\r\n itself reject, and a promise that *resolves* a promise that fulfills will\r\n itself fulfill.\r\n \r\n \r\n Basic Usage:\r\n ------------\r\n \r\n ```js\r\n let promise = new Promise(function(resolve, reject) {\r\n // on success\r\n resolve(value);\r\n \r\n // on failure\r\n reject(reason);\r\n });\r\n \r\n promise.then(function(value) {\r\n // on fulfillment\r\n }, function(reason) {\r\n // on rejection\r\n });\r\n ```\r\n \r\n Advanced Usage:\r\n ---------------\r\n \r\n Promises shine when abstracting away asynchronous interactions such as\r\n `XMLHttpRequest`s.\r\n \r\n ```js\r\n function getJSON(url) {\r\n return new Promise(function(resolve, reject){\r\n let xhr = new XMLHttpRequest();\r\n \r\n xhr.open('GET', url);\r\n xhr.onreadystatechange = handler;\r\n xhr.responseType = 'json';\r\n xhr.setRequestHeader('Accept', 'application/json');\r\n xhr.send();\r\n \r\n function handler() {\r\n if (this.readyState === this.DONE) {\r\n if (this.status === 200) {\r\n resolve(this.response);\r\n } else {\r\n reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));\r\n }\r\n }\r\n };\r\n });\r\n }\r\n \r\n getJSON('/posts.json').then(function(json) {\r\n // on fulfillment\r\n }, function(reason) {\r\n // on rejection\r\n });\r\n ```\r\n \r\n Unlike callbacks, promises are great composable primitives.\r\n \r\n ```js\r\n Promise.all([\r\n getJSON('/posts'),\r\n getJSON('/comments')\r\n ]).then(function(values){\r\n values[0] // => postsJSON\r\n values[1] // => commentsJSON\r\n \r\n return values;\r\n });\r\n ```\r\n \r\n @class Promise\r\n @param {Function} resolver\r\n Useful for tooling.\r\n @constructor\r\n */\r\n\r\n var Promise$2 = function () {\r\n function Promise(resolver) {\r\n this[PROMISE_ID] = nextId();\r\n this._result = this._state = undefined;\r\n this._subscribers = [];\r\n\r\n if (noop !== resolver) {\r\n typeof resolver !== 'function' && needsResolver();\r\n this instanceof Promise ? initializePromise(this, resolver) : needsNew();\r\n }\r\n }\r\n\r\n /**\r\n The primary way of interacting with a promise is through its `then` method,\r\n which registers callbacks to receive either a promise's eventual value or the\r\n reason why the promise cannot be fulfilled.\r\n ```js\r\n findUser().then(function(user){\r\n // user is available\r\n }, function(reason){\r\n // user is unavailable, and you are given the reason why\r\n });\r\n ```\r\n Chaining\r\n --------\r\n The return value of `then` is itself a promise. This second, 'downstream'\r\n promise is resolved with the return value of the first promise's fulfillment\r\n or rejection handler, or rejected if the handler throws an exception.\r\n ```js\r\n findUser().then(function (user) {\r\n return user.name;\r\n }, function (reason) {\r\n return 'default name';\r\n }).then(function (userName) {\r\n // If `findUser` fulfilled, `userName` will be the user's name, otherwise it\r\n // will be `'default name'`\r\n });\r\n findUser().then(function (user) {\r\n throw new Error('Found user, but still unhappy');\r\n }, function (reason) {\r\n throw new Error('`findUser` rejected and we're unhappy');\r\n }).then(function (value) {\r\n // never reached\r\n }, function (reason) {\r\n // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.\r\n // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.\r\n });\r\n ```\r\n If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.\r\n ```js\r\n findUser().then(function (user) {\r\n throw new PedagogicalException('Upstream error');\r\n }).then(function (value) {\r\n // never reached\r\n }).then(function (value) {\r\n // never reached\r\n }, function (reason) {\r\n // The `PedgagocialException` is propagated all the way down to here\r\n });\r\n ```\r\n Assimilation\r\n ------------\r\n Sometimes the value you want to propagate to a downstream promise can only be\r\n retrieved asynchronously. This can be achieved by returning a promise in the\r\n fulfillment or rejection handler. The downstream promise will then be pending\r\n until the returned promise is settled. This is called *assimilation*.\r\n ```js\r\n findUser().then(function (user) {\r\n return findCommentsByAuthor(user);\r\n }).then(function (comments) {\r\n // The user's comments are now available\r\n });\r\n ```\r\n If the assimliated promise rejects, then the downstream promise will also reject.\r\n ```js\r\n findUser().then(function (user) {\r\n return findCommentsByAuthor(user);\r\n }).then(function (comments) {\r\n // If `findCommentsByAuthor` fulfills, we'll have the value here\r\n }, function (reason) {\r\n // If `findCommentsByAuthor` rejects, we'll have the reason here\r\n });\r\n ```\r\n Simple Example\r\n --------------\r\n Synchronous Example\r\n ```javascript\r\n let result;\r\n try {\r\n result = findResult();\r\n // success\r\n } catch(reason) {\r\n // failure\r\n }\r\n ```\r\n Errback Example\r\n ```js\r\n findResult(function(result, err){\r\n if (err) {\r\n // failure\r\n } else {\r\n // success\r\n }\r\n });\r\n ```\r\n Promise Example;\r\n ```javascript\r\n findResult().then(function(result){\r\n // success\r\n }, function(reason){\r\n // failure\r\n });\r\n ```\r\n Advanced Example\r\n --------------\r\n Synchronous Example\r\n ```javascript\r\n let author, books;\r\n try {\r\n author = findAuthor();\r\n books = findBooksByAuthor(author);\r\n // success\r\n } catch(reason) {\r\n // failure\r\n }\r\n ```\r\n Errback Example\r\n ```js\r\n function foundBooks(books) {\r\n }\r\n function failure(reason) {\r\n }\r\n findAuthor(function(author, err){\r\n if (err) {\r\n failure(err);\r\n // failure\r\n } else {\r\n try {\r\n findBoooksByAuthor(author, function(books, err) {\r\n if (err) {\r\n failure(err);\r\n } else {\r\n try {\r\n foundBooks(books);\r\n } catch(reason) {\r\n failure(reason);\r\n }\r\n }\r\n });\r\n } catch(error) {\r\n failure(err);\r\n }\r\n // success\r\n }\r\n });\r\n ```\r\n Promise Example;\r\n ```javascript\r\n findAuthor().\r\n then(findBooksByAuthor).\r\n then(function(books){\r\n // found books\r\n }).catch(function(reason){\r\n // something went wrong\r\n });\r\n ```\r\n @method then\r\n @param {Function} onFulfilled\r\n @param {Function} onRejected\r\n Useful for tooling.\r\n @return {Promise}\r\n */\r\n\r\n /**\r\n `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same\r\n as the catch block of a try/catch statement.\r\n ```js\r\n function findAuthor(){\r\n throw new Error('couldn't find that author');\r\n }\r\n // synchronous\r\n try {\r\n findAuthor();\r\n } catch(reason) {\r\n // something went wrong\r\n }\r\n // async with promises\r\n findAuthor().catch(function(reason){\r\n // something went wrong\r\n });\r\n ```\r\n @method catch\r\n @param {Function} onRejection\r\n Useful for tooling.\r\n @return {Promise}\r\n */\r\n\r\n\r\n Promise.prototype.catch = function _catch(onRejection) {\r\n return this.then(null, onRejection);\r\n };\r\n\r\n /**\r\n `finally` will be invoked regardless of the promise's fate just as native\r\n try/catch/finally behaves\r\n \r\n Synchronous example:\r\n \r\n ```js\r\n findAuthor() {\r\n if (Math.random() > 0.5) {\r\n throw new Error();\r\n }\r\n return new Author();\r\n }\r\n \r\n try {\r\n return findAuthor(); // succeed or fail\r\n } catch(error) {\r\n return findOtherAuther();\r\n } finally {\r\n // always runs\r\n // doesn't affect the return value\r\n }\r\n ```\r\n \r\n Asynchronous example:\r\n \r\n ```js\r\n findAuthor().catch(function(reason){\r\n return findOtherAuther();\r\n }).finally(function(){\r\n // author was either found, or not\r\n });\r\n ```\r\n \r\n @method finally\r\n @param {Function} callback\r\n @return {Promise}\r\n */\r\n\r\n\r\n Promise.prototype.finally = function _finally(callback) {\r\n var promise = this;\r\n var constructor = promise.constructor;\r\n\r\n return promise.then(function (value) {\r\n return constructor.resolve(callback()).then(function () {\r\n return value;\r\n });\r\n }, function (reason) {\r\n return constructor.resolve(callback()).then(function () {\r\n throw reason;\r\n });\r\n });\r\n };\r\n\r\n return Promise;\r\n }();\r\n\r\n Promise$2.prototype.then = then;\r\n Promise$2.all = all;\r\n Promise$2.race = race;\r\n Promise$2.resolve = resolve$1;\r\n Promise$2.reject = reject$1;\r\n Promise$2._setScheduler = setScheduler;\r\n Promise$2._setAsap = setAsap;\r\n Promise$2._asap = asap;\r\n\r\n /*global self*/\r\n function polyfill() {\r\n var local = void 0;\r\n\r\n if (typeof global !== 'undefined') {\r\n local = global;\r\n } else if (typeof self !== 'undefined') {\r\n local = self;\r\n } else {\r\n try {\r\n local = Function('return this')();\r\n } catch (e) {\r\n throw new Error('polyfill failed because global object is unavailable in this environment');\r\n }\r\n }\r\n\r\n var P = local.Promise;\r\n\r\n if (P) {\r\n var promiseToString = null;\r\n try {\r\n promiseToString = Object.prototype.toString.call(P.resolve());\r\n } catch (e) {\r\n // silently ignored\r\n }\r\n\r\n if (promiseToString === '[object Promise]' && !P.cast) {\r\n return;\r\n }\r\n }\r\n\r\n local.Promise = Promise$2;\r\n }\r\n\r\n // Strange compat..\r\n Promise$2.polyfill = polyfill;\r\n Promise$2.Promise = Promise$2;\r\n\r\n Promise$2.polyfill();\r\n\r\n return Promise$2;\r\n\r\n})));\r\n\r\n\r\n\r\n//# sourceMappingURL=es6-promise.auto.map","$(document).ready(function () {\r\n if (!navigator.userAgent.match(/(iPad)|(iPhone)|(iPod)|(android)|(webOS)/i) && ($(\".module-footermenu-list .nice-select\").length > 0 || $(\".module-dropdown .nice-select\").length > 0)) {\r\n var li = $(\".module-footermenu-list .nice-select > ul > li, .module-dropdown .nice-select > ul > li\");\r\n\r\n li.click(function () {\r\n window.open($(this).attr(\"value\"), $(this).attr(\"data-target\"));\r\n });\r\n\r\n li.keypress(function (e) {\r\n if (e.which == 13) {\r\n window.open($(this).attr(\"value\"), $(this).attr(\"data-target\"));\r\n }\r\n });\r\n } else if ($(\".module-footermenu-list select\").length > 0 || (\".module-dropdown select\").length > 0) {\r\n var select = $(\".module-footermenu-list select, .module-dropdown select\");\r\n select.change(function () {\r\n window.location.replace($(this).val());\r\n });\r\n }\r\n});","$(document).ready(function () {\r\n var video = $(\"[data-contentheader-video]\"),\r\n toggle = $(\"[data-contentheader-video-toggle]\");\r\n\r\n toggle.click(function () {\r\n videoToggle(toggle, video);\r\n });\r\n\r\n toggle.keypress(function (e) {\r\n // If enter.\r\n if (e.which == 13) {\r\n videoToggle();\r\n }\r\n // If space.\r\n if (e.which == 32) {\r\n videoToggle();\r\n }\r\n });\r\n if (video.length) {\r\n video[0].onended = function () {\r\n toggle.addClass(\"rerun\");\r\n toggle.removeClass(\"play\");\r\n toggle.removeClass(\"pause\");\r\n }\r\n };\r\n});\r\n\r\nfunction videoToggle(toggle, video) {\r\n if (video.length) {\r\n if (video[0].paused) {\r\n video[0].play();\r\n toggle.addClass(\"pause\");\r\n toggle.removeClass(\"play\");\r\n toggle.removeClass(\"rerun\");\r\n } else {\r\n video[0].pause();\r\n toggle.addClass(\"play\");\r\n toggle.removeClass(\"pause\");\r\n toggle.removeClass(\"rerun\");\r\n }\r\n }\r\n}\r\n","// IE Polyfill for \"foreach\"\r\nif (window.NodeList && !NodeList.prototype.forEach) {\r\n NodeList.prototype.forEach = function(callback, thisArg) {\r\n thisArg = thisArg || window;\r\n for (var i = 0; i < this.length; i++) {\r\n callback.call(thisArg, this[i], i, this);\r\n }\r\n };\r\n}\r\n\r\nfunction CookieConsent() {\r\n this.cookies;\r\n this.cookiesEnabled = false;\r\n this.categories = [];\r\n this.cookieHasBeenOpen = false;\r\n this.tabelhead = function(cookieContent, cookiehead) {\r\n return `\r\n \r\n \r\n | ${cookiehead.name} | \r\n ${cookiehead.company} | \r\n ${cookiehead.description} | \r\n ${cookiehead.expires} | \r\n
\r\n \r\n \r\n ${cookieContent}\r\n \r\n
`;\r\n };\r\n this.tabelbody = function(cookie, singleCookie, cookiehead) {\r\n return `\r\n | ${singleCookie} | \r\n ${cookie.company} | \r\n ${cookie.description} | \r\n ${cookie.expires} | \r\n
\r\n `;\r\n };\r\n this.cookiehead;\r\n\r\n //Native async request function to load json\r\n this.loadJSON = function(path, success, error) {\r\n var xhr = new XMLHttpRequest();\r\n xhr.onreadystatechange = function() {\r\n if (xhr.readyState === XMLHttpRequest.DONE) {\r\n if (xhr.status === 200) {\r\n if (success) success(JSON.parse(xhr.responseText));\r\n } else {\r\n if (error) error(xhr);\r\n }\r\n }\r\n };\r\n xhr.open(\"GET\", path, true);\r\n xhr.send();\r\n };\r\n\r\n this.init = function() {\r\n var _self = this;\r\n document.addEventListener(\"DOMContentLoaded\", function(event) {\r\n _self.cookiesEnabled =\r\n document.querySelector(\".cookie-container\") != null;\r\n\r\n if (_self.cookiesEnabled) {\r\n const hiddenInputCookiesContainer = document.querySelector(\r\n \"#hiddenInputCookiesContainer\"\r\n );\r\n\r\n if (\r\n hiddenInputCookiesContainer == null ||\r\n hiddenInputCookiesContainer.value == \"\"\r\n ) {\r\n const data = JSON.parse(\"[]\");\r\n _self.cookies = data;\r\n } else {\r\n const data = JSON.parse(hiddenInputCookiesContainer.value);\r\n _self.cookies = data;\r\n }\r\n\r\n _self.createGlobalCookieBtn();\r\n //Is user previously has accepted cookies\r\n if (_self.CheckCookieExistance(\"cookiesAccepted\")) {\r\n _self.runCookieScripts();\r\n } else {\r\n _self.openConsent();\r\n }\r\n }\r\n });\r\n };\r\n\r\n this.createGlobalCookieBtn = function() {\r\n var btnContainer = document.createElement(\"div\");\r\n btnContainer.classList.add(\"cookie-button-container\");\r\n\r\n var icon = document.createElement(\"i\");\r\n icon.innerHTML = \"ⓘ\";\r\n\r\n var textEl = document.createElement(\"span\");\r\n textEl.innerText = \"Cookies\";\r\n\r\n btnContainer.appendChild(icon);\r\n btnContainer.appendChild(textEl);\r\n btnContainer.tabIndex = 0; //add tabIndex\r\n\r\n var _self = this;\r\n\r\n btnContainer.addEventListener(\"click\", function() {\r\n _self.openConsent();\r\n });\r\n\r\n // open consent with tabIndex\r\n btnContainer.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n _self.openConsent();\r\n }\r\n });\r\n\r\n var containerBtnContainer = document.querySelector(\".cookie-container\");\r\n\r\n containerBtnContainer.parentElement.insertBefore(\r\n btnContainer,\r\n containerBtnContainer\r\n );\r\n };\r\n\r\n this.setupConsentPopup = function() {\r\n var string = document.getElementById(\"CookieTableHead\").value;\r\n this.cookiehead = JSON.parse(string);\r\n\r\n this.sortCookiesIntoCategories();\r\n var _self = this;\r\n\r\n //ACCEPT BUTTON CLICK\r\n document\r\n .querySelector(\"#acceptCookies\")\r\n .addEventListener(\"click\", () => {\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n _self.setCategoryCookies();\r\n document.cookie =\r\n \"cookiesAccepted=true; expires=\" + expires + \"; path=/;\";\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.remove(\"cookie-container--show\");\r\n _self.runCookieScripts();\r\n });\r\n document\r\n .querySelector(\"#rejectCookies\")\r\n .addEventListener(\"click\", () => {\r\n _self.rejectCookies();\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n _self.setCategoryCookies();\r\n document.cookie =\r\n \"cookiesAccepted=true; expires=\" + expires + \"; path=/;\";\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.remove(\"cookie-container--show\");\r\n _self.runCookieScripts();\r\n });\r\n\r\n var showDetailButtonText = document\r\n .querySelectorAll(\"[data-toggle-details]\")[0]\r\n .getAttribute(\"data-details-show-title\");\r\n var hideDetailsButtonText = document\r\n .querySelectorAll(\"[data-toggle-details]\")[0]\r\n .getAttribute(\"data-details-hide-title\");\r\n var showMoreAboutCookieButton = document.querySelectorAll(\r\n \"[data-toggle-details]\"\r\n )[0];\r\n\r\n var categoriesTypesButton = document.querySelectorAll(\r\n \"[data-declartion-button]\"\r\n )[0];\r\n var aboutCookiesButton = document.querySelectorAll(\r\n \"[data-about-cookies-button]\"\r\n )[0];\r\n\r\n var categoriesTypesContainer = document.querySelectorAll(\r\n \"[data-categories-types-container]\"\r\n )[0];\r\n var aboutCookiesContainer = document.querySelectorAll(\r\n \"[data-detail-type-content]\"\r\n )[0];\r\n\r\n showMoreAboutCookieButton.innerHTML = showDetailButtonText;\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesButton.addEventListener(\"click\", function() {\r\n if (\r\n !categoriesTypesContainer.classList.contains(\r\n \"cookie-detail-tab-item--show\"\r\n )\r\n ) {\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n aboutCookiesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n aboutCookiesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n }\r\n });\r\n\r\n aboutCookiesButton.addEventListener(\"click\", function() {\r\n if (\r\n !aboutCookiesContainer.classList.contains(\r\n \"cookie-detail-tab-item--show\"\r\n )\r\n ) {\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n aboutCookiesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n aboutCookiesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n }\r\n });\r\n\r\n showMoreAboutCookieButton.addEventListener(\"click\", function() {\r\n document\r\n .querySelectorAll(\"[data-cookie-detail]\")[0]\r\n .classList.toggle(\"cookie-detail--show\");\r\n if (showMoreAboutCookieButton.innerHTML === showDetailButtonText) {\r\n showMoreAboutCookieButton.innerHTML = hideDetailsButtonText;\r\n } else {\r\n showMoreAboutCookieButton.innerHTML = showDetailButtonText;\r\n }\r\n });\r\n };\r\n\r\n this.setCategoryCookies = function() {\r\n var _self = this;\r\n\r\n var checkboxContainers = document.getElementsByClassName(\r\n \"cookie-setting-checkbox\"\r\n );\r\n Array.prototype.forEach.call(checkboxContainers, function(container) {\r\n var checkbox = container.getElementsByTagName(\"input\")[0];\r\n\r\n var cookieName = checkbox.id.replace(\"categoryCheckbox\", \"\");\r\n\r\n //IF COOKIE EXISTS\r\n if (_self.CheckCookieExistance(cookieName)) {\r\n //REMOVE COOKIE\r\n document.cookie =\r\n cookieName +\r\n \"=; expires=Thu, 01 Jan 1970 00:00:00 UTC; path=/;\";\r\n }\r\n\r\n if (checkbox.checked === true) {\r\n //ADD COOKIE\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n document.cookie =\r\n cookieName + \"=allow; expires=\" + expires + \"; path=/;\";\r\n }\r\n });\r\n };\r\n\r\n this.CheckCookieExistance = function(cname) {\r\n var name = cname + \"=\";\r\n var decodedCookie = decodeURIComponent(document.cookie);\r\n var ca = decodedCookie.split(\";\");\r\n for (var i = 0; i < ca.length; i++) {\r\n var c = ca[i];\r\n while (c.charAt(0) == \" \") {\r\n c = c.substring(1);\r\n }\r\n if (c.indexOf(name) == 0) {\r\n return true;\r\n }\r\n }\r\n return false;\r\n };\r\n\r\n this.openConsent = function() {\r\n if (!this.cookieHasBeenOpen) {\r\n this.setupConsentPopup();\r\n this.cookieHasBeenOpen = true;\r\n }\r\n\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.add(\"cookie-container--show\");\r\n };\r\n\r\n this.sortCookiesIntoCategories = function() {\r\n var _self = this;\r\n this.cookies.forEach(function(cookie) {\r\n if (_self.categories.length > 0) {\r\n var categoryExist = false;\r\n\r\n _self.categories.forEach(function(category) {\r\n if (category.name === cookie.category) {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n category.categoryCookies.push(catCookie);\r\n\r\n categoryExist = true;\r\n }\r\n });\r\n\r\n if (!categoryExist) {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n var cat = {\r\n name: cookie.category,\r\n categoryCookies: [catCookie]\r\n };\r\n\r\n _self.categories.push(cat);\r\n }\r\n } else {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n var cat = {\r\n name: cookie.category,\r\n categoryCookies: [catCookie]\r\n };\r\n\r\n _self.categories.push(cat);\r\n }\r\n });\r\n\r\n this.createCheckboks();\r\n this.createCategoryTabels();\r\n };\r\n\r\n this.runCookieScripts = function() {\r\n if (this.CheckCookieExistance(\"CookieCategory2\")) {\r\n // ikke obligatorisk\r\n this.runScripts();\r\n }\r\n };\r\n\r\n this.createCheckboks = function() {\r\n var _self = this;\r\n this.categories.forEach(function(category) {\r\n //Container for checkbox and label\r\n var checkboxContainer = document.createElement(\"div\");\r\n checkboxContainer.className = \"cookie-setting-checkbox\";\r\n\r\n //Checkbox for toggleing each category\r\n var checkbox = document.createElement(\"input\");\r\n checkbox.type = \"checkbox\";\r\n checkbox.name = \"categoryCheckbox\" + category.name;\r\n checkbox.id = \"categoryCheckbox\" + category.name;\r\n\r\n //Start tabIndex\r\n if (category.name !== \"CookieCategory1\") {\r\n checkboxContainer.tabIndex = 0;\r\n }\r\n checkboxContainer.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n if (category.name !== \"CookieCategory1\") {\r\n if (checkbox.checked) {\r\n checkbox.checked = false;\r\n } else {\r\n checkbox.checked = true;\r\n }\r\n }\r\n }\r\n });\r\n //End tabIndex\r\n\r\n if (category.name === \"CookieCategory1\") {\r\n //MANDATORY\r\n checkbox.checked = true;\r\n checkbox.disabled = true;\r\n } else if (!_self.CheckCookieExistance(\"cookiesAccepted\")) {\r\n //CHECK ALL ON FIRST VISIT\r\n checkbox.checked = true;\r\n } else if (_self.CheckCookieExistance(category.name)) {\r\n //CHECK IF COOKIE SET\r\n checkbox.checked = true;\r\n }\r\n\r\n //Label for checkbox\r\n var label = document.createElement(\"label\");\r\n label.htmlFor = \"categoryCheckbox\" + category.name;\r\n label.appendChild(\r\n document.createTextNode(\r\n document.getElementById(category.name).value\r\n )\r\n );\r\n\r\n //Append checkbox and label to container\r\n checkboxContainer.appendChild(checkbox);\r\n checkboxContainer.appendChild(label);\r\n\r\n //Append container to dom\r\n document\r\n .querySelectorAll(\"[data-categories]\")[0]\r\n .appendChild(checkboxContainer);\r\n });\r\n };\r\n\r\n this.runCookie = function(cookie) {\r\n if (cookie.accept && !cookie.runned) {\r\n cookie.runned = true;\r\n eval(\"(\" + cookie.accept + \")\")();\r\n }\r\n };\r\n\r\n this.rejectCookies = () => {\r\n var checkboxContainers = document.getElementsByClassName(\r\n \"cookie-setting-checkbox\"\r\n );\r\n Array.prototype.forEach.call(checkboxContainers, function(container) {\r\n var checkbox = container.getElementsByTagName(\"input\")[0];\r\n\r\n if (checkbox.name !== \"categoryCheckboxCookieCategory1\") {\r\n checkbox.checked = false;\r\n }\r\n });\r\n };\r\n\r\n this.runScripts = function() {\r\n var scriptTags = document.querySelectorAll(\"[type='text/plain']\");\r\n var _self = this;\r\n scriptTags.forEach(function(script) {\r\n var scriptToLoad = script.cloneNode(true);\r\n scriptToLoad.setAttribute(\"type\", \"text/javascript\");\r\n _self.insertAfter(script, scriptToLoad);\r\n });\r\n };\r\n\r\n this.insertAfter = function(referenceNode, newNode) {\r\n referenceNode.parentNode.insertBefore(\r\n newNode,\r\n referenceNode.nextSibling\r\n );\r\n };\r\n\r\n this.createCategoryTabels = function() {\r\n var self = this;\r\n this.categories.forEach(function(category, index) {\r\n var cookieCategoryTypeLink = document.createElement(\"a\");\r\n\r\n //Start tabIndex effect\r\n cookieCategoryTypeLink.tabIndex = 0;\r\n cookieCategoryTypeLink.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n var cookieCategoryToShow = document.querySelectorAll(\r\n '[data-category-type=\"' + category.name + '\"]'\r\n )[0];\r\n var allCookieCategories = document.querySelectorAll(\r\n \"[data-category-type]\"\r\n );\r\n\r\n if (\r\n !cookieCategoryToShow.classList.contains(\r\n \"cookie-type-container--show\"\r\n )\r\n ) {\r\n allCookieCategories.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-container--show\");\r\n });\r\n cookieCategoryToShow.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n var allCookiteCategorieLinks = document.querySelectorAll(\r\n \"[data-categories-types] a\"\r\n );\r\n\r\n allCookiteCategorieLinks.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-link--active\");\r\n });\r\n\r\n this.classList.add(\"cookie-type-link--active\");\r\n }\r\n }\r\n });\r\n //End tabIndex effect\r\n\r\n cookieCategoryTypeLink.addEventListener(\"click\", function() {\r\n var cookieCategoryToShow = document.querySelectorAll(\r\n '[data-category-type=\"' + category.name + '\"]'\r\n )[0];\r\n var allCookieCategories = document.querySelectorAll(\r\n \"[data-category-type]\"\r\n );\r\n\r\n if (\r\n !cookieCategoryToShow.classList.contains(\r\n \"cookie-type-container--show\"\r\n )\r\n ) {\r\n allCookieCategories.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-container--show\");\r\n });\r\n cookieCategoryToShow.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n var allCookiteCategorieLinks = document.querySelectorAll(\r\n \"[data-categories-types] a\"\r\n );\r\n allCookiteCategorieLinks.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-link--active\");\r\n });\r\n this.classList.add(\"cookie-type-link--active\");\r\n }\r\n });\r\n\r\n cookieCategoryTypeLink.classList.add(\"cookie-type-link\");\r\n //cookieCategoryTypeLink.setAttribute(\"data-category-type-link\", category.name);\r\n\r\n var cookieCategoryTypeContainer = document.createElement(\"div\");\r\n cookieCategoryTypeContainer.setAttribute(\r\n \"data-category-type\",\r\n category.name\r\n );\r\n cookieCategoryTypeContainer.className = \"cookie-type-container\";\r\n\r\n if (index === 0) {\r\n cookieCategoryTypeContainer.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n cookieCategoryTypeLink.classList.add(\r\n \"cookie-type-link--active\"\r\n );\r\n }\r\n var cookiesHtml = \"\";\r\n category.categoryCookies.forEach(function(cookie) {\r\n var thisCookie = cookie;\r\n\r\n cookie.cookies.forEach(function(singleCookie) {\r\n //Using template string function table body to generate html\r\n var cookieHtml = self.tabelbody(\r\n thisCookie,\r\n singleCookie,\r\n self.cookiehead\r\n );\r\n cookiesHtml += cookieHtml;\r\n });\r\n });\r\n\r\n //Using tmeplate string function, insert generated body into table head function\r\n var tabelHtml = self.tabelhead(cookiesHtml, self.cookiehead);\r\n cookieCategoryTypeContainer.innerHTML = tabelHtml;\r\n\r\n document\r\n .querySelectorAll(\"[data-categories-types-details]\")[0]\r\n .appendChild(cookieCategoryTypeContainer);\r\n cookieCategoryTypeLink.appendChild(\r\n document.createTextNode(\r\n document.getElementById(category.name).value\r\n )\r\n );\r\n document\r\n .querySelectorAll(\"[data-categories-types]\")[0]\r\n .appendChild(cookieCategoryTypeLink);\r\n });\r\n };\r\n}\r\n\r\n/*\r\n * classList.js: Cross-browser full element.classList implementation.\r\n * 1.1.20170427\r\n *\r\n * By Eli Grey, http://eligrey.com\r\n * License: Dedicated to the public domain.\r\n * See https://github.com/eligrey/classList.js/blob/master/LICENSE.md\r\n */\r\n\r\n/*global self, document, DOMException */\r\n\r\n/*! @source http://purl.eligrey.com/github/classList.js/blob/master/classList.js */\r\n\"document\" in window.self &&\r\n ((\"classList\" in document.createElement(\"_\") &&\r\n (!document.createElementNS ||\r\n \"classList\" in\r\n document.createElementNS(\"http://www.w3.org/2000/svg\", \"g\"))) ||\r\n (function(t) {\r\n \"use strict\";\r\n if (\"Element\" in t) {\r\n var e = \"classList\",\r\n n = \"prototype\",\r\n i = t.Element[n],\r\n s = Object,\r\n r =\r\n String[n].trim ||\r\n function() {\r\n return this.replace(/^\\s+|\\s+$/g, \"\");\r\n },\r\n o =\r\n Array[n].indexOf ||\r\n function(t) {\r\n for (var e = 0, n = this.length; e < n; e++)\r\n if (e in this && this[e] === t) return e;\r\n return -1;\r\n },\r\n c = function(t, e) {\r\n (this.name = t),\r\n (this.code = DOMException[t]),\r\n (this.message = e);\r\n },\r\n a = function(t, e) {\r\n if (\"\" === e)\r\n throw new c(\r\n \"SYNTAX_ERR\",\r\n \"An invalid or illegal string was specified\"\r\n );\r\n if (/\\s/.test(e))\r\n throw new c(\r\n \"INVALID_CHARACTER_ERR\",\r\n \"String contains an invalid character\"\r\n );\r\n return o.call(t, e);\r\n },\r\n l = function(t) {\r\n for (\r\n var e = r.call(t.getAttribute(\"class\") || \"\"),\r\n n = e ? e.split(/\\s+/) : [],\r\n i = 0,\r\n s = n.length;\r\n i < s;\r\n i++\r\n )\r\n this.push(n[i]);\r\n this._updateClassName = function() {\r\n t.setAttribute(\"class\", this.toString());\r\n };\r\n },\r\n u = (l[n] = []),\r\n f = function() {\r\n return new l(this);\r\n };\r\n if (\r\n ((c[n] = Error[n]),\r\n (u.item = function(t) {\r\n return this[t] || null;\r\n }),\r\n (u.contains = function(t) {\r\n return -1 !== a(this, (t += \"\"));\r\n }),\r\n (u.add = function() {\r\n for (\r\n var t, e = arguments, n = 0, i = e.length, s = !1;\r\n (t = e[n] + \"\"),\r\n -1 === a(this, t) && (this.push(t), (s = !0)),\r\n ++n < i;\r\n\r\n );\r\n s && this._updateClassName();\r\n }),\r\n (u.remove = function() {\r\n var t,\r\n e,\r\n n = arguments,\r\n i = 0,\r\n s = n.length,\r\n r = !1;\r\n do {\r\n for (t = n[i] + \"\", e = a(this, t); -1 !== e; )\r\n this.splice(e, 1), (r = !0), (e = a(this, t));\r\n } while (++i < s);\r\n r && this._updateClassName();\r\n }),\r\n (u.toggle = function(t, e) {\r\n t += \"\";\r\n var n = this.contains(t),\r\n i = n ? !0 !== e && \"remove\" : !1 !== e && \"add\";\r\n return i && this[i](t), !0 === e || !1 === e ? e : !n;\r\n }),\r\n (u.toString = function() {\r\n return this.join(\" \");\r\n }),\r\n s.defineProperty)\r\n ) {\r\n var h = { get: f, enumerable: !0, configurable: !0 };\r\n try {\r\n s.defineProperty(i, e, h);\r\n } catch (t) {\r\n (void 0 !== t.number && -2146823252 !== t.number) ||\r\n ((h.enumerable = !1), s.defineProperty(i, e, h));\r\n }\r\n } else s[n].__defineGetter__ && i.__defineGetter__(e, f);\r\n }\r\n })(window.self),\r\n (function() {\r\n \"use strict\";\r\n var t = document.createElement(\"_\");\r\n if ((t.classList.add(\"c1\", \"c2\"), !t.classList.contains(\"c2\"))) {\r\n var e = function(t) {\r\n var i = DOMTokenList.prototype[t];\r\n DOMTokenList.prototype[t] = function(t) {\r\n var e,\r\n n = arguments.length;\r\n for (e = 0; e < n; e++) (t = arguments[e]), i.call(this, t);\r\n };\r\n };\r\n e(\"add\"), e(\"remove\");\r\n }\r\n if ((t.classList.toggle(\"c3\", !1), t.classList.contains(\"c3\"))) {\r\n var n = DOMTokenList.prototype.toggle;\r\n DOMTokenList.prototype.toggle = function(t, e) {\r\n return 1 in arguments && !this.contains(t) == !e\r\n ? e\r\n : n.call(this, t);\r\n };\r\n }\r\n t = null;\r\n })());\r\n\r\nvar cookie = new CookieConsent();\r\ncookie.init();\r\n","$(document).ready(function () {\r\n // Add smooth scrolling to all links\r\n $(\"a\").on('click', function (event) {\r\n\r\n var currentUrl = window.location.origin + window.location.pathname\r\n var thisUrlStripped = $(this).attr(\"href\").replace(this.hash, \"\")\r\n // Make sure this.hash has a value before overriding default behavior\r\n if (this.hash !== \"\" && $(this.hash).length && currentUrl.indexOf(thisUrlStripped) > -1) {\r\n\r\n // Prevent default anchor click behavior\r\n event.preventDefault();\r\n\r\n // Store hash\r\n var hash = this.hash;\r\n\r\n // Using jQuery's animate() method to add smooth page scroll\r\n // The optional number (800) specifies the number of milliseconds it takes to scroll to the specified area\r\n $('html, body').animate({\r\n scrollTop: $(hash).offset().top\r\n }, 800, function () {\r\n\r\n // Add hash (#) to URL when done scrolling (default click behavior)\r\n window.location.hash = hash;\r\n });\r\n } // End if\r\n });\r\n});","$(document).ready(function () {\r\n var form = $('form[data-wffm]');\r\n\r\n var pageHeader = $('div.page-header', form);\r\n\r\n pageHeader.removeClass('page-header');\r\n\r\n $(pageHeader).replaceWith(function () {\r\n return $(this).html().replace('h1>', 'h3>');\r\n });\r\n\r\n $(document).on(\"tap click\", 'form[data-wffm] label a', function (event, data) {\r\n event.stopPropagation();\r\n event.preventDefault();\r\n window.open($(this).attr('href'), $(this).attr('target'));\r\n return false;\r\n });\r\n});","import GlueFrame from \"./../_lib/GlueFrame/GlueFrame\";\r\n\r\nwindow.youTube = function(id, videoUrl) {\r\n if (window.__youtube_inited === undefined) {\r\n window.__youtube_inited = true;\r\n\r\n var tag = document.createElement(\"script\");\r\n tag.src = \"https://www.youtube.com/iframe_api\";\r\n\r\n var firstScriptTag = document.getElementsByTagName(\"script\")[0];\r\n firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\r\n\r\n window.pendingPlayers = [];\r\n window.onYouTubeIframeAPIReady = function() {\r\n window.pendingPlayers.forEach(function(player) {\r\n player.ytPlayer = new YT.Player(player.container, {\r\n height: \"720\",\r\n width: \"1280\",\r\n videoId: player.videoId,\r\n events: {\r\n onReady: player.onPlayerReady,\r\n onStateChange: player.onPlayerStateChange\r\n },\r\n playerVars: {\r\n controls: 0,\r\n modestbranding: 1,\r\n showinfo: 0,\r\n rel: 0\r\n }\r\n });\r\n });\r\n };\r\n }\r\n\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n var player = {\r\n container: document.getElementById(`video-${id}`),\r\n videoId: `${videoUrl}`,\r\n onPlayerReady: function(event) {\r\n // event.target.playVideo()\r\n },\r\n onPlayerStateChange: function(event) {\r\n if (event.data === 0) {\r\n player.ytPlayer.stopVideo();\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }\r\n if (event.data === 1) {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n }\r\n if (event.data === 2) {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n }\r\n }\r\n };\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (player.ytPlayer) {\r\n if (player.ytPlayer.getPlayerState() !== 1) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n player.ytPlayer.playVideo();\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n }\r\n }\r\n });\r\n\r\n window.pendingPlayers.push(player);\r\n};\r\n\r\nwindow.vimeo = function(id, videoUrl) {\r\n var options = {\r\n id: `${videoUrl}`,\r\n height: 720,\r\n width: 1280,\r\n loop: false\r\n };\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n var player = new Vimeo.Player(`video-${id}`, options);\r\n\r\n player.on(\"play\", function() {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n });\r\n player.on(\"pause\", function() {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n });\r\n player.on(\"ended\", function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n });\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n player.play();\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n });\r\n};\r\n\r\nwindow.twentyThree = function(id, videoUrl) {\r\n var Player;\r\n var embedIframe = ``;\r\n var container = document.getElementById(`video-${id}`);\r\n container.innerHTML = embedIframe;\r\n var frame = container.querySelectorAll(\"iframe\")[0];\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n\r\n var lookForGlueGrame = function(callback) {\r\n if (typeof GlueFrame != \"undefined\") {\r\n callback();\r\n } else {\r\n window.setTimeout(function() {\r\n lookForGlueGrame(callback);\r\n }, 100);\r\n }\r\n };\r\n\r\n var loadGlueFrame = function(frame, callback) {\r\n if (typeof GlueFrame != \"undefined\") {\r\n callback(frame);\r\n } else {\r\n lookForGlueGrame(function() {\r\n callback(frame);\r\n });\r\n }\r\n };\r\n\r\n loadGlueFrame(frame, function() {\r\n Player = new GlueFrame(frame, `Player${id}`);\r\n\r\n Player.bind(\"player:video:play\", function(e) {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n });\r\n Player.bind(\"player:video:pause\", function(e) {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n });\r\n Player.bind(\"player:video:end\", function(e) {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n });\r\n });\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n Player.set(\"playing\", true);\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n });\r\n};\r\n","// https://github.com/23/GlueFrame\r\n// GlueFrame.js Last updated 30 april 2017.\r\nexport default function(iframe, appName) {\r\n var $this = this;\r\n\r\n // GlueFrame version\r\n $this.glueframe = \"1.1.3\";\r\n\r\n // Allow posting messages only to the domain of the app\r\n var _domain = (\"\" + iframe.src)\r\n .split(\"/\")\r\n .slice(0, 3)\r\n .join(\"/\");\r\n\r\n // Determine method of communication with iframe\r\n var _method = (function() {\r\n if (\r\n _domain ==\r\n (\"\" + window.location)\r\n .split(\"/\")\r\n .slice(0, 3)\r\n .join(\"/\")\r\n ) {\r\n return \"object\";\r\n } else if (typeof window.postMessage !== \"undefined\") {\r\n return \"post\";\r\n } else {\r\n return \"none\";\r\n }\r\n })();\r\n\r\n // Poll the iframe until the app is bootstrapped\r\n $this.ready = false;\r\n var _readyInterval = window.setInterval(function() {\r\n if (!this.ready && _method === \"object\") {\r\n if (\r\n iframe.contentWindow[appName] &&\r\n iframe.contentWindow[appName].bootstrapped\r\n ) {\r\n $this.ready = true;\r\n window.clearInterval(_readyInterval);\r\n _processQueue();\r\n }\r\n } else if (!this.ready && _method === \"post\") {\r\n $this.get(\r\n \"bootstrapped\",\r\n function(bootstrapped) {\r\n if (bootstrapped) {\r\n $this.ready = true;\r\n window.clearInterval(_readyInterval);\r\n _processQueue();\r\n }\r\n },\r\n true\r\n );\r\n }\r\n }, 100);\r\n\r\n $this.glueFrameId = Math.floor(new Date().getTime() * Math.random());\r\n var _callbackCount = 0;\r\n var _callbacks = {};\r\n\r\n // Store callback functions in the parent window\r\n var _registerCallback = function(callback, requireCallback) {\r\n var callbackIdentifier = $this.glueFrameId + \"_\" + ++_callbackCount;\r\n if (typeof callback === \"function\") {\r\n _callbacks[callbackIdentifier] = callback;\r\n } else if (requireCallback) {\r\n throw \"GlueFrame: Callback not registered correctly.\";\r\n }\r\n return callbackIdentifier;\r\n };\r\n\r\n // Queue up method calls until app is ready\r\n var _queue = [];\r\n var _addToQueue = function(method, args) {\r\n _queue.push({ method: method, args: args });\r\n };\r\n\r\n // Loop through queue when app is ready\r\n var _processQueue = function() {\r\n for (var i = 0; i < _queue.length; i += 1) {\r\n var queueItem = _queue[i];\r\n queueItem.method.apply(null, queueItem.args);\r\n }\r\n _queue = [];\r\n $this.set(\"queuedEventsProcessed\", true);\r\n };\r\n\r\n $this.get = function(prop, callback, force) {\r\n if (!$this.ready && !force) {\r\n _addToQueue($this.get, [prop, callback]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, true);\r\n if (_method === \"object\") {\r\n var value = iframe.contentWindow[appName].get.apply(null, [prop]);\r\n if (typeof _callbacks[cbId] !== \"undefined\") {\r\n _callbacks[cbId].apply(null, [value]);\r\n }\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"get\", args: [prop], cbId: cbId };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n force ? \"*\" : _domain\r\n );\r\n }\r\n };\r\n\r\n $this.set = function(prop, val, callback) {\r\n if (!$this.ready) {\r\n _addToQueue($this.set, [prop, val, callback]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, false);\r\n if (_method === \"object\") {\r\n var value = iframe.contentWindow[appName].set.apply(null, [\r\n prop,\r\n val\r\n ]);\r\n if (typeof _callbacks[cbId] !== \"undefined\") {\r\n _callbacks[cbId].apply(null, [value]);\r\n }\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"set\", args: [prop, val], cbId: cbId };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n $this.bind = function(event, callback, triggerQueue) {\r\n var triggerQueue = triggerQueue || false;\r\n if (!$this.ready) {\r\n _addToQueue($this.bind, [event, callback, true]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, true);\r\n if (_method === \"object\") {\r\n iframe.contentWindow[appName].bind.apply(null, [\r\n event,\r\n callback,\r\n triggerQueue\r\n ]);\r\n } else if (_method === \"post\") {\r\n var messageObject = {\r\n f: \"bind\",\r\n args: [event],\r\n cbId: cbId,\r\n triggerQueue: triggerQueue\r\n };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n $this.fire = function(event, obj) {\r\n if (!$this.ready) {\r\n _addToQueue($this.fire, [event, obj]);\r\n return;\r\n }\r\n if (_method === \"object\") {\r\n return iframe.contentWindow[appName].fire.apply(null, [event, obj]);\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"fire\", args: [event, obj] };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n // Remove event listeners, callbacks and intervals\r\n $this.destroy = function() {\r\n if (window.addEventListener) {\r\n window.removeEventListener(\"message\", _receiveMessage, false);\r\n } else {\r\n window.detachEvent(\"onmessage\", _receiveMessage);\r\n }\r\n window.clearInterval(_readyInterval);\r\n _callbacks = {};\r\n };\r\n\r\n // Parse messages received from iframe\r\n var _receiveMessage = function(e) {\r\n if (e.origin === _domain) {\r\n var data;\r\n try {\r\n data = JSON.parse(e.data);\r\n } catch (e) {}\r\n if (\r\n typeof data !== \"undefined\" &&\r\n typeof data.cbId !== \"undefined\" &&\r\n typeof _callbacks[data.cbId] === \"function\"\r\n ) {\r\n _callbacks[data.cbId].apply(null, [data.a, data.b]);\r\n }\r\n }\r\n };\r\n\r\n // Listen for message events if need\r\n if (window.addEventListener) {\r\n window.addEventListener(\"message\", _receiveMessage, false);\r\n } else {\r\n window.attachEvent(\"onmessage\", _receiveMessage);\r\n }\r\n}\r\n","$(function() {\r\n let notifications = $(\".module-banner__notification\");\r\n notifications.each(function() {\r\n if (!$(\"body\").hasClass(\"website-state-edit\")) {\r\n let btn = $(\"button\", this);\r\n let textContent = $(\".module-banner-text-container\", this);\r\n textContent.hide();\r\n btn.on(\"click\", function() {\r\n btn.toggleClass(\"notification-expanded\");\r\n let isAriaExp = $(this).attr(\"aria-expanded\");\r\n let newAriaExp = isAriaExp == \"false\" ? \"true\" : \"false\";\r\n $(this).attr(\"aria-expanded\", newAriaExp);\r\n\r\n let isAriaHid = textContent.attr(\"aria-hidden\");\r\n\r\n if (isAriaHid == \"true\") {\r\n textContent.attr(\"aria-hidden\", \"false\");\r\n textContent.slideDown(\"fast\", function() {});\r\n } else {\r\n textContent.attr(\"aria-hidden\", \"true\");\r\n textContent.slideUp(\"fast\");\r\n }\r\n });\r\n }\r\n });\r\n});\r\n","$(document).ready(function () {\r\n const newsModule = $('#ritzauNews');\r\n const newsNav = $('.news-nav');\r\n const toggles = $('.accordion-toggle');\r\n const sections = $('.module-news-section');\r\n const search = $('.js-search-news');\r\n\r\n if (newsModule && typeof URL !== 'undefined') {\r\n // Remove query parameters from URL on page load\r\n const url = new URL(window.location.toString());\r\n var currentPage = url.searchParams.has('page') ? parseInt(url.searchParams.get('page')) : 1;\r\n var currentSearch = url.searchParams.get('search');\r\n url.searchParams.delete('page');\r\n url.searchParams.delete('search');\r\n window.history.replaceState({}, '', url);\r\n\r\n newsNav.click(function(){\r\n const index = $(this).attr('data-page');\r\n filterNews(index);\r\n });\r\n\r\n toggles.click(function() {\r\n const target = $(this).attr('data-target');\r\n const targetElement = $(`[data-id='${target}']`);\r\n\r\n if (targetElement) {\r\n toggles.removeClass('active');\r\n $(this).addClass('active');\r\n sections.hide();\r\n targetElement.show();\r\n }\r\n });\r\n\r\n search.submit(function(e) {\r\n e.preventDefault();\r\n const searchTerm = search.find('input').val();\r\n window.location.href = url + '?search=' + encodeURIComponent(searchTerm);\r\n });\r\n\r\n function filterNews(index) {\r\n const url = new URL(window.location.toString());\r\n\r\n if (index === '-') {\r\n url.searchParams.set('page', currentPage - 1);\r\n } else if (index === '+') {\r\n url.searchParams.set('page', currentPage + 1);\r\n } else {\r\n url.searchParams.set('page', index);\r\n }\r\n \r\n if (currentSearch) {\r\n url.searchParams.set('search', currentSearch);\r\n }\r\n window.history.pushState({}, '', url);\r\n window.history.go();\r\n };\r\n }\r\n});","import flatpickr from \"flatpickr\";\r\n\r\n$(document).ready(function () {\r\n const $form = $('.js-addPostingForm');\r\n const $startDate = $('.js-startDate');\r\n const $endDate = $('.js-endDate');\r\n const $postingsList = $('.js-postingsList');\r\n const $userEmail = $('.js-userEmail');\r\n\r\n initDatepickers();\r\n\r\n if ($form.length && $postingsList.length) {\r\n init();\r\n }\r\n\r\n function initDatepickers() {\r\n const startDate = flatpickr($startDate, {\r\n dateFormat: 'Y-m-d',\r\n altInput: true,\r\n altFormat: 'd-m-Y',\r\n allowInput: true,\r\n onChange: function(sel, date) {\r\n endDate.set(\"minDate\", date);\r\n }\r\n });\r\n\r\n const endDate = flatpickr($endDate, {\r\n dateFormat: 'Y-m-d',\r\n altInput: true,\r\n altFormat: 'd-m-Y',\r\n allowInput: true,\r\n onChange: function(sel, date) {\r\n startDate.set(\"maxDate\", date);\r\n }\r\n });\r\n };\r\n\r\n const dateFormatter = (dateString) => {\r\n var date = new Date(dateString);\r\n var day = String(date.getDate()).padStart(2, '0');\r\n var month = String(date.getMonth() + 1).padStart(2, '0');\r\n var year = date.getFullYear();\r\n \r\n return day + '.' + month + '.' + year;\r\n }\r\n\r\n const validFields = () => {\r\n if ($startDate.val() === '' || $endDate.val() === '') {\r\n $form.addClass('has-errors');\r\n return false;\r\n } else {\r\n $form.removeClass('has-errors');\r\n return true;\r\n }\r\n };\r\n\r\n const submitForm = (data) => {\r\n $form.addClass('is-loading');\r\n\r\n $.ajax({\r\n url: '/api/user/AddPosting',\r\n type: 'post',\r\n data,\r\n success: function (id) {\r\n loadPostings('append', id);\r\n $form.removeClass('is-loading');\r\n },\r\n error: function (err) {\r\n console.error(\"Error submitting posting - \", err)\r\n\r\n $form.addClass('has-errors');\r\n $form.removeClass('is-loading');\r\n }\r\n });\r\n };\r\n\r\n $form.submit(function(e){\r\n e.preventDefault();\r\n\r\n if(!validFields()) {\r\n return;\r\n }\r\n\r\n const data = $(this).serialize();\r\n\r\n submitForm(data);\r\n });\r\n\r\n const postingHtmlBuilder = (posting) => {\r\n return `\r\n ${posting.City}\r\n \r\n ${dateFormatter(posting.StartDate)} - \r\n ${dateFormatter(posting.EndDate)}\r\n \r\n
\r\n `;\r\n };\r\n\r\n $(document).on('click', '.js-deletePostingButton', function() {\r\n deletePosting($(this).attr('data-posting-id'));\r\n });\r\n\r\n function deletePosting(postingId) {\r\n if (!postingId) {\r\n return;\r\n }\r\n\r\n $.ajax({\r\n url: '/api/user/RemovePosting',\r\n type: 'post',\r\n contentType: 'application/json',\r\n data: JSON.stringify(postingId),\r\n success: function () {\r\n loadPostings('replace');\r\n },\r\n error: function (err) {\r\n console.error(\"Error removing posting - \", err)\r\n }\r\n });\r\n }\r\n\r\n function loadPostings(method, id = '') {\r\n if (!$userEmail) {\r\n return;\r\n }\r\n\r\n $postingsList.addClass('is-loading');\r\n\r\n $.ajax({\r\n url: `/api/user/GetPostings?email=${$userEmail.val()}`,\r\n type: 'get',\r\n success: function (postings) {\r\n if (!postings) {\r\n return;\r\n }\r\n\r\n if (method === 'replace') {\r\n $postingsList.empty();\r\n\r\n $.each(postings, function(index, posting){\r\n $postingsList.append(postingHtmlBuilder(posting));\r\n });\r\n } else if (method === 'append') {\r\n const postingToAdd = postings.find((posting) => {\r\n return posting.Id === id;\r\n });\r\n\r\n if (postingToAdd) {\r\n $postingsList.append(postingHtmlBuilder(postingToAdd));\r\n }\r\n }\r\n\r\n $postingsList.removeClass('is-loading');\r\n },\r\n error: function (err) {\r\n console.error(\"Error loading postings - \", err)\r\n $postingsList.removeClass('is-loading');\r\n }\r\n });\r\n }\r\n\r\n function init() {\r\n loadPostings('replace');\r\n }\r\n});","import { defaults as defaultOptions, HOOKS, } from \"./types/options\";\nimport English from \"./l10n/default\";\nimport { arrayify, debounce, int, pad } from \"./utils\";\nimport { clearNode, createElement, createNumberInput, findParent, toggleClass, getEventTarget, } from \"./utils/dom\";\nimport { compareDates, createDateParser, createDateFormatter, duration, isBetween, getDefaultHours, } from \"./utils/dates\";\nimport { tokenRegex, monthToStr } from \"./utils/formatting\";\nimport \"./utils/polyfills\";\nconst DEBOUNCED_CHANGE_MS = 300;\nfunction FlatpickrInstance(element, instanceConfig) {\n const self = {\n config: Object.assign(Object.assign({}, defaultOptions), flatpickr.defaultConfig),\n l10n: English,\n };\n self.parseDate = createDateParser({ config: self.config, l10n: self.l10n });\n self._handlers = [];\n self.pluginElements = [];\n self.loadedPlugins = [];\n self._bind = bind;\n self._setHoursFromDate = setHoursFromDate;\n self._positionCalendar = positionCalendar;\n self.changeMonth = changeMonth;\n self.changeYear = changeYear;\n self.clear = clear;\n self.close = close;\n self._createElement = createElement;\n self.destroy = destroy;\n self.isEnabled = isEnabled;\n self.jumpToDate = jumpToDate;\n self.open = open;\n self.redraw = redraw;\n self.set = set;\n self.setDate = setDate;\n self.toggle = toggle;\n function setupHelperFunctions() {\n self.utils = {\n getDaysInMonth(month = self.currentMonth, yr = self.currentYear) {\n if (month === 1 && ((yr % 4 === 0 && yr % 100 !== 0) || yr % 400 === 0))\n return 29;\n return self.l10n.daysInMonth[month];\n },\n };\n }\n function init() {\n self.element = self.input = element;\n self.isOpen = false;\n parseConfig();\n setupLocale();\n setupInputs();\n setupDates();\n setupHelperFunctions();\n if (!self.isMobile)\n build();\n bindEvents();\n if (self.selectedDates.length || self.config.noCalendar) {\n if (self.config.enableTime) {\n setHoursFromDate(self.config.noCalendar ? self.latestSelectedDateObj : undefined);\n }\n updateValue(false);\n }\n setCalendarWidth();\n const isSafari = /^((?!chrome|android).)*safari/i.test(navigator.userAgent);\n if (!self.isMobile && isSafari) {\n positionCalendar();\n }\n triggerEvent(\"onReady\");\n }\n function bindToInstance(fn) {\n return fn.bind(self);\n }\n function setCalendarWidth() {\n const config = self.config;\n if (config.weekNumbers === false && config.showMonths === 1) {\n return;\n }\n else if (config.noCalendar !== true) {\n window.requestAnimationFrame(function () {\n if (self.calendarContainer !== undefined) {\n self.calendarContainer.style.visibility = \"hidden\";\n self.calendarContainer.style.display = \"block\";\n }\n if (self.daysContainer !== undefined) {\n const daysWidth = (self.days.offsetWidth + 1) * config.showMonths;\n self.daysContainer.style.width = daysWidth + \"px\";\n self.calendarContainer.style.width =\n daysWidth +\n (self.weekWrapper !== undefined\n ? self.weekWrapper.offsetWidth\n : 0) +\n \"px\";\n self.calendarContainer.style.removeProperty(\"visibility\");\n self.calendarContainer.style.removeProperty(\"display\");\n }\n });\n }\n }\n function updateTime(e) {\n if (self.selectedDates.length === 0) {\n const defaultDate = self.config.minDate === undefined ||\n compareDates(new Date(), self.config.minDate) >= 0\n ? new Date()\n : new Date(self.config.minDate.getTime());\n const defaults = getDefaultHours(self.config);\n defaultDate.setHours(defaults.hours, defaults.minutes, defaults.seconds, defaultDate.getMilliseconds());\n self.selectedDates = [defaultDate];\n self.latestSelectedDateObj = defaultDate;\n }\n if (e !== undefined && e.type !== \"blur\") {\n timeWrapper(e);\n }\n const prevValue = self._input.value;\n setHoursFromInputs();\n updateValue();\n if (self._input.value !== prevValue) {\n self._debouncedChange();\n }\n }\n function ampm2military(hour, amPM) {\n return (hour % 12) + 12 * int(amPM === self.l10n.amPM[1]);\n }\n function military2ampm(hour) {\n switch (hour % 24) {\n case 0:\n case 12:\n return 12;\n default:\n return hour % 12;\n }\n }\n function setHoursFromInputs() {\n if (self.hourElement === undefined || self.minuteElement === undefined)\n return;\n let hours = (parseInt(self.hourElement.value.slice(-2), 10) || 0) % 24, minutes = (parseInt(self.minuteElement.value, 10) || 0) % 60, seconds = self.secondElement !== undefined\n ? (parseInt(self.secondElement.value, 10) || 0) % 60\n : 0;\n if (self.amPM !== undefined) {\n hours = ampm2military(hours, self.amPM.textContent);\n }\n const limitMinHours = self.config.minTime !== undefined ||\n (self.config.minDate &&\n self.minDateHasTime &&\n self.latestSelectedDateObj &&\n compareDates(self.latestSelectedDateObj, self.config.minDate, true) ===\n 0);\n const limitMaxHours = self.config.maxTime !== undefined ||\n (self.config.maxDate &&\n self.maxDateHasTime &&\n self.latestSelectedDateObj &&\n compareDates(self.latestSelectedDateObj, self.config.maxDate, true) ===\n 0);\n if (limitMaxHours) {\n const maxTime = self.config.maxTime !== undefined\n ? self.config.maxTime\n : self.config.maxDate;\n hours = Math.min(hours, maxTime.getHours());\n if (hours === maxTime.getHours())\n minutes = Math.min(minutes, maxTime.getMinutes());\n if (minutes === maxTime.getMinutes())\n seconds = Math.min(seconds, maxTime.getSeconds());\n }\n if (limitMinHours) {\n const minTime = self.config.minTime !== undefined\n ? self.config.minTime\n : self.config.minDate;\n hours = Math.max(hours, minTime.getHours());\n if (hours === minTime.getHours() && minutes < minTime.getMinutes())\n minutes = minTime.getMinutes();\n if (minutes === minTime.getMinutes())\n seconds = Math.max(seconds, minTime.getSeconds());\n }\n setHours(hours, minutes, seconds);\n }\n function setHoursFromDate(dateObj) {\n const date = dateObj || self.latestSelectedDateObj;\n if (date) {\n setHours(date.getHours(), date.getMinutes(), date.getSeconds());\n }\n }\n function setHours(hours, minutes, seconds) {\n if (self.latestSelectedDateObj !== undefined) {\n self.latestSelectedDateObj.setHours(hours % 24, minutes, seconds || 0, 0);\n }\n if (!self.hourElement || !self.minuteElement || self.isMobile)\n return;\n self.hourElement.value = pad(!self.config.time_24hr\n ? ((12 + hours) % 12) + 12 * int(hours % 12 === 0)\n : hours);\n self.minuteElement.value = pad(minutes);\n if (self.amPM !== undefined)\n self.amPM.textContent = self.l10n.amPM[int(hours >= 12)];\n if (self.secondElement !== undefined)\n self.secondElement.value = pad(seconds);\n }\n function onYearInput(event) {\n const eventTarget = getEventTarget(event);\n const year = parseInt(eventTarget.value) + (event.delta || 0);\n if (year / 1000 > 1 ||\n (event.key === \"Enter\" && !/[^\\d]/.test(year.toString()))) {\n changeYear(year);\n }\n }\n function bind(element, event, handler, options) {\n if (event instanceof Array)\n return event.forEach((ev) => bind(element, ev, handler, options));\n if (element instanceof Array)\n return element.forEach((el) => bind(el, event, handler, options));\n element.addEventListener(event, handler, options);\n self._handlers.push({\n remove: () => element.removeEventListener(event, handler),\n });\n }\n function triggerChange() {\n triggerEvent(\"onChange\");\n }\n function bindEvents() {\n if (self.config.wrap) {\n [\"open\", \"close\", \"toggle\", \"clear\"].forEach((evt) => {\n Array.prototype.forEach.call(self.element.querySelectorAll(`[data-${evt}]`), (el) => bind(el, \"click\", self[evt]));\n });\n }\n if (self.isMobile) {\n setupMobile();\n return;\n }\n const debouncedResize = debounce(onResize, 50);\n self._debouncedChange = debounce(triggerChange, DEBOUNCED_CHANGE_MS);\n if (self.daysContainer && !/iPhone|iPad|iPod/i.test(navigator.userAgent))\n bind(self.daysContainer, \"mouseover\", (e) => {\n if (self.config.mode === \"range\")\n onMouseOver(getEventTarget(e));\n });\n bind(window.document.body, \"keydown\", onKeyDown);\n if (!self.config.inline && !self.config.static)\n bind(window, \"resize\", debouncedResize);\n if (window.ontouchstart !== undefined)\n bind(window.document, \"touchstart\", documentClick);\n else\n bind(window.document, \"mousedown\", documentClick);\n bind(window.document, \"focus\", documentClick, { capture: true });\n if (self.config.clickOpens === true) {\n bind(self._input, \"focus\", self.open);\n bind(self._input, \"click\", self.open);\n }\n if (self.daysContainer !== undefined) {\n bind(self.monthNav, \"click\", onMonthNavClick);\n bind(self.monthNav, [\"keyup\", \"increment\"], onYearInput);\n bind(self.daysContainer, \"click\", selectDate);\n }\n if (self.timeContainer !== undefined &&\n self.minuteElement !== undefined &&\n self.hourElement !== undefined) {\n const selText = (e) => getEventTarget(e).select();\n bind(self.timeContainer, [\"increment\"], updateTime);\n bind(self.timeContainer, \"blur\", updateTime, { capture: true });\n bind(self.timeContainer, \"click\", timeIncrement);\n bind([self.hourElement, self.minuteElement], [\"focus\", \"click\"], selText);\n if (self.secondElement !== undefined)\n bind(self.secondElement, \"focus\", () => self.secondElement && self.secondElement.select());\n if (self.amPM !== undefined) {\n bind(self.amPM, \"click\", (e) => {\n updateTime(e);\n triggerChange();\n });\n }\n }\n if (self.config.allowInput) {\n bind(self._input, \"blur\", onBlur);\n }\n }\n function jumpToDate(jumpDate, triggerChange) {\n const jumpTo = jumpDate !== undefined\n ? self.parseDate(jumpDate)\n : self.latestSelectedDateObj ||\n (self.config.minDate && self.config.minDate > self.now\n ? self.config.minDate\n : self.config.maxDate && self.config.maxDate < self.now\n ? self.config.maxDate\n : self.now);\n const oldYear = self.currentYear;\n const oldMonth = self.currentMonth;\n try {\n if (jumpTo !== undefined) {\n self.currentYear = jumpTo.getFullYear();\n self.currentMonth = jumpTo.getMonth();\n }\n }\n catch (e) {\n e.message = \"Invalid date supplied: \" + jumpTo;\n self.config.errorHandler(e);\n }\n if (triggerChange && self.currentYear !== oldYear) {\n triggerEvent(\"onYearChange\");\n buildMonthSwitch();\n }\n if (triggerChange &&\n (self.currentYear !== oldYear || self.currentMonth !== oldMonth)) {\n triggerEvent(\"onMonthChange\");\n }\n self.redraw();\n }\n function timeIncrement(e) {\n const eventTarget = getEventTarget(e);\n if (~eventTarget.className.indexOf(\"arrow\"))\n incrementNumInput(e, eventTarget.classList.contains(\"arrowUp\") ? 1 : -1);\n }\n function incrementNumInput(e, delta, inputElem) {\n const target = e && getEventTarget(e);\n const input = inputElem ||\n (target && target.parentNode && target.parentNode.firstChild);\n const event = createEvent(\"increment\");\n event.delta = delta;\n input && input.dispatchEvent(event);\n }\n function build() {\n const fragment = window.document.createDocumentFragment();\n self.calendarContainer = createElement(\"div\", \"flatpickr-calendar\");\n self.calendarContainer.tabIndex = -1;\n if (!self.config.noCalendar) {\n fragment.appendChild(buildMonthNav());\n self.innerContainer = createElement(\"div\", \"flatpickr-innerContainer\");\n if (self.config.weekNumbers) {\n const { weekWrapper, weekNumbers } = buildWeeks();\n self.innerContainer.appendChild(weekWrapper);\n self.weekNumbers = weekNumbers;\n self.weekWrapper = weekWrapper;\n }\n self.rContainer = createElement(\"div\", \"flatpickr-rContainer\");\n self.rContainer.appendChild(buildWeekdays());\n if (!self.daysContainer) {\n self.daysContainer = createElement(\"div\", \"flatpickr-days\");\n self.daysContainer.tabIndex = -1;\n }\n buildDays();\n self.rContainer.appendChild(self.daysContainer);\n self.innerContainer.appendChild(self.rContainer);\n fragment.appendChild(self.innerContainer);\n }\n if (self.config.enableTime) {\n fragment.appendChild(buildTime());\n }\n toggleClass(self.calendarContainer, \"rangeMode\", self.config.mode === \"range\");\n toggleClass(self.calendarContainer, \"animate\", self.config.animate === true);\n toggleClass(self.calendarContainer, \"multiMonth\", self.config.showMonths > 1);\n self.calendarContainer.appendChild(fragment);\n const customAppend = self.config.appendTo !== undefined &&\n self.config.appendTo.nodeType !== undefined;\n if (self.config.inline || self.config.static) {\n self.calendarContainer.classList.add(self.config.inline ? \"inline\" : \"static\");\n if (self.config.inline) {\n if (!customAppend && self.element.parentNode)\n self.element.parentNode.insertBefore(self.calendarContainer, self._input.nextSibling);\n else if (self.config.appendTo !== undefined)\n self.config.appendTo.appendChild(self.calendarContainer);\n }\n if (self.config.static) {\n const wrapper = createElement(\"div\", \"flatpickr-wrapper\");\n if (self.element.parentNode)\n self.element.parentNode.insertBefore(wrapper, self.element);\n wrapper.appendChild(self.element);\n if (self.altInput)\n wrapper.appendChild(self.altInput);\n wrapper.appendChild(self.calendarContainer);\n }\n }\n if (!self.config.static && !self.config.inline)\n (self.config.appendTo !== undefined\n ? self.config.appendTo\n : window.document.body).appendChild(self.calendarContainer);\n }\n function createDay(className, date, dayNumber, i) {\n const dateIsEnabled = isEnabled(date, true), dayElement = createElement(\"span\", \"flatpickr-day \" + className, date.getDate().toString());\n dayElement.dateObj = date;\n dayElement.$i = i;\n dayElement.setAttribute(\"aria-label\", self.formatDate(date, self.config.ariaDateFormat));\n if (className.indexOf(\"hidden\") === -1 &&\n compareDates(date, self.now) === 0) {\n self.todayDateElem = dayElement;\n dayElement.classList.add(\"today\");\n dayElement.setAttribute(\"aria-current\", \"date\");\n }\n if (dateIsEnabled) {\n dayElement.tabIndex = -1;\n if (isDateSelected(date)) {\n dayElement.classList.add(\"selected\");\n self.selectedDateElem = dayElement;\n if (self.config.mode === \"range\") {\n toggleClass(dayElement, \"startRange\", self.selectedDates[0] &&\n compareDates(date, self.selectedDates[0], true) === 0);\n toggleClass(dayElement, \"endRange\", self.selectedDates[1] &&\n compareDates(date, self.selectedDates[1], true) === 0);\n if (className === \"nextMonthDay\")\n dayElement.classList.add(\"inRange\");\n }\n }\n }\n else {\n dayElement.classList.add(\"flatpickr-disabled\");\n }\n if (self.config.mode === \"range\") {\n if (isDateInRange(date) && !isDateSelected(date))\n dayElement.classList.add(\"inRange\");\n }\n if (self.weekNumbers &&\n self.config.showMonths === 1 &&\n className !== \"prevMonthDay\" &&\n dayNumber % 7 === 1) {\n self.weekNumbers.insertAdjacentHTML(\"beforeend\", \"\" + self.config.getWeek(date) + \"\");\n }\n triggerEvent(\"onDayCreate\", dayElement);\n return dayElement;\n }\n function focusOnDayElem(targetNode) {\n targetNode.focus();\n if (self.config.mode === \"range\")\n onMouseOver(targetNode);\n }\n function getFirstAvailableDay(delta) {\n const startMonth = delta > 0 ? 0 : self.config.showMonths - 1;\n const endMonth = delta > 0 ? self.config.showMonths : -1;\n for (let m = startMonth; m != endMonth; m += delta) {\n const month = self.daysContainer.children[m];\n const startIndex = delta > 0 ? 0 : month.children.length - 1;\n const endIndex = delta > 0 ? month.children.length : -1;\n for (let i = startIndex; i != endIndex; i += delta) {\n const c = month.children[i];\n if (c.className.indexOf(\"hidden\") === -1 && isEnabled(c.dateObj))\n return c;\n }\n }\n return undefined;\n }\n function getNextAvailableDay(current, delta) {\n const givenMonth = current.className.indexOf(\"Month\") === -1\n ? current.dateObj.getMonth()\n : self.currentMonth;\n const endMonth = delta > 0 ? self.config.showMonths : -1;\n const loopDelta = delta > 0 ? 1 : -1;\n for (let m = givenMonth - self.currentMonth; m != endMonth; m += loopDelta) {\n const month = self.daysContainer.children[m];\n const startIndex = givenMonth - self.currentMonth === m\n ? current.$i + delta\n : delta < 0\n ? month.children.length - 1\n : 0;\n const numMonthDays = month.children.length;\n for (let i = startIndex; i >= 0 && i < numMonthDays && i != (delta > 0 ? numMonthDays : -1); i += loopDelta) {\n const c = month.children[i];\n if (c.className.indexOf(\"hidden\") === -1 &&\n isEnabled(c.dateObj) &&\n Math.abs(current.$i - i) >= Math.abs(delta))\n return focusOnDayElem(c);\n }\n }\n self.changeMonth(loopDelta);\n focusOnDay(getFirstAvailableDay(loopDelta), 0);\n return undefined;\n }\n function focusOnDay(current, offset) {\n const dayFocused = isInView(document.activeElement || document.body);\n const startElem = current !== undefined\n ? current\n : dayFocused\n ? document.activeElement\n : self.selectedDateElem !== undefined && isInView(self.selectedDateElem)\n ? self.selectedDateElem\n : self.todayDateElem !== undefined && isInView(self.todayDateElem)\n ? self.todayDateElem\n : getFirstAvailableDay(offset > 0 ? 1 : -1);\n if (startElem === undefined) {\n self._input.focus();\n }\n else if (!dayFocused) {\n focusOnDayElem(startElem);\n }\n else {\n getNextAvailableDay(startElem, offset);\n }\n }\n function buildMonthDays(year, month) {\n const firstOfMonth = (new Date(year, month, 1).getDay() - self.l10n.firstDayOfWeek + 7) % 7;\n const prevMonthDays = self.utils.getDaysInMonth((month - 1 + 12) % 12, year);\n const daysInMonth = self.utils.getDaysInMonth(month, year), days = window.document.createDocumentFragment(), isMultiMonth = self.config.showMonths > 1, prevMonthDayClass = isMultiMonth ? \"prevMonthDay hidden\" : \"prevMonthDay\", nextMonthDayClass = isMultiMonth ? \"nextMonthDay hidden\" : \"nextMonthDay\";\n let dayNumber = prevMonthDays + 1 - firstOfMonth, dayIndex = 0;\n for (; dayNumber <= prevMonthDays; dayNumber++, dayIndex++) {\n days.appendChild(createDay(prevMonthDayClass, new Date(year, month - 1, dayNumber), dayNumber, dayIndex));\n }\n for (dayNumber = 1; dayNumber <= daysInMonth; dayNumber++, dayIndex++) {\n days.appendChild(createDay(\"\", new Date(year, month, dayNumber), dayNumber, dayIndex));\n }\n for (let dayNum = daysInMonth + 1; dayNum <= 42 - firstOfMonth &&\n (self.config.showMonths === 1 || dayIndex % 7 !== 0); dayNum++, dayIndex++) {\n days.appendChild(createDay(nextMonthDayClass, new Date(year, month + 1, dayNum % daysInMonth), dayNum, dayIndex));\n }\n const dayContainer = createElement(\"div\", \"dayContainer\");\n dayContainer.appendChild(days);\n return dayContainer;\n }\n function buildDays() {\n if (self.daysContainer === undefined) {\n return;\n }\n clearNode(self.daysContainer);\n if (self.weekNumbers)\n clearNode(self.weekNumbers);\n const frag = document.createDocumentFragment();\n for (let i = 0; i < self.config.showMonths; i++) {\n const d = new Date(self.currentYear, self.currentMonth, 1);\n d.setMonth(self.currentMonth + i);\n frag.appendChild(buildMonthDays(d.getFullYear(), d.getMonth()));\n }\n self.daysContainer.appendChild(frag);\n self.days = self.daysContainer.firstChild;\n if (self.config.mode === \"range\" && self.selectedDates.length === 1) {\n onMouseOver();\n }\n }\n function buildMonthSwitch() {\n if (self.config.showMonths > 1 ||\n self.config.monthSelectorType !== \"dropdown\")\n return;\n const shouldBuildMonth = function (month) {\n if (self.config.minDate !== undefined &&\n self.currentYear === self.config.minDate.getFullYear() &&\n month < self.config.minDate.getMonth()) {\n return false;\n }\n return !(self.config.maxDate !== undefined &&\n self.currentYear === self.config.maxDate.getFullYear() &&\n month > self.config.maxDate.getMonth());\n };\n self.monthsDropdownContainer.tabIndex = -1;\n self.monthsDropdownContainer.innerHTML = \"\";\n for (let i = 0; i < 12; i++) {\n if (!shouldBuildMonth(i))\n continue;\n const month = createElement(\"option\", \"flatpickr-monthDropdown-month\");\n month.value = new Date(self.currentYear, i).getMonth().toString();\n month.textContent = monthToStr(i, self.config.shorthandCurrentMonth, self.l10n);\n month.tabIndex = -1;\n if (self.currentMonth === i) {\n month.selected = true;\n }\n self.monthsDropdownContainer.appendChild(month);\n }\n }\n function buildMonth() {\n const container = createElement(\"div\", \"flatpickr-month\");\n const monthNavFragment = window.document.createDocumentFragment();\n let monthElement;\n if (self.config.showMonths > 1 ||\n self.config.monthSelectorType === \"static\") {\n monthElement = createElement(\"span\", \"cur-month\");\n }\n else {\n self.monthsDropdownContainer = createElement(\"select\", \"flatpickr-monthDropdown-months\");\n self.monthsDropdownContainer.setAttribute(\"aria-label\", self.l10n.monthAriaLabel);\n bind(self.monthsDropdownContainer, \"change\", (e) => {\n const target = getEventTarget(e);\n const selectedMonth = parseInt(target.value, 10);\n self.changeMonth(selectedMonth - self.currentMonth);\n triggerEvent(\"onMonthChange\");\n });\n buildMonthSwitch();\n monthElement = self.monthsDropdownContainer;\n }\n const yearInput = createNumberInput(\"cur-year\", { tabindex: \"-1\" });\n const yearElement = yearInput.getElementsByTagName(\"input\")[0];\n yearElement.setAttribute(\"aria-label\", self.l10n.yearAriaLabel);\n if (self.config.minDate) {\n yearElement.setAttribute(\"min\", self.config.minDate.getFullYear().toString());\n }\n if (self.config.maxDate) {\n yearElement.setAttribute(\"max\", self.config.maxDate.getFullYear().toString());\n yearElement.disabled =\n !!self.config.minDate &&\n self.config.minDate.getFullYear() === self.config.maxDate.getFullYear();\n }\n const currentMonth = createElement(\"div\", \"flatpickr-current-month\");\n currentMonth.appendChild(monthElement);\n currentMonth.appendChild(yearInput);\n monthNavFragment.appendChild(currentMonth);\n container.appendChild(monthNavFragment);\n return {\n container,\n yearElement,\n monthElement,\n };\n }\n function buildMonths() {\n clearNode(self.monthNav);\n self.monthNav.appendChild(self.prevMonthNav);\n if (self.config.showMonths) {\n self.yearElements = [];\n self.monthElements = [];\n }\n for (let m = self.config.showMonths; m--;) {\n const month = buildMonth();\n self.yearElements.push(month.yearElement);\n self.monthElements.push(month.monthElement);\n self.monthNav.appendChild(month.container);\n }\n self.monthNav.appendChild(self.nextMonthNav);\n }\n function buildMonthNav() {\n self.monthNav = createElement(\"div\", \"flatpickr-months\");\n self.yearElements = [];\n self.monthElements = [];\n self.prevMonthNav = createElement(\"span\", \"flatpickr-prev-month\");\n self.prevMonthNav.innerHTML = self.config.prevArrow;\n self.nextMonthNav = createElement(\"span\", \"flatpickr-next-month\");\n self.nextMonthNav.innerHTML = self.config.nextArrow;\n buildMonths();\n Object.defineProperty(self, \"_hidePrevMonthArrow\", {\n get: () => self.__hidePrevMonthArrow,\n set(bool) {\n if (self.__hidePrevMonthArrow !== bool) {\n toggleClass(self.prevMonthNav, \"flatpickr-disabled\", bool);\n self.__hidePrevMonthArrow = bool;\n }\n },\n });\n Object.defineProperty(self, \"_hideNextMonthArrow\", {\n get: () => self.__hideNextMonthArrow,\n set(bool) {\n if (self.__hideNextMonthArrow !== bool) {\n toggleClass(self.nextMonthNav, \"flatpickr-disabled\", bool);\n self.__hideNextMonthArrow = bool;\n }\n },\n });\n self.currentYearElement = self.yearElements[0];\n updateNavigationCurrentMonth();\n return self.monthNav;\n }\n function buildTime() {\n self.calendarContainer.classList.add(\"hasTime\");\n if (self.config.noCalendar)\n self.calendarContainer.classList.add(\"noCalendar\");\n const defaults = getDefaultHours(self.config);\n self.timeContainer = createElement(\"div\", \"flatpickr-time\");\n self.timeContainer.tabIndex = -1;\n const separator = createElement(\"span\", \"flatpickr-time-separator\", \":\");\n const hourInput = createNumberInput(\"flatpickr-hour\", {\n \"aria-label\": self.l10n.hourAriaLabel,\n });\n self.hourElement = hourInput.getElementsByTagName(\"input\")[0];\n const minuteInput = createNumberInput(\"flatpickr-minute\", {\n \"aria-label\": self.l10n.minuteAriaLabel,\n });\n self.minuteElement = minuteInput.getElementsByTagName(\"input\")[0];\n self.hourElement.tabIndex = self.minuteElement.tabIndex = -1;\n self.hourElement.value = pad(self.latestSelectedDateObj\n ? self.latestSelectedDateObj.getHours()\n : self.config.time_24hr\n ? defaults.hours\n : military2ampm(defaults.hours));\n self.minuteElement.value = pad(self.latestSelectedDateObj\n ? self.latestSelectedDateObj.getMinutes()\n : defaults.minutes);\n self.hourElement.setAttribute(\"step\", self.config.hourIncrement.toString());\n self.minuteElement.setAttribute(\"step\", self.config.minuteIncrement.toString());\n self.hourElement.setAttribute(\"min\", self.config.time_24hr ? \"0\" : \"1\");\n self.hourElement.setAttribute(\"max\", self.config.time_24hr ? \"23\" : \"12\");\n self.hourElement.setAttribute(\"maxlength\", \"2\");\n self.minuteElement.setAttribute(\"min\", \"0\");\n self.minuteElement.setAttribute(\"max\", \"59\");\n self.minuteElement.setAttribute(\"maxlength\", \"2\");\n self.timeContainer.appendChild(hourInput);\n self.timeContainer.appendChild(separator);\n self.timeContainer.appendChild(minuteInput);\n if (self.config.time_24hr)\n self.timeContainer.classList.add(\"time24hr\");\n if (self.config.enableSeconds) {\n self.timeContainer.classList.add(\"hasSeconds\");\n const secondInput = createNumberInput(\"flatpickr-second\");\n self.secondElement = secondInput.getElementsByTagName(\"input\")[0];\n self.secondElement.value = pad(self.latestSelectedDateObj\n ? self.latestSelectedDateObj.getSeconds()\n : defaults.seconds);\n self.secondElement.setAttribute(\"step\", self.minuteElement.getAttribute(\"step\"));\n self.secondElement.setAttribute(\"min\", \"0\");\n self.secondElement.setAttribute(\"max\", \"59\");\n self.secondElement.setAttribute(\"maxlength\", \"2\");\n self.timeContainer.appendChild(createElement(\"span\", \"flatpickr-time-separator\", \":\"));\n self.timeContainer.appendChild(secondInput);\n }\n if (!self.config.time_24hr) {\n self.amPM = createElement(\"span\", \"flatpickr-am-pm\", self.l10n.amPM[int((self.latestSelectedDateObj\n ? self.hourElement.value\n : self.config.defaultHour) > 11)]);\n self.amPM.title = self.l10n.toggleTitle;\n self.amPM.tabIndex = -1;\n self.timeContainer.appendChild(self.amPM);\n }\n return self.timeContainer;\n }\n function buildWeekdays() {\n if (!self.weekdayContainer)\n self.weekdayContainer = createElement(\"div\", \"flatpickr-weekdays\");\n else\n clearNode(self.weekdayContainer);\n for (let i = self.config.showMonths; i--;) {\n const container = createElement(\"div\", \"flatpickr-weekdaycontainer\");\n self.weekdayContainer.appendChild(container);\n }\n updateWeekdays();\n return self.weekdayContainer;\n }\n function updateWeekdays() {\n if (!self.weekdayContainer) {\n return;\n }\n const firstDayOfWeek = self.l10n.firstDayOfWeek;\n let weekdays = [...self.l10n.weekdays.shorthand];\n if (firstDayOfWeek > 0 && firstDayOfWeek < weekdays.length) {\n weekdays = [\n ...weekdays.splice(firstDayOfWeek, weekdays.length),\n ...weekdays.splice(0, firstDayOfWeek),\n ];\n }\n for (let i = self.config.showMonths; i--;) {\n self.weekdayContainer.children[i].innerHTML = `\n \n ${weekdays.join(\"\")}\n \n `;\n }\n }\n function buildWeeks() {\n self.calendarContainer.classList.add(\"hasWeeks\");\n const weekWrapper = createElement(\"div\", \"flatpickr-weekwrapper\");\n weekWrapper.appendChild(createElement(\"span\", \"flatpickr-weekday\", self.l10n.weekAbbreviation));\n const weekNumbers = createElement(\"div\", \"flatpickr-weeks\");\n weekWrapper.appendChild(weekNumbers);\n return {\n weekWrapper,\n weekNumbers,\n };\n }\n function changeMonth(value, isOffset = true) {\n const delta = isOffset ? value : value - self.currentMonth;\n if ((delta < 0 && self._hidePrevMonthArrow === true) ||\n (delta > 0 && self._hideNextMonthArrow === true))\n return;\n self.currentMonth += delta;\n if (self.currentMonth < 0 || self.currentMonth > 11) {\n self.currentYear += self.currentMonth > 11 ? 1 : -1;\n self.currentMonth = (self.currentMonth + 12) % 12;\n triggerEvent(\"onYearChange\");\n buildMonthSwitch();\n }\n buildDays();\n triggerEvent(\"onMonthChange\");\n updateNavigationCurrentMonth();\n }\n function clear(triggerChangeEvent = true, toInitial = true) {\n self.input.value = \"\";\n if (self.altInput !== undefined)\n self.altInput.value = \"\";\n if (self.mobileInput !== undefined)\n self.mobileInput.value = \"\";\n self.selectedDates = [];\n self.latestSelectedDateObj = undefined;\n if (toInitial === true) {\n self.currentYear = self._initialDate.getFullYear();\n self.currentMonth = self._initialDate.getMonth();\n }\n if (self.config.enableTime === true) {\n const { hours, minutes, seconds } = getDefaultHours(self.config);\n setHours(hours, minutes, seconds);\n }\n self.redraw();\n if (triggerChangeEvent)\n triggerEvent(\"onChange\");\n }\n function close() {\n self.isOpen = false;\n if (!self.isMobile) {\n if (self.calendarContainer !== undefined) {\n self.calendarContainer.classList.remove(\"open\");\n }\n if (self._input !== undefined) {\n self._input.classList.remove(\"active\");\n }\n }\n triggerEvent(\"onClose\");\n }\n function destroy() {\n if (self.config !== undefined)\n triggerEvent(\"onDestroy\");\n for (let i = self._handlers.length; i--;) {\n self._handlers[i].remove();\n }\n self._handlers = [];\n if (self.mobileInput) {\n if (self.mobileInput.parentNode)\n self.mobileInput.parentNode.removeChild(self.mobileInput);\n self.mobileInput = undefined;\n }\n else if (self.calendarContainer && self.calendarContainer.parentNode) {\n if (self.config.static && self.calendarContainer.parentNode) {\n const wrapper = self.calendarContainer.parentNode;\n wrapper.lastChild && wrapper.removeChild(wrapper.lastChild);\n if (wrapper.parentNode) {\n while (wrapper.firstChild)\n wrapper.parentNode.insertBefore(wrapper.firstChild, wrapper);\n wrapper.parentNode.removeChild(wrapper);\n }\n }\n else\n self.calendarContainer.parentNode.removeChild(self.calendarContainer);\n }\n if (self.altInput) {\n self.input.type = \"text\";\n if (self.altInput.parentNode)\n self.altInput.parentNode.removeChild(self.altInput);\n delete self.altInput;\n }\n if (self.input) {\n self.input.type = self.input._type;\n self.input.classList.remove(\"flatpickr-input\");\n self.input.removeAttribute(\"readonly\");\n }\n [\n \"_showTimeInput\",\n \"latestSelectedDateObj\",\n \"_hideNextMonthArrow\",\n \"_hidePrevMonthArrow\",\n \"__hideNextMonthArrow\",\n \"__hidePrevMonthArrow\",\n \"isMobile\",\n \"isOpen\",\n \"selectedDateElem\",\n \"minDateHasTime\",\n \"maxDateHasTime\",\n \"days\",\n \"daysContainer\",\n \"_input\",\n \"_positionElement\",\n \"innerContainer\",\n \"rContainer\",\n \"monthNav\",\n \"todayDateElem\",\n \"calendarContainer\",\n \"weekdayContainer\",\n \"prevMonthNav\",\n \"nextMonthNav\",\n \"monthsDropdownContainer\",\n \"currentMonthElement\",\n \"currentYearElement\",\n \"navigationCurrentMonth\",\n \"selectedDateElem\",\n \"config\",\n ].forEach((k) => {\n try {\n delete self[k];\n }\n catch (_) { }\n });\n }\n function isCalendarElem(elem) {\n if (self.config.appendTo && self.config.appendTo.contains(elem))\n return true;\n return self.calendarContainer.contains(elem);\n }\n function documentClick(e) {\n if (self.isOpen && !self.config.inline) {\n const eventTarget = getEventTarget(e);\n const isCalendarElement = isCalendarElem(eventTarget);\n const isInput = eventTarget === self.input ||\n eventTarget === self.altInput ||\n self.element.contains(eventTarget) ||\n (e.path &&\n e.path.indexOf &&\n (~e.path.indexOf(self.input) ||\n ~e.path.indexOf(self.altInput)));\n const lostFocus = e.type === \"blur\"\n ? isInput &&\n e.relatedTarget &&\n !isCalendarElem(e.relatedTarget)\n : !isInput &&\n !isCalendarElement &&\n !isCalendarElem(e.relatedTarget);\n const isIgnored = !self.config.ignoredFocusElements.some((elem) => elem.contains(eventTarget));\n if (lostFocus && isIgnored) {\n if (self.timeContainer !== undefined &&\n self.minuteElement !== undefined &&\n self.hourElement !== undefined &&\n self.input.value !== \"\" &&\n self.input.value !== undefined) {\n updateTime();\n }\n self.close();\n if (self.config &&\n self.config.mode === \"range\" &&\n self.selectedDates.length === 1) {\n self.clear(false);\n self.redraw();\n }\n }\n }\n }\n function changeYear(newYear) {\n if (!newYear ||\n (self.config.minDate && newYear < self.config.minDate.getFullYear()) ||\n (self.config.maxDate && newYear > self.config.maxDate.getFullYear()))\n return;\n const newYearNum = newYear, isNewYear = self.currentYear !== newYearNum;\n self.currentYear = newYearNum || self.currentYear;\n if (self.config.maxDate &&\n self.currentYear === self.config.maxDate.getFullYear()) {\n self.currentMonth = Math.min(self.config.maxDate.getMonth(), self.currentMonth);\n }\n else if (self.config.minDate &&\n self.currentYear === self.config.minDate.getFullYear()) {\n self.currentMonth = Math.max(self.config.minDate.getMonth(), self.currentMonth);\n }\n if (isNewYear) {\n self.redraw();\n triggerEvent(\"onYearChange\");\n buildMonthSwitch();\n }\n }\n function isEnabled(date, timeless = true) {\n var _a;\n const dateToCheck = self.parseDate(date, undefined, timeless);\n if ((self.config.minDate &&\n dateToCheck &&\n compareDates(dateToCheck, self.config.minDate, timeless !== undefined ? timeless : !self.minDateHasTime) < 0) ||\n (self.config.maxDate &&\n dateToCheck &&\n compareDates(dateToCheck, self.config.maxDate, timeless !== undefined ? timeless : !self.maxDateHasTime) > 0))\n return false;\n if (!self.config.enable && self.config.disable.length === 0)\n return true;\n if (dateToCheck === undefined)\n return false;\n const bool = !!self.config.enable, array = (_a = self.config.enable) !== null && _a !== void 0 ? _a : self.config.disable;\n for (let i = 0, d; i < array.length; i++) {\n d = array[i];\n if (typeof d === \"function\" &&\n d(dateToCheck))\n return bool;\n else if (d instanceof Date &&\n dateToCheck !== undefined &&\n d.getTime() === dateToCheck.getTime())\n return bool;\n else if (typeof d === \"string\") {\n const parsed = self.parseDate(d, undefined, true);\n return parsed && parsed.getTime() === dateToCheck.getTime()\n ? bool\n : !bool;\n }\n else if (typeof d === \"object\" &&\n dateToCheck !== undefined &&\n d.from &&\n d.to &&\n dateToCheck.getTime() >= d.from.getTime() &&\n dateToCheck.getTime() <= d.to.getTime())\n return bool;\n }\n return !bool;\n }\n function isInView(elem) {\n if (self.daysContainer !== undefined)\n return (elem.className.indexOf(\"hidden\") === -1 &&\n elem.className.indexOf(\"flatpickr-disabled\") === -1 &&\n self.daysContainer.contains(elem));\n return false;\n }\n function onBlur(e) {\n const isInput = e.target === self._input;\n if (isInput &&\n (self.selectedDates.length > 0 || self._input.value.length > 0) &&\n !(e.relatedTarget && isCalendarElem(e.relatedTarget))) {\n self.setDate(self._input.value, true, e.target === self.altInput\n ? self.config.altFormat\n : self.config.dateFormat);\n }\n }\n function onKeyDown(e) {\n const eventTarget = getEventTarget(e);\n const isInput = self.config.wrap\n ? element.contains(eventTarget)\n : eventTarget === self._input;\n const allowInput = self.config.allowInput;\n const allowKeydown = self.isOpen && (!allowInput || !isInput);\n const allowInlineKeydown = self.config.inline && isInput && !allowInput;\n if (e.keyCode === 13 && isInput) {\n if (allowInput) {\n self.setDate(self._input.value, true, eventTarget === self.altInput\n ? self.config.altFormat\n : self.config.dateFormat);\n return eventTarget.blur();\n }\n else {\n self.open();\n }\n }\n else if (isCalendarElem(eventTarget) ||\n allowKeydown ||\n allowInlineKeydown) {\n const isTimeObj = !!self.timeContainer &&\n self.timeContainer.contains(eventTarget);\n switch (e.keyCode) {\n case 13:\n if (isTimeObj) {\n e.preventDefault();\n updateTime();\n focusAndClose();\n }\n else\n selectDate(e);\n break;\n case 27:\n e.preventDefault();\n focusAndClose();\n break;\n case 8:\n case 46:\n if (isInput && !self.config.allowInput) {\n e.preventDefault();\n self.clear();\n }\n break;\n case 37:\n case 39:\n if (!isTimeObj && !isInput) {\n e.preventDefault();\n if (self.daysContainer !== undefined &&\n (allowInput === false ||\n (document.activeElement && isInView(document.activeElement)))) {\n const delta = e.keyCode === 39 ? 1 : -1;\n if (!e.ctrlKey)\n focusOnDay(undefined, delta);\n else {\n e.stopPropagation();\n changeMonth(delta);\n focusOnDay(getFirstAvailableDay(1), 0);\n }\n }\n }\n else if (self.hourElement)\n self.hourElement.focus();\n break;\n case 38:\n case 40:\n e.preventDefault();\n const delta = e.keyCode === 40 ? 1 : -1;\n if ((self.daysContainer &&\n eventTarget.$i !== undefined) ||\n eventTarget === self.input ||\n eventTarget === self.altInput) {\n if (e.ctrlKey) {\n e.stopPropagation();\n changeYear(self.currentYear - delta);\n focusOnDay(getFirstAvailableDay(1), 0);\n }\n else if (!isTimeObj)\n focusOnDay(undefined, delta * 7);\n }\n else if (eventTarget === self.currentYearElement) {\n changeYear(self.currentYear - delta);\n }\n else if (self.config.enableTime) {\n if (!isTimeObj && self.hourElement)\n self.hourElement.focus();\n updateTime(e);\n self._debouncedChange();\n }\n break;\n case 9:\n if (isTimeObj) {\n const elems = [\n self.hourElement,\n self.minuteElement,\n self.secondElement,\n self.amPM,\n ]\n .concat(self.pluginElements)\n .filter((x) => x);\n const i = elems.indexOf(eventTarget);\n if (i !== -1) {\n const target = elems[i + (e.shiftKey ? -1 : 1)];\n e.preventDefault();\n (target || self._input).focus();\n }\n }\n else if (!self.config.noCalendar &&\n self.daysContainer &&\n self.daysContainer.contains(eventTarget) &&\n e.shiftKey) {\n e.preventDefault();\n self._input.focus();\n }\n break;\n default:\n break;\n }\n }\n if (self.amPM !== undefined && eventTarget === self.amPM) {\n switch (e.key) {\n case self.l10n.amPM[0].charAt(0):\n case self.l10n.amPM[0].charAt(0).toLowerCase():\n self.amPM.textContent = self.l10n.amPM[0];\n setHoursFromInputs();\n updateValue();\n break;\n case self.l10n.amPM[1].charAt(0):\n case self.l10n.amPM[1].charAt(0).toLowerCase():\n self.amPM.textContent = self.l10n.amPM[1];\n setHoursFromInputs();\n updateValue();\n break;\n }\n }\n if (isInput || isCalendarElem(eventTarget)) {\n triggerEvent(\"onKeyDown\", e);\n }\n }\n function onMouseOver(elem) {\n if (self.selectedDates.length !== 1 ||\n (elem &&\n (!elem.classList.contains(\"flatpickr-day\") ||\n elem.classList.contains(\"flatpickr-disabled\"))))\n return;\n const hoverDate = elem\n ? elem.dateObj.getTime()\n : self.days.firstElementChild.dateObj.getTime(), initialDate = self.parseDate(self.selectedDates[0], undefined, true).getTime(), rangeStartDate = Math.min(hoverDate, self.selectedDates[0].getTime()), rangeEndDate = Math.max(hoverDate, self.selectedDates[0].getTime());\n let containsDisabled = false;\n let minRange = 0, maxRange = 0;\n for (let t = rangeStartDate; t < rangeEndDate; t += duration.DAY) {\n if (!isEnabled(new Date(t), true)) {\n containsDisabled =\n containsDisabled || (t > rangeStartDate && t < rangeEndDate);\n if (t < initialDate && (!minRange || t > minRange))\n minRange = t;\n else if (t > initialDate && (!maxRange || t < maxRange))\n maxRange = t;\n }\n }\n for (let m = 0; m < self.config.showMonths; m++) {\n const month = self.daysContainer.children[m];\n for (let i = 0, l = month.children.length; i < l; i++) {\n const dayElem = month.children[i], date = dayElem.dateObj;\n const timestamp = date.getTime();\n const outOfRange = (minRange > 0 && timestamp < minRange) ||\n (maxRange > 0 && timestamp > maxRange);\n if (outOfRange) {\n dayElem.classList.add(\"notAllowed\");\n [\"inRange\", \"startRange\", \"endRange\"].forEach((c) => {\n dayElem.classList.remove(c);\n });\n continue;\n }\n else if (containsDisabled && !outOfRange)\n continue;\n [\"startRange\", \"inRange\", \"endRange\", \"notAllowed\"].forEach((c) => {\n dayElem.classList.remove(c);\n });\n if (elem !== undefined) {\n elem.classList.add(hoverDate <= self.selectedDates[0].getTime()\n ? \"startRange\"\n : \"endRange\");\n if (initialDate < hoverDate && timestamp === initialDate)\n dayElem.classList.add(\"startRange\");\n else if (initialDate > hoverDate && timestamp === initialDate)\n dayElem.classList.add(\"endRange\");\n if (timestamp >= minRange &&\n (maxRange === 0 || timestamp <= maxRange) &&\n isBetween(timestamp, initialDate, hoverDate))\n dayElem.classList.add(\"inRange\");\n }\n }\n }\n }\n function onResize() {\n if (self.isOpen && !self.config.static && !self.config.inline)\n positionCalendar();\n }\n function open(e, positionElement = self._positionElement) {\n if (self.isMobile === true) {\n if (e) {\n e.preventDefault();\n const eventTarget = getEventTarget(e);\n if (eventTarget) {\n eventTarget.blur();\n }\n }\n if (self.mobileInput !== undefined) {\n self.mobileInput.focus();\n self.mobileInput.click();\n }\n triggerEvent(\"onOpen\");\n return;\n }\n else if (self._input.disabled || self.config.inline) {\n return;\n }\n const wasOpen = self.isOpen;\n self.isOpen = true;\n if (!wasOpen) {\n self.calendarContainer.classList.add(\"open\");\n self._input.classList.add(\"active\");\n triggerEvent(\"onOpen\");\n positionCalendar(positionElement);\n }\n if (self.config.enableTime === true && self.config.noCalendar === true) {\n if (self.config.allowInput === false &&\n (e === undefined ||\n !self.timeContainer.contains(e.relatedTarget))) {\n setTimeout(() => self.hourElement.select(), 50);\n }\n }\n }\n function minMaxDateSetter(type) {\n return (date) => {\n const dateObj = (self.config[`_${type}Date`] = self.parseDate(date, self.config.dateFormat));\n const inverseDateObj = self.config[`_${type === \"min\" ? \"max\" : \"min\"}Date`];\n if (dateObj !== undefined) {\n self[type === \"min\" ? \"minDateHasTime\" : \"maxDateHasTime\"] =\n dateObj.getHours() > 0 ||\n dateObj.getMinutes() > 0 ||\n dateObj.getSeconds() > 0;\n }\n if (self.selectedDates) {\n self.selectedDates = self.selectedDates.filter((d) => isEnabled(d));\n if (!self.selectedDates.length && type === \"min\")\n setHoursFromDate(dateObj);\n updateValue();\n }\n if (self.daysContainer) {\n redraw();\n if (dateObj !== undefined)\n self.currentYearElement[type] = dateObj.getFullYear().toString();\n else\n self.currentYearElement.removeAttribute(type);\n self.currentYearElement.disabled =\n !!inverseDateObj &&\n dateObj !== undefined &&\n inverseDateObj.getFullYear() === dateObj.getFullYear();\n }\n };\n }\n function parseConfig() {\n const boolOpts = [\n \"wrap\",\n \"weekNumbers\",\n \"allowInput\",\n \"allowInvalidPreload\",\n \"clickOpens\",\n \"time_24hr\",\n \"enableTime\",\n \"noCalendar\",\n \"altInput\",\n \"shorthandCurrentMonth\",\n \"inline\",\n \"static\",\n \"enableSeconds\",\n \"disableMobile\",\n ];\n const userConfig = Object.assign(Object.assign({}, JSON.parse(JSON.stringify(element.dataset || {}))), instanceConfig);\n const formats = {};\n self.config.parseDate = userConfig.parseDate;\n self.config.formatDate = userConfig.formatDate;\n Object.defineProperty(self.config, \"enable\", {\n get: () => self.config._enable,\n set: (dates) => {\n self.config._enable = parseDateRules(dates);\n },\n });\n Object.defineProperty(self.config, \"disable\", {\n get: () => self.config._disable,\n set: (dates) => {\n self.config._disable = parseDateRules(dates);\n },\n });\n const timeMode = userConfig.mode === \"time\";\n if (!userConfig.dateFormat && (userConfig.enableTime || timeMode)) {\n const defaultDateFormat = flatpickr.defaultConfig.dateFormat || defaultOptions.dateFormat;\n formats.dateFormat =\n userConfig.noCalendar || timeMode\n ? \"H:i\" + (userConfig.enableSeconds ? \":S\" : \"\")\n : defaultDateFormat + \" H:i\" + (userConfig.enableSeconds ? \":S\" : \"\");\n }\n if (userConfig.altInput &&\n (userConfig.enableTime || timeMode) &&\n !userConfig.altFormat) {\n const defaultAltFormat = flatpickr.defaultConfig.altFormat || defaultOptions.altFormat;\n formats.altFormat =\n userConfig.noCalendar || timeMode\n ? \"h:i\" + (userConfig.enableSeconds ? \":S K\" : \" K\")\n : defaultAltFormat + ` h:i${userConfig.enableSeconds ? \":S\" : \"\"} K`;\n }\n Object.defineProperty(self.config, \"minDate\", {\n get: () => self.config._minDate,\n set: minMaxDateSetter(\"min\"),\n });\n Object.defineProperty(self.config, \"maxDate\", {\n get: () => self.config._maxDate,\n set: minMaxDateSetter(\"max\"),\n });\n const minMaxTimeSetter = (type) => (val) => {\n self.config[type === \"min\" ? \"_minTime\" : \"_maxTime\"] = self.parseDate(val, \"H:i:S\");\n };\n Object.defineProperty(self.config, \"minTime\", {\n get: () => self.config._minTime,\n set: minMaxTimeSetter(\"min\"),\n });\n Object.defineProperty(self.config, \"maxTime\", {\n get: () => self.config._maxTime,\n set: minMaxTimeSetter(\"max\"),\n });\n if (userConfig.mode === \"time\") {\n self.config.noCalendar = true;\n self.config.enableTime = true;\n }\n Object.assign(self.config, formats, userConfig);\n for (let i = 0; i < boolOpts.length; i++)\n self.config[boolOpts[i]] =\n self.config[boolOpts[i]] === true ||\n self.config[boolOpts[i]] === \"true\";\n HOOKS.filter((hook) => self.config[hook] !== undefined).forEach((hook) => {\n self.config[hook] = arrayify(self.config[hook] || []).map(bindToInstance);\n });\n self.isMobile =\n !self.config.disableMobile &&\n !self.config.inline &&\n self.config.mode === \"single\" &&\n !self.config.disable.length &&\n !self.config.enable &&\n !self.config.weekNumbers &&\n /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent);\n for (let i = 0; i < self.config.plugins.length; i++) {\n const pluginConf = self.config.plugins[i](self) || {};\n for (const key in pluginConf) {\n if (HOOKS.indexOf(key) > -1) {\n self.config[key] = arrayify(pluginConf[key])\n .map(bindToInstance)\n .concat(self.config[key]);\n }\n else if (typeof userConfig[key] === \"undefined\")\n self.config[key] = pluginConf[key];\n }\n }\n if (!userConfig.altInputClass) {\n self.config.altInputClass =\n getInputElem().className + \" \" + self.config.altInputClass;\n }\n triggerEvent(\"onParseConfig\");\n }\n function getInputElem() {\n return self.config.wrap\n ? element.querySelector(\"[data-input]\")\n : element;\n }\n function setupLocale() {\n if (typeof self.config.locale !== \"object\" &&\n typeof flatpickr.l10ns[self.config.locale] === \"undefined\")\n self.config.errorHandler(new Error(`flatpickr: invalid locale ${self.config.locale}`));\n self.l10n = Object.assign(Object.assign({}, flatpickr.l10ns.default), (typeof self.config.locale === \"object\"\n ? self.config.locale\n : self.config.locale !== \"default\"\n ? flatpickr.l10ns[self.config.locale]\n : undefined));\n tokenRegex.K = `(${self.l10n.amPM[0]}|${self.l10n.amPM[1]}|${self.l10n.amPM[0].toLowerCase()}|${self.l10n.amPM[1].toLowerCase()})`;\n const userConfig = Object.assign(Object.assign({}, instanceConfig), JSON.parse(JSON.stringify(element.dataset || {})));\n if (userConfig.time_24hr === undefined &&\n flatpickr.defaultConfig.time_24hr === undefined) {\n self.config.time_24hr = self.l10n.time_24hr;\n }\n self.formatDate = createDateFormatter(self);\n self.parseDate = createDateParser({ config: self.config, l10n: self.l10n });\n }\n function positionCalendar(customPositionElement) {\n if (typeof self.config.position === \"function\") {\n return void self.config.position(self, customPositionElement);\n }\n if (self.calendarContainer === undefined)\n return;\n triggerEvent(\"onPreCalendarPosition\");\n const positionElement = customPositionElement || self._positionElement;\n const calendarHeight = Array.prototype.reduce.call(self.calendarContainer.children, ((acc, child) => acc + child.offsetHeight), 0), calendarWidth = self.calendarContainer.offsetWidth, configPos = self.config.position.split(\" \"), configPosVertical = configPos[0], configPosHorizontal = configPos.length > 1 ? configPos[1] : null, inputBounds = positionElement.getBoundingClientRect(), distanceFromBottom = window.innerHeight - inputBounds.bottom, showOnTop = configPosVertical === \"above\" ||\n (configPosVertical !== \"below\" &&\n distanceFromBottom < calendarHeight &&\n inputBounds.top > calendarHeight);\n const top = window.pageYOffset +\n inputBounds.top +\n (!showOnTop ? positionElement.offsetHeight + 2 : -calendarHeight - 2);\n toggleClass(self.calendarContainer, \"arrowTop\", !showOnTop);\n toggleClass(self.calendarContainer, \"arrowBottom\", showOnTop);\n if (self.config.inline)\n return;\n let left = window.pageXOffset + inputBounds.left;\n let isCenter = false;\n let isRight = false;\n if (configPosHorizontal === \"center\") {\n left -= (calendarWidth - inputBounds.width) / 2;\n isCenter = true;\n }\n else if (configPosHorizontal === \"right\") {\n left -= calendarWidth - inputBounds.width;\n isRight = true;\n }\n toggleClass(self.calendarContainer, \"arrowLeft\", !isCenter && !isRight);\n toggleClass(self.calendarContainer, \"arrowCenter\", isCenter);\n toggleClass(self.calendarContainer, \"arrowRight\", isRight);\n const right = window.document.body.offsetWidth -\n (window.pageXOffset + inputBounds.right);\n const rightMost = left + calendarWidth > window.document.body.offsetWidth;\n const centerMost = right + calendarWidth > window.document.body.offsetWidth;\n toggleClass(self.calendarContainer, \"rightMost\", rightMost);\n if (self.config.static)\n return;\n self.calendarContainer.style.top = `${top}px`;\n if (!rightMost) {\n self.calendarContainer.style.left = `${left}px`;\n self.calendarContainer.style.right = \"auto\";\n }\n else if (!centerMost) {\n self.calendarContainer.style.left = \"auto\";\n self.calendarContainer.style.right = `${right}px`;\n }\n else {\n const doc = getDocumentStyleSheet();\n if (doc === undefined)\n return;\n const bodyWidth = window.document.body.offsetWidth;\n const centerLeft = Math.max(0, bodyWidth / 2 - calendarWidth / 2);\n const centerBefore = \".flatpickr-calendar.centerMost:before\";\n const centerAfter = \".flatpickr-calendar.centerMost:after\";\n const centerIndex = doc.cssRules.length;\n const centerStyle = `{left:${inputBounds.left}px;right:auto;}`;\n toggleClass(self.calendarContainer, \"rightMost\", false);\n toggleClass(self.calendarContainer, \"centerMost\", true);\n doc.insertRule(`${centerBefore},${centerAfter}${centerStyle}`, centerIndex);\n self.calendarContainer.style.left = `${centerLeft}px`;\n self.calendarContainer.style.right = \"auto\";\n }\n }\n function getDocumentStyleSheet() {\n let editableSheet = null;\n for (let i = 0; i < document.styleSheets.length; i++) {\n const sheet = document.styleSheets[i];\n try {\n sheet.cssRules;\n }\n catch (err) {\n continue;\n }\n editableSheet = sheet;\n break;\n }\n return editableSheet != null ? editableSheet : createStyleSheet();\n }\n function createStyleSheet() {\n const style = document.createElement(\"style\");\n document.head.appendChild(style);\n return style.sheet;\n }\n function redraw() {\n if (self.config.noCalendar || self.isMobile)\n return;\n buildMonthSwitch();\n updateNavigationCurrentMonth();\n buildDays();\n }\n function focusAndClose() {\n self._input.focus();\n if (window.navigator.userAgent.indexOf(\"MSIE\") !== -1 ||\n navigator.msMaxTouchPoints !== undefined) {\n setTimeout(self.close, 0);\n }\n else {\n self.close();\n }\n }\n function selectDate(e) {\n e.preventDefault();\n e.stopPropagation();\n const isSelectable = (day) => day.classList &&\n day.classList.contains(\"flatpickr-day\") &&\n !day.classList.contains(\"flatpickr-disabled\") &&\n !day.classList.contains(\"notAllowed\");\n const t = findParent(getEventTarget(e), isSelectable);\n if (t === undefined)\n return;\n const target = t;\n const selectedDate = (self.latestSelectedDateObj = new Date(target.dateObj.getTime()));\n const shouldChangeMonth = (selectedDate.getMonth() < self.currentMonth ||\n selectedDate.getMonth() >\n self.currentMonth + self.config.showMonths - 1) &&\n self.config.mode !== \"range\";\n self.selectedDateElem = target;\n if (self.config.mode === \"single\")\n self.selectedDates = [selectedDate];\n else if (self.config.mode === \"multiple\") {\n const selectedIndex = isDateSelected(selectedDate);\n if (selectedIndex)\n self.selectedDates.splice(parseInt(selectedIndex), 1);\n else\n self.selectedDates.push(selectedDate);\n }\n else if (self.config.mode === \"range\") {\n if (self.selectedDates.length === 2) {\n self.clear(false, false);\n }\n self.latestSelectedDateObj = selectedDate;\n self.selectedDates.push(selectedDate);\n if (compareDates(selectedDate, self.selectedDates[0], true) !== 0)\n self.selectedDates.sort((a, b) => a.getTime() - b.getTime());\n }\n setHoursFromInputs();\n if (shouldChangeMonth) {\n const isNewYear = self.currentYear !== selectedDate.getFullYear();\n self.currentYear = selectedDate.getFullYear();\n self.currentMonth = selectedDate.getMonth();\n if (isNewYear) {\n triggerEvent(\"onYearChange\");\n buildMonthSwitch();\n }\n triggerEvent(\"onMonthChange\");\n }\n updateNavigationCurrentMonth();\n buildDays();\n updateValue();\n if (!shouldChangeMonth &&\n self.config.mode !== \"range\" &&\n self.config.showMonths === 1)\n focusOnDayElem(target);\n else if (self.selectedDateElem !== undefined &&\n self.hourElement === undefined) {\n self.selectedDateElem && self.selectedDateElem.focus();\n }\n if (self.hourElement !== undefined)\n self.hourElement !== undefined && self.hourElement.focus();\n if (self.config.closeOnSelect) {\n const single = self.config.mode === \"single\" && !self.config.enableTime;\n const range = self.config.mode === \"range\" &&\n self.selectedDates.length === 2 &&\n !self.config.enableTime;\n if (single || range) {\n focusAndClose();\n }\n }\n triggerChange();\n }\n const CALLBACKS = {\n locale: [setupLocale, updateWeekdays],\n showMonths: [buildMonths, setCalendarWidth, buildWeekdays],\n minDate: [jumpToDate],\n maxDate: [jumpToDate],\n clickOpens: [\n () => {\n if (self.config.clickOpens === true) {\n bind(self._input, \"focus\", self.open);\n bind(self._input, \"click\", self.open);\n }\n else {\n self._input.removeEventListener(\"focus\", self.open);\n self._input.removeEventListener(\"click\", self.open);\n }\n },\n ],\n };\n function set(option, value) {\n if (option !== null && typeof option === \"object\") {\n Object.assign(self.config, option);\n for (const key in option) {\n if (CALLBACKS[key] !== undefined)\n CALLBACKS[key].forEach((x) => x());\n }\n }\n else {\n self.config[option] = value;\n if (CALLBACKS[option] !== undefined)\n CALLBACKS[option].forEach((x) => x());\n else if (HOOKS.indexOf(option) > -1)\n self.config[option] = arrayify(value);\n }\n self.redraw();\n updateValue(true);\n }\n function setSelectedDate(inputDate, format) {\n let dates = [];\n if (inputDate instanceof Array)\n dates = inputDate.map((d) => self.parseDate(d, format));\n else if (inputDate instanceof Date || typeof inputDate === \"number\")\n dates = [self.parseDate(inputDate, format)];\n else if (typeof inputDate === \"string\") {\n switch (self.config.mode) {\n case \"single\":\n case \"time\":\n dates = [self.parseDate(inputDate, format)];\n break;\n case \"multiple\":\n dates = inputDate\n .split(self.config.conjunction)\n .map((date) => self.parseDate(date, format));\n break;\n case \"range\":\n dates = inputDate\n .split(self.l10n.rangeSeparator)\n .map((date) => self.parseDate(date, format));\n break;\n default:\n break;\n }\n }\n else\n self.config.errorHandler(new Error(`Invalid date supplied: ${JSON.stringify(inputDate)}`));\n self.selectedDates = (self.config.allowInvalidPreload\n ? dates\n : dates.filter((d) => d instanceof Date && isEnabled(d, false)));\n if (self.config.mode === \"range\")\n self.selectedDates.sort((a, b) => a.getTime() - b.getTime());\n }\n function setDate(date, triggerChange = false, format = self.config.dateFormat) {\n if ((date !== 0 && !date) || (date instanceof Array && date.length === 0))\n return self.clear(triggerChange);\n setSelectedDate(date, format);\n self.latestSelectedDateObj =\n self.selectedDates[self.selectedDates.length - 1];\n self.redraw();\n jumpToDate(undefined, triggerChange);\n setHoursFromDate();\n if (self.selectedDates.length === 0) {\n self.clear(false);\n }\n updateValue(triggerChange);\n if (triggerChange)\n triggerEvent(\"onChange\");\n }\n function parseDateRules(arr) {\n return arr\n .slice()\n .map((rule) => {\n if (typeof rule === \"string\" ||\n typeof rule === \"number\" ||\n rule instanceof Date) {\n return self.parseDate(rule, undefined, true);\n }\n else if (rule &&\n typeof rule === \"object\" &&\n rule.from &&\n rule.to)\n return {\n from: self.parseDate(rule.from, undefined),\n to: self.parseDate(rule.to, undefined),\n };\n return rule;\n })\n .filter((x) => x);\n }\n function setupDates() {\n self.selectedDates = [];\n self.now = self.parseDate(self.config.now) || new Date();\n const preloadedDate = self.config.defaultDate ||\n ((self.input.nodeName === \"INPUT\" ||\n self.input.nodeName === \"TEXTAREA\") &&\n self.input.placeholder &&\n self.input.value === self.input.placeholder\n ? null\n : self.input.value);\n if (preloadedDate)\n setSelectedDate(preloadedDate, self.config.dateFormat);\n self._initialDate =\n self.selectedDates.length > 0\n ? self.selectedDates[0]\n : self.config.minDate &&\n self.config.minDate.getTime() > self.now.getTime()\n ? self.config.minDate\n : self.config.maxDate &&\n self.config.maxDate.getTime() < self.now.getTime()\n ? self.config.maxDate\n : self.now;\n self.currentYear = self._initialDate.getFullYear();\n self.currentMonth = self._initialDate.getMonth();\n if (self.selectedDates.length > 0)\n self.latestSelectedDateObj = self.selectedDates[0];\n if (self.config.minTime !== undefined)\n self.config.minTime = self.parseDate(self.config.minTime, \"H:i\");\n if (self.config.maxTime !== undefined)\n self.config.maxTime = self.parseDate(self.config.maxTime, \"H:i\");\n self.minDateHasTime =\n !!self.config.minDate &&\n (self.config.minDate.getHours() > 0 ||\n self.config.minDate.getMinutes() > 0 ||\n self.config.minDate.getSeconds() > 0);\n self.maxDateHasTime =\n !!self.config.maxDate &&\n (self.config.maxDate.getHours() > 0 ||\n self.config.maxDate.getMinutes() > 0 ||\n self.config.maxDate.getSeconds() > 0);\n }\n function setupInputs() {\n self.input = getInputElem();\n if (!self.input) {\n self.config.errorHandler(new Error(\"Invalid input element specified\"));\n return;\n }\n self.input._type = self.input.type;\n self.input.type = \"text\";\n self.input.classList.add(\"flatpickr-input\");\n self._input = self.input;\n if (self.config.altInput) {\n self.altInput = createElement(self.input.nodeName, self.config.altInputClass);\n self._input = self.altInput;\n self.altInput.placeholder = self.input.placeholder;\n self.altInput.disabled = self.input.disabled;\n self.altInput.required = self.input.required;\n self.altInput.tabIndex = self.input.tabIndex;\n self.altInput.type = \"text\";\n self.input.setAttribute(\"type\", \"hidden\");\n if (!self.config.static && self.input.parentNode)\n self.input.parentNode.insertBefore(self.altInput, self.input.nextSibling);\n }\n if (!self.config.allowInput)\n self._input.setAttribute(\"readonly\", \"readonly\");\n self._positionElement = self.config.positionElement || self._input;\n }\n function setupMobile() {\n const inputType = self.config.enableTime\n ? self.config.noCalendar\n ? \"time\"\n : \"datetime-local\"\n : \"date\";\n self.mobileInput = createElement(\"input\", self.input.className + \" flatpickr-mobile\");\n self.mobileInput.tabIndex = 1;\n self.mobileInput.type = inputType;\n self.mobileInput.disabled = self.input.disabled;\n self.mobileInput.required = self.input.required;\n self.mobileInput.placeholder = self.input.placeholder;\n self.mobileFormatStr =\n inputType === \"datetime-local\"\n ? \"Y-m-d\\\\TH:i:S\"\n : inputType === \"date\"\n ? \"Y-m-d\"\n : \"H:i:S\";\n if (self.selectedDates.length > 0) {\n self.mobileInput.defaultValue = self.mobileInput.value = self.formatDate(self.selectedDates[0], self.mobileFormatStr);\n }\n if (self.config.minDate)\n self.mobileInput.min = self.formatDate(self.config.minDate, \"Y-m-d\");\n if (self.config.maxDate)\n self.mobileInput.max = self.formatDate(self.config.maxDate, \"Y-m-d\");\n if (self.input.getAttribute(\"step\"))\n self.mobileInput.step = String(self.input.getAttribute(\"step\"));\n self.input.type = \"hidden\";\n if (self.altInput !== undefined)\n self.altInput.type = \"hidden\";\n try {\n if (self.input.parentNode)\n self.input.parentNode.insertBefore(self.mobileInput, self.input.nextSibling);\n }\n catch (_a) { }\n bind(self.mobileInput, \"change\", (e) => {\n self.setDate(getEventTarget(e).value, false, self.mobileFormatStr);\n triggerEvent(\"onChange\");\n triggerEvent(\"onClose\");\n });\n }\n function toggle(e) {\n if (self.isOpen === true)\n return self.close();\n self.open(e);\n }\n function triggerEvent(event, data) {\n if (self.config === undefined)\n return;\n const hooks = self.config[event];\n if (hooks !== undefined && hooks.length > 0) {\n for (let i = 0; hooks[i] && i < hooks.length; i++)\n hooks[i](self.selectedDates, self.input.value, self, data);\n }\n if (event === \"onChange\") {\n self.input.dispatchEvent(createEvent(\"change\"));\n self.input.dispatchEvent(createEvent(\"input\"));\n }\n }\n function createEvent(name) {\n const e = document.createEvent(\"Event\");\n e.initEvent(name, true, true);\n return e;\n }\n function isDateSelected(date) {\n for (let i = 0; i < self.selectedDates.length; i++) {\n if (compareDates(self.selectedDates[i], date) === 0)\n return \"\" + i;\n }\n return false;\n }\n function isDateInRange(date) {\n if (self.config.mode !== \"range\" || self.selectedDates.length < 2)\n return false;\n return (compareDates(date, self.selectedDates[0]) >= 0 &&\n compareDates(date, self.selectedDates[1]) <= 0);\n }\n function updateNavigationCurrentMonth() {\n if (self.config.noCalendar || self.isMobile || !self.monthNav)\n return;\n self.yearElements.forEach((yearElement, i) => {\n const d = new Date(self.currentYear, self.currentMonth, 1);\n d.setMonth(self.currentMonth + i);\n if (self.config.showMonths > 1 ||\n self.config.monthSelectorType === \"static\") {\n self.monthElements[i].textContent =\n monthToStr(d.getMonth(), self.config.shorthandCurrentMonth, self.l10n) + \" \";\n }\n else {\n self.monthsDropdownContainer.value = d.getMonth().toString();\n }\n yearElement.value = d.getFullYear().toString();\n });\n self._hidePrevMonthArrow =\n self.config.minDate !== undefined &&\n (self.currentYear === self.config.minDate.getFullYear()\n ? self.currentMonth <= self.config.minDate.getMonth()\n : self.currentYear < self.config.minDate.getFullYear());\n self._hideNextMonthArrow =\n self.config.maxDate !== undefined &&\n (self.currentYear === self.config.maxDate.getFullYear()\n ? self.currentMonth + 1 > self.config.maxDate.getMonth()\n : self.currentYear > self.config.maxDate.getFullYear());\n }\n function getDateStr(format) {\n return self.selectedDates\n .map((dObj) => self.formatDate(dObj, format))\n .filter((d, i, arr) => self.config.mode !== \"range\" ||\n self.config.enableTime ||\n arr.indexOf(d) === i)\n .join(self.config.mode !== \"range\"\n ? self.config.conjunction\n : self.l10n.rangeSeparator);\n }\n function updateValue(triggerChange = true) {\n if (self.mobileInput !== undefined && self.mobileFormatStr) {\n self.mobileInput.value =\n self.latestSelectedDateObj !== undefined\n ? self.formatDate(self.latestSelectedDateObj, self.mobileFormatStr)\n : \"\";\n }\n self.input.value = getDateStr(self.config.dateFormat);\n if (self.altInput !== undefined) {\n self.altInput.value = getDateStr(self.config.altFormat);\n }\n if (triggerChange !== false)\n triggerEvent(\"onValueUpdate\");\n }\n function onMonthNavClick(e) {\n const eventTarget = getEventTarget(e);\n const isPrevMonth = self.prevMonthNav.contains(eventTarget);\n const isNextMonth = self.nextMonthNav.contains(eventTarget);\n if (isPrevMonth || isNextMonth) {\n changeMonth(isPrevMonth ? -1 : 1);\n }\n else if (self.yearElements.indexOf(eventTarget) >= 0) {\n eventTarget.select();\n }\n else if (eventTarget.classList.contains(\"arrowUp\")) {\n self.changeYear(self.currentYear + 1);\n }\n else if (eventTarget.classList.contains(\"arrowDown\")) {\n self.changeYear(self.currentYear - 1);\n }\n }\n function timeWrapper(e) {\n e.preventDefault();\n const isKeyDown = e.type === \"keydown\", eventTarget = getEventTarget(e), input = eventTarget;\n if (self.amPM !== undefined && eventTarget === self.amPM) {\n self.amPM.textContent =\n self.l10n.amPM[int(self.amPM.textContent === self.l10n.amPM[0])];\n }\n const min = parseFloat(input.getAttribute(\"min\")), max = parseFloat(input.getAttribute(\"max\")), step = parseFloat(input.getAttribute(\"step\")), curValue = parseInt(input.value, 10), delta = e.delta ||\n (isKeyDown ? (e.which === 38 ? 1 : -1) : 0);\n let newValue = curValue + step * delta;\n if (typeof input.value !== \"undefined\" && input.value.length === 2) {\n const isHourElem = input === self.hourElement, isMinuteElem = input === self.minuteElement;\n if (newValue < min) {\n newValue =\n max +\n newValue +\n int(!isHourElem) +\n (int(isHourElem) && int(!self.amPM));\n if (isMinuteElem)\n incrementNumInput(undefined, -1, self.hourElement);\n }\n else if (newValue > max) {\n newValue =\n input === self.hourElement ? newValue - max - int(!self.amPM) : min;\n if (isMinuteElem)\n incrementNumInput(undefined, 1, self.hourElement);\n }\n if (self.amPM &&\n isHourElem &&\n (step === 1\n ? newValue + curValue === 23\n : Math.abs(newValue - curValue) > step)) {\n self.amPM.textContent =\n self.l10n.amPM[int(self.amPM.textContent === self.l10n.amPM[0])];\n }\n input.value = pad(newValue);\n }\n }\n init();\n return self;\n}\nfunction _flatpickr(nodeList, config) {\n const nodes = Array.prototype.slice\n .call(nodeList)\n .filter((x) => x instanceof HTMLElement);\n const instances = [];\n for (let i = 0; i < nodes.length; i++) {\n const node = nodes[i];\n try {\n if (node.getAttribute(\"data-fp-omit\") !== null)\n continue;\n if (node._flatpickr !== undefined) {\n node._flatpickr.destroy();\n node._flatpickr = undefined;\n }\n node._flatpickr = FlatpickrInstance(node, config || {});\n instances.push(node._flatpickr);\n }\n catch (e) {\n console.error(e);\n }\n }\n return instances.length === 1 ? instances[0] : instances;\n}\nif (typeof HTMLElement !== \"undefined\" &&\n typeof HTMLCollection !== \"undefined\" &&\n typeof NodeList !== \"undefined\") {\n HTMLCollection.prototype.flatpickr = NodeList.prototype.flatpickr = function (config) {\n return _flatpickr(this, config);\n };\n HTMLElement.prototype.flatpickr = function (config) {\n return _flatpickr([this], config);\n };\n}\nvar flatpickr = function (selector, config) {\n if (typeof selector === \"string\") {\n return _flatpickr(window.document.querySelectorAll(selector), config);\n }\n else if (selector instanceof Node) {\n return _flatpickr([selector], config);\n }\n else {\n return _flatpickr(selector, config);\n }\n};\nflatpickr.defaultConfig = {};\nflatpickr.l10ns = {\n en: Object.assign({}, English),\n default: Object.assign({}, English),\n};\nflatpickr.localize = (l10n) => {\n flatpickr.l10ns.default = Object.assign(Object.assign({}, flatpickr.l10ns.default), l10n);\n};\nflatpickr.setDefaults = (config) => {\n flatpickr.defaultConfig = Object.assign(Object.assign({}, flatpickr.defaultConfig), config);\n};\nflatpickr.parseDate = createDateParser({});\nflatpickr.formatDate = createDateFormatter({});\nflatpickr.compareDates = compareDates;\nif (typeof jQuery !== \"undefined\" && typeof jQuery.fn !== \"undefined\") {\n jQuery.fn.flatpickr = function (config) {\n return _flatpickr(this, config);\n };\n}\nDate.prototype.fp_incr = function (days) {\n return new Date(this.getFullYear(), this.getMonth(), this.getDate() + (typeof days === \"string\" ? parseInt(days, 10) : days));\n};\nif (typeof window !== \"undefined\") {\n window.flatpickr = flatpickr;\n}\nexport default flatpickr;\n","$(document).ready(function () {\r\n const $search = $('.js-searchPostings');\r\n const $postingsList = $('.js-allPostingsList');\r\n const $searchButton = $('.js-searchButton');\r\n const $clearButton = $('.js-clearPostings');\r\n\r\n $postingsList.children().hide()\r\n\r\n function debounce(func, wait) {\r\n let timeout;\r\n return function() {\r\n const context = this, args = arguments;\r\n clearTimeout(timeout);\r\n timeout = setTimeout(() => func.apply(context, args), wait);\r\n };\r\n };\r\n\r\n function search() {\r\n const query = $search.val().toLowerCase();\r\n if (query.length >= 2) {\r\n $clearButton.show();\r\n $postingsList.children().each(function() {\r\n const searchableText = $(this).data('search').toLowerCase();\r\n if (searchableText.includes(query)) {\r\n $(this).show();\r\n } else {\r\n $(this).hide();\r\n }\r\n });\r\n } else {\r\n $clearButton.hide();\r\n $postingsList.children().hide();\r\n }\r\n };\r\n\r\n $search.on('input', debounce(search, 200));\r\n $searchButton.on('click', function() {\r\n search();\r\n });\r\n $clearButton.on('click', function() {\r\n $search.val('');\r\n search();\r\n });\r\n});","!function (t, e) { \"object\" == typeof exports && \"object\" == typeof module ? module.exports = e() : \"function\" == typeof define && define.amd ? define([], e) : \"object\" == typeof exports ? exports.VueSelect = e() : t.VueSelect = e() }(this, function () {\r\n return function (t) { function e(r) { if (n[r]) return n[r].exports; var o = n[r] = { exports: {}, id: r, loaded: !1 }; return t[r].call(o.exports, o, o.exports, e), o.loaded = !0, o.exports } var n = {}; return e.m = t, e.c = n, e.p = \"/\", e(0) }([function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }), e.mixins = e.VueSelect = void 0; var o = n(83), i = r(o), a = n(42), s = r(a); e.default = i.default, e.VueSelect = i.default, e.mixins = s.default }, function (t, e) { var n = t.exports = \"undefined\" != typeof window && window.Math == Math ? window : \"undefined\" != typeof self && self.Math == Math ? self : Function(\"return this\")(); \"number\" == typeof __g && (__g = n) }, function (t, e, n) { t.exports = !n(9)(function () { return 7 != Object.defineProperty({}, \"a\", { get: function () { return 7 } }).a }) }, function (t, e) { var n = {}.hasOwnProperty; t.exports = function (t, e) { return n.call(t, e) } }, function (t, e, n) { var r = n(11), o = n(33), i = n(25), a = Object.defineProperty; e.f = n(2) ? Object.defineProperty : function (t, e, n) { if (r(t), e = i(e, !0), r(n), o) try { return a(t, e, n) } catch (t) { } if (\"get\" in n || \"set\" in n) throw TypeError(\"Accessors not supported!\"); return \"value\" in n && (t[e] = n.value), t } }, function (t, e) { var n = t.exports = { version: \"2.5.2\" }; \"number\" == typeof __e && (__e = n) }, function (t, e, n) { var r = n(4), o = n(14); t.exports = n(2) ? function (t, e, n) { return r.f(t, e, o(1, n)) } : function (t, e, n) { return t[e] = n, t } }, function (t, e, n) { var r = n(59), o = n(16); t.exports = function (t) { return r(o(t)) } }, function (t, e, n) { var r = n(23)(\"wks\"), o = n(15), i = n(1).Symbol, a = \"function\" == typeof i, s = t.exports = function (t) { return r[t] || (r[t] = a && i[t] || (a ? i : o)(\"Symbol.\" + t)) }; s.store = r }, function (t, e) { t.exports = function (t) { try { return !!t() } catch (t) { return !0 } } }, function (t, e) { t.exports = function (t) { return \"object\" == typeof t ? null !== t : \"function\" == typeof t } }, function (t, e, n) { var r = n(10); t.exports = function (t) { if (!r(t)) throw TypeError(t + \" is not an object!\"); return t } }, function (t, e, n) { var r = n(1), o = n(5), i = n(56), a = n(6), s = \"prototype\", u = function (t, e, n) { var l, c, f, p = t & u.F, d = t & u.G, h = t & u.S, b = t & u.P, v = t & u.B, g = t & u.W, y = d ? o : o[e] || (o[e] = {}), m = y[s], x = d ? r : h ? r[e] : (r[e] || {})[s]; d && (n = e); for (l in n) c = !p && x && void 0 !== x[l], c && l in y || (f = c ? x[l] : n[l], y[l] = d && \"function\" != typeof x[l] ? n[l] : v && c ? i(f, r) : g && x[l] == f ? function (t) { var e = function (e, n, r) { if (this instanceof t) { switch (arguments.length) { case 0: return new t; case 1: return new t(e); case 2: return new t(e, n) }return new t(e, n, r) } return t.apply(this, arguments) }; return e[s] = t[s], e }(f) : b && \"function\" == typeof f ? i(Function.call, f) : f, b && ((y.virtual || (y.virtual = {}))[l] = f, t & u.R && m && !m[l] && a(m, l, f))) }; u.F = 1, u.G = 2, u.S = 4, u.P = 8, u.B = 16, u.W = 32, u.U = 64, u.R = 128, t.exports = u }, function (t, e, n) { var r = n(38), o = n(17); t.exports = Object.keys || function (t) { return r(t, o) } }, function (t, e) { t.exports = function (t, e) { return { enumerable: !(1 & t), configurable: !(2 & t), writable: !(4 & t), value: e } } }, function (t, e) { var n = 0, r = Math.random(); t.exports = function (t) { return \"Symbol(\".concat(void 0 === t ? \"\" : t, \")_\", (++n + r).toString(36)) } }, function (t, e) { t.exports = function (t) { if (void 0 == t) throw TypeError(\"Can't call method on \" + t); return t } }, function (t, e) { t.exports = \"constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf\".split(\",\") }, function (t, e) { t.exports = {} }, function (t, e) { t.exports = !0 }, function (t, e) { e.f = {}.propertyIsEnumerable }, function (t, e, n) { var r = n(4).f, o = n(3), i = n(8)(\"toStringTag\"); t.exports = function (t, e, n) { t && !o(t = n ? t : t.prototype, i) && r(t, i, { configurable: !0, value: e }) } }, function (t, e, n) { var r = n(23)(\"keys\"), o = n(15); t.exports = function (t) { return r[t] || (r[t] = o(t)) } }, function (t, e, n) { var r = n(1), o = \"__core-js_shared__\", i = r[o] || (r[o] = {}); t.exports = function (t) { return i[t] || (i[t] = {}) } }, function (t, e) { var n = Math.ceil, r = Math.floor; t.exports = function (t) { return isNaN(t = +t) ? 0 : (t > 0 ? r : n)(t) } }, function (t, e, n) { var r = n(10); t.exports = function (t, e) { if (!r(t)) return t; var n, o; if (e && \"function\" == typeof (n = t.toString) && !r(o = n.call(t))) return o; if (\"function\" == typeof (n = t.valueOf) && !r(o = n.call(t))) return o; if (!e && \"function\" == typeof (n = t.toString) && !r(o = n.call(t))) return o; throw TypeError(\"Can't convert object to primitive value\") } }, function (t, e, n) { var r = n(1), o = n(5), i = n(19), a = n(27), s = n(4).f; t.exports = function (t) { var e = o.Symbol || (o.Symbol = i ? {} : r.Symbol || {}); \"_\" == t.charAt(0) || t in e || s(e, t, { value: a.f(t) }) } }, function (t, e, n) { e.f = n(8) }, function (t, e) { \"use strict\"; t.exports = { props: { loading: { type: Boolean, default: !1 }, onSearch: { type: Function, default: function (t, e) { } } }, data: function () { return { mutableLoading: !1 } }, watch: { search: function () { this.search.length > 0 && (this.onSearch(this.search, this.toggleLoading), this.$emit(\"search\", this.search, this.toggleLoading)) }, loading: function (t) { this.mutableLoading = t } }, methods: { toggleLoading: function () { var t = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : null; return null == t ? this.mutableLoading = !this.mutableLoading : this.mutableLoading = t } } } }, function (t, e) { \"use strict\"; t.exports = { watch: { typeAheadPointer: function () { this.maybeAdjustScroll() } }, methods: { maybeAdjustScroll: function () { var t = this.pixelsToPointerTop(), e = this.pixelsToPointerBottom(); return t <= this.viewport().top ? this.scrollTo(t) : e >= this.viewport().bottom ? this.scrollTo(this.viewport().top + this.pointerHeight()) : void 0 }, pixelsToPointerTop: function t() { var t = 0; if (this.$refs.dropdownMenu) for (var e = 0; e < this.typeAheadPointer; e++)t += this.$refs.dropdownMenu.children[e].offsetHeight; return t }, pixelsToPointerBottom: function () { return this.pixelsToPointerTop() + this.pointerHeight() }, pointerHeight: function () { var t = !!this.$refs.dropdownMenu && this.$refs.dropdownMenu.children[this.typeAheadPointer]; return t ? t.offsetHeight : 0 }, viewport: function () { return { top: this.$refs.dropdownMenu ? this.$refs.dropdownMenu.scrollTop : 0, bottom: this.$refs.dropdownMenu ? this.$refs.dropdownMenu.offsetHeight + this.$refs.dropdownMenu.scrollTop : 0 } }, scrollTo: function (t) { return this.$refs.dropdownMenu ? this.$refs.dropdownMenu.scrollTop = t : null } } } }, function (t, e) { \"use strict\"; t.exports = { data: function () { return { typeAheadPointer: -1 } }, watch: { filteredOptions: function () { this.typeAheadPointer = 0 } }, methods: { typeAheadUp: function () { this.typeAheadPointer > 0 && (this.typeAheadPointer-- , this.maybeAdjustScroll && this.maybeAdjustScroll()) }, typeAheadDown: function () { this.typeAheadPointer < this.filteredOptions.length - 1 && (this.typeAheadPointer++ , this.maybeAdjustScroll && this.maybeAdjustScroll()) }, typeAheadSelect: function () { this.filteredOptions[this.typeAheadPointer] ? this.select(this.filteredOptions[this.typeAheadPointer]) : this.taggable && this.search.length && this.select(this.search), this.clearSearchOnSelect && (this.search = \"\") } } } }, function (t, e) { var n = {}.toString; t.exports = function (t) { return n.call(t).slice(8, -1) } }, function (t, e, n) { var r = n(10), o = n(1).document, i = r(o) && r(o.createElement); t.exports = function (t) { return i ? o.createElement(t) : {} } }, function (t, e, n) { t.exports = !n(2) && !n(9)(function () { return 7 != Object.defineProperty(n(32)(\"div\"), \"a\", { get: function () { return 7 } }).a }) }, function (t, e, n) { \"use strict\"; var r = n(19), o = n(12), i = n(39), a = n(6), s = n(3), u = n(18), l = n(61), c = n(21), f = n(67), p = n(8)(\"iterator\"), d = !([].keys && \"next\" in [].keys()), h = \"@@iterator\", b = \"keys\", v = \"values\", g = function () { return this }; t.exports = function (t, e, n, y, m, x, w) { l(n, e, y); var S, O, _, j = function (t) { if (!d && t in A) return A[t]; switch (t) { case b: return function () { return new n(this, t) }; case v: return function () { return new n(this, t) } }return function () { return new n(this, t) } }, k = e + \" Iterator\", P = m == v, C = !1, A = t.prototype, M = A[p] || A[h] || m && A[m], L = M || j(m), T = m ? P ? j(\"entries\") : L : void 0, E = \"Array\" == e ? A.entries || M : M; if (E && (_ = f(E.call(new t)), _ !== Object.prototype && _.next && (c(_, k, !0), r || s(_, p) || a(_, p, g))), P && M && M.name !== v && (C = !0, L = function () { return M.call(this) }), r && !w || !d && !C && A[p] || a(A, p, L), u[e] = L, u[k] = g, m) if (S = { values: P ? L : j(v), keys: x ? L : j(b), entries: T }, w) for (O in S) O in A || i(A, O, S[O]); else o(o.P + o.F * (d || C), e, S); return S } }, function (t, e, n) { var r = n(11), o = n(64), i = n(17), a = n(22)(\"IE_PROTO\"), s = function () { }, u = \"prototype\", l = function () { var t, e = n(32)(\"iframe\"), r = i.length, o = \"<\", a = \">\"; for (e.style.display = \"none\", n(58).appendChild(e), e.src = \"javascript:\", t = e.contentWindow.document, t.open(), t.write(o + \"script\" + a + \"document.F=Object\" + o + \"/script\" + a), t.close(), l = t.F; r--;)delete l[u][i[r]]; return l() }; t.exports = Object.create || function (t, e) { var n; return null !== t ? (s[u] = r(t), n = new s, s[u] = null, n[a] = t) : n = l(), void 0 === e ? n : o(n, e) } }, function (t, e, n) { var r = n(38), o = n(17).concat(\"length\", \"prototype\"); e.f = Object.getOwnPropertyNames || function (t) { return r(t, o) } }, function (t, e) { e.f = Object.getOwnPropertySymbols }, function (t, e, n) { var r = n(3), o = n(7), i = n(55)(!1), a = n(22)(\"IE_PROTO\"); t.exports = function (t, e) { var n, s = o(t), u = 0, l = []; for (n in s) n != a && r(s, n) && l.push(n); for (; e.length > u;)r(s, n = e[u++]) && (~i(l, n) || l.push(n)); return l } }, function (t, e, n) { t.exports = n(6) }, function (t, e, n) { var r = n(16); t.exports = function (t) { return Object(r(t)) } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }); var o = n(44), i = r(o), a = n(47), s = r(a), u = n(48), l = r(u), c = n(29), f = r(c), p = n(30), d = r(p), h = n(28), b = r(h); e.default = { mixins: [f.default, d.default, b.default], props: { value: { default: null }, options: { type: Array, default: function () { return [] } }, disabled: { type: Boolean, default: !1 }, maxHeight: { type: String, default: \"400px\" }, searchable: { type: Boolean, default: !0 }, multiple: { type: Boolean, default: !1 }, placeholder: { type: String, default: \"\" }, transition: { type: String, default: \"fade\" }, clearSearchOnSelect: { type: Boolean, default: !0 }, closeOnSelect: { type: Boolean, default: !0 }, label: { type: String, default: \"label\" }, getOptionLabel: { type: Function, default: function (t) { return \"object\" === (\"undefined\" == typeof t ? \"undefined\" : (0, l.default)(t)) && this.label && t[this.label] ? t[this.label] : t } }, onChange: { type: Function, default: function (t) { this.$emit(\"input\", t) } }, taggable: { type: Boolean, default: !1 }, tabindex: { type: Number, default: null }, pushTags: { type: Boolean, default: !1 }, filterable: { type: Boolean, default: !0 }, createOption: { type: Function, default: function (t) { return \"object\" === (0, l.default)(this.mutableOptions[0]) && (t = (0, s.default)({}, this.label, t)), this.$emit(\"option:created\", t), t } }, resetOnOptionsChange: { type: Boolean, default: !1 }, noDrop: { type: Boolean, default: !1 }, inputId: { type: String }, dir: { type: String, default: \"auto\" } }, data: function () { return { search: \"\", open: !1, mutableValue: null, mutableOptions: [] } }, watch: { value: function (t) { this.mutableValue = t }, mutableValue: function (t, e) { this.multiple ? this.onChange ? this.onChange(t) : null : this.onChange && t !== e ? this.onChange(t) : null }, options: function (t) { this.mutableOptions = t }, mutableOptions: function () { !this.taggable && this.resetOnOptionsChange && (this.mutableValue = this.multiple ? [] : null) }, multiple: function (t) { this.mutableValue = t ? [] : null } }, created: function () { this.mutableValue = this.value, this.mutableOptions = this.options.slice(0), this.mutableLoading = this.loading, this.$on(\"option:created\", this.maybePushTag) }, methods: { select: function (t) { this.isOptionSelected(t) ? this.deselect(t) : (this.taggable && !this.optionExists(t) && (t = this.createOption(t)), this.multiple && !this.mutableValue ? this.mutableValue = [t] : this.multiple ? this.mutableValue.push(t) : this.mutableValue = t), this.onAfterSelect(t) }, deselect: function (t) { var e = this; if (this.multiple) { var n = -1; this.mutableValue.forEach(function (r) { (r === t || \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t[e.label]) && (n = r) }); var r = this.mutableValue.indexOf(n); this.mutableValue.splice(r, 1) } else this.mutableValue = null }, clearSelection: function () { this.mutableValue = this.multiple ? [] : null }, onAfterSelect: function (t) { this.closeOnSelect && (this.open = !this.open, this.$refs.search.blur()), this.clearSearchOnSelect && (this.search = \"\") }, toggleDropdown: function (t) { t.target !== this.$refs.openIndicator && t.target !== this.$refs.search && t.target !== this.$refs.toggle && t.target !== this.$el || (this.open ? this.$refs.search.blur() : this.disabled || (this.open = !0, this.$refs.search.focus())) }, isOptionSelected: function (t) { var e = this; if (this.multiple && this.mutableValue) { var n = !1; return this.mutableValue.forEach(function (r) { \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t[e.label] ? n = !0 : \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t ? n = !0 : r === t && (n = !0) }), n } return this.mutableValue === t }, onEscape: function () { this.search.length ? this.search = \"\" : this.$refs.search.blur() }, onSearchBlur: function () { this.clearSearchOnBlur && (this.search = \"\"), this.open = !1, this.$emit(\"search:blur\") }, onSearchFocus: function () { this.open = !0, this.$emit(\"search:focus\") }, maybeDeleteValue: function () { if (!this.$refs.search.value.length && this.mutableValue) return this.multiple ? this.mutableValue.pop() : this.mutableValue = null }, optionExists: function (t) { var e = this, n = !1; return this.mutableOptions.forEach(function (r) { \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t ? n = !0 : r === t && (n = !0) }), n }, maybePushTag: function (t) { this.pushTags && this.mutableOptions.push(t) } }, computed: { dropdownClasses: function () { return { open: this.dropdownOpen, single: !this.multiple, searching: this.searching, searchable: this.searchable, unsearchable: !this.searchable, loading: this.mutableLoading, rtl: \"rtl\" === this.dir, disabled: this.disabled } }, clearSearchOnBlur: function () { return this.clearSearchOnSelect && !this.multiple }, searching: function () { return !!this.search }, dropdownOpen: function () { return !this.noDrop && (this.open && !this.mutableLoading) }, searchPlaceholder: function () { if (this.isValueEmpty && this.placeholder) return this.placeholder }, filteredOptions: function () { var t = this; if (!this.filterable && !this.taggable) return this.mutableOptions.slice(); var e = this.mutableOptions.filter(function (e) { return \"object\" === (\"undefined\" == typeof e ? \"undefined\" : (0, l.default)(e)) && e.hasOwnProperty(t.label) ? e[t.label].toLowerCase().indexOf(t.search.toLowerCase()) > -1 : \"object\" !== (\"undefined\" == typeof e ? \"undefined\" : (0, l.default)(e)) || e.hasOwnProperty(t.label) ? e.toLowerCase().indexOf(t.search.toLowerCase()) > -1 : console.warn('[vue-select warn]: Label key \"option.' + t.label + '\" does not exist in options object.\\nhttp://sagalbot.github.io/vue-select/#ex-labels') }); return this.taggable && this.search.length && !this.optionExists(this.search) && e.unshift(this.search), e }, isValueEmpty: function () { return !this.mutableValue || (\"object\" === (0, l.default)(this.mutableValue) ? !(0, i.default)(this.mutableValue).length : !this.mutableValue.length) }, valueAsArray: function () { return this.multiple ? this.mutableValue : this.mutableValue ? [this.mutableValue] : [] }, showClearButton: function () { return !this.multiple && !this.open && null != this.mutableValue } } } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }); var o = n(28), i = r(o), a = n(30), s = r(a), u = n(29), l = r(u); e.default = { ajax: i.default, pointer: s.default, pointerScroll: l.default } }, function (t, e, n) { t.exports = { default: n(49), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(50), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(51), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(52), __esModule: !0 } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } e.__esModule = !0; var o = n(43), i = r(o); e.default = function (t, e, n) { return e in t ? (0, i.default)(t, e, { value: n, enumerable: !0, configurable: !0, writable: !0 }) : t[e] = n, t } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } e.__esModule = !0; var o = n(46), i = r(o), a = n(45), s = r(a), u = \"function\" == typeof s.default && \"symbol\" == typeof i.default ? function (t) { return typeof t } : function (t) { return t && \"function\" == typeof s.default && t.constructor === s.default && t !== s.default.prototype ? \"symbol\" : typeof t }; e.default = \"function\" == typeof s.default && \"symbol\" === u(i.default) ? function (t) { return \"undefined\" == typeof t ? \"undefined\" : u(t) } : function (t) { return t && \"function\" == typeof s.default && t.constructor === s.default && t !== s.default.prototype ? \"symbol\" : \"undefined\" == typeof t ? \"undefined\" : u(t) } }, function (t, e, n) { n(73); var r = n(5).Object; t.exports = function (t, e, n) { return r.defineProperty(t, e, n) } }, function (t, e, n) { n(74), t.exports = n(5).Object.keys }, function (t, e, n) { n(77), n(75), n(78), n(79), t.exports = n(5).Symbol }, function (t, e, n) { n(76), n(80), t.exports = n(27).f(\"iterator\") }, function (t, e) { t.exports = function (t) { if (\"function\" != typeof t) throw TypeError(t + \" is not a function!\"); return t } }, function (t, e) { t.exports = function () { } }, function (t, e, n) { var r = n(7), o = n(71), i = n(70); t.exports = function (t) { return function (e, n, a) { var s, u = r(e), l = o(u.length), c = i(a, l); if (t && n != n) { for (; l > c;)if (s = u[c++], s != s) return !0 } else for (; l > c; c++)if ((t || c in u) && u[c] === n) return t || c || 0; return !t && -1 } } }, function (t, e, n) { var r = n(53); t.exports = function (t, e, n) { if (r(t), void 0 === e) return t; switch (n) { case 1: return function (n) { return t.call(e, n) }; case 2: return function (n, r) { return t.call(e, n, r) }; case 3: return function (n, r, o) { return t.call(e, n, r, o) } }return function () { return t.apply(e, arguments) } } }, function (t, e, n) { var r = n(13), o = n(37), i = n(20); t.exports = function (t) { var e = r(t), n = o.f; if (n) for (var a, s = n(t), u = i.f, l = 0; s.length > l;)u.call(t, a = s[l++]) && e.push(a); return e } }, function (t, e, n) { var r = n(1).document; t.exports = r && r.documentElement }, function (t, e, n) { var r = n(31); t.exports = Object(\"z\").propertyIsEnumerable(0) ? Object : function (t) { return \"String\" == r(t) ? t.split(\"\") : Object(t) } }, function (t, e, n) { var r = n(31); t.exports = Array.isArray || function (t) { return \"Array\" == r(t) } }, function (t, e, n) { \"use strict\"; var r = n(35), o = n(14), i = n(21), a = {}; n(6)(a, n(8)(\"iterator\"), function () { return this }), t.exports = function (t, e, n) { t.prototype = r(a, { next: o(1, n) }), i(t, e + \" Iterator\") } }, function (t, e) { t.exports = function (t, e) { return { value: e, done: !!t } } }, function (t, e, n) { var r = n(15)(\"meta\"), o = n(10), i = n(3), a = n(4).f, s = 0, u = Object.isExtensible || function () { return !0 }, l = !n(9)(function () { return u(Object.preventExtensions({})) }), c = function (t) { a(t, r, { value: { i: \"O\" + ++s, w: {} } }) }, f = function (t, e) { if (!o(t)) return \"symbol\" == typeof t ? t : (\"string\" == typeof t ? \"S\" : \"P\") + t; if (!i(t, r)) { if (!u(t)) return \"F\"; if (!e) return \"E\"; c(t) } return t[r].i }, p = function (t, e) { if (!i(t, r)) { if (!u(t)) return !0; if (!e) return !1; c(t) } return t[r].w }, d = function (t) { return l && h.NEED && u(t) && !i(t, r) && c(t), t }, h = t.exports = { KEY: r, NEED: !1, fastKey: f, getWeak: p, onFreeze: d } }, function (t, e, n) { var r = n(4), o = n(11), i = n(13); t.exports = n(2) ? Object.defineProperties : function (t, e) { o(t); for (var n, a = i(e), s = a.length, u = 0; s > u;)r.f(t, n = a[u++], e[n]); return t } }, function (t, e, n) { var r = n(20), o = n(14), i = n(7), a = n(25), s = n(3), u = n(33), l = Object.getOwnPropertyDescriptor; e.f = n(2) ? l : function (t, e) { if (t = i(t), e = a(e, !0), u) try { return l(t, e) } catch (t) { } if (s(t, e)) return o(!r.f.call(t, e), t[e]) } }, function (t, e, n) { var r = n(7), o = n(36).f, i = {}.toString, a = \"object\" == typeof window && window && Object.getOwnPropertyNames ? Object.getOwnPropertyNames(window) : [], s = function (t) { try { return o(t) } catch (t) { return a.slice() } }; t.exports.f = function (t) { return a && \"[object Window]\" == i.call(t) ? s(t) : o(r(t)) } }, function (t, e, n) { var r = n(3), o = n(40), i = n(22)(\"IE_PROTO\"), a = Object.prototype; t.exports = Object.getPrototypeOf || function (t) { return t = o(t), r(t, i) ? t[i] : \"function\" == typeof t.constructor && t instanceof t.constructor ? t.constructor.prototype : t instanceof Object ? a : null } }, function (t, e, n) { var r = n(12), o = n(5), i = n(9); t.exports = function (t, e) { var n = (o.Object || {})[t] || Object[t], a = {}; a[t] = e(n), r(r.S + r.F * i(function () { n(1) }), \"Object\", a) } }, function (t, e, n) { var r = n(24), o = n(16); t.exports = function (t) { return function (e, n) { var i, a, s = String(o(e)), u = r(n), l = s.length; return u < 0 || u >= l ? t ? \"\" : void 0 : (i = s.charCodeAt(u), i < 55296 || i > 56319 || u + 1 === l || (a = s.charCodeAt(u + 1)) < 56320 || a > 57343 ? t ? s.charAt(u) : i : t ? s.slice(u, u + 2) : (i - 55296 << 10) + (a - 56320) + 65536) } } }, function (t, e, n) { var r = n(24), o = Math.max, i = Math.min; t.exports = function (t, e) { return t = r(t), t < 0 ? o(t + e, 0) : i(t, e) } }, function (t, e, n) { var r = n(24), o = Math.min; t.exports = function (t) { return t > 0 ? o(r(t), 9007199254740991) : 0 } }, function (t, e, n) { \"use strict\"; var r = n(54), o = n(62), i = n(18), a = n(7); t.exports = n(34)(Array, \"Array\", function (t, e) { this._t = a(t), this._i = 0, this._k = e }, function () { var t = this._t, e = this._k, n = this._i++; return !t || n >= t.length ? (this._t = void 0, o(1)) : \"keys\" == e ? o(0, n) : \"values\" == e ? o(0, t[n]) : o(0, [n, t[n]]) }, \"values\"), i.Arguments = i.Array, r(\"keys\"), r(\"values\"), r(\"entries\") }, function (t, e, n) { var r = n(12); r(r.S + r.F * !n(2), \"Object\", { defineProperty: n(4).f }) }, function (t, e, n) { var r = n(40), o = n(13); n(68)(\"keys\", function () { return function (t) { return o(r(t)) } }) }, function (t, e) { }, function (t, e, n) { \"use strict\"; var r = n(69)(!0); n(34)(String, \"String\", function (t) { this._t = String(t), this._i = 0 }, function () { var t, e = this._t, n = this._i; return n >= e.length ? { value: void 0, done: !0 } : (t = r(e, n), this._i += t.length, { value: t, done: !1 }) }) }, function (t, e, n) { \"use strict\"; var r = n(1), o = n(3), i = n(2), a = n(12), s = n(39), u = n(63).KEY, l = n(9), c = n(23), f = n(21), p = n(15), d = n(8), h = n(27), b = n(26), v = n(57), g = n(60), y = n(11), m = n(10), x = n(7), w = n(25), S = n(14), O = n(35), _ = n(66), j = n(65), k = n(4), P = n(13), C = j.f, A = k.f, M = _.f, L = r.Symbol, T = r.JSON, E = T && T.stringify, V = \"prototype\", B = d(\"_hidden\"), F = d(\"toPrimitive\"), $ = {}.propertyIsEnumerable, N = c(\"symbol-registry\"), D = c(\"symbols\"), I = c(\"op-symbols\"), R = Object[V], z = \"function\" == typeof L, H = r.QObject, G = !H || !H[V] || !H[V].findChild, U = i && l(function () { return 7 != O(A({}, \"a\", { get: function () { return A(this, \"a\", { value: 7 }).a } })).a }) ? function (t, e, n) { var r = C(R, e); r && delete R[e], A(t, e, n), r && t !== R && A(R, e, r) } : A, W = function (t) { var e = D[t] = O(L[V]); return e._k = t, e }, J = z && \"symbol\" == typeof L.iterator ? function (t) { return \"symbol\" == typeof t } : function (t) { return t instanceof L }, K = function (t, e, n) { return t === R && K(I, e, n), y(t), e = w(e, !0), y(n), o(D, e) ? (n.enumerable ? (o(t, B) && t[B][e] && (t[B][e] = !1), n = O(n, { enumerable: S(0, !1) })) : (o(t, B) || A(t, B, S(1, {})), t[B][e] = !0), U(t, e, n)) : A(t, e, n) }, Y = function (t, e) { y(t); for (var n, r = v(e = x(e)), o = 0, i = r.length; i > o;)K(t, n = r[o++], e[n]); return t }, q = function (t, e) { return void 0 === e ? O(t) : Y(O(t), e) }, Q = function (t) { var e = $.call(this, t = w(t, !0)); return !(this === R && o(D, t) && !o(I, t)) && (!(e || !o(this, t) || !o(D, t) || o(this, B) && this[B][t]) || e) }, Z = function (t, e) { if (t = x(t), e = w(e, !0), t !== R || !o(D, e) || o(I, e)) { var n = C(t, e); return !n || !o(D, e) || o(t, B) && t[B][e] || (n.enumerable = !0), n } }, X = function (t) { for (var e, n = M(x(t)), r = [], i = 0; n.length > i;)o(D, e = n[i++]) || e == B || e == u || r.push(e); return r }, tt = function (t) { for (var e, n = t === R, r = M(n ? I : x(t)), i = [], a = 0; r.length > a;)!o(D, e = r[a++]) || n && !o(R, e) || i.push(D[e]); return i }; z || (L = function () { if (this instanceof L) throw TypeError(\"Symbol is not a constructor!\"); var t = p(arguments.length > 0 ? arguments[0] : void 0), e = function (n) { this === R && e.call(I, n), o(this, B) && o(this[B], t) && (this[B][t] = !1), U(this, t, S(1, n)) }; return i && G && U(R, t, { configurable: !0, set: e }), W(t) }, s(L[V], \"toString\", function () { return this._k }), j.f = Z, k.f = K, n(36).f = _.f = X, n(20).f = Q, n(37).f = tt, i && !n(19) && s(R, \"propertyIsEnumerable\", Q, !0), h.f = function (t) { return W(d(t)) }), a(a.G + a.W + a.F * !z, { Symbol: L }); for (var et = \"hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables\".split(\",\"), nt = 0; et.length > nt;)d(et[nt++]); for (var rt = P(d.store), ot = 0; rt.length > ot;)b(rt[ot++]); a(a.S + a.F * !z, \"Symbol\", { for: function (t) { return o(N, t += \"\") ? N[t] : N[t] = L(t) }, keyFor: function (t) { if (!J(t)) throw TypeError(t + \" is not a symbol!\"); for (var e in N) if (N[e] === t) return e }, useSetter: function () { G = !0 }, useSimple: function () { G = !1 } }), a(a.S + a.F * !z, \"Object\", { create: q, defineProperty: K, defineProperties: Y, getOwnPropertyDescriptor: Z, getOwnPropertyNames: X, getOwnPropertySymbols: tt }), T && a(a.S + a.F * (!z || l(function () { var t = L(); return \"[null]\" != E([t]) || \"{}\" != E({ a: t }) || \"{}\" != E(Object(t)) })), \"JSON\", { stringify: function (t) { for (var e, n, r = [t], o = 1; arguments.length > o;)r.push(arguments[o++]); if (n = e = r[1], (m(e) || void 0 !== t) && !J(t)) return g(e) || (e = function (t, e) { if (n && (e = n.call(this, t, e)), !J(e)) return e }), r[1] = e, E.apply(T, r) } }), L[V][F] || n(6)(L[V], F, L[V].valueOf), f(L, \"Symbol\"), f(Math, \"Math\", !0), f(r.JSON, \"JSON\", !0) }, function (t, e, n) { n(26)(\"asyncIterator\") }, function (t, e, n) { n(26)(\"observable\") }, function (t, e, n) { n(72); for (var r = n(1), o = n(6), i = n(18), a = n(8)(\"toStringTag\"), s = \"CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,MediaList,MimeTypeArray,NamedNodeMap,NodeList,PaintRequestList,Plugin,PluginArray,SVGLengthList,SVGNumberList,SVGPathSegList,SVGPointList,SVGStringList,SVGTransformList,SourceBufferList,StyleSheetList,TextTrackCueList,TextTrackList,TouchList\".split(\",\"), u = 0; u < s.length; u++) { var l = s[u], c = r[l], f = c && c.prototype; f && !f[a] && o(f, a, l), i[l] = i.Array } }, function (t, e, n) { e = t.exports = n(82)(), e.push([t.id, '.v-select{position:relative;font-family:sans-serif}.v-select,.v-select *{box-sizing:border-box}.v-select.rtl .open-indicator{left:10px;right:auto}.v-select.rtl .selected-tag{float:right;margin-right:3px;margin-left:1px}.v-select.rtl .dropdown-menu{text-align:right}.v-select.rtl .dropdown-toggle .clear{left:30px;right:auto}.v-select .open-indicator{position:absolute;bottom:6px;right:10px;cursor:pointer;pointer-events:all;opacity:1;height:20px}.v-select .open-indicator,.v-select .open-indicator:before{display:inline-block;transition:all .15s cubic-bezier(1,-.115,.975,.855);transition-timing-function:cubic-bezier(1,-.115,.975,.855);width:10px}.v-select .open-indicator:before{border-color:rgba(60,60,60,.5);border-style:solid;border-width:3px 3px 0 0;content:\"\";height:10px;vertical-align:top;transform:rotate(133deg);box-sizing:inherit}.v-select.open .open-indicator:before{transform:rotate(315deg)}.v-select.loading .open-indicator{opacity:0}.v-select.open .open-indicator{bottom:1px}.v-select .dropdown-toggle{-webkit-appearance:none;-moz-appearance:none;appearance:none;display:block;padding:0;background:none;border:1px solid rgba(60,60,60,.26);border-radius:4px;white-space:normal}.v-select .dropdown-toggle:after{visibility:hidden;display:block;font-size:0;content:\" \";clear:both;height:0}.v-select .dropdown-toggle .clear{position:absolute;bottom:9px;right:30px;font-size:23px;font-weight:700;line-height:1;color:rgba(60,60,60,.5);padding:0;border:0;background-color:transparent;cursor:pointer}.v-select.searchable .dropdown-toggle{cursor:text}.v-select.unsearchable .dropdown-toggle{cursor:pointer}.v-select.open .dropdown-toggle{border-bottom-color:transparent;border-bottom-left-radius:0;border-bottom-right-radius:0}.v-select .dropdown-menu{display:block;position:absolute;top:100%;left:0;z-index:1000;min-width:160px;padding:5px 0;margin:0;width:100%;overflow-y:scroll;border:1px solid rgba(0,0,0,.26);box-shadow:0 3px 6px 0 rgba(0,0,0,.15);border-top:none;border-radius:0 0 4px 4px;text-align:left;list-style:none;background:#fff}.v-select .no-options{text-align:center}.v-select .selected-tag{color:#333;background-color:#f0f0f0;border:1px solid #ccc;border-radius:4px;height:26px;margin:4px 1px 0 3px;padding:1px .25em;float:left;line-height:24px}.v-select.single .selected-tag{background-color:transparent;border-color:transparent}.v-select.single.open .selected-tag{position:absolute;opacity:.5}.v-select.single.loading .selected-tag,.v-select.single.open.searching .selected-tag{display:none}.v-select .selected-tag .close{float:none;margin-right:0;font-size:20px;appearance:none;padding:0;cursor:pointer;background:0 0;border:0;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2}.v-select.single.searching:not(.open):not(.loading) input[type=search]{opacity:.2}.v-select input[type=search]::-webkit-search-cancel-button,.v-select input[type=search]::-webkit-search-decoration,.v-select input[type=search]::-webkit-search-results-button,.v-select input[type=search]::-webkit-search-results-decoration{display:none}.v-select input[type=search]::-ms-clear{display:none}.v-select input[type=search],.v-select input[type=search]:focus{appearance:none;-webkit-appearance:none;-moz-appearance:none;line-height:1.42857143;font-size:1em;height:34px;display:inline-block;border:none;outline:none;margin:0;padding:0 .5em;width:10em;max-width:100%;background:none;position:relative;box-shadow:none}.v-select.unsearchable input[type=search]{opacity:0}.v-select.unsearchable input[type=search]:hover{cursor:pointer}.v-select li{line-height:1.42857143}.v-select li>a{display:block;padding:3px 20px;clear:both;color:#333;white-space:nowrap}.v-select li:hover{cursor:pointer}.v-select .dropdown-menu .active>a{color:#333;background:rgba(50,50,50,.1)}.v-select .dropdown-menu>.highlight>a{background:#5897fb;color:#fff}.v-select .highlight:not(:last-child){margin-bottom:0}.v-select .spinner{opacity:0;position:absolute;top:5px;right:10px;font-size:5px;text-indent:-9999em;overflow:hidden;border-top:.9em solid hsla(0,0%,39%,.1);border-right:.9em solid hsla(0,0%,39%,.1);border-bottom:.9em solid hsla(0,0%,39%,.1);border-left:.9em solid rgba(60,60,60,.45);transform:translateZ(0);animation:vSelectSpinner 1.1s infinite linear;transition:opacity .1s}.v-select .spinner,.v-select .spinner:after{border-radius:50%;width:5em;height:5em}.v-select.disabled .dropdown-toggle,.v-select.disabled .dropdown-toggle .clear,.v-select.disabled .dropdown-toggle input,.v-select.disabled .open-indicator,.v-select.disabled .selected-tag .close{cursor:not-allowed;background-color:#f8f8f8}.v-select.loading .spinner{opacity:1}@-webkit-keyframes vSelectSpinner{0%{transform:rotate(0deg)}to{transform:rotate(1turn)}}@keyframes vSelectSpinner{0%{transform:rotate(0deg)}to{transform:rotate(1turn)}}.fade-enter-active,.fade-leave-active{transition:opacity .15s cubic-bezier(1,.5,.8,1)}.fade-enter,.fade-leave-to{opacity:0}', \"\"]) }, function (t, e) { t.exports = function () { var t = []; return t.toString = function () { for (var t = [], e = 0; e < this.length; e++) { var n = this[e]; n[2] ? t.push(\"@media \" + n[2] + \"{\" + n[1] + \"}\") : t.push(n[1]) } return t.join(\"\") }, t.i = function (e, n) { \"string\" == typeof e && (e = [[null, e, \"\"]]); for (var r = {}, o = 0; o < this.length; o++) { var i = this[o][0]; \"number\" == typeof i && (r[i] = !0) } for (o = 0; o < e.length; o++) { var a = e[o]; \"number\" == typeof a[0] && r[a[0]] || (n && !a[2] ? a[2] = n : n && (a[2] = \"(\" + a[2] + \") and (\" + n + \")\"), t.push(a)) } }, t } }, function (t, e, n) { n(87); var r = n(84)(n(41), n(85), null, null); t.exports = r.exports }, function (t, e) { t.exports = function (t, e, n, r) { var o, i = t = t || {}, a = typeof t.default; \"object\" !== a && \"function\" !== a || (o = t, i = t.default); var s = \"function\" == typeof i ? i.options : i; if (e && (s.render = e.render, s.staticRenderFns = e.staticRenderFns), n && (s._scopeId = n), r) { var u = s.computed || (s.computed = {}); Object.keys(r).forEach(function (t) { var e = r[t]; u[t] = function () { return e } }) } return { esModule: o, exports: i, options: s } } }, function (t, e) {\r\n t.exports = {\r\n render: function () {\r\n var t = this, e = t.$createElement, n = t._self._c || e; return n(\"div\", { staticClass: \"dropdown v-select\", class: t.dropdownClasses, attrs: { dir: t.dir } }, [n(\"div\", { ref: \"toggle\", class: [\"dropdown-toggle\", \"clearfix\"], on: { mousedown: function (e) { e.preventDefault(), t.toggleDropdown(e) } } }, [t._l(t.valueAsArray, function (e) { return n(\"span\", { key: e.index, staticClass: \"selected-tag\" }, [t._t(\"selected-option\", [t._v(\"\\n \" + t._s(t.getOptionLabel(e)) + \"\\n \")], null, e), t._v(\" \"), t.multiple ? n(\"button\", { staticClass: \"close\", attrs: { disabled: t.disabled, type: \"button\", \"aria-label\": \"Remove option\" }, on: { click: function (n) { t.deselect(e) } } }, [n(\"span\", { attrs: { \"aria-hidden\": \"true\" } }, [t._v(\"×\")])]) : t._e()], 2) }), t._v(\" \"), n(\"input\", {\r\n directives: [{ name: \"model\", rawName: \"v-model\", value: t.search, expression: \"search\" }], ref: \"search\", staticClass: \"form-control\", style: { width: t.isValueEmpty ? \"100%\" : \"auto\" }, attrs: { type: \"search\", autocomplete: \"false\", disabled: t.disabled, placeholder: t.searchPlaceholder, tabindex: t.tabindex, readonly: !t.searchable, id: t.inputId, \"aria-label\": \"Search for option\" }, domProps: { value: t.search }, on: {\r\n keydown: [function (e) { return \"button\" in e || !t._k(e.keyCode, \"delete\", [8, 46], e.key) ? void t.maybeDeleteValue(e) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"up\", 38, e.key) ? (e.preventDefault(), void t.typeAheadUp(e)) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"down\", 40, e.key) ? (e.preventDefault(), void t.typeAheadDown(e)) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"enter\", 13, e.key) ? (e.preventDefault(), void t.typeAheadSelect(e)) : null }], keyup: function (e) { return \"button\" in e || !t._k(e.keyCode, \"esc\", 27, e.key) ? void t.onEscape(e) : null }, blur: t.onSearchBlur, focus: t.onSearchFocus, input: function (e) {\r\n e.target.composing || (t.search = e.target.value)\r\n }\r\n }\r\n }), t._v(\" \"), n(\"button\", { directives: [{ name: \"show\", rawName: \"v-show\", value: t.showClearButton, expression: \"showClearButton\" }], staticClass: \"clear\", attrs: { disabled: t.disabled, type: \"button\", title: \"Clear selection\" }, on: { click: t.clearSelection } }, [n(\"span\", { attrs: { \"aria-hidden\": \"true\" } }, [t._v(\"×\")])]), t._v(\" \"), t.noDrop ? t._e() : n(\"i\", { ref: \"openIndicator\", staticClass: \"open-indicator\", attrs: { role: \"presentation\" } }), t._v(\" \"), t._t(\"spinner\", [n(\"div\", { directives: [{ name: \"show\", rawName: \"v-show\", value: t.mutableLoading, expression: \"mutableLoading\" }], staticClass: \"spinner\" }, [t._v(\"Loading...\")])])], 2), t._v(\" \"), n(\"transition\", { attrs: { name: t.transition } }, [t.dropdownOpen ? n(\"ul\", { ref: \"dropdownMenu\", staticClass: \"dropdown-menu\", style: { \"max-height\": t.maxHeight } }, [t._l(t.filteredOptions, function (e, r) { return n(\"li\", { key: r, class: { active: t.isOptionSelected(e), highlight: r === t.typeAheadPointer }, on: { mouseover: function (e) { t.typeAheadPointer = r } } }, [n(\"a\", { on: { mousedown: function (n) { n.preventDefault(), t.select(e) } } }, [t._t(\"option\", [t._v(\"\\n \" + t._s(t.getOptionLabel(e)) + \"\\n \")], null, e)], 2)]) }), t._v(\" \"), t.filteredOptions.length ? t._e() : n(\"li\", { staticClass: \"no-options\" }, [t._t(\"no-options\", [t._v(\"Sorry, no matching options.\")])], 2)], 2) : t._e()])], 1)\r\n }, staticRenderFns: []\r\n }\r\n }, function (t, e, n) { function r(t, e) { for (var n = 0; n < t.length; n++) { var r = t[n], o = f[r.id]; if (o) { o.refs++; for (var i = 0; i < o.parts.length; i++)o.parts[i](r.parts[i]); for (; i < r.parts.length; i++)o.parts.push(u(r.parts[i], e)) } else { for (var a = [], i = 0; i < r.parts.length; i++)a.push(u(r.parts[i], e)); f[r.id] = { id: r.id, refs: 1, parts: a } } } } function o(t) { for (var e = [], n = {}, r = 0; r < t.length; r++) { var o = t[r], i = o[0], a = o[1], s = o[2], u = o[3], l = { css: a, media: s, sourceMap: u }; n[i] ? n[i].parts.push(l) : e.push(n[i] = { id: i, parts: [l] }) } return e } function i(t, e) { var n = h(), r = g[g.length - 1]; if (\"top\" === t.insertAt) r ? r.nextSibling ? n.insertBefore(e, r.nextSibling) : n.appendChild(e) : n.insertBefore(e, n.firstChild), g.push(e); else { if (\"bottom\" !== t.insertAt) throw new Error(\"Invalid value for parameter 'insertAt'. Must be 'top' or 'bottom'.\"); n.appendChild(e) } } function a(t) { t.parentNode.removeChild(t); var e = g.indexOf(t); e >= 0 && g.splice(e, 1) } function s(t) { var e = document.createElement(\"style\"); return e.type = \"text/css\", i(t, e), e } function u(t, e) { var n, r, o; if (e.singleton) { var i = v++; n = b || (b = s(e)), r = l.bind(null, n, i, !1), o = l.bind(null, n, i, !0) } else n = s(e), r = c.bind(null, n), o = function () { a(n) }; return r(t), function (e) { if (e) { if (e.css === t.css && e.media === t.media && e.sourceMap === t.sourceMap) return; r(t = e) } else o() } } function l(t, e, n, r) { var o = n ? \"\" : r.css; if (t.styleSheet) t.styleSheet.cssText = y(e, o); else { var i = document.createTextNode(o), a = t.childNodes; a[e] && t.removeChild(a[e]), a.length ? t.insertBefore(i, a[e]) : t.appendChild(i) } } function c(t, e) { var n = e.css, r = e.media, o = e.sourceMap; if (r && t.setAttribute(\"media\", r), o && (n += \"\\n/*# sourceURL=\" + o.sources[0] + \" */\", n += \"\\n/*# sourceMappingURL=data:application/json;base64,\" + btoa(unescape(encodeURIComponent(JSON.stringify(o)))) + \" */\"), t.styleSheet) t.styleSheet.cssText = n; else { for (; t.firstChild;)t.removeChild(t.firstChild); t.appendChild(document.createTextNode(n)) } } var f = {}, p = function (t) { var e; return function () { return \"undefined\" == typeof e && (e = t.apply(this, arguments)), e } }, d = p(function () { return /msie [6-9]\\b/.test(window.navigator.userAgent.toLowerCase()) }), h = p(function () { return document.head || document.getElementsByTagName(\"head\")[0] }), b = null, v = 0, g = []; t.exports = function (t, e) { e = e || {}, \"undefined\" == typeof e.singleton && (e.singleton = d()), \"undefined\" == typeof e.insertAt && (e.insertAt = \"bottom\"); var n = o(t); return r(n, e), function (t) { for (var i = [], a = 0; a < n.length; a++) { var s = n[a], u = f[s.id]; u.refs-- , i.push(u) } if (t) { var l = o(t); r(l, e) } for (var a = 0; a < i.length; a++) { var u = i[a]; if (0 === u.refs) { for (var c = 0; c < u.parts.length; c++)u.parts[c](); delete f[u.id] } } } }; var y = function () { var t = []; return function (e, n) { return t[e] = n, t.filter(Boolean).join(\"\\n\") } }() }, function (t, e, n) { var r = n(81); \"string\" == typeof r && (r = [[t.id, r, \"\"]]); n(86)(r, {}); r.locals && (t.exports = r.locals) }])\r\n});\r\n//# sourceMappingURL=vue-select.js.map","import \"./header\"\r\nimport \"./lead-tool\"","$(window).scroll(function () {\r\n if ($(window).scrollTop() >= 20) {\r\n $('body').addClass('fixed-header');\r\n }\r\n else {\r\n $('body').removeClass('fixed-header');\r\n }\r\n});\r\n\r\n$(document).ready(function () {\r\n var isMobile = /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent);\r\n \r\n $(\"#menu-toggle\").click(function () {\r\n $(\"body\").toggleClass(\"open\");\r\n });\r\n\r\n $(\"[data-search-box-toggle]\").click(function() {\r\n $(\"[data-search-box-open]\").slideToggle(200);\r\n $(\"[data-search-box-toggle]\").toggleClass(\"open\");\r\n $(\"[data-search-box-open-input]\").focus();\r\n });\r\n\r\n if ($(\"body\").hasClass(\"page-type-search-page\") && !isMobile) {\r\n $(\"[data-search-box-open]\").slideToggle(0);\r\n $(\"[data-search-box-toggle]\").toggleClass(\"open\");\r\n }\r\n\r\n if (navigator.userAgent.indexOf('Edge') !== -1 && !isMobile) {\r\n $(\"[data-search-box-open-input]\").removeAttr(\"placeholder\"); // Removes the placeholder attribute when on Edge and not mobile, this is done to right align the input cursor, which is otherwise not possible in Edge with a placeholder active.\r\n }\r\n\r\n function setContentHeaderHeight() {\r\n $(\".contentheader-rich\").css('min-height', $(\".contentheader-rich-body\").outerHeight() + 50 + 'px');\r\n }\r\n\r\n if ($(\".contentheader-rich-body\").length != 0) {\r\n if ($(window).width() < 991 && $(\".contentheader-rich-body\").outerHeight() > 400) {\r\n setContentHeaderHeight();\r\n } else if ($(window).width() > 992 && $(window).width() < 1199 && $(\".contentheader-rich-body\").outerHeight() > 650) {\r\n setContentHeaderHeight();\r\n } else if ($(window).width() > 1200 && $(\".contentheader-rich-body\").outerHeight() > 650) {\r\n setContentHeaderHeight();\r\n }\r\n }\r\n});","export const HOOKS = [\n \"onChange\",\n \"onClose\",\n \"onDayCreate\",\n \"onDestroy\",\n \"onKeyDown\",\n \"onMonthChange\",\n \"onOpen\",\n \"onParseConfig\",\n \"onReady\",\n \"onValueUpdate\",\n \"onYearChange\",\n \"onPreCalendarPosition\",\n];\nexport const defaults = {\n _disable: [],\n allowInput: false,\n allowInvalidPreload: false,\n altFormat: \"F j, Y\",\n altInput: false,\n altInputClass: \"form-control input\",\n animate: typeof window === \"object\" &&\n window.navigator.userAgent.indexOf(\"MSIE\") === -1,\n ariaDateFormat: \"F j, Y\",\n autoFillDefaultTime: true,\n clickOpens: true,\n closeOnSelect: true,\n conjunction: \", \",\n dateFormat: \"Y-m-d\",\n defaultHour: 12,\n defaultMinute: 0,\n defaultSeconds: 0,\n disable: [],\n disableMobile: false,\n enableSeconds: false,\n enableTime: false,\n errorHandler: (err) => typeof console !== \"undefined\" && console.warn(err),\n getWeek: (givenDate) => {\n const date = new Date(givenDate.getTime());\n date.setHours(0, 0, 0, 0);\n date.setDate(date.getDate() + 3 - ((date.getDay() + 6) % 7));\n var week1 = new Date(date.getFullYear(), 0, 4);\n return (1 +\n Math.round(((date.getTime() - week1.getTime()) / 86400000 -\n 3 +\n ((week1.getDay() + 6) % 7)) /\n 7));\n },\n hourIncrement: 1,\n ignoredFocusElements: [],\n inline: false,\n locale: \"default\",\n minuteIncrement: 5,\n mode: \"single\",\n monthSelectorType: \"dropdown\",\n nextArrow: \"\",\n noCalendar: false,\n now: new Date(),\n onChange: [],\n onClose: [],\n onDayCreate: [],\n onDestroy: [],\n onKeyDown: [],\n onMonthChange: [],\n onOpen: [],\n onParseConfig: [],\n onReady: [],\n onValueUpdate: [],\n onYearChange: [],\n onPreCalendarPosition: [],\n plugins: [],\n position: \"auto\",\n positionElement: undefined,\n prevArrow: \"\",\n shorthandCurrentMonth: false,\n showMonths: 1,\n static: false,\n time_24hr: false,\n weekNumbers: false,\n wrap: false,\n};\n","import Vue from './../_lib/vue/vue.min'\r\nimport VeeValidate from './../_lib/vue/vee-validate'\r\nimport vSelect from './../_lib/vue/vue-select'\r\n\r\n// Validation customization\r\nVue.use(VeeValidate, {\r\n dictionary: {\r\n en: {\r\n custom: {\r\n email: {\r\n required: 'Udfyld venligst din e-mail',\r\n email: 'Udfyld venligst en gyldig e-mail'\r\n },\r\n fullname: {\r\n required: 'Udfyld venligst dit fulde navn'\r\n },\r\n companyName: {\r\n required: 'Udfyld venligst din virksomheds navn'\r\n },\r\n companyRegion: {\r\n required: 'Vælg venligst en region'\r\n },\r\n tlf: {\r\n required: 'Udfyld venligst dit telefonnummer'\r\n },\r\n gdprCheckbox: {\r\n required: 'Acceptér venligst for at kunne fortsætte'\r\n }\r\n }\r\n }\r\n }\r\n});\r\n\r\nwindow.onload = function() {\r\n const leadTool = new Vue({\r\n el: '[data-lead-tool]',\r\n data() {\r\n return {\r\n step: 1,\r\n exportMarketSelectedItems: [],\r\n exportMarketSelectedGuids: []\r\n }\r\n },\r\n methods: {\r\n // Base\r\n prev() {\r\n window.scrollTo(0, 0);\r\n this.step--;\r\n window.scrollTo(0, 0);\r\n },\r\n next() {\r\n window.scrollTo(0, 0);\r\n this.step++;\r\n window.scrollTo(0, 0);\r\n },\r\n validateBeforeSubmit() {\r\n this.$validator.validateAll().then((result) => {\r\n if (result) {\r\n document.getElementById('leadToolForm').submit();\r\n }\r\n });\r\n },\r\n //Step 3\r\n primaryExportSector(event) {\r\n var radios = document.querySelectorAll(\"[name='primaryExportSector'][type='radio']\"),\r\n input = document.querySelector(\"[name='primaryExportSector'][type='text']\"),\r\n nextButton = document.querySelector('.primary-export-sector .next');\r\n\r\n // If there are input in textfield remove check on radios\r\n if (event.target.type === 'text') {\r\n for (var i = 0, length = radios.length; i < length; i++) {\r\n if (radios[i].checked && input.value !== '') {\r\n radios[i].checked = false;\r\n }\r\n }\r\n }\r\n\r\n // If radio is checked remove text in textfield\r\n if (event.target.type === 'radio') {\r\n input.value = '';\r\n }\r\n\r\n // If an input has value remove disable next step\r\n if (input.value !== '') {\r\n nextButton.removeAttribute('disabled');\r\n }\r\n\r\n // If an input has value remove disable next step or set disable if all fields are empty \r\n for (var i = 0, length = radios.length; i < length; i++) {\r\n if (radios[i].checked) {\r\n nextButton.removeAttribute('disabled');\r\n break;\r\n } else if (radios[i].checked === false && input.value === '') {\r\n nextButton.setAttribute('disabled', 'disabled');\r\n }\r\n }\r\n },\r\n //Step 4\r\n exportMarketOptionsSelected(event) {\r\n var select = document.querySelector('.export-market-select'),\r\n undecidedRadio = document.querySelector('.export-market-undecided'),\r\n guidsRadio = document.querySelector('.export-market-select-guids'),\r\n nextButton = document.querySelector('.export-market-select-fieldset .next');\r\n\r\n // Disable at 3 selected markets\r\n if (event.length >= 3) {\r\n select.classList.add('disabled');\r\n }\r\n // Remove disable if less that 3 selected markets\r\n if (event.length < 3) {\r\n select.classList.remove('disabled');\r\n }\r\n // Check hidden radio if value\r\n if (event.length > 0) {\r\n guidsRadio.checked = true;\r\n }\r\n\r\n // If both radio undecided is empty and guids is empty\r\n if (event.length === 0 && guidsRadio.checked === true && undecidedRadio.checked === false) {\r\n guidsRadio.checked = false;\r\n\r\n // Set disable if all fields empty\r\n nextButton.setAttribute('disabled', 'disabled');\r\n }\r\n if (event.length !== 0 || undecidedRadio.checked) {\r\n\r\n // Remove disable if a field has value\r\n nextButton.removeAttribute('disabled');\r\n }\r\n // Uncheck undecided checkbox if an export market is selected\r\n if (event.length > 0 && undecidedRadio.checked) {\r\n undecidedRadio.checked = false;\r\n }\r\n\r\n // Set value of select\r\n this.exportMarketSelectedGuids = [];\r\n var items = document.querySelector('.v-select').__vue__._data.mutableValue;\r\n for (var i = 0, length = items.length; i < length; i++) {\r\n this.exportMarketSelectedGuids.push(items[i].value);\r\n }\r\n\r\n },\r\n exportMarketSelectClearDropdowns(event) {\r\n // Clear selected export markets when undecided is checked\r\n if (event.target.checked) {\r\n document.querySelector('.v-select').__vue__._data.mutableValue = [];\r\n this.exportMarketSelectedGuids = [];\r\n \r\n }\r\n }\r\n },\r\n mounted() {\r\n if (document.getElementById(\"leadToolForm\") && this.step < 7) {\r\n document.body.classList.add(\"lead-tool-page\");\r\n }\r\n }\r\n });\r\n};\r\n\r\nVue.component('v-select', vSelect);\r\n","export const english = {\n weekdays: {\n shorthand: [\"Sun\", \"Mon\", \"Tue\", \"Wed\", \"Thu\", \"Fri\", \"Sat\"],\n longhand: [\n \"Sunday\",\n \"Monday\",\n \"Tuesday\",\n \"Wednesday\",\n \"Thursday\",\n \"Friday\",\n \"Saturday\",\n ],\n },\n months: {\n shorthand: [\n \"Jan\",\n \"Feb\",\n \"Mar\",\n \"Apr\",\n \"May\",\n \"Jun\",\n \"Jul\",\n \"Aug\",\n \"Sep\",\n \"Oct\",\n \"Nov\",\n \"Dec\",\n ],\n longhand: [\n \"January\",\n \"February\",\n \"March\",\n \"April\",\n \"May\",\n \"June\",\n \"July\",\n \"August\",\n \"September\",\n \"October\",\n \"November\",\n \"December\",\n ],\n },\n daysInMonth: [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31],\n firstDayOfWeek: 0,\n ordinal: (nth) => {\n const s = nth % 100;\n if (s > 3 && s < 21)\n return \"th\";\n switch (s % 10) {\n case 1:\n return \"st\";\n case 2:\n return \"nd\";\n case 3:\n return \"rd\";\n default:\n return \"th\";\n }\n },\n rangeSeparator: \" to \",\n weekAbbreviation: \"Wk\",\n scrollTitle: \"Scroll to increment\",\n toggleTitle: \"Click to toggle\",\n amPM: [\"AM\", \"PM\"],\n yearAriaLabel: \"Year\",\n monthAriaLabel: \"Month\",\n hourAriaLabel: \"Hour\",\n minuteAriaLabel: \"Minute\",\n time_24hr: false,\n};\nexport default english;\n","export const pad = (number, length = 2) => `000${number}`.slice(length * -1);\nexport const int = (bool) => (bool === true ? 1 : 0);\nexport function debounce(fn, wait) {\n let t;\n return function () {\n clearTimeout(t);\n t = setTimeout(() => fn.apply(this, arguments), wait);\n };\n}\nexport const arrayify = (obj) => obj instanceof Array ? obj : [obj];\n","import { int, pad } from \"../utils\";\nconst doNothing = () => undefined;\nexport const monthToStr = (monthNumber, shorthand, locale) => locale.months[shorthand ? \"shorthand\" : \"longhand\"][monthNumber];\nexport const revFormat = {\n D: doNothing,\n F: function (dateObj, monthName, locale) {\n dateObj.setMonth(locale.months.longhand.indexOf(monthName));\n },\n G: (dateObj, hour) => {\n dateObj.setHours(parseFloat(hour));\n },\n H: (dateObj, hour) => {\n dateObj.setHours(parseFloat(hour));\n },\n J: (dateObj, day) => {\n dateObj.setDate(parseFloat(day));\n },\n K: (dateObj, amPM, locale) => {\n dateObj.setHours((dateObj.getHours() % 12) +\n 12 * int(new RegExp(locale.amPM[1], \"i\").test(amPM)));\n },\n M: function (dateObj, shortMonth, locale) {\n dateObj.setMonth(locale.months.shorthand.indexOf(shortMonth));\n },\n S: (dateObj, seconds) => {\n dateObj.setSeconds(parseFloat(seconds));\n },\n U: (_, unixSeconds) => new Date(parseFloat(unixSeconds) * 1000),\n W: function (dateObj, weekNum, locale) {\n const weekNumber = parseInt(weekNum);\n const date = new Date(dateObj.getFullYear(), 0, 2 + (weekNumber - 1) * 7, 0, 0, 0, 0);\n date.setDate(date.getDate() - date.getDay() + locale.firstDayOfWeek);\n return date;\n },\n Y: (dateObj, year) => {\n dateObj.setFullYear(parseFloat(year));\n },\n Z: (_, ISODate) => new Date(ISODate),\n d: (dateObj, day) => {\n dateObj.setDate(parseFloat(day));\n },\n h: (dateObj, hour) => {\n dateObj.setHours(parseFloat(hour));\n },\n i: (dateObj, minutes) => {\n dateObj.setMinutes(parseFloat(minutes));\n },\n j: (dateObj, day) => {\n dateObj.setDate(parseFloat(day));\n },\n l: doNothing,\n m: (dateObj, month) => {\n dateObj.setMonth(parseFloat(month) - 1);\n },\n n: (dateObj, month) => {\n dateObj.setMonth(parseFloat(month) - 1);\n },\n s: (dateObj, seconds) => {\n dateObj.setSeconds(parseFloat(seconds));\n },\n u: (_, unixMillSeconds) => new Date(parseFloat(unixMillSeconds)),\n w: doNothing,\n y: (dateObj, year) => {\n dateObj.setFullYear(2000 + parseFloat(year));\n },\n};\nexport const tokenRegex = {\n D: \"(\\\\w+)\",\n F: \"(\\\\w+)\",\n G: \"(\\\\d\\\\d|\\\\d)\",\n H: \"(\\\\d\\\\d|\\\\d)\",\n J: \"(\\\\d\\\\d|\\\\d)\\\\w+\",\n K: \"\",\n M: \"(\\\\w+)\",\n S: \"(\\\\d\\\\d|\\\\d)\",\n U: \"(.+)\",\n W: \"(\\\\d\\\\d|\\\\d)\",\n Y: \"(\\\\d{4})\",\n Z: \"(.+)\",\n d: \"(\\\\d\\\\d|\\\\d)\",\n h: \"(\\\\d\\\\d|\\\\d)\",\n i: \"(\\\\d\\\\d|\\\\d)\",\n j: \"(\\\\d\\\\d|\\\\d)\",\n l: \"(\\\\w+)\",\n m: \"(\\\\d\\\\d|\\\\d)\",\n n: \"(\\\\d\\\\d|\\\\d)\",\n s: \"(\\\\d\\\\d|\\\\d)\",\n u: \"(.+)\",\n w: \"(\\\\d\\\\d|\\\\d)\",\n y: \"(\\\\d{2})\",\n};\nexport const formats = {\n Z: (date) => date.toISOString(),\n D: function (date, locale, options) {\n return locale.weekdays.shorthand[formats.w(date, locale, options)];\n },\n F: function (date, locale, options) {\n return monthToStr(formats.n(date, locale, options) - 1, false, locale);\n },\n G: function (date, locale, options) {\n return pad(formats.h(date, locale, options));\n },\n H: (date) => pad(date.getHours()),\n J: function (date, locale) {\n return locale.ordinal !== undefined\n ? date.getDate() + locale.ordinal(date.getDate())\n : date.getDate();\n },\n K: (date, locale) => locale.amPM[int(date.getHours() > 11)],\n M: function (date, locale) {\n return monthToStr(date.getMonth(), true, locale);\n },\n S: (date) => pad(date.getSeconds()),\n U: (date) => date.getTime() / 1000,\n W: function (date, _, options) {\n return options.getWeek(date);\n },\n Y: (date) => pad(date.getFullYear(), 4),\n d: (date) => pad(date.getDate()),\n h: (date) => (date.getHours() % 12 ? date.getHours() % 12 : 12),\n i: (date) => pad(date.getMinutes()),\n j: (date) => date.getDate(),\n l: function (date, locale) {\n return locale.weekdays.longhand[date.getDay()];\n },\n m: (date) => pad(date.getMonth() + 1),\n n: (date) => date.getMonth() + 1,\n s: (date) => date.getSeconds(),\n u: (date) => date.getTime(),\n w: (date) => date.getDay(),\n y: (date) => String(date.getFullYear()).substring(2),\n};\n"],"sourceRoot":""}